![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 - opening.spc | 2020-03-04 23:56 | 65K | |
| 02 - main theme.spc | 2020-03-04 23:56 | 65K | |
| 03 - character selec..> | 2020-03-04 23:56 | 65K | |
| 04 - next mission.spc | 2020-03-04 23:56 | 65K | |
| 05 - dragon dojo ext..> | 2020-03-04 23:56 | 65K | |
| 06 - dragon dojo int..> | 2020-03-04 23:56 | 65K | |
| 07 - cody's nutron g..> | 2020-03-04 23:56 | 65K | |
| 08 - dusty's garage.spc | 2020-03-04 23:56 | 65K | |
| 09 - metro city hote..> | 2020-03-04 23:56 | 65K | |
| 10 - metro city sewe..> | 2020-03-04 23:56 | 65K | |
| 11 - chemical factor..> | 2020-03-04 23:56 | 65K | |
| 12 - fusion plant ex..> | 2020-03-04 23:56 | 65K | |
| 13 - fusion plant in..> | 2020-03-04 23:56 | 65K | |
| 14 - shadow dungeon.spc | 2020-03-04 23:56 | 65K | |
| 15 - shadow dojo ext..> | 2020-03-04 23:56 | 65K | |
| 16 - shadow dojo int..> | 2020-03-04 23:56 | 65K | |
| 17 - end of the figh..> | 2020-03-04 23:56 | 65K | |