![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 - konami logo.spc | 2020-03-04 23:58 | 65K | |
| 02 - title.spc | 2020-03-04 23:58 | 65K | |
| 03 - opening - no mo..> | 2020-03-04 23:58 | 65K | |
| 04 - opening - wisem..> | 2020-03-04 23:58 | 65K | |
| 05 - opening - the h..> | 2020-03-04 23:58 | 65K | |
| 06 - opening - bisum..> | 2020-03-04 23:58 | 65K | |
| 07 - opening - prepa..> | 2020-03-04 23:58 | 65K | |
| 08 - village.spc | 2020-03-04 23:58 | 65K | |
| 09 - shop.spc | 2020-03-04 23:58 | 65K | |
| 10 - travel agency.spc | 2020-03-04 23:58 | 65K | |
| 11 - fortune teller.spc | 2020-03-04 23:58 | 65K | |
| 12 - stage 1.spc | 2020-03-04 23:58 | 65K | |
| 13 - what cute frogs..> | 2020-03-04 23:58 | 65K | |
| 14 - boss battle.spc | 2020-03-04 23:58 | 65K | |
| 15 - afterwards....spc | 2020-03-04 23:58 | 65K | |
| 16 - making our esca..> | 2020-03-04 23:58 | 65K | |
| 17 - run faster!.spc | 2020-03-04 23:58 | 65K | |
| 18 - festival town.spc | 2020-03-04 23:58 | 65K | |
| 19 - stage 2.spc | 2020-03-04 23:58 | 65K | |
| 20 - got something!.spc | 2020-03-04 23:58 | 65K | |
| 21 - a challenge for..> | 2020-03-04 23:58 | 65K | |
| 22 - stage 3.spc | 2020-03-04 23:58 | 65K | |
| 23 - it's starting t..> | 2020-03-04 23:58 | 65K | |
| 24 - edo destroyed....> | 2020-03-04 23:58 | 65K | |
| 25 - bisumaru's them..> | 2020-03-04 23:58 | 65K | |
| 26 - omitsu kidnappe..> | 2020-03-04 23:58 | 65K | |
| 27 - impact's theme.spc | 2020-03-04 23:58 | 65K | |
| 28 - ready.......spc | 2020-03-04 23:58 | 65K | |
| 29 - impact goes to ..> | 2020-03-04 23:58 | 65K | |
| 30 - impact battle.spc | 2020-03-04 23:58 | 65K | |
| 31 - whoops!.spc | 2020-03-04 23:58 | 65K | |
| 32 - future overworl..> | 2020-03-04 23:58 | 65K | |
| 33 - futuristic stor..> | 2020-03-04 23:58 | 65K | |
| 34 - futuristic trav..> | 2020-03-04 23:58 | 65K | |
| 35 - gotcha!.spc | 2020-03-04 23:58 | 65K | |
| 36 - police robot.spc | 2020-03-04 23:58 | 65K | |
| 37 - futuristic pris..> | 2020-03-04 23:58 | 65K | |
| 38 - thief neko.spc | 2020-03-04 23:58 | 65K | |
| 39 - underground.spc | 2020-03-04 23:58 | 65K | |
| 40 - futuristic fort..> | 2020-03-04 23:58 | 65K | |
| 41 - stage 4.spc | 2020-03-04 23:58 | 65K | |
| 42 - stage 4 part tw..> | 2020-03-04 23:58 | 65K | |
| 43 - church.spc | 2020-03-04 23:58 | 65K | |
| 44 - dancing demon!.spc | 2020-03-04 23:58 | 65K | |
| 45 - stage 5.spc | 2020-03-04 23:58 | 65K | |
| 46 - stage 5 part tw..> | 2020-03-04 23:58 | 65K | |
| 47 - fearsome hand!.spc | 2020-03-04 23:58 | 65K | |
| 48 - antagonist.spc | 2020-03-04 23:58 | 65K | |
| 49 - stage 6.spc | 2020-03-04 23:58 | 65K | |
| 50 - frozen cave.spc | 2020-03-04 23:58 | 65K | |
| 51 - stage 7.spc | 2020-03-04 23:58 | 65K | |
| 52 - parodius boss b..> | 2020-03-04 23:58 | 65K | |
| 53 - industrial town..> | 2020-03-04 23:58 | 65K | |
| 54 - stage 8.spc | 2020-03-04 23:58 | 65K | |
| 55 - nearing the fin..> | 2020-03-04 23:58 | 65K | |
| 56 - attack!!.spc | 2020-03-04 23:58 | 65K | |
| 57 - oh no!.spc.spc | 2020-03-04 23:58 | 65K | |
| 58 - the power is mi..> | 2020-03-04 23:58 | 65K | |
| 59 - final battle.spc | 2020-03-04 23:58 | 65K | |
| 60 - a defeated man...> | 2020-03-04 23:58 | 65K | |
| 61 - returning home.spc | 2020-03-04 23:58 | 65K | |
| 62 - credits.spc | 2020-03-04 23:58 | 65K | |
| 63 - game over.spc | 2020-03-04 23:58 | 65K | |