Index of /incoming/warehouse/S3M
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | ß castles ß.s3m | 2018-01-04 15:09 | 238K | |
![[SND]](/icons/sound2.gif) | äyour fateä z ã u..> | 2018-01-04 15:09 | 522K | |
![[SND]](/icons/sound2.gif) | ùaùlùsùoù evilg..> | 2018-01-04 15:09 | 221K | |
![[SND]](/icons/sound2.gif) | þnine soulsþ [doc]..> | 2018-01-04 15:09 | 197K | |
![[SND]](/icons/sound2.gif) | þrushþ [doc].s3m | 2018-01-04 15:09 | 267K | |
![[SND]](/icons/sound2.gif) | þscream!þ [doc].s3m | 2018-01-04 15:09 | 435K | |
![[SND]](/icons/sound2.gif) | þswing it!þ [doc].s3m | 2018-01-04 15:09 | 255K | |
![[SND]](/icons/sound2.gif) | þtwilight - v1.1 þ..> | 2018-01-04 15:09 | 631K | |
![[SND]](/icons/sound2.gif) | þtwoþ [doc].s3m | 2018-01-04 15:09 | 352K | |
![[SND]](/icons/sound2.gif) | þtype 8þ [doc].s3m | 2018-01-04 15:09 | 214K | |
![[DIR]](/icons/folder.gif) | 2UNLIMIT/ | 2018-01-04 15:09 | - | |
![[SND]](/icons/sound2.gif) | 4 tt4-loki.s3m | 2018-01-04 15:09 | 136K | |
![[DIR]](/icons/folder.gif) | BEANER/ | 2018-01-04 15:09 | - | |
![[SND]](/icons/sound2.gif) | COOLOUT.S3M | 2018-01-04 15:09 | 245K | |
![[DIR]](/icons/folder.gif) | FRSTMEIR/ | 2018-01-04 15:09 | - | |
![[DIR]](/icons/folder.gif) | MK/ | 2018-01-04 15:09 | - | |
![[DIR]](/icons/folder.gif) | PRODIGY/ | 2018-01-04 15:09 | - | |
![[DIR]](/icons/folder.gif) | SAMAEL/ | 2023-12-29 12:55 | - | |
![[DIR]](/icons/folder.gif) | SORROX/ | 2018-01-04 15:09 | - | |
![[DIR]](/icons/folder.gif) | TFC_SKAV/ | 2025-02-15 19:18 | - | |
![[DIR]](/icons/folder.gif) | TG/ | 2018-01-04 15:09 | - | |
![[SND]](/icons/sound2.gif) | TRANCE2.S3M | 2018-01-04 15:09 | 223K | |
![[SND]](/icons/sound2.gif) | a-cend.s3m | 2018-01-04 15:09 | 340K | |
![[SND]](/icons/sound2.gif) | a. zero ambient musi..> | 2018-01-04 15:09 | 154K | |
![[SND]](/icons/sound2.gif) | adze.s3m | 2018-01-04 15:09 | 53K | |
![[SND]](/icons/sound2.gif) | african beat(by fatt..> | 2018-01-04 15:09 | 124K | |
![[SND]](/icons/sound2.gif) | africosis.s3m | 2018-01-04 15:09 | 389K | |
![[SND]](/icons/sound2.gif) | air for free wow! d.s3m | 2018-01-04 15:09 | 135K | |
![[SND]](/icons/sound2.gif) | alien invasion!!.s3m | 2018-01-04 15:09 | 38K | |
![[SND]](/icons/sound2.gif) | alien march.s3m | 2018-01-04 15:09 | 179K | |
![[SND]](/icons/sound2.gif) | alph t2.s3m | 2018-01-04 15:09 | 126K | |
![[SND]](/icons/sound2.gif) | alph t3.s3m | 2018-01-04 15:09 | 127K | |
![[SND]](/icons/sound2.gif) | alph t4.s3m | 2018-01-04 15:09 | 104K | |
![[SND]](/icons/sound2.gif) | always dark.s3m | 2018-01-04 15:09 | 137K | |
![[SND]](/icons/sound2.gif) | amber wave.s3m | 2018-01-04 15:09 | 103K | |
![[SND]](/icons/sound2.gif) | ambient extremes.s3m | 2018-01-04 15:09 | 266K | |
![[SND]](/icons/sound2.gif) | ambient one (night v..> | 2018-01-04 15:09 | 109K | |
![[SND]](/icons/sound2.gif) | anonymous water.s3m | 2018-01-04 15:09 | 285K | |
![[SND]](/icons/sound2.gif) | another weird day.s3m | 2018-01-04 15:09 | 333K | |
![[SND]](/icons/sound2.gif) | anymotion - asyntote..> | 2018-01-04 15:09 | 252K | |
![[SND]](/icons/sound2.gif) | arabian nites.s3m | 2018-01-04 15:09 | 146K | |
![[SND]](/icons/sound2.gif) | arabian tights - zin..> | 2018-01-04 15:09 | 122K | |
![[SND]](/icons/sound2.gif) | atomkia.s3m | 2018-01-04 15:09 | 99K | |
![[SND]](/icons/sound2.gif) | attackem.s3m | 2018-01-04 15:09 | 73K | |
![[SND]](/icons/sound2.gif) | at the heart of it a..> | 2018-01-04 15:09 | 175K | |
![[SND]](/icons/sound2.gif) | autumns piano.s3m | 2018-01-04 15:09 | 23K | |
![[SND]](/icons/sound2.gif) | ba-ripc.s3m | 2018-01-04 15:09 | 16K | |
![[SND]](/icons/sound2.gif) | babay's dreams....s3m | 2018-01-04 15:09 | 40K | |
![[SND]](/icons/sound2.gif) | back from hell.s3m | 2018-01-04 15:09 | 97K | |
![[SND]](/icons/sound2.gif) | back to school.s3m | 2018-01-04 15:09 | 12K | |
![[SND]](/icons/sound2.gif) | bass 2fast.s3m | 2018-01-04 15:09 | 263K | |
![[SND]](/icons/sound2.gif) | bazz trip .s3m | 2018-01-04 15:09 | 130K | |
![[SND]](/icons/sound2.gif) | beats !!!.s3m | 2018-01-04 15:09 | 257K | |
![[SND]](/icons/sound2.gif) | beavis & butthead mi..> | 2018-01-04 15:09 | 509K | |
![[SND]](/icons/sound2.gif) | been a son.s3m | 2018-01-04 15:09 | 148K | |
![[SND]](/icons/sound2.gif) | beethoven dream.s3m | 2018-01-04 15:09 | 234K | |
![[SND]](/icons/sound2.gif) | believe.s3m | 2018-01-04 15:09 | 468K | |
![[SND]](/icons/sound2.gif) | bells-o-freedom.s3m | 2018-01-04 15:09 | 135K | |
![[SND]](/icons/sound2.gif) | bent2 by nick.s3m | 2018-01-04 15:09 | 95K | |
![[SND]](/icons/sound2.gif) | betacarotine - chipt..> | 2018-01-04 15:09 | 47K | |
![[SND]](/icons/sound2.gif) | beyond presence.s3m | 2018-01-04 15:09 | 231K | |
![[SND]](/icons/sound2.gif) | beyond the highest.s3m | 2018-01-04 15:09 | 373K | |
![[SND]](/icons/sound2.gif) | bigthem.s3m | 2018-01-04 15:09 | 141K | |
![[SND]](/icons/sound2.gif) | big yoots forever ....> | 2018-01-04 15:09 | 265K | |
![[SND]](/icons/sound2.gif) | biomachine.s3m | 2018-01-04 15:09 | 316K | |
![[SND]](/icons/sound2.gif) | black rain.s3m | 2018-01-04 15:09 | 233K | |
![[SND]](/icons/sound2.gif) | black sabbath.s3m | 2018-01-04 15:09 | 292K | |
![[SND]](/icons/sound2.gif) | black symphony.s3m | 2018-01-04 15:09 | 226K | |
![[SND]](/icons/sound2.gif) | blacky's back !!!!.s3m | 2018-01-04 15:09 | 11K | |
![[SND]](/icons/sound2.gif) | blacky-shit.s3m | 2018-01-04 15:09 | 58K | |
![[SND]](/icons/sound2.gif) | blender.s3m | 2018-01-04 15:09 | 68K | |
![[SND]](/icons/sound2.gif) | blown away.s3m | 2018-01-04 15:09 | 437K | |
![[SND]](/icons/sound2.gif) | blue abyss.s3m | 2018-01-04 15:09 | 143K | |
![[SND]](/icons/sound2.gif) | blue lounge.s3m | 2018-01-04 15:09 | 188K | |
![[SND]](/icons/sound2.gif) | blue mars.s3m | 2018-01-04 15:09 | 284K | |
![[SND]](/icons/sound2.gif) | bodily spazms.s3m | 2018-01-04 15:09 | 109K | |
![[SND]](/icons/sound2.gif) | bolt.s3m | 2018-01-04 15:09 | 523K | |
![[SND]](/icons/sound2.gif) | boomboomboom-happymi..> | 2018-01-04 15:09 | 261K | |
![[SND]](/icons/sound2.gif) | bordom and its many ..> | 2018-01-04 15:09 | 150K | |
![[SND]](/icons/sound2.gif) | brain.s3m | 2018-01-04 15:09 | 58K | |
![[SND]](/icons/sound2.gif) | brain lapse - zinc.s3m | 2018-01-04 15:09 | 355K | |
![[SND]](/icons/sound2.gif) | brain pick.s3m | 2018-01-04 15:09 | 467K | |
![[SND]](/icons/sound2.gif) | braze of a bullet.s3m | 2018-01-04 15:09 | 122K | |
![[SND]](/icons/sound2.gif) | breakdown.s3m | 2018-01-04 15:09 | 456K | |
![[SND]](/icons/sound2.gif) | breaking free -ca..> | 2018-01-04 15:09 | 283K | |
![[SND]](/icons/sound2.gif) | breaking some walls.s3m | 2018-01-04 15:09 | 134K | |
![[SND]](/icons/sound2.gif) | breeze.s3m | 2018-01-04 15:09 | 391K | |
![[SND]](/icons/sound2.gif) | bren1.s3m | 2018-01-04 15:09 | 527K | |
![[SND]](/icons/sound2.gif) | broken wings.s3m | 2018-01-04 15:09 | 113K | |
![[SND]](/icons/sound2.gif) | brutal knowledge - m..> | 2018-01-04 15:09 | 190K | |
![[SND]](/icons/sound2.gif) | bs1.s3m | 2018-01-04 15:09 | 55K | |
![[SND]](/icons/sound2.gif) | buried.s3m | 2018-01-04 15:09 | 336K | |
![[SND]](/icons/sound2.gif) | burning serene tribe..> | 2018-01-04 15:09 | 91K | |
![[SND]](/icons/sound2.gif) | burpday surprise.s3m | 2018-01-04 15:09 | 354K | |
![[SND]](/icons/sound2.gif) | busted.s3m | 2018-01-04 15:09 | 146K | |
![[SND]](/icons/sound2.gif) | c-space 2.s3m | 2018-01-04 15:09 | 230K | |
![[SND]](/icons/sound2.gif) | c2h6 me.s3m | 2018-01-04 15:09 | 215K | |
![[SND]](/icons/sound2.gif) | cammy.s3m | 2018-01-04 15:09 | 227K | |
![[SND]](/icons/sound2.gif) | candlepin + bowling ..> | 2018-01-04 15:09 | 221K | |
![[SND]](/icons/sound2.gif) | cap'n'power.s3m | 2018-01-04 15:09 | 125K | |
![[SND]](/icons/sound2.gif) | carls tune.s3m | 2018-01-04 15:09 | 271K | |
![[SND]](/icons/sound2.gif) | castanets of crystal..> | 2018-01-04 15:09 | 62K | |
![[SND]](/icons/sound2.gif) | catastrophy.s3m | 2018-01-04 15:09 | 167K | |
![[SND]](/icons/sound2.gif) | catch me blues 2.s3m | 2018-01-04 15:09 | 128K | |
![[SND]](/icons/sound2.gif) | celest‚ fish.s3m | 2018-01-04 15:09 | 392K | |
![[SND]](/icons/sound2.gif) | chain reaction.s3m | 2018-01-04 15:09 | 268K | |
![[SND]](/icons/sound2.gif) | changes 1.s3m | 2018-01-04 15:09 | 235K | |
![[SND]](/icons/sound2.gif) | charts overdrive-pm.s3m | 2018-01-04 15:09 | 20K | |
![[SND]](/icons/sound2.gif) | check out the base.s3m | 2018-01-04 15:09 | 106K | |
![[SND]](/icons/sound2.gif) | chernobyl.s3m | 2018-01-04 15:09 | 320K | |
![[SND]](/icons/sound2.gif) | chicken soup iv.s3m | 2018-01-04 15:09 | 459K | |
![[SND]](/icons/sound2.gif) | children!.s3m | 2018-01-04 15:09 | 268K | |
![[SND]](/icons/sound2.gif) | children.s3m | 2018-01-04 15:09 | 376K | |
![[SND]](/icons/sound2.gif) | children of the nigh..> | 2018-01-04 15:09 | 453K | |
![[SND]](/icons/sound2.gif) | children of the nigh..> | 2018-01-04 15:09 | 410K | |
![[SND]](/icons/sound2.gif) | chillout folk - nexu..> | 2018-01-04 15:09 | 455K | |
![[SND]](/icons/sound2.gif) | chilly whisper.s3m | 2018-01-04 15:09 | 233K | |
![[SND]](/icons/sound2.gif) | china.s3m | 2018-01-04 15:09 | 138K | |
![[SND]](/icons/sound2.gif) | chizra.s3m | 2018-01-04 15:09 | 412K | |
![[SND]](/icons/sound2.gif) | choices.s3m | 2018-01-04 15:09 | 31K | |
![[SND]](/icons/sound2.gif) | chopper1.s3m | 2018-01-04 15:09 | 112K | |
![[SND]](/icons/sound2.gif) | christmas 1998 mix.s3m | 2018-01-04 15:09 | 116K | |
![[SND]](/icons/sound2.gif) | chrono trigger...bel..> | 2018-01-04 15:09 | 124K | |
![[SND]](/icons/sound2.gif) | chrushing.s3m | 2018-01-04 15:09 | 143K | |
![[SND]](/icons/sound2.gif) | chunder man.s3m | 2018-01-04 15:09 | 200K | |
![[SND]](/icons/sound2.gif) | cityscape~1.s3m | 2018-01-04 15:09 | 222K | |
![[SND]](/icons/sound2.gif) | cj's 1st beat!).s3m | 2018-01-04 15:09 | 51K | |
![[SND]](/icons/sound2.gif) | cjungle.s3m | 2018-01-04 15:09 | 49K | |
![[SND]](/icons/sound2.gif) | classe!.s3m | 2018-01-04 15:09 | 521K | |
![[SND]](/icons/sound2.gif) | classic dreams.s3m | 2018-01-04 15:09 | 200K | |
![[SND]](/icons/sound2.gif) | classic factory.s3m | 2018-01-04 15:09 | 217K | |
![[SND]](/icons/sound2.gif) | clawed illusions.s3m | 2018-01-04 15:09 | 566K | |
![[SND]](/icons/sound2.gif) | clinging to nothing ..> | 2018-01-04 15:09 | 207K | |
![[SND]](/icons/sound2.gif) | closer (1).s3m | 2018-01-04 15:09 | 205K | |
![[SND]](/icons/sound2.gif) | closer - static mix.s3m | 2018-01-04 15:09 | 487K | |
![[SND]](/icons/sound2.gif) | closer.s3m | 2018-01-04 15:09 | 277K | |
![[SND]](/icons/sound2.gif) | cmx on the wing.s3m | 2018-01-04 15:09 | 320K | |
![[SND]](/icons/sound2.gif) | cold wet leaf. by wo..> | 2018-01-04 15:09 | 775K | |
![[SND]](/icons/sound2.gif) | comfuzion!.s3m | 2018-01-04 15:09 | 76K | |
![[SND]](/icons/sound2.gif) | command2.s3m | 2018-01-04 15:09 | 94K | |
![[SND]](/icons/sound2.gif) | commercial instrumen..> | 2018-01-04 15:09 | 142K | |
![[SND]](/icons/sound2.gif) | compo v„„nt”.s3m | 2018-01-04 15:09 | 15K | |
![[SND]](/icons/sound2.gif) | concepts in dance by..> | 2018-01-04 15:09 | 160K | |
![[SND]](/icons/sound2.gif) | conexion.s3m | 2018-01-04 15:09 | 72K | |
![[SND]](/icons/sound2.gif) | contientout.s3m | 2018-01-04 15:09 | 57K | |
![[SND]](/icons/sound2.gif) | continental shifts.s3m | 2018-01-04 15:09 | 210K | |
![[SND]](/icons/sound2.gif) | converted nes music ..> | 2018-01-04 15:09 | 7.1K | |
![[SND]](/icons/sound2.gif) | converted nes music ..> | 2018-01-04 15:09 | 23K | |
![[SND]](/icons/sound2.gif) | converted nes music ..> | 2018-01-04 15:09 | 20K | |
![[SND]](/icons/sound2.gif) | converted nes music.s3m | 2018-01-04 15:09 | 25K | |
![[SND]](/icons/sound2.gif) | converted nes music ..> | 2018-01-04 15:09 | 17K | |
![[SND]](/icons/sound2.gif) | converted nes music ..> | 2018-01-04 15:09 | 22K | |
![[SND]](/icons/sound2.gif) | converted nes music~..> | 2018-01-04 15:09 | 20K | |
![[SND]](/icons/sound2.gif) | cool2.s3m | 2018-01-04 15:09 | 232K | |
![[SND]](/icons/sound2.gif) | cool maan....s3m | 2018-01-04 15:09 | 196K | |
![[SND]](/icons/sound2.gif) | cooltechno by undert..> | 2018-01-04 15:09 | 677K | |
![[SND]](/icons/sound2.gif) | corrosion.s3m | 2018-01-04 15:09 | 79K | |
![[SND]](/icons/sound2.gif) | countdown.s3m | 2018-01-04 15:09 | 79K | |
![[SND]](/icons/sound2.gif) | coy crab.s3m | 2018-01-04 15:09 | 313K | |
![[SND]](/icons/sound2.gif) | cranial unit.s3m | 2018-01-04 15:09 | 498K | |
![[SND]](/icons/sound2.gif) | crazy.s3m | 2018-01-04 15:09 | 148K | |
![[SND]](/icons/sound2.gif) | crazy world.s3m | 2018-01-04 15:09 | 47K | |
![[SND]](/icons/sound2.gif) | cream.s3m | 2018-01-04 15:09 | 124K | |
![[SND]](/icons/sound2.gif) | credit.s3m | 2018-01-04 15:09 | 408K | |
![[SND]](/icons/sound2.gif) | crest of techno powe..> | 2018-01-04 15:09 | 110K | |
![[SND]](/icons/sound2.gif) | crime in the streets..> | 2018-01-04 15:09 | 6.2K | |
![[SND]](/icons/sound2.gif) | crimson blade .. hec..> | 2018-01-04 15:09 | 493K | |
![[SND]](/icons/sound2.gif) | cringe.s3m | 2018-01-04 15:09 | 469K | |
![[SND]](/icons/sound2.gif) | cristall-s o c r a t..> | 2018-01-04 15:09 | 369K | |
![[SND]](/icons/sound2.gif) | crocket theme.s3m | 2018-01-04 15:09 | 244K | |
![[SND]](/icons/sound2.gif) | crown.s3m | 2018-01-04 15:09 | 29K | |
![[SND]](/icons/sound2.gif) | crucifix by brian.s3m | 2018-01-04 15:09 | 132K | |
![[SND]](/icons/sound2.gif) | crystal chips by tro..> | 2018-01-04 15:09 | 15K | |
![[SND]](/icons/sound2.gif) | crystalline tears 1.s3m | 2018-01-04 15:09 | 206K | |
![[SND]](/icons/sound2.gif) | crystal sea.s3m | 2018-01-04 15:09 | 212K | |
![[SND]](/icons/sound2.gif) | cs 1 big in japan.s3m | 2018-01-04 15:09 | 129K | |
![[SND]](/icons/sound2.gif) | culture clash.s3m | 2018-01-04 15:09 | 232K | |
![[SND]](/icons/sound2.gif) | curley madness.s3m | 2018-01-04 15:09 | 137K | |
![[SND]](/icons/sound2.gif) | cx reali.s3m | 2018-01-04 15:09 | 305K | |
![[SND]](/icons/sound2.gif) | cyberrats.s3m | 2018-01-04 15:09 | 203K | |
![[SND]](/icons/sound2.gif) | cyborgjeff-aszelda.s3m | 2018-01-04 15:09 | 35K | |
![[SND]](/icons/sound2.gif) | cyborgjeff-bambie2.s3m | 2018-01-04 15:09 | 151K | |
![[SND]](/icons/sound2.gif) | cyborgjeff-baskc.s3m | 2018-01-04 15:09 | 204K | |
![[SND]](/icons/sound2.gif) | cyborx.s3m | 2018-01-04 15:09 | 23K | |
![[SND]](/icons/sound2.gif) | cyk1.s3m | 2018-01-04 15:09 | 67K | |
![[SND]](/icons/sound2.gif) | cynusx.s3m | 2018-01-04 15:09 | 330K | |
![[SND]](/icons/sound2.gif) | cynusxs.s3m | 2018-01-04 15:09 | 331K | |
![[SND]](/icons/sound2.gif) | d-person.s3m | 2018-01-04 15:09 | 146K | |
![[SND]](/icons/sound2.gif) | da capo.s3m | 2018-01-04 15:09 | 167K | |
![[SND]](/icons/sound2.gif) | dance, dance! little..> | 2018-01-04 15:09 | 14K | |
![[SND]](/icons/sound2.gif) | dance 2 insanity.s3m | 2018-01-04 15:09 | 180K | |
![[SND]](/icons/sound2.gif) | dance fever.s3m | 2018-01-04 15:09 | 196K | |
![[SND]](/icons/sound2.gif) | dance troop.s3m | 2018-01-04 15:09 | 152K | |
![[SND]](/icons/sound2.gif) | dance until death.s3m | 2018-01-04 15:09 | 96K | |
![[SND]](/icons/sound2.gif) | dancing light-exp.s3m | 2018-01-04 15:09 | 71K | |
![[SND]](/icons/sound2.gif) | datura feat. robert ..> | 2018-01-04 15:09 | 362K | |
![[SND]](/icons/sound2.gif) | ddm-2 --socrates.s3m | 2018-01-04 15:09 | 279K | |
![[SND]](/icons/sound2.gif) | deadlock.s3m | 2018-01-04 15:09 | 81K | |
![[SND]](/icons/sound2.gif) | death's way.s3m | 2018-01-04 15:09 | 155K | |
![[SND]](/icons/sound2.gif) | deathstar.s3m | 2018-01-04 15:09 | 128K | |
![[SND]](/icons/sound2.gif) | death surviving.s3m | 2018-01-04 15:09 | 149K | |
![[SND]](/icons/sound2.gif) | deception of heat.s3m | 2018-01-04 15:09 | 81K | |
![[SND]](/icons/sound2.gif) | decker blend.s3m | 2018-01-04 15:09 | 210K | |
![[SND]](/icons/sound2.gif) | dedicated to all oer..> | 2018-01-04 15:09 | 355K | |
![[SND]](/icons/sound2.gif) | deep deep water.s3m | 2018-01-04 15:09 | 103K | |
![[SND]](/icons/sound2.gif) | deep in her eyes.s3m | 2018-01-04 15:09 | 214K | |
![[SND]](/icons/sound2.gif) | deep space.s3m | 2018-01-04 15:09 | 58K | |
![[SND]](/icons/sound2.gif) | defconone.s3m | 2018-01-04 15:09 | 120K | |
![[SND]](/icons/sound2.gif) | deks-o-baby.s3m | 2018-01-04 15:09 | 79K | |
![[SND]](/icons/sound2.gif) | demo-endtune-thingy-..> | 2018-01-04 15:09 | 228K | |
![[SND]](/icons/sound2.gif) | demoleitor mix.s3m | 2018-01-04 15:09 | 653K | |
![[SND]](/icons/sound2.gif) | demonica.s3m | 2018-01-04 15:09 | 258K | |
![[SND]](/icons/sound2.gif) | demonicb.s3m | 2018-01-04 15:09 | 211K | |
![[SND]](/icons/sound2.gif) | denne er til deg msm..> | 2018-01-04 15:09 | 31K | |
![[SND]](/icons/sound2.gif) | depredated joy.s3m | 2018-01-04 15:09 | 244K | |
![[SND]](/icons/sound2.gif) | desert dream - roman..> | 2018-01-04 15:09 | 371K | |
![[SND]](/icons/sound2.gif) | desire.s3m | 2018-01-04 15:09 | 37K | |
![[SND]](/icons/sound2.gif) | desolation by teo fr..> | 2018-01-04 15:09 | 127K | |
![[SND]](/icons/sound2.gif) | destiny in your eyes..> | 2018-01-04 15:09 | 951K | |
![[SND]](/icons/sound2.gif) | destiny of life.s3m | 2018-01-04 15:09 | 152K | |
![[SND]](/icons/sound2.gif) | deva.s3m | 2018-01-04 15:09 | 81K | |
![[SND]](/icons/sound2.gif) | devilxkn.s3m | 2018-01-04 15:09 | 181K | |
![[SND]](/icons/sound2.gif) | dezi's dilemma.s3m | 2018-01-04 15:09 | 364K | |
![[SND]](/icons/sound2.gif) | digital observer.s3m | 2018-01-04 15:09 | 96K | |
![[SND]](/icons/sound2.gif) | digital past.s3m | 2018-01-04 15:09 | 145K | |
![[SND]](/icons/sound2.gif) | digital vertigo.s3m | 2018-01-04 15:09 | 253K | |
![[SND]](/icons/sound2.gif) | dimphony ii.s3m | 2018-01-04 15:09 | 136K | |
![[SND]](/icons/sound2.gif) | dinamic.s3m | 2018-01-04 15:09 | 213K | |
![[SND]](/icons/sound2.gif) | dinner in candleligh..> | 2018-01-04 15:09 | 121K | |
![[SND]](/icons/sound2.gif) | dionysus.s3m | 2018-01-04 15:09 | 327K | |
![[SND]](/icons/sound2.gif) | disc.s3m | 2018-01-04 15:09 | 105K | |
![[SND]](/icons/sound2.gif) | disco 1.s3m | 2018-01-04 15:09 | 221K | |
![[SND]](/icons/sound2.gif) | discover.s3m | 2018-01-04 15:09 | 131K | |
![[SND]](/icons/sound2.gif) | diskintro.4.s3m | 2018-01-04 15:09 | 31K | |
![[SND]](/icons/sound2.gif) | disposable heroes.s3m | 2018-01-04 15:09 | 138K | |
![[SND]](/icons/sound2.gif) | distorted dimensions..> | 2018-01-04 15:09 | 152K | |
![[SND]](/icons/sound2.gif) | dj.fizo- altat.s3m | 2018-01-04 15:09 | 537K | |
![[SND]](/icons/sound2.gif) | dj felixete- maximum..> | 2018-01-04 15:09 | 240K | |
![[SND]](/icons/sound2.gif) | dj guile's boom !.s3m | 2018-01-04 15:09 | 392K | |
![[SND]](/icons/sound2.gif) | dksregea.s3m | 2018-01-04 15:09 | 162K | |
![[SND]](/icons/sound2.gif) | dman sahara.s3m | 2018-01-04 15:09 | 274K | |
![[SND]](/icons/sound2.gif) | dn3 chip 4 remix.s3m | 2018-01-04 15:09 | 50K | |
![[SND]](/icons/sound2.gif) | dna-project dna-gro..> | 2018-01-04 15:09 | 161K | |
![[SND]](/icons/sound2.gif) | dne_n02.s3m | 2018-01-04 15:09 | 50K | |
![[SND]](/icons/sound2.gif) | dodgeintro1.s3m | 2018-01-04 15:09 | 21K | |
![[SND]](/icons/sound2.gif) | dolly moon-preview.s3m | 2018-01-04 15:09 | 37K | |
![[SND]](/icons/sound2.gif) | domestic.s3m | 2018-01-04 15:09 | 30K | |
![[SND]](/icons/sound2.gif) | doom and stuff v4 by..> | 2018-01-04 15:09 | 662K | |
![[SND]](/icons/sound2.gif) | doomdreams deathmatc..> | 2018-01-04 15:09 | 316K | |
![[SND]](/icons/sound2.gif) | doom ii easy listeni..> | 2018-01-04 15:09 | 211K | |
![[SND]](/icons/sound2.gif) | dopo il buio....s3m | 2018-01-04 15:09 | 402K | |
![[SND]](/icons/sound2.gif) | dorado.s3m | 2018-01-04 15:09 | 477K | |
![[SND]](/icons/sound2.gif) | do that.s3m | 2018-01-04 15:09 | 408K | |
![[SND]](/icons/sound2.gif) | down.s3m | 2018-01-04 15:09 | 928K | |
![[SND]](/icons/sound2.gif) | down and dirty!.s3m | 2018-01-04 15:09 | 45K | |
![[SND]](/icons/sound2.gif) | downer 1.s3m | 2018-01-04 15:09 | 99K | |
![[SND]](/icons/sound2.gif) | dr.evil's song.s3m | 2018-01-04 15:09 | 124K | |
![[SND]](/icons/sound2.gif) | dr. who -- avatar ve..> | 2018-01-04 15:09 | 306K | |
![[SND]](/icons/sound2.gif) | dragon's lair remix.s3m | 2018-01-04 15:09 | 16K | |
![[SND]](/icons/sound2.gif) | dragon ball.s3m | 2018-01-04 15:09 | 92K | |
![[SND]](/icons/sound2.gif) | dr destructo's reven..> | 2018-01-04 15:09 | 281K | |
![[SND]](/icons/sound2.gif) | dreamer's dreams.s3m | 2018-01-04 15:09 | 144K | |
![[SND]](/icons/sound2.gif) | dreamin' - 16chn. ..> | 2018-01-04 15:09 | 357K | |
![[SND]](/icons/sound2.gif) | dreaming of the girl..> | 2018-01-04 15:09 | 326K | |
![[SND]](/icons/sound2.gif) | dreamland.s3m | 2018-01-04 15:09 | 80K | |
![[SND]](/icons/sound2.gif) | dream of perfection!..> | 2018-01-04 15:09 | 134K | |
![[SND]](/icons/sound2.gif) | dream or reality.s3m | 2018-01-04 15:09 | 215K | |
![[SND]](/icons/sound2.gif) | dreams of love.s3m | 2018-01-04 15:09 | 308K | |
![[SND]](/icons/sound2.gif) | dreamz.s3m | 2018-01-04 15:09 | 402K | |
![[SND]](/icons/sound2.gif) | drive!.s3m | 2018-01-04 15:09 | 494K | |
![[SND]](/icons/sound2.gif) | drive straight (p102..> | 2018-01-04 15:09 | 166K | |
![[SND]](/icons/sound2.gif) | druln01.s3m | 2018-01-04 15:09 | 265K | |
![[SND]](/icons/sound2.gif) | druln02.s3m | 2018-01-04 15:09 | 112K | |
![[SND]](/icons/sound2.gif) | druln04.s3m | 2018-01-04 15:09 | 114K | |
![[SND]](/icons/sound2.gif) | druln05.s3m | 2018-01-04 15:09 | 135K | |
![[SND]](/icons/sound2.gif) | drum machine.s3m | 2018-01-04 15:09 | 46K | |
![[SND]](/icons/sound2.gif) | drummin.s3m | 2018-01-04 15:09 | 35K | |
![[SND]](/icons/sound2.gif) | dubu78.s3m | 2018-01-04 15:09 | 258K | |
![[SND]](/icons/sound2.gif) | duckjob.s3m | 2018-01-04 15:09 | 292K | |
![[SND]](/icons/sound2.gif) | dust of time (1).s3m | 2018-01-04 15:09 | 112K | |
![[SND]](/icons/sound2.gif) | dust of time.s3m | 2018-01-04 15:09 | 91K | |
![[SND]](/icons/sound2.gif) | dying eyes.s3m | 2018-01-04 15:09 | 112K | |
![[SND]](/icons/sound2.gif) | dynamicron - s3m.s3m | 2018-01-04 15:09 | 306K | |
![[SND]](/icons/sound2.gif) | e-89842.s3m | 2018-01-04 15:09 | 476K | |
![[SND]](/icons/sound2.gif) | ecconps - corpse.s3m | 2018-01-04 15:09 | 51K | |
![[SND]](/icons/sound2.gif) | echo.s3m | 2018-01-04 15:09 | 182K | |
![[SND]](/icons/sound2.gif) | echoes.s3m | 2018-01-04 15:09 | 771K | |
![[SND]](/icons/sound2.gif) | ecolove twistedtohel..> | 2018-01-04 15:09 | 216K | |
![[SND]](/icons/sound2.gif) | efex, da second.s3m | 2018-01-04 15:09 | 175K | |
![[SND]](/icons/sound2.gif) | elasticity - zincrad..> | 2018-01-04 15:09 | 103K | |
![[SND]](/icons/sound2.gif) | electro de chocobo.s3m | 2018-01-04 15:09 | 277K | |
![[SND]](/icons/sound2.gif) | electromagneticpulse..> | 2018-01-04 15:09 | 311K | |
![[SND]](/icons/sound2.gif) | electrophy.s3m | 2018-01-04 15:09 | 305K | |
![[SND]](/icons/sound2.gif) | elements~1.s3m | 2018-01-04 15:09 | 94K | |
![[SND]](/icons/sound2.gif) | elettra - starbeam.s3m | 2018-01-04 15:09 | 207K | |
![[SND]](/icons/sound2.gif) | eliran's soul dna-g..> | 2018-01-04 15:09 | 173K | |
![[SND]](/icons/sound2.gif) | elixxer's 32k funhou..> | 2018-01-04 15:09 | 32K | |
![[SND]](/icons/sound2.gif) | elysis-classe.s3m | 2018-01-04 15:09 | 521K | |
![[SND]](/icons/sound2.gif) | elysium - mystery mi..> | 2018-01-04 15:09 | 250K | |
![[SND]](/icons/sound2.gif) | emerald island.s3m | 2018-01-04 15:09 | 128K | |
![[SND]](/icons/sound2.gif) | emotion.s3m | 2018-01-04 15:09 | 98K | |
![[SND]](/icons/sound2.gif) | empty space (101) ....> | 2018-01-04 15:09 | 167K | |
![[SND]](/icons/sound2.gif) | endless silence (tec..> | 2018-01-04 15:09 | 366K | |
![[SND]](/icons/sound2.gif) | energia - necros fm.s3m | 2018-01-04 15:09 | 428K | |
![[SND]](/icons/sound2.gif) | energy audio + intro..> | 2018-01-04 15:09 | 357K | |
![[SND]](/icons/sound2.gif) | erbs.s3m | 2018-01-04 15:09 | 47K | |
![[SND]](/icons/sound2.gif) | espaa-falange-dios.s3m | 2018-01-04 15:09 | 443K | |
![[SND]](/icons/sound2.gif) | esservessence.s3m | 2018-01-04 15:09 | 482K | |
![[SND]](/icons/sound2.gif) | eternal immortality.s3m | 2018-01-04 15:09 | 156K | |
![[SND]](/icons/sound2.gif) | eternal smoke.s3m | 2018-01-04 15:09 | 791K | |
![[SND]](/icons/sound2.gif) | even in his youth.s3m | 2018-01-04 15:09 | 99K | |
![[SND]](/icons/sound2.gif) | everybody (on the fl..> | 2018-01-04 15:09 | 59K | |
![[SND]](/icons/sound2.gif) | excitation-bl of ea.s3m | 2018-01-04 15:09 | 117K | |
![[SND]](/icons/sound2.gif) | exotic drummer dance..> | 2018-01-04 15:09 | 81K | |
![[SND]](/icons/sound2.gif) | exploits - atl.s3m | 2018-01-04 15:09 | 269K | |
![[SND]](/icons/sound2.gif) | explorer.s3m | 2018-01-04 15:09 | 635K | |
![[SND]](/icons/sound2.gif) | exploring the galaxy..> | 2018-01-04 15:09 | 191K | |
![[SND]](/icons/sound2.gif) | extravagance.s3m | 2018-01-04 15:09 | 154K | |
![[SND]](/icons/sound2.gif) | fab c est cool.s3m | 2018-01-04 15:09 | 126K | |
![[SND]](/icons/sound2.gif) | faded life.s3m | 2018-01-04 15:09 | 177K | |
![[SND]](/icons/sound2.gif) | fantasy studio ..> | 2018-01-04 15:09 | 72K | |
![[SND]](/icons/sound2.gif) | faraway love....s3m | 2018-01-04 15:09 | 432K | |
![[SND]](/icons/sound2.gif) | fastcomp.s3m | 2018-01-04 15:09 | 22K | |
![[SND]](/icons/sound2.gif) | fear of the dark.s3m | 2018-01-04 15:09 | 409K | |
![[SND]](/icons/sound2.gif) | feel no fear -spk.s3m | 2018-01-04 15:09 | 319K | |
![[SND]](/icons/sound2.gif) | fifteen minutes by t..> | 2018-01-04 15:09 | 9.0K | |
![[SND]](/icons/sound2.gif) | final experience.s3m | 2018-01-04 15:09 | 577K | |
![[SND]](/icons/sound2.gif) | final fantasy (all) ..> | 2018-01-04 15:09 | 62K | |
![[SND]](/icons/sound2.gif) | final fantasy prelud..> | 2018-01-04 15:09 | 53K | |
![[SND]](/icons/sound2.gif) | final skope.s3m | 2018-01-04 15:09 | 382K | |
![[SND]](/icons/sound2.gif) | fire, water and terr..> | 2018-01-04 15:09 | 171K | |
![[SND]](/icons/sound2.gif) | firepower.s3m | 2018-01-04 15:09 | 238K | |
![[SND]](/icons/sound2.gif) | first plan(christo).s3m | 2018-01-04 15:09 | 136K | |
![[SND]](/icons/sound2.gif) | five miles from wher..> | 2018-01-04 15:09 | 134K | |
![[SND]](/icons/sound2.gif) | five sides -- sklath..> | 2018-01-04 15:09 | 280K | |
![[SND]](/icons/sound2.gif) | flashback by heiko s..> | 2018-01-04 15:09 | 317K | |
![[SND]](/icons/sound2.gif) | flat line.s3m | 2018-01-04 15:09 | 296K | |
![[SND]](/icons/sound2.gif) | fletan mix (by mc ba..> | 2018-01-04 15:09 | 449K | |
![[SND]](/icons/sound2.gif) | fligh of the avian.s3m | 2018-01-04 15:09 | 341K | |
![[SND]](/icons/sound2.gif) | flight of the bluebi..> | 2018-01-04 15:09 | 205K | |
![[SND]](/icons/sound2.gif) | flight of the humble..> | 2018-01-04 15:09 | 6.7K | |
![[SND]](/icons/sound2.gif) | floyd the barber.s3m | 2018-01-04 15:09 | 130K | |
![[SND]](/icons/sound2.gif) | foes' fear.s3m | 2018-01-04 15:09 | 270K | |
![[SND]](/icons/sound2.gif) | for breakfast.s3m | 2018-01-04 15:09 | 187K | |
![[SND]](/icons/sound2.gif) | forced labor ii afte..> | 2018-01-04 15:09 | 115K | |
![[SND]](/icons/sound2.gif) | foregone.s3m | 2018-01-04 15:09 | 78K | |
![[SND]](/icons/sound2.gif) | forget the pain (mir..> | 2018-01-04 15:09 | 62K | |
![[SND]](/icons/sound2.gif) | for the love of lisa..> | 2018-01-04 15:09 | 505K | |
![[SND]](/icons/sound2.gif) | for u.s3m | 2018-01-04 15:09 | 183K | |
![[SND]](/icons/sound2.gif) | fracture in space-pm..> | 2018-01-04 15:09 | 168K | |
![[SND]](/icons/sound2.gif) | freadom.s3m | 2018-01-04 15:09 | 335K | |
![[SND]](/icons/sound2.gif) | fredxmas.s3m | 2018-01-04 15:09 | 71K | |
![[SND]](/icons/sound2.gif) | freedom 2'11.s3m | 2018-01-04 15:09 | 313K | |
![[SND]](/icons/sound2.gif) | freedom track.s3m | 2018-01-04 15:09 | 110K | |
![[SND]](/icons/sound2.gif) | frere j.2.s3m | 2018-01-04 15:09 | 105K | |
![[SND]](/icons/sound2.gif) | frog melodymix.s3m | 2018-01-04 15:09 | 379K | |
![[SND]](/icons/sound2.gif) | frozen moments.s3m | 2018-01-04 15:09 | 136K | |
![[SND]](/icons/sound2.gif) | frq-frea.s3m | 2018-01-04 15:09 | 566K | |
![[SND]](/icons/sound2.gif) | fruits!!.s3m | 2018-01-04 15:09 | 420K | |
![[SND]](/icons/sound2.gif) | fuck'em allong song!..> | 2018-01-04 15:09 | 109K | |
![[SND]](/icons/sound2.gif) | fuck it, fuck the pa..> | 2018-01-04 15:09 | 89K | |
![[SND]](/icons/sound2.gif) | funk me with an orga..> | 2018-01-04 15:09 | 231K | |
![[SND]](/icons/sound2.gif) | funko-jazzy.s3m | 2018-01-04 15:09 | 122K | |
![[SND]](/icons/sound2.gif) | funk up your ass.s3m | 2018-01-04 15:09 | 56K | |
![[SND]](/icons/sound2.gif) | funky meister.s3m | 2018-01-04 15:09 | 441K | |
![[SND]](/icons/sound2.gif) | funplastik.s3m | 2018-01-04 15:09 | 115K | |
![[SND]](/icons/sound2.gif) | futility ii.s3m | 2018-01-04 15:09 | 85K | |
![[SND]](/icons/sound2.gif) | future brain.s3m | 2018-01-04 15:09 | 108K | |
![[SND]](/icons/sound2.gif) | future flying past.s3m | 2018-01-04 15:09 | 530K | |
![[SND]](/icons/sound2.gif) | futurism.s3m | 2018-01-04 15:09 | 98K | |
![[SND]](/icons/sound2.gif) | fuzzy future.s3m | 2018-01-04 15:09 | 102K | |
![[SND]](/icons/sound2.gif) | g-forces.s3m | 2018-01-04 15:09 | 323K | |
![[SND]](/icons/sound2.gif) | gal spakoz.s3m | 2018-01-04 15:09 | 162K | |
![[SND]](/icons/sound2.gif) | gamemuzax.s3m | 2018-01-04 15:09 | 111K | |
![[SND]](/icons/sound2.gif) | gems.s3m | 2018-01-04 15:09 | 204K | |
![[SND]](/icons/sound2.gif) | genestealers.s3m | 2018-01-04 15:09 | 25K | |
![[SND]](/icons/sound2.gif) | get hassan.s3m | 2018-01-04 15:09 | 330K | |
![[SND]](/icons/sound2.gif) | get in to techno.s3m | 2018-01-04 15:09 | 172K | |
![[SND]](/icons/sound2.gif) | getting down with bo..> | 2018-01-04 15:09 | 150K | |
![[SND]](/icons/sound2.gif) | ghosts 'n' goblins t..> | 2018-01-04 15:09 | 81K | |
![[SND]](/icons/sound2.gif) | giveme.s3m | 2018-01-04 15:09 | 314K | |
![[SND]](/icons/sound2.gif) | gladiator.s3m | 2018-01-04 15:09 | 329K | |
![[SND]](/icons/sound2.gif) | glow.s3m | 2018-01-04 15:09 | 97K | |
![[SND]](/icons/sound2.gif) | gm.s3m | 2018-01-04 15:09 | 755K | |
![[SND]](/icons/sound2.gif) | gnome underworld.s3m | 2018-01-04 15:09 | 390K | |
![[SND]](/icons/sound2.gif) | goblin's pit octopvs..> | 2018-01-04 15:09 | 139K | |
![[SND]](/icons/sound2.gif) | god-shit.s3m | 2018-01-04 15:09 | 16K | |
![[SND]](/icons/sound2.gif) | go for it.s3m | 2018-01-04 15:09 | 202K | |
![[SND]](/icons/sound2.gif) | going far.s3m | 2018-01-04 15:09 | 71K | |
![[SND]](/icons/sound2.gif) | goingin.s3m | 2018-01-04 15:09 | 381K | |
![[SND]](/icons/sound2.gif) | golliwog's cakewalk.s3m | 2018-01-04 15:09 | 122K | |
![[SND]](/icons/sound2.gif) | good boy.s3m | 2018-01-04 15:09 | 187K | |
![[SND]](/icons/sound2.gif) | goodbye (1).s3m | 2018-01-04 15:09 | 160K | |
![[SND]](/icons/sound2.gif) | goodbye - titansoft.s3m | 2018-01-04 15:09 | 175K | |
![[SND]](/icons/sound2.gif) | gooftechno by undert..> | 2018-01-04 15:09 | 310K | |
![[SND]](/icons/sound2.gif) | gorrfang & groggo.s3m | 2018-01-04 15:09 | 199K | |
![[SND]](/icons/sound2.gif) | gothic dreams.s3m | 2018-01-04 15:09 | 17K | |
![[SND]](/icons/sound2.gif) | got ya.s3m | 2018-01-04 15:09 | 81K | |
![[SND]](/icons/sound2.gif) | go west.s3m | 2018-01-04 15:09 | 315K | |
![[SND]](/icons/sound2.gif) | go where you should ..> | 2018-01-04 15:09 | 164K | |
![[SND]](/icons/sound2.gif) | grandiosa experience..> | 2018-01-04 15:09 | 102K | |
![[SND]](/icons/sound2.gif) | greenmold.s3m | 2018-01-04 15:09 | 46K | |
![[SND]](/icons/sound2.gif) | groove1.s3m | 2018-01-04 15:09 | 367K | |
![[SND]](/icons/sound2.gif) | groove now.s3m | 2018-01-04 15:09 | 64K | |
![[SND]](/icons/sound2.gif) | groovethang.s3m | 2018-01-04 15:09 | 120K | |
![[SND]](/icons/sound2.gif) | groovyfunkyjammin'be..> | 2018-01-04 15:09 | 70K | |
![[SND]](/icons/sound2.gif) | groovy thing.s3m | 2018-01-04 15:09 | 181K | |
![[SND]](/icons/sound2.gif) | grosshouse.s3m | 2018-01-04 15:09 | 189K | |
![[SND]](/icons/sound2.gif) | gtrsnr.s3m | 2018-01-04 15:09 | 649K | |
![[SND]](/icons/sound2.gif) | guardian.s3m | 2018-01-04 15:09 | 367K | |
![[SND]](/icons/sound2.gif) | guitar tune.s3m | 2018-01-04 15:09 | 223K | |
![[SND]](/icons/sound2.gif) | gunny.s3m | 2018-01-04 15:09 | 25K | |
![[SND]](/icons/sound2.gif) | gymkata - camelot's ..> | 2018-01-04 15:09 | 483K | |
![[SND]](/icons/sound2.gif) | halucination.s3m | 2018-01-04 15:09 | 60K | |
![[SND]](/icons/sound2.gif) | hand in hand.s3m | 2018-01-04 15:09 | 707K | |
![[SND]](/icons/sound2.gif) | hand in hand happymi..> | 2018-01-04 15:09 | 859K | |
![[SND]](/icons/sound2.gif) | happy birthday sandr..> | 2018-01-04 15:09 | 236K | |
![[SND]](/icons/sound2.gif) | happy daze by zinc.s3m | 2018-01-04 15:09 | 313K | |
![[SND]](/icons/sound2.gif) | happy ending.s3m | 2018-01-04 15:09 | 8.8K | |
![[SND]](/icons/sound2.gif) | happy new 97 year!.s3m | 2018-01-04 15:09 | 112K | |
![[SND]](/icons/sound2.gif) | happy tears.s3m | 2018-01-04 15:09 | 156K | |
![[SND]](/icons/sound2.gif) | hard-rockin.s3m | 2018-01-04 15:09 | 83K | |
![[SND]](/icons/sound2.gif) | hard.s3m | 2018-01-04 15:09 | 623K | |
![[SND]](/icons/sound2.gif) | hard core.s3m | 2018-01-04 15:09 | 128K | |
![[SND]](/icons/sound2.gif) | hardie paartie.s3m | 2018-01-04 15:09 | 91K | |
![[SND]](/icons/sound2.gif) | hardrave.s3m | 2018-01-04 15:09 | 131K | |
![[SND]](/icons/sound2.gif) | hard types.s3m | 2018-01-04 15:09 | 259K | |
![[SND]](/icons/sound2.gif) | hard world - titanso..> | 2018-01-04 15:09 | 472K | |
![[SND]](/icons/sound2.gif) | harsh environment -s..> | 2018-01-04 15:09 | 214K | |
![[SND]](/icons/sound2.gif) | h a r v y i i.s3m | 2018-01-04 15:09 | 364K | |
![[SND]](/icons/sound2.gif) | hate!.s3m | 2018-01-04 15:09 | 599K | |
![[SND]](/icons/sound2.gif) | hauhau.s3m | 2018-01-04 15:09 | 85K | |
![[SND]](/icons/sound2.gif) | having it all - jest..> | 2018-01-04 15:09 | 565K | |
![[SND]](/icons/sound2.gif) | heard it on channel ..> | 2018-01-04 15:09 | 228K | |
![[SND]](/icons/sound2.gif) | hear this ! 2 - the ..> | 2018-01-04 15:09 | 502K | |
![[SND]](/icons/sound2.gif) | hear this ! 3 - time..> | 2018-01-04 15:09 | 254K | |
![[SND]](/icons/sound2.gif) | hear this ! 4 -i.b.a..> | 2018-01-04 15:09 | 411K | |
![[SND]](/icons/sound2.gif) | hear this ! 5 - refl..> | 2018-01-04 15:09 | 312K | |
![[SND]](/icons/sound2.gif) | hear this - by jrb.s3m | 2018-01-04 15:09 | 652K | |
![[SND]](/icons/sound2.gif) | hear this by jrb.s3m | 2018-01-04 15:09 | 658K | |
![[SND]](/icons/sound2.gif) | heart of fire.s3m | 2018-01-04 15:09 | 280K | |
![[SND]](/icons/sound2.gif) | heavy metal.s3m | 2018-01-04 15:09 | 61K | |
![[SND]](/icons/sound2.gif) | heavy water.s3m | 2018-01-04 15:09 | 585K | |
![[SND]](/icons/sound2.gif) | helianim.s3m | 2018-01-04 15:09 | 38K | |
![[SND]](/icons/sound2.gif) | hell lair.s3m | 2018-01-04 15:09 | 109K | |
![[SND]](/icons/sound2.gif) | helpless.s3m | 2018-01-04 15:09 | 54K | |
![[SND]](/icons/sound2.gif) | hemorrhage.s3m | 2018-01-04 15:09 | 52K | |
![[SND]](/icons/sound2.gif) | heppy beppy!.s3m | 2018-01-04 15:09 | 34K | |
![[SND]](/icons/sound2.gif) | hero of dreams.s3m | 2018-01-04 15:09 | 170K | |
![[SND]](/icons/sound2.gif) | hh funckshow.s3m | 2018-01-04 15:09 | 263K | |
![[SND]](/icons/sound2.gif) | hidden emotions.s3m | 2018-01-04 15:09 | 252K | |
![[SND]](/icons/sound2.gif) | high high over the s..> | 2018-01-04 15:09 | 260K | |
![[SND]](/icons/sound2.gif) | hiroshima.s3m | 2018-01-04 15:09 | 24K | |
![[SND]](/icons/sound2.gif) | hisprox.s3m | 2018-01-04 15:09 | 68K | |
![[SND]](/icons/sound2.gif) | hit & run.............> | 2018-01-04 15:09 | 85K | |
![[SND]](/icons/sound2.gif) | hm.s3m | 2018-01-04 15:09 | 19K | |
![[SND]](/icons/sound2.gif) | hnthink.s3m | 2018-01-04 15:09 | 166K | |
![[SND]](/icons/sound2.gif) | holier then thou.s3m | 2018-01-04 15:09 | 39K | |
![[SND]](/icons/sound2.gif) | homecoming - rain of..> | 2018-01-04 15:09 | 241K | |
![[SND]](/icons/sound2.gif) | honkhonk.s3m | 2018-01-04 15:09 | 30K | |
![[SND]](/icons/sound2.gif) | hope.s3m | 2018-01-04 15:09 | 540K | |
![[SND]](/icons/sound2.gif) | hope to nowhere.s3m | 2018-01-04 15:09 | 287K | |
![[SND]](/icons/sound2.gif) | hot.summernights.s3m | 2018-01-04 15:09 | 105K | |
![[SND]](/icons/sound2.gif) | hot shot and candy s..> | 2018-01-04 15:09 | 162K | |
![[SND]](/icons/sound2.gif) | house4.s3m | 2018-01-04 15:09 | 207K | |
![[SND]](/icons/sound2.gif) | housed lxvii.s3m | 2018-01-04 15:09 | 394K | |
![[SND]](/icons/sound2.gif) | house eey! #24 versi..> | 2018-01-04 15:09 | 352K | |
![[SND]](/icons/sound2.gif) | house eey #7.s3m | 2018-01-04 15:09 | 179K | |
![[SND]](/icons/sound2.gif) | house eey #17(stereo..> | 2018-01-04 15:09 | 214K | |
![[SND]](/icons/sound2.gif) | house eey #35 (hide3..> | 2018-01-04 15:09 | 86K | |
![[SND]](/icons/sound2.gif) | house eey #37..s3m | 2018-01-04 15:09 | 188K | |
![[SND]](/icons/sound2.gif) | hub 5.s3m | 2018-01-04 15:09 | 853K | |
![[SND]](/icons/sound2.gif) | huh huh that would b..> | 2018-01-04 15:09 | 223K | |
![[SND]](/icons/sound2.gif) | huismuziekje.s3m | 2018-01-04 15:09 | 172K | |
![[SND]](/icons/sound2.gif) | hulivili haitari.s3m | 2018-01-04 15:09 | 122K | |
![[SND]](/icons/sound2.gif) | human.s3m | 2018-01-04 15:09 | 206K | |
![[SND]](/icons/sound2.gif) | hyperchip.s3m | 2018-01-04 15:09 | 55K | |
![[SND]](/icons/sound2.gif) | hypersong 001.s3m | 2018-01-04 15:09 | 129K | |
![[SND]](/icons/sound2.gif) | hypersong 002.s3m | 2018-01-04 15:09 | 70K | |
![[SND]](/icons/sound2.gif) | h y p o t h e r m i ..> | 2018-01-04 15:09 | 76K | |
![[SND]](/icons/sound2.gif) | i'll be there.s3m | 2018-01-04 15:09 | 147K | |
![[SND]](/icons/sound2.gif) | i'm scared, mommy..s3m | 2018-01-04 15:09 | 62K | |
![[SND]](/icons/sound2.gif) | i'm waitin 4u remix.s3m | 2018-01-04 15:09 | 108K | |
![[SND]](/icons/sound2.gif) | i am very cool.s3m | 2018-01-04 15:09 | 71K | |
![[SND]](/icons/sound2.gif) | i believe in the dee..> | 2018-01-04 15:09 | 204K | |
![[SND]](/icons/sound2.gif) | ice mountain.s3m | 2018-01-04 15:09 | 96K | |
![[SND]](/icons/sound2.gif) | ice of her heart.s3m | 2018-01-04 15:09 | 270K | |
![[SND]](/icons/sound2.gif) | idreams.s3m | 2018-01-04 15:09 | 848K | |
![[SND]](/icons/sound2.gif) | i had a dream.s3m | 2018-01-04 15:09 | 237K | |
![[SND]](/icons/sound2.gif) | i have a dream.s3m | 2018-01-04 15:09 | 122K | |
![[SND]](/icons/sound2.gif) | iiiiiid.s3m | 2018-01-04 15:09 | 288K | |
![[SND]](/icons/sound2.gif) | i kiss your lips.s3m | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | illan viimeinen hida..> | 2018-01-04 15:09 | 299K | |
![[SND]](/icons/sound2.gif) | illumination.s3m | 2018-01-04 15:09 | 123K | |
![[SND]](/icons/sound2.gif) | image of variance.s3m | 2018-01-04 15:09 | 144K | |
![[SND]](/icons/sound2.gif) | imitation.s3m | 2018-01-04 15:09 | 286K | |
![[SND]](/icons/sound2.gif) | immortal.s3m | 2018-01-04 15:09 | 93K | |
![[SND]](/icons/sound2.gif) | impulse nine.s3m | 2018-01-04 15:09 | 324K | |
![[SND]](/icons/sound2.gif) | incantation of the 3..> | 2018-01-04 15:09 | 610K | |
![[SND]](/icons/sound2.gif) | independence.s3m | 2018-01-04 15:09 | 269K | |
![[SND]](/icons/sound2.gif) | industrial light & m..> | 2018-01-04 15:09 | 762K | |
![[SND]](/icons/sound2.gif) | industrial vacation.s3m | 2018-01-04 15:09 | 229K | |
![[SND]](/icons/sound2.gif) | industrielle symfoni..> | 2018-01-04 15:09 | 190K | |
![[SND]](/icons/sound2.gif) | industry.s3m | 2018-01-04 15:09 | 133K | |
![[SND]](/icons/sound2.gif) | information.s3m | 2018-01-04 15:09 | 114K | |
![[SND]](/icons/sound2.gif) | insane (in the membr..> | 2018-01-04 15:09 | 583K | |
![[SND]](/icons/sound2.gif) | inside a murder....s3m | 2018-01-04 15:09 | 94K | |
![[SND]](/icons/sound2.gif) | inside what who car..> | 2018-01-04 15:09 | 158K | |
![[SND]](/icons/sound2.gif) | insomnia - mixed by ..> | 2018-01-04 15:09 | 93K | |
![[SND]](/icons/sound2.gif) | insomniac.s3m | 2018-01-04 15:09 | 95K | |
![[SND]](/icons/sound2.gif) | insomnia rmx byfabin..> | 2018-01-04 15:09 | 198K | |
![[SND]](/icons/sound2.gif) | interlude i.s3m | 2018-01-04 15:09 | 115K | |
![[SND]](/icons/sound2.gif) | interlude ii.s3m | 2018-01-04 15:09 | 514K | |
![[SND]](/icons/sound2.gif) | in the mist.s3m | 2018-01-04 15:09 | 185K | |
![[SND]](/icons/sound2.gif) | into-space2.s3m | 2018-01-04 15:09 | 85K | |
![[SND]](/icons/sound2.gif) | intoxicated agony.s3m | 2018-01-04 15:09 | 331K | |
![[SND]](/icons/sound2.gif) | intrinsic 2'10.s3m | 2018-01-04 15:09 | 156K | |
![[SND]](/icons/sound2.gif) | intro.s3m | 2018-01-04 15:09 | 290K | |
![[SND]](/icons/sound2.gif) | intro i.s3m | 2018-01-04 15:09 | 13K | |
![[SND]](/icons/sound2.gif) | invader (by heiko sc..> | 2018-01-04 15:09 | 255K | |
![[SND]](/icons/sound2.gif) | invaders.s3m | 2018-01-04 15:09 | 221K | |
![[SND]](/icons/sound2.gif) | inverted reality.s3m | 2018-01-04 15:09 | 422K | |
![[SND]](/icons/sound2.gif) | invintro.s3m | 2018-01-04 15:09 | 140K | |
![[SND]](/icons/sound2.gif) | invisible f0rce! the..> | 2018-01-04 15:09 | 258K | |
![[SND]](/icons/sound2.gif) | iris.s3m | 2018-01-04 15:09 | 37K | |
![[SND]](/icons/sound2.gif) | ironman.s3m | 2018-01-04 15:09 | 221K | |
![[SND]](/icons/sound2.gif) | isam.s3m | 2018-01-04 15:09 | 353K | |
![[SND]](/icons/sound2.gif) | islands of paradise.s3m | 2018-01-04 15:09 | 168K | |
![[SND]](/icons/sound2.gif) | is you happy by unde..> | 2018-01-04 15:09 | 274K | |
![[SND]](/icons/sound2.gif) | it's just a flesh wo..> | 2018-01-04 15:09 | 229K | |
![[SND]](/icons/sound2.gif) | i technot think so.s3m | 2018-01-04 15:09 | 265K | |
![[SND]](/icons/sound2.gif) | itrust.s3m | 2018-01-04 15:09 | 309K | |
![[SND]](/icons/sound2.gif) | its magic.s3m | 2018-01-04 15:09 | 186K | |
![[SND]](/icons/sound2.gif) | i wanna rock ya (rem..> | 2018-01-04 15:09 | 132K | |
![[SND]](/icons/sound2.gif) | i will stay.s3m | 2018-01-04 15:09 | 64K | |
![[SND]](/icons/sound2.gif) | iz-wtmg.s3m | 2018-01-04 15:09 | 371K | |
![[SND]](/icons/sound2.gif) | jacob's ladder - ler..> | 2018-01-04 15:09 | 383K | |
![[SND]](/icons/sound2.gif) | jacob's ladder - ler..> | 2018-01-04 15:09 | 383K | |
![[SND]](/icons/sound2.gif) | james.s3m | 2018-01-04 15:09 | 19K | |
![[SND]](/icons/sound2.gif) | jam for me.s3m | 2018-01-04 15:09 | 128K | |
![[SND]](/icons/sound2.gif) | japanese rock.s3m | 2018-01-04 15:09 | 87K | |
![[SND]](/icons/sound2.gif) | jarre- chronologie p..> | 2018-01-04 15:09 | 555K | |
![[SND]](/icons/sound2.gif) | jason lives....s3m | 2018-01-04 15:09 | 198K | |
![[SND]](/icons/sound2.gif) | jays dream vol.1.s3m | 2018-01-04 15:09 | 260K | |
![[SND]](/icons/sound2.gif) | jb makes an ass of h..> | 2018-01-04 15:09 | 6.3K | |
![[SND]](/icons/sound2.gif) | jbtrick.s3m | 2018-01-04 15:09 | 225K | |
![[SND]](/icons/sound2.gif) | jesus...thereturn.s3m | 2018-01-04 15:09 | 121K | |
![[SND]](/icons/sound2.gif) | jiggin.s3m | 2018-01-04 15:09 | 459K | |
![[SND]](/icons/sound2.gif) | jingle1.s3m | 2018-01-04 15:09 | 34K | |
![[SND]](/icons/sound2.gif) | jingle3.s3m | 2018-01-04 15:09 | 23K | |
![[SND]](/icons/sound2.gif) | jingle bells remix.s3m | 2018-01-04 15:09 | 154K | |
![[SND]](/icons/sound2.gif) | jkl-2.s3m | 2018-01-04 15:09 | 116K | |
![[SND]](/icons/sound2.gif) | joe and his guitar.s3m | 2018-01-04 15:09 | 113K | |
![[SND]](/icons/sound2.gif) | join them.s3m | 2018-01-04 15:09 | 42K | |
![[SND]](/icons/sound2.gif) | join us (q-sound).s3m | 2018-01-04 15:09 | 206K | |
![[SND]](/icons/sound2.gif) | joulupukki on..s3m | 2018-01-04 15:09 | 74K | |
![[SND]](/icons/sound2.gif) | joulurokki.s3m | 2018-01-04 15:09 | 143K | |
![[SND]](/icons/sound2.gif) | judgement.s3m | 2018-01-04 15:09 | 409K | |
![[SND]](/icons/sound2.gif) | judgement day, anima..> | 2018-01-04 15:09 | 62K | |
![[SND]](/icons/sound2.gif) | juillet aout 1997.s3m | 2018-01-04 15:09 | 101K | |
![[SND]](/icons/sound2.gif) | jullov.s3m | 2018-01-04 15:09 | 49K | |
![[SND]](/icons/sound2.gif) | jumputus.s3m | 2018-01-04 15:09 | 223K | |
![[SND]](/icons/sound2.gif) | jungle #1.s3m | 2018-01-04 15:09 | 222K | |
![[SND]](/icons/sound2.gif) | jupp.s3m | 2018-01-04 15:09 | 6.6K | |
![[SND]](/icons/sound2.gif) | jurassic park lv 4 (..> | 2018-01-04 15:09 | 436K | |
![[SND]](/icons/sound2.gif) | just shake your ass.s3m | 2018-01-04 15:09 | 167K | |
![[SND]](/icons/sound2.gif) | k-styles compo.s3m | 2018-01-04 15:09 | 13K | |
![[SND]](/icons/sound2.gif) | kaksi orjaa!.s3m | 2018-01-04 15:09 | 24K | |
![[SND]](/icons/sound2.gif) | kartago.s3m | 2018-01-04 15:09 | 30K | |
![[SND]](/icons/sound2.gif) | kefrens funky.s3m | 2018-01-04 15:09 | 103K | |
![[SND]](/icons/sound2.gif) | kick back.s3m | 2018-01-04 15:09 | 354K | |
![[SND]](/icons/sound2.gif) | kids hate cops.s3m | 2018-01-04 15:09 | 483K | |
![[SND]](/icons/sound2.gif) | kievarinkierukka.s3m | 2018-01-04 15:09 | 16K | |
![[SND]](/icons/sound2.gif) | killer - hb2me!.s3m | 2018-01-04 15:09 | 131K | |
![[SND]](/icons/sound2.gif) | killer - internet.s3m | 2018-01-04 15:09 | 387K | |
![[SND]](/icons/sound2.gif) | killer - la-psha.s3m | 2018-01-04 15:09 | 493K | |
![[SND]](/icons/sound2.gif) | killer euphoria -- h..> | 2018-01-04 15:09 | 190K | |
![[SND]](/icons/sound2.gif) | kitamatik.s3m | 2018-01-04 15:09 | 19K | |
![[SND]](/icons/sound2.gif) | klaxtitle.s3m | 2018-01-04 15:09 | 141K | |
![[SND]](/icons/sound2.gif) | klc.s3m | 2018-01-04 15:09 | 106K | |
![[SND]](/icons/sound2.gif) | knock test #400.s3m | 2018-01-04 15:09 | 59K | |
![[SND]](/icons/sound2.gif) | koni.s3m | 2018-01-04 15:09 | 599K | |
![[SND]](/icons/sound2.gif) | kontest.s3m | 2018-01-04 15:09 | 12K | |
![[SND]](/icons/sound2.gif) | kool.s3m | 2018-01-04 15:09 | 137K | |
![[SND]](/icons/sound2.gif) | kraftwerk 8.24(sam).s3m | 2018-01-04 15:09 | 346K | |
![[SND]](/icons/sound2.gif) | kuri.s3m | 2018-01-04 15:09 | 69K | |
![[SND]](/icons/sound2.gif) | kyll„ se p”yt„..> | 2018-01-04 15:09 | 426K | |
![[SND]](/icons/sound2.gif) | laban.s3m | 2018-01-04 15:09 | 113K | |
![[SND]](/icons/sound2.gif) | la fuerza del deseo.s3m | 2018-01-04 15:09 | 442K | |
![[SND]](/icons/sound2.gif) | lalalalala....s3m | 2018-01-04 15:09 | 47K | |
![[SND]](/icons/sound2.gif) | landward.s3m | 2018-01-04 15:09 | 211K | |
![[SND]](/icons/sound2.gif) | last summer.s3m | 2018-01-04 15:09 | 203K | |
![[SND]](/icons/sound2.gif) | late night chip.s3m | 2018-01-04 15:09 | 5.8K | |
![[SND]](/icons/sound2.gif) | lavos core - first b..> | 2018-01-04 15:09 | 132K | |
![[SND]](/icons/sound2.gif) | leaves.s3m | 2018-01-04 15:09 | 78K | |
![[SND]](/icons/sound2.gif) | legend2000.s3m | 2018-01-04 15:09 | 654K | |
![[SND]](/icons/sound2.gif) | legend of the night-..> | 2018-01-04 15:09 | 122K | |
![[SND]](/icons/sound2.gif) | legend of the night.s3m | 2018-01-04 15:09 | 138K | |
![[SND]](/icons/sound2.gif) | leias wrath.s3m | 2018-01-04 15:09 | 207K | |
![[SND]](/icons/sound2.gif) | lemming.s3m | 2018-01-04 15:09 | 126K | |
![[SND]](/icons/sound2.gif) | let's go!.s3m | 2018-01-04 15:09 | 213K | |
![[SND]](/icons/sound2.gif) | let me free.s3m | 2018-01-04 15:09 | 518K | |
![[SND]](/icons/sound2.gif) | let me go tor.s3m | 2018-01-04 15:09 | 217K | |
![[SND]](/icons/sound2.gif) | lex.s3m | 2018-01-04 15:09 | 321K | |
![[SND]](/icons/sound2.gif) | liberally yours.s3m | 2018-01-04 15:09 | 75K | |
![[SND]](/icons/sound2.gif) | liberty!!!.s3m | 2018-01-04 15:09 | 189K | |
![[SND]](/icons/sound2.gif) | life (1).s3m | 2018-01-04 15:09 | 248K | |
![[SND]](/icons/sound2.gif) | life (life of an and..> | 2018-01-04 15:09 | 76K | |
![[SND]](/icons/sound2.gif) | life.s3m | 2018-01-04 15:09 | 269K | |
![[SND]](/icons/sound2.gif) | life after death.s3m | 2018-01-04 15:09 | 845K | |
![[SND]](/icons/sound2.gif) | lifeblood.s3m | 2018-01-04 15:09 | 38K | |
![[SND]](/icons/sound2.gif) | life rmx.s3m | 2018-01-04 15:09 | 309K | |
![[SND]](/icons/sound2.gif) | lift-off nerves.s3m | 2018-01-04 15:09 | 127K | |
![[SND]](/icons/sound2.gif) | lightning from a bri..> | 2018-01-04 15:09 | 359K | |
![[SND]](/icons/sound2.gif) | lily of the valley (..> | 2018-01-04 15:09 | 121K | |
![[SND]](/icons/sound2.gif) | lim0std1.s3m | 2018-01-04 15:09 | 46K | |
![[SND]](/icons/sound2.gif) | lim0std5.s3m | 2018-01-04 15:09 | 47K | |
![[SND]](/icons/sound2.gif) | linger.s3m | 2018-01-04 15:09 | 94K | |
![[SND]](/icons/sound2.gif) | liquid - sosgrindbro..> | 2018-01-04 15:09 | 757K | |
![[SND]](/icons/sound2.gif) | liquid blue forest.s3m | 2018-01-04 15:09 | 137K | |
![[SND]](/icons/sound2.gif) | liquid heat - pgm.s3m | 2018-01-04 15:09 | 260K | |
![[SND]](/icons/sound2.gif) | liquid metamorfunkus..> | 2018-01-04 15:09 | 148K | |
![[SND]](/icons/sound2.gif) | lisa went to school...> | 2018-01-04 15:09 | 125K | |
![[SND]](/icons/sound2.gif) | listen 2 the rhythm ..> | 2018-01-04 15:09 | 357K | |
![[SND]](/icons/sound2.gif) | little scooter & sco..> | 2018-01-04 15:09 | 253K | |
![[SND]](/icons/sound2.gif) | live performance.s3m | 2018-01-04 15:09 | 279K | |
![[SND]](/icons/sound2.gif) | loader.s3m | 2018-01-04 15:09 | 59K | |
![[SND]](/icons/sound2.gif) | long hard tuesday ni..> | 2018-01-04 15:09 | 355K | |
![[SND]](/icons/sound2.gif) | looser motion.s3m | 2018-01-04 15:09 | 133K | |
![[SND]](/icons/sound2.gif) | loosy motion.s3m | 2018-01-04 15:09 | 248K | |
![[SND]](/icons/sound2.gif) | loquacious lady.s3m | 2018-01-04 15:09 | 181K | |
![[SND]](/icons/sound2.gif) | losing it -- ler95.s3m | 2018-01-04 15:09 | 412K | |
![[SND]](/icons/sound2.gif) | lost illusions.s3m | 2018-01-04 15:09 | 76K | |
![[SND]](/icons/sound2.gif) | lost in the rain..s3m | 2018-01-04 15:09 | 173K | |
![[SND]](/icons/sound2.gif) | love and death by ..> | 2018-01-04 15:09 | 315K | |
![[SND]](/icons/sound2.gif) | lovesong.s3m | 2018-01-04 15:09 | 516K | |
![[SND]](/icons/sound2.gif) | low alt'95 remix.s3m | 2018-01-04 15:09 | 278K | |
![[SND]](/icons/sound2.gif) | lowrider -war thx.s3m | 2018-01-04 15:09 | 426K | |
![[SND]](/icons/sound2.gif) | lsd.s3m | 2018-01-04 15:09 | 20K | |
![[SND]](/icons/sound2.gif) | lun mind.s3m | 2018-01-04 15:09 | 317K | |
![[SND]](/icons/sound2.gif) | m -land -alfa.s3m | 2018-01-04 15:09 | 113K | |
![[SND]](/icons/sound2.gif) | m.k. the movie music..> | 2018-01-04 15:09 | 93K | |
![[SND]](/icons/sound2.gif) | m.l.k..s3m | 2018-01-04 15:09 | 81K | |
![[SND]](/icons/sound2.gif) | macgyver.s3m | 2018-01-04 15:09 | 144K | |
![[SND]](/icons/sound2.gif) | machine sex ....s3m | 2018-01-04 15:09 | 145K | |
![[SND]](/icons/sound2.gif) | machmind.s3m | 2018-01-04 15:09 | 90K | |
![[SND]](/icons/sound2.gif) | mad chip-like!.s3m | 2018-01-04 15:09 | 68K | |
![[SND]](/icons/sound2.gif) | magic box.s3m | 2018-01-04 15:09 | 18K | |
![[SND]](/icons/sound2.gif) | magic flowers flight..> | 2018-01-04 15:09 | 407K | |
![[SND]](/icons/sound2.gif) | magic melody one.s3m | 2018-01-04 15:09 | 186K | |
![[SND]](/icons/sound2.gif) | magic world.s3m | 2018-01-04 15:09 | 354K | |
![[SND]](/icons/sound2.gif) | magnetic.fields.s3m | 2018-01-04 15:09 | 144K | |
![[SND]](/icons/sound2.gif) | malefic underground.s3m | 2018-01-04 15:09 | 274K | |
![[SND]](/icons/sound2.gif) | marcelle.s3m | 2018-01-04 15:09 | 624K | |
![[SND]](/icons/sound2.gif) | marshmellow dreams.s3m | 2018-01-04 15:09 | 448K | |
![[SND]](/icons/sound2.gif) | marshmellow meditati..> | 2018-01-04 15:09 | 683K | |
![[SND]](/icons/sound2.gif) | mask of joy.cut.s3m | 2018-01-04 15:09 | 74K | |
![[SND]](/icons/sound2.gif) | massive.s3m | 2018-01-04 15:09 | 446K | |
![[SND]](/icons/sound2.gif) | mayhem.s3m | 2018-01-04 15:09 | 183K | |
![[SND]](/icons/sound2.gif) | mazer -spk.s3m | 2018-01-04 15:09 | 703K | |
![[SND]](/icons/sound2.gif) | mc3 v1.s3m | 2018-01-04 15:09 | 414K | |
![[SND]](/icons/sound2.gif) | mc4.s3m | 2018-01-04 15:09 | 247K | |
![[SND]](/icons/sound2.gif) | mconv 1.00 (c)'96 by..> | 2018-01-04 15:09 | 33K | |
![[SND]](/icons/sound2.gif) | mc teardrops.s3m | 2018-01-04 15:09 | 49K | |
![[SND]](/icons/sound2.gif) | medieval happy song.s3m | 2018-01-04 15:09 | 27K | |
![[SND]](/icons/sound2.gif) | medieval serenade.s3m | 2018-01-04 15:09 | 34K | |
![[SND]](/icons/sound2.gif) | meeting the unxpecte..> | 2018-01-04 15:09 | 129K | |
![[SND]](/icons/sound2.gif) | megablast.s3m | 2018-01-04 15:09 | 151K | |
![[SND]](/icons/sound2.gif) | megaman x tune (snes..> | 2018-01-04 15:09 | 239K | |
![[SND]](/icons/sound2.gif) | mel -deal for life.s3m | 2018-01-04 15:09 | 739K | |
![[SND]](/icons/sound2.gif) | mel -diablo part 1.s3m | 2018-01-04 15:09 | 144K | |
![[SND]](/icons/sound2.gif) | mel -in heaven.s3m | 2018-01-04 15:09 | 219K | |
![[SND]](/icons/sound2.gif) | melodious magic.s3m | 2018-01-04 15:09 | 77K | |
![[SND]](/icons/sound2.gif) | melody.s3m | 2018-01-04 15:09 | 30K | |
![[SND]](/icons/sound2.gif) | melt away.s3m | 2018-01-04 15:09 | 242K | |
![[SND]](/icons/sound2.gif) | meltdown! -spk.s3m | 2018-01-04 15:09 | 369K | |
![[SND]](/icons/sound2.gif) | melt melody 2'45.s3m | 2018-01-04 15:09 | 214K | |
![[SND]](/icons/sound2.gif) | memory.s3m | 2018-01-04 15:09 | 276K | |
![[SND]](/icons/sound2.gif) | mental analysis.s3m | 2018-01-04 15:09 | 161K | |
![[SND]](/icons/sound2.gif) | mental reverb.s3m | 2018-01-04 15:09 | 129K | |
![[SND]](/icons/sound2.gif) | menu.s3m | 2018-01-04 15:09 | 35K | |
![[SND]](/icons/sound2.gif) | metal.s3m | 2018-01-04 15:09 | 327K | |
![[SND]](/icons/sound2.gif) | metallic [remix].s3m | 2018-01-04 15:09 | 162K | |
![[SND]](/icons/sound2.gif) | metamorphica.s3m | 2018-01-04 15:09 | 103K | |
![[SND]](/icons/sound2.gif) | metaphasic burn out!..> | 2018-01-04 15:09 | 541K | |
![[SND]](/icons/sound2.gif) | mideval times.s3m | 2018-01-04 15:09 | 50K | |
![[SND]](/icons/sound2.gif) | midnight.s3m | 2018-01-04 15:09 | 47K | |
![[SND]](/icons/sound2.gif) | mike's rock 'n' rap.s3m | 2018-01-04 15:09 | 169K | |
![[SND]](/icons/sound2.gif) | mike125.s3m | 2018-01-04 15:09 | 426K | |
![[SND]](/icons/sound2.gif) | mike325.s3m | 2018-01-04 15:09 | 434K | |
![[SND]](/icons/sound2.gif) | mike394.s3m | 2018-01-04 15:09 | 541K | |
![[SND]](/icons/sound2.gif) | mike398.s3m | 2018-01-04 15:09 | 694K | |
![[SND]](/icons/sound2.gif) | mike438.s3m | 2018-01-04 15:09 | 405K | |
![[SND]](/icons/sound2.gif) | mike439.s3m | 2018-01-04 15:09 | 695K | |
![[SND]](/icons/sound2.gif) | mike oldfield.s3m | 2018-01-04 15:09 | 37K | |
![[SND]](/icons/sound2.gif) | mike rowchip - zinc.s3m | 2018-01-04 15:09 | 6.8K | |
![[SND]](/icons/sound2.gif) | militant call.s3m | 2018-01-04 15:09 | 248K | |
![[SND]](/icons/sound2.gif) | military docks.s3m | 2018-01-04 15:09 | 28K | |
![[SND]](/icons/sound2.gif) | military xeulogy (re..> | 2018-01-04 15:09 | 125K | |
![[SND]](/icons/sound2.gif) | mimanchi.s3m | 2018-01-04 15:09 | 71K | |
![[SND]](/icons/sound2.gif) | mind-less.s3m | 2018-01-04 15:09 | 50K | |
![[SND]](/icons/sound2.gif) | mirage.s3m | 2018-01-04 15:09 | 36K | |
![[SND]](/icons/sound2.gif) | misiki theme.s3m | 2018-01-04 15:09 | 229K | |
![[SND]](/icons/sound2.gif) | misong.s3m | 2018-01-04 15:09 | 213K | |
![[SND]](/icons/sound2.gif) | mission impossible r..> | 2018-01-04 15:09 | 137K | |
![[SND]](/icons/sound2.gif) | mister2.s3m | 2018-01-04 15:09 | 63K | |
![[SND]](/icons/sound2.gif) | mix 95.s3m | 2018-01-04 15:09 | 817K | |
![[SND]](/icons/sound2.gif) | mmm.... canned peas...> | 2018-01-04 15:09 | 72K | |
![[SND]](/icons/sound2.gif) | mocking bird.s3m | 2018-01-04 15:09 | 204K | |
![[SND]](/icons/sound2.gif) | moderatly dark.s3m | 2018-01-04 15:09 | 140K | |
![[SND]](/icons/sound2.gif) | moisture dreaming.s3m | 2018-01-04 15:09 | 253K | |
![[SND]](/icons/sound2.gif) | molly's lips.s3m | 2018-01-04 15:09 | 190K | |
![[SND]](/icons/sound2.gif) | molotov shake.s3m | 2018-01-04 15:09 | 80K | |
![[SND]](/icons/sound2.gif) | mom5.s3m | 2018-01-04 15:09 | 455K | |
![[SND]](/icons/sound2.gif) | monkey dance.s3m | 2018-01-04 15:09 | 50K | |
![[SND]](/icons/sound2.gif) | monochrome skies.s3m | 2018-01-04 15:09 | 129K | |
![[SND]](/icons/sound2.gif) | monotrak k12.s3m | 2018-01-04 15:09 | 377K | |
![[SND]](/icons/sound2.gif) | mood swing.s3m | 2018-01-04 15:09 | 472K | |
![[SND]](/icons/sound2.gif) | moon.s3m | 2018-01-04 15:09 | 360K | |
![[SND]](/icons/sound2.gif) | moonlit river.s3m | 2018-01-04 15:09 | 303K | |
![[SND]](/icons/sound2.gif) | more than a feeling ..> | 2018-01-04 15:09 | 140K | |
![[SND]](/icons/sound2.gif) | morrin murrin.s3m | 2018-01-04 15:09 | 117K | |
![[SND]](/icons/sound2.gif) | mortal kombat.s3m | 2018-01-04 15:09 | 500K | |
![[SND]](/icons/sound2.gif) | moskyt1.s3m | 2018-01-04 15:09 | 9.2K | |
![[SND]](/icons/sound2.gif) | moveit.s3m | 2018-01-04 15:09 | 183K | |
![[SND]](/icons/sound2.gif) | mozaic.s3m | 2018-01-04 15:09 | 211K | |
![[SND]](/icons/sound2.gif) | mr. pringle.s3m | 2018-01-04 15:09 | 76K | |
![[SND]](/icons/sound2.gif) | mrmoust.s3m | 2018-01-04 15:09 | 35K | |
![[SND]](/icons/sound2.gif) | mtv eua!.s3m | 2018-01-04 15:09 | 191K | |
![[SND]](/icons/sound2.gif) | mtv rlms.s3m | 2018-01-04 15:09 | 247K | |
![[SND]](/icons/sound2.gif) | mundos de luz- socra..> | 2018-01-04 15:09 | 286K | |
![[SND]](/icons/sound2.gif) | music-bird.s3m | 2018-01-04 15:09 | 427K | |
![[SND]](/icons/sound2.gif) | music1.s3m | 2018-01-04 15:09 | 73K | |
![[SND]](/icons/sound2.gif) | music 2 masturbate 2..> | 2018-01-04 15:09 | 447K | |
![[SND]](/icons/sound2.gif) | music block.s3m | 2018-01-04 15:09 | 123K | |
![[SND]](/icons/sound2.gif) | music instructor.s3m | 2018-01-04 15:09 | 705K | |
![[SND]](/icons/sound2.gif) | must.s3m | 2018-01-04 15:09 | 147K | |
![[SND]](/icons/sound2.gif) | mutante- ---.s3m | 2018-01-04 15:09 | 486K | |
![[SND]](/icons/sound2.gif) | my ears are bleeding..> | 2018-01-04 15:09 | 298K | |
![[SND]](/icons/sound2.gif) | my friend of misery.s3m | 2018-01-04 15:09 | 151K | |
![[SND]](/icons/sound2.gif) | mysteries.s3m | 2018-01-04 15:09 | 410K | |
![[SND]](/icons/sound2.gif) | mystery for alexandr..> | 2018-01-04 15:09 | 223K | |
![[SND]](/icons/sound2.gif) | mystery in fur.s3m | 2018-01-04 15:09 | 126K | |
![[SND]](/icons/sound2.gif) | n-rat by anoxer.s3m | 2018-01-04 15:09 | 154K | |
![[SND]](/icons/sound2.gif) | nailgun rape.s3m | 2018-01-04 15:09 | 507K | |
![[SND]](/icons/sound2.gif) | najmi.s3m | 2018-01-04 15:09 | 151K | |
![[SND]](/icons/sound2.gif) | natale (canzone reli..> | 2018-01-04 15:09 | 175K | |
![[SND]](/icons/sound2.gif) | navigator.s3m | 2018-01-04 15:09 | 437K | |
![[SND]](/icons/sound2.gif) | nbeat 666.s3m | 2018-01-04 15:09 | 146K | |
![[SND]](/icons/sound2.gif) | neurophiks.s3m | 2018-01-04 15:09 | 84K | |
![[SND]](/icons/sound2.gif) | neverending lies.s3m | 2018-01-04 15:09 | 347K | |
![[SND]](/icons/sound2.gif) | never forgotten.s3m | 2018-01-04 15:09 | 80K | |
![[SND]](/icons/sound2.gif) | newdemo2.3.s3m | 2018-01-04 15:09 | 58K | |
![[SND]](/icons/sound2.gif) | new hard.s3m | 2018-01-04 15:09 | 65K | |
![[SND]](/icons/sound2.gif) | new jungle song! raz..> | 2018-01-04 15:09 | 254K | |
![[SND]](/icons/sound2.gif) | new meditation.s3m | 2018-01-04 15:09 | 221K | |
![[SND]](/icons/sound2.gif) | newtech.s3m | 2018-01-04 15:09 | 51K | |
![[SND]](/icons/sound2.gif) | new voices 4'28.s3m | 2018-01-04 15:09 | 213K | |
![[SND]](/icons/sound2.gif) | nf-argh.s3m | 2018-01-04 15:09 | 11K | |
![[SND]](/icons/sound2.gif) | niagara-falls. gab!.s3m | 2018-01-04 15:09 | 106K | |
![[SND]](/icons/sound2.gif) | nick get that out of..> | 2018-01-04 15:09 | 113K | |
![[SND]](/icons/sound2.gif) | night cruiser (revis..> | 2018-01-04 15:09 | 172K | |
![[SND]](/icons/sound2.gif) | night dance - vassag..> | 2018-01-04 15:09 | 110K | |
![[SND]](/icons/sound2.gif) | nightfall euggie.s3m | 2018-01-04 15:09 | 386K | |
![[SND]](/icons/sound2.gif) | nightlife.s3m | 2018-01-04 15:09 | 101K | |
![[SND]](/icons/sound2.gif) | night march.s3m | 2018-01-04 15:09 | 171K | |
![[SND]](/icons/sound2.gif) | nightmare disco.s3m | 2018-01-04 15:09 | 99K | |
![[SND]](/icons/sound2.gif) | night sky.s3m | 2018-01-04 15:09 | 64K | |
![[SND]](/icons/sound2.gif) | nightvision - sandma..> | 2018-01-04 15:09 | 673K | |
![[SND]](/icons/sound2.gif) | niilo's raving!.s3m | 2018-01-04 15:09 | 296K | |
![[SND]](/icons/sound2.gif) | nin melody re-mix i.s3m | 2018-01-04 15:09 | 467K | |
![[SND]](/icons/sound2.gif) | nin melody re-mix i~..> | 2018-01-04 15:09 | 467K | |
![[SND]](/icons/sound2.gif) | nirvana syndrome.s3m | 2018-01-04 15:09 | 277K | |
![[SND]](/icons/sound2.gif) | nitro.s3m | 2018-01-04 15:09 | 165K | |
![[SND]](/icons/sound2.gif) | no access to buildin..> | 2018-01-04 15:09 | 147K | |
![[SND]](/icons/sound2.gif) | nobody-drift.s3m | 2018-01-04 15:09 | 225K | |
![[SND]](/icons/sound2.gif) | nobody cares.s3m | 2018-01-04 15:09 | 35K | |
![[SND]](/icons/sound2.gif) | no contest.s3m | 2018-01-04 15:09 | 122K | |
![[SND]](/icons/sound2.gif) | nodoz.s3m | 2018-01-04 15:09 | 55K | |
![[SND]](/icons/sound2.gif) | noel.s3m | 2018-01-04 15:09 | 38K | |
![[SND]](/icons/sound2.gif) | nofate.s3m | 2018-01-04 15:09 | 625K | |
![[SND]](/icons/sound2.gif) | nog-wine remix (1996..> | 2018-01-04 15:09 | 257K | |
![[SND]](/icons/sound2.gif) | no hatred -spk.s3m | 2018-01-04 15:09 | 216K | |
![[SND]](/icons/sound2.gif) | no more chances.s3m | 2018-01-04 15:09 | 182K | |
![[SND]](/icons/sound2.gif) | noname.s3m | 2018-01-04 15:09 | 52K | |
![[SND]](/icons/sound2.gif) | noname2.s3m | 2018-01-04 15:09 | 196K | |
![[SND]](/icons/sound2.gif) | noname4.s3m | 2018-01-04 15:09 | 130K | |
![[SND]](/icons/sound2.gif) | noname5.s3m | 2018-01-04 15:09 | 52K | |
![[SND]](/icons/sound2.gif) | noname6.s3m | 2018-01-04 15:09 | 220K | |
![[SND]](/icons/sound2.gif) | noname7.s3m | 2018-01-04 15:09 | 151K | |
![[SND]](/icons/sound2.gif) | nonstop rain.s3m | 2018-01-04 15:09 | 171K | |
![[SND]](/icons/sound2.gif) | noontime raindrops.s3m | 2018-01-04 15:09 | 249K | |
![[SND]](/icons/sound2.gif) | northface of the min..> | 2018-01-04 15:09 | 339K | |
![[SND]](/icons/sound2.gif) | north pole jungle.s3m | 2018-01-04 15:09 | 340K | |
![[SND]](/icons/sound2.gif) | no sound.s3m | 2018-01-04 15:09 | 3.4K | |
![[SND]](/icons/sound2.gif) | nostril journey.s3m | 2018-01-04 15:09 | 125K | |
![[SND]](/icons/sound2.gif) | not yet - strange fe..> | 2018-01-04 15:09 | 376K | |
![[SND]](/icons/sound2.gif) | nuclear party!.s3m | 2018-01-04 15:09 | 246K | |
![[SND]](/icons/sound2.gif) | oasis - legendforce^..> | 2018-01-04 15:09 | 482K | |
![[SND]](/icons/sound2.gif) | obsidian dream.s3m | 2018-01-04 15:09 | 45K | |
![[SND]](/icons/sound2.gif) | obsticularius.s3m | 2018-01-04 15:09 | 83K | |
![[SND]](/icons/sound2.gif) | ode to matt sheahan.s3m | 2018-01-04 15:09 | 780K | |
![[SND]](/icons/sound2.gif) | off topic..hip-hop i..> | 2018-01-04 15:09 | 445K | |
![[SND]](/icons/sound2.gif) | ojnk!.s3m | 2018-01-04 15:09 | 51K | |
![[SND]](/icons/sound2.gif) | ok.2.s3m | 2018-01-04 15:09 | 65K | |
![[SND]](/icons/sound2.gif) | ollaksemme rehellisi..> | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | once again i found.s3m | 2018-01-04 15:09 | 346K | |
![[SND]](/icons/sound2.gif) | one world.s3m | 2018-01-04 15:09 | 70K | |
![[SND]](/icons/sound2.gif) | only my dreams....s3m | 2018-01-04 15:09 | 62K | |
![[SND]](/icons/sound2.gif) | on the moon.s3m | 2018-01-04 15:09 | 390K | |
![[SND]](/icons/sound2.gif) | on your latin body i..> | 2018-01-04 15:09 | 192K | |
![[SND]](/icons/sound2.gif) | oriental by qwartbp.s3m | 2018-01-04 15:09 | 373K | |
![[SND]](/icons/sound2.gif) | our universe .. hect..> | 2018-01-04 15:09 | 451K | |
![[SND]](/icons/sound2.gif) | out again ....s3m | 2018-01-04 15:09 | 184K | |
![[SND]](/icons/sound2.gif) | out run.s3m | 2018-01-04 15:09 | 59K | |
![[SND]](/icons/sound2.gif) | outside.s3m | 2018-01-04 15:09 | 168K | |
![[SND]](/icons/sound2.gif) | outsider.s3m | 2018-01-04 15:09 | 457K | |
![[SND]](/icons/sound2.gif) | ouverture2.s3m | 2018-01-04 15:09 | 30K | |
![[SND]](/icons/sound2.gif) | oversoul.s3m | 2018-01-04 15:09 | 22K | |
![[SND]](/icons/sound2.gif) | overture.s3m | 2018-01-04 15:09 | 79K | |
![[SND]](/icons/sound2.gif) | oxygene-jmj-kreator.s3m | 2018-01-04 15:09 | 141K | |
![[SND]](/icons/sound2.gif) | oxymoron 2 (q-sound)..> | 2018-01-04 15:09 | 301K | |
![[SND]](/icons/sound2.gif) | p17.s3m | 2018-01-04 15:09 | 141K | |
![[SND]](/icons/sound2.gif) | painless.s3m | 2018-01-04 15:09 | 168K | |
![[SND]](/icons/sound2.gif) | pamel-brussel (by so..> | 2018-01-04 15:09 | 483K | |
![[SND]](/icons/sound2.gif) | pan's dance (dna-gro..> | 2018-01-04 15:09 | 148K | |
![[SND]](/icons/sound2.gif) | panic (1).s3m | 2018-01-04 15:09 | 99K | |
![[SND]](/icons/sound2.gif) | panic (2).s3m | 2018-01-04 15:09 | 676K | |
![[SND]](/icons/sound2.gif) | panic.s3m | 2018-01-04 15:09 | 579K | |
![[SND]](/icons/sound2.gif) | paradise.s3m | 2018-01-04 15:09 | 83K | |
![[SND]](/icons/sound2.gif) | paradox - karma rein..> | 2018-01-04 15:09 | 275K | |
![[SND]](/icons/sound2.gif) | paradoxial - k5 - an..> | 2018-01-04 15:09 | 311K | |
![[SND]](/icons/sound2.gif) | particle 99 [412].s3m | 2018-01-04 15:09 | 317K | |
![[SND]](/icons/sound2.gif) | past happiness.s3m | 2018-01-04 15:09 | 398K | |
![[SND]](/icons/sound2.gif) | patricia, i luv u 2 ..> | 2018-01-04 15:09 | 602K | |
![[SND]](/icons/sound2.gif) | paut-iik.s3m | 2018-01-04 15:09 | 6.5K | |
![[SND]](/icons/sound2.gif) | peace.s3m | 2018-01-04 15:09 | 70K | |
![[SND]](/icons/sound2.gif) | peace and friendship..> | 2018-01-04 15:09 | 225K | |
![[SND]](/icons/sound2.gif) | peace dna-groove.s3m | 2018-01-04 15:09 | 88K | |
![[SND]](/icons/sound2.gif) | peaceful journey 1.1..> | 2018-01-04 15:09 | 105K | |
![[SND]](/icons/sound2.gif) | peats.s3m | 2018-01-04 15:09 | 97K | |
![[SND]](/icons/sound2.gif) | pedophile.s3m | 2018-01-04 15:09 | 152K | |
![[SND]](/icons/sound2.gif) | pegasus.s3m | 2018-01-04 15:09 | 259K | |
![[SND]](/icons/sound2.gif) | pendant.s3m | 2018-01-04 15:09 | 85K | |
![[SND]](/icons/sound2.gif) | peony in bloom.s3m | 2018-01-04 15:09 | 393K | |
![[SND]](/icons/sound2.gif) | people over.s3m | 2018-01-04 15:09 | 348K | |
![[SND]](/icons/sound2.gif) | perfection {mobius}.s3m | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | phantom.s3m | 2018-01-04 15:09 | 197K | |
![[SND]](/icons/sound2.gif) | phantom of the opera..> | 2018-01-04 15:09 | 286K | |
![[SND]](/icons/sound2.gif) | phantom rulez tha la..> | 2018-01-04 15:09 | 604K | |
![[SND]](/icons/sound2.gif) | phreak's 4217-song.s3m | 2018-01-04 15:09 | 134K | |
![[SND]](/icons/sound2.gif) | phreakin'ðbtka.s3m | 2018-01-04 15:09 | 920K | |
![[SND]](/icons/sound2.gif) | phreaking hardcore -..> | 2018-01-04 15:09 | 438K | |
![[SND]](/icons/sound2.gif) | p i a n o.s3m | 2018-01-04 15:09 | 221K | |
![[SND]](/icons/sound2.gif) | piano angst.s3m | 2018-01-04 15:09 | 74K | |
![[SND]](/icons/sound2.gif) | piano twilight.s3m | 2018-01-04 15:09 | 192K | |
![[SND]](/icons/sound2.gif) | picard to the bridge..> | 2018-01-04 15:09 | 354K | |
![[SND]](/icons/sound2.gif) | pinball~1.s3m | 2018-01-04 15:09 | 152K | |
![[SND]](/icons/sound2.gif) | pink hr.s3m | 2018-01-04 15:09 | 67K | |
![[SND]](/icons/sound2.gif) | piski.s3m | 2018-01-04 15:09 | 20K | |
![[SND]](/icons/sound2.gif) | pizzaforte!.s3m | 2018-01-04 15:09 | 288K | |
![[SND]](/icons/sound2.gif) | pjn - hexadec.s3m | 2018-01-04 15:09 | 127K | |
![[SND]](/icons/sound2.gif) | plan9.s3m | 2018-01-04 15:09 | 78K | |
![[SND]](/icons/sound2.gif) | planet groove - mcfd..> | 2018-01-04 15:09 | 510K | |
![[SND]](/icons/sound2.gif) | planet on acid.eleme..> | 2018-01-04 15:09 | 373K | |
![[SND]](/icons/sound2.gif) | plano c - dr. saygon..> | 2018-01-04 15:09 | 304K | |
![[SND]](/icons/sound2.gif) | plasma.s3m | 2018-01-04 15:09 | 121K | |
![[SND]](/icons/sound2.gif) | plasmohia.s3m | 2018-01-04 15:09 | 74K | |
![[SND]](/icons/sound2.gif) | plateau 1 {mobius}.s3m | 2018-01-04 15:09 | 168K | |
![[SND]](/icons/sound2.gif) | plaz is a cheezeball..> | 2018-01-04 15:09 | 143K | |
![[SND]](/icons/sound2.gif) | point.s3m | 2018-01-04 15:09 | 195K | |
![[SND]](/icons/sound2.gif) | pointless feelings.s3m | 2018-01-04 15:09 | 256K | |
![[SND]](/icons/sound2.gif) | polly new wave.s3m | 2018-01-04 15:09 | 151K | |
![[SND]](/icons/sound2.gif) | poormouth.s3m | 2018-01-04 15:09 | 82K | |
![[SND]](/icons/sound2.gif) | popcorn remix.s3m | 2018-01-04 15:09 | 99K | |
![[SND]](/icons/sound2.gif) | portal to hell.s3m | 2018-01-04 15:09 | 168K | |
![[SND]](/icons/sound2.gif) | portobello road.s3m | 2018-01-04 15:09 | 221K | |
![[SND]](/icons/sound2.gif) | porus.s3m | 2018-01-04 15:09 | 131K | |
![[SND]](/icons/sound2.gif) | poskgubbe chippyy.. ..> | 2018-01-04 15:09 | 11K | |
![[SND]](/icons/sound2.gif) | postinkantaja, aamu ..> | 2018-01-04 15:09 | 142K | |
![[SND]](/icons/sound2.gif) | potensial distortion..> | 2018-01-04 15:09 | 209K | |
![[SND]](/icons/sound2.gif) | praise the lord of h..> | 2018-01-04 15:09 | 253K | |
![[SND]](/icons/sound2.gif) | preludi ala bach.s3m | 2018-01-04 15:09 | 24K | |
![[SND]](/icons/sound2.gif) | preview - reserved.s3m | 2018-01-04 15:09 | 108K | |
![[SND]](/icons/sound2.gif) | prime hades of pr.s3m | 2018-01-04 15:09 | 325K | |
![[SND]](/icons/sound2.gif) | prince ali.s3m | 2018-01-04 15:09 | 206K | |
![[SND]](/icons/sound2.gif) | pristine2.s3m | 2018-01-04 15:09 | 169K | |
![[SND]](/icons/sound2.gif) | profecy6.s3m | 2018-01-04 15:09 | 295K | |
![[SND]](/icons/sound2.gif) | progression.s3m | 2018-01-04 15:09 | 315K | |
![[SND]](/icons/sound2.gif) | proj99.s3m | 2018-01-04 15:09 | 288K | |
![[SND]](/icons/sound2.gif) | project icabod.s3m | 2018-01-04 15:09 | 235K | |
![[SND]](/icons/sound2.gif) | project v.s3m | 2018-01-04 15:09 | 148K | |
![[SND]](/icons/sound2.gif) | proton.s3m | 2018-01-04 15:09 | 70K | |
![[SND]](/icons/sound2.gif) | psicho.s3m | 2018-01-04 15:09 | 783K | |
![[SND]](/icons/sound2.gif) | psycho-pathetic runn..> | 2018-01-04 15:09 | 231K | |
![[SND]](/icons/sound2.gif) | psychodude.s3m | 2018-01-04 15:09 | 185K | |
![[SND]](/icons/sound2.gif) | psychopet's night ou..> | 2018-01-04 15:09 | 256K | |
![[SND]](/icons/sound2.gif) | psykedeelinen kives.s3m | 2018-01-04 15:09 | 4.7K | |
![[SND]](/icons/sound2.gif) | pull of the deep (mc..> | 2018-01-04 15:09 | 513K | |
![[SND]](/icons/sound2.gif) | punchline.s3m | 2018-01-04 15:09 | 89K | |
![[SND]](/icons/sound2.gif) | punchsmash.s3m | 2018-01-04 15:09 | 93K | |
![[SND]](/icons/sound2.gif) | pure levy.s3m | 2018-01-04 15:09 | 142K | |
![[SND]](/icons/sound2.gif) | purjo ja palsternakk..> | 2018-01-04 15:09 | 27K | |
![[SND]](/icons/sound2.gif) | q s h m s o t.s3m | 2018-01-04 15:09 | 153K | |
![[SND]](/icons/sound2.gif) | quality rulez.s3m | 2018-01-04 15:09 | 7.2K | |
![[SND]](/icons/sound2.gif) | quasar sol (bhm mix ..> | 2018-01-04 15:09 | 358K | |
![[SND]](/icons/sound2.gif) | r'n'r, the moderator..> | 2018-01-04 15:09 | 196K | |
![[SND]](/icons/sound2.gif) | radio.s3m | 2018-01-04 15:09 | 524K | |
![[SND]](/icons/sound2.gif) | radioactive.s3m | 2018-01-04 15:09 | 222K | |
![[SND]](/icons/sound2.gif) | rainbow islands.s3m | 2018-01-04 15:09 | 48K | |
![[SND]](/icons/sound2.gif) | raisu ukko -.s3m | 2018-01-04 15:09 | 105K | |
![[SND]](/icons/sound2.gif) | rally 4.s3m | 2018-01-04 15:09 | 97K | |
![[SND]](/icons/sound2.gif) | ramjam.s3m | 2018-01-04 15:09 | 57K | |
![[SND]](/icons/sound2.gif) | ranma 12.s3m | 2018-01-04 15:09 | 193K | |
![[SND]](/icons/sound2.gif) | rap1991coool.s3m | 2018-01-04 15:09 | 46K | |
![[SND]](/icons/sound2.gif) | ratman is alive 104.s3m | 2018-01-04 15:09 | 69K | |
![[SND]](/icons/sound2.gif) | raudebux classics el..> | 2018-01-04 15:09 | 402K | |
![[SND]](/icons/sound2.gif) | rave explotion (14-2..> | 2018-01-04 15:09 | 339K | |
![[SND]](/icons/sound2.gif) | raveotwd.s3m | 2018-01-04 15:09 | 281K | |
![[SND]](/icons/sound2.gif) | rav fx.s3m | 2018-01-04 15:09 | 254K | |
![[SND]](/icons/sound2.gif) | raz, dva, kazachok.s3m | 2018-01-04 15:09 | 378K | |
![[SND]](/icons/sound2.gif) | raze the stray.s3m | 2018-01-04 15:09 | 285K | |
![[SND]](/icons/sound2.gif) | razor-1911.s3m | 2018-01-04 15:09 | 72K | |
![[SND]](/icons/sound2.gif) | razors 3'15.s3m | 2018-01-04 15:09 | 193K | |
![[SND]](/icons/sound2.gif) | reach by styves.surr..> | 2018-01-04 15:09 | 510K | |
![[SND]](/icons/sound2.gif) | rebels.s3m | 2018-01-04 15:09 | 5.9K | |
![[SND]](/icons/sound2.gif) | rebels2.s3m | 2018-01-04 15:09 | 3.2K | |
![[SND]](/icons/sound2.gif) | red, green, blue.s3m | 2018-01-04 15:09 | 207K | |
![[SND]](/icons/sound2.gif) | red barchetta - ler9..> | 2018-01-04 15:09 | 444K | |
![[SND]](/icons/sound2.gif) | red fog.s3m | 2018-01-04 15:09 | 476K | |
![[SND]](/icons/sound2.gif) | reflex.s3m | 2018-01-04 15:09 | 312K | |
![[SND]](/icons/sound2.gif) | reggae.s3m | 2018-01-04 15:09 | 28K | |
![[SND]](/icons/sound2.gif) | reggae maxima!.s3m | 2018-01-04 15:09 | 137K | |
![[SND]](/icons/sound2.gif) | reksio vs.s3m | 2018-01-04 15:09 | 334K | |
![[SND]](/icons/sound2.gif) | relic for you 3'09.s3m | 2018-01-04 15:09 | 316K | |
![[SND]](/icons/sound2.gif) | relinquish.s3m | 2018-01-04 15:09 | 244K | |
![[SND]](/icons/sound2.gif) | remedy.s3m | 2018-01-04 15:09 | 178K | |
![[SND]](/icons/sound2.gif) | remember me - mev ta..> | 2018-01-04 15:09 | 96K | |
![[SND]](/icons/sound2.gif) | remix.s3m | 2018-01-04 15:09 | 226K | |
![[SND]](/icons/sound2.gif) | reprise - zinc.s3m | 2018-01-04 15:09 | 290K | |
![[SND]](/icons/sound2.gif) | resistance movement ..> | 2018-01-04 15:09 | 263K | |
![[SND]](/icons/sound2.gif) | rest in peace.s3m | 2018-01-04 15:09 | 96K | |
![[SND]](/icons/sound2.gif) | reunion! (to jay & t..> | 2018-01-04 15:09 | 810K | |
![[SND]](/icons/sound2.gif) | revelation][ iv004d..> | 2018-01-04 15:09 | 420K | |
![[SND]](/icons/sound2.gif) | revenge of the legos..> | 2018-01-04 15:09 | 161K | |
![[SND]](/icons/sound2.gif) | revive.s3m | 2018-01-04 15:09 | 135K | |
![[SND]](/icons/sound2.gif) | revolution 2 - maxtr..> | 2018-01-04 15:09 | 179K | |
![[SND]](/icons/sound2.gif) | revolution~1.s3m | 2018-01-04 15:09 | 82K | |
![[SND]](/icons/sound2.gif) | rhthms from the blue..> | 2018-01-04 15:09 | 419K | |
![[SND]](/icons/sound2.gif) | ride the lightning.s3m | 2018-01-04 15:09 | 295K | |
![[SND]](/icons/sound2.gif) | riding home (by sopc..> | 2018-01-04 15:09 | 92K | |
![[SND]](/icons/sound2.gif) | rim-xmas.s3m | 2018-01-04 15:09 | 8.7K | |
![[SND]](/icons/sound2.gif) | riot!.s3m | 2018-01-04 15:09 | 83K | |
![[SND]](/icons/sound2.gif) | rise - live - fall.s3m | 2018-01-04 15:09 | 187K | |
![[SND]](/icons/sound2.gif) | road.s3m | 2018-01-04 15:09 | 8.5K | |
![[SND]](/icons/sound2.gif) | rock'n'roll.s3m | 2018-01-04 15:09 | 37K | |
![[SND]](/icons/sound2.gif) | rock2.s3m | 2018-01-04 15:09 | 292K | |
![[SND]](/icons/sound2.gif) | rock fox.s3m | 2018-01-04 15:09 | 137K | |
![[SND]](/icons/sound2.gif) | rockroll.s3m | 2018-01-04 15:09 | 32K | |
![[SND]](/icons/sound2.gif) | round and round (xfc..> | 2018-01-04 15:09 | 41K | |
![[SND]](/icons/sound2.gif) | rrs 1st movement.s3m | 2018-01-04 15:09 | 197K | |
![[SND]](/icons/sound2.gif) | rrs the finale.s3m | 2018-01-04 15:09 | 258K | |
![[SND]](/icons/sound2.gif) | rubber room revisite..> | 2018-01-04 15:09 | 166K | |
![[SND]](/icons/sound2.gif) | rumbling silencedna-..> | 2018-01-04 15:09 | 269K | |
![[SND]](/icons/sound2.gif) | run like hell.s3m | 2018-01-04 15:09 | 69K | |
![[SND]](/icons/sound2.gif) | r u ready 4 this -=r..> | 2018-01-04 15:09 | 309K | |
![[SND]](/icons/sound2.gif) | rushing the day away..> | 2018-01-04 15:09 | 119K | |
![[SND]](/icons/sound2.gif) | russian bake sale.s3m | 2018-01-04 15:09 | 98K | |
![[SND]](/icons/sound2.gif) | ryorcangel by quincy..> | 2018-01-04 15:09 | 361K | |
![[SND]](/icons/sound2.gif) | saaste.s3m | 2018-01-04 15:09 | 326K | |
![[SND]](/icons/sound2.gif) | sadistic dentist.s3m | 2018-01-04 15:09 | 118K | |
![[SND]](/icons/sound2.gif) | sailor moon techno m..> | 2018-01-04 15:09 | 538K | |
![[SND]](/icons/sound2.gif) | sailor moon techno m..> | 2018-01-04 15:09 | 221K | |
![[SND]](/icons/sound2.gif) | sample this, dick!.s3m | 2018-01-04 15:09 | 116K | |
![[SND]](/icons/sound2.gif) | sanchez.s3m | 2018-01-04 15:09 | 236K | |
![[SND]](/icons/sound2.gif) | sand dance.s3m | 2018-01-04 15:09 | 72K | |
![[SND]](/icons/sound2.gif) | sandy's birthday con..> | 2018-01-04 15:09 | 62K | |
![[SND]](/icons/sound2.gif) | sanomalehti.s3m | 2018-01-04 15:09 | 19K | |
![[SND]](/icons/sound2.gif) | satans playground.s3m | 2018-01-04 15:09 | 334K | |
![[SND]](/icons/sound2.gif) | satanus.s3m | 2018-01-04 15:09 | 46K | |
![[SND]](/icons/sound2.gif) | satori.s3m | 2018-01-04 15:09 | 150K | |
![[SND]](/icons/sound2.gif) | saturn.s3m | 2018-01-04 15:09 | 149K | |
![[SND]](/icons/sound2.gif) | savannah.s3m | 2018-01-04 15:09 | 53K | |
![[SND]](/icons/sound2.gif) | saying goodbye.s3m | 2018-01-04 15:09 | 131K | |
![[SND]](/icons/sound2.gif) | saying goodbyes -spk..> | 2018-01-04 15:09 | 211K | |
![[SND]](/icons/sound2.gif) | say me good bye....s3m | 2018-01-04 15:09 | 35K | |
![[SND]](/icons/sound2.gif) | scream.s3m | 2018-01-04 15:09 | 688K | |
![[SND]](/icons/sound2.gif) | scream of hope.s3m | 2018-01-04 15:09 | 267K | |
![[SND]](/icons/sound2.gif) | scrunch - by underta..> | 2018-01-04 15:09 | 463K | |
![[SND]](/icons/sound2.gif) | sculpin.s3m | 2018-01-04 15:09 | 107K | |
![[SND]](/icons/sound2.gif) | sea-side.s3m | 2018-01-04 15:09 | 75K | |
![[SND]](/icons/sound2.gif) | sea of dreams.s3m | 2018-01-04 15:09 | 105K | |
![[SND]](/icons/sound2.gif) | searching for the da..> | 2018-01-04 15:09 | 129K | |
![[SND]](/icons/sound2.gif) | second short jam.s3m | 2018-01-04 15:09 | 84K | |
![[SND]](/icons/sound2.gif) | second sphere.s3m | 2018-01-04 15:09 | 139K | |
![[SND]](/icons/sound2.gif) | seeya gab!.s3m | 2018-01-04 15:09 | 48K | |
![[SND]](/icons/sound2.gif) | sensory nerves.s3m | 2018-01-04 15:09 | 130K | |
![[SND]](/icons/sound2.gif) | september funk - mcf..> | 2018-01-04 15:09 | 241K | |
![[SND]](/icons/sound2.gif) | serpent of the black..> | 2018-01-04 15:09 | 709K | |
![[SND]](/icons/sound2.gif) | sfakters!.s3m | 2018-01-04 15:09 | 239K | |
![[SND]](/icons/sound2.gif) | shades of night ii.s3m | 2018-01-04 15:09 | 292K | |
![[SND]](/icons/sound2.gif) | shadows.s3m | 2018-01-04 15:09 | 539K | |
![[SND]](/icons/sound2.gif) | shadows in darkness.s3m | 2018-01-04 15:09 | 187K | |
![[SND]](/icons/sound2.gif) | shangrila.s3m | 2018-01-04 15:09 | 86K | |
![[SND]](/icons/sound2.gif) | sheer nootz.s3m | 2018-01-04 15:09 | 59K | |
![[SND]](/icons/sound2.gif) | shine.s3m | 2018-01-04 15:09 | 201K | |
![[SND]](/icons/sound2.gif) | shit.s3m | 2018-01-04 15:09 | 17K | |
![[SND]](/icons/sound2.gif) | shock.s3m | 2018-01-04 15:09 | 312K | |
![[SND]](/icons/sound2.gif) | show me love [remix]..> | 2018-01-04 15:09 | 115K | |
![[SND]](/icons/sound2.gif) | shrot on market.s3m | 2018-01-04 15:09 | 193K | |
![[SND]](/icons/sound2.gif) | shwingalokate.s3m | 2018-01-04 15:09 | 165K | |
![[SND]](/icons/sound2.gif) | shyndou [525].s3m | 2018-01-04 15:09 | 363K | |
![[SND]](/icons/sound2.gif) | sidestep al la aahz.s3m | 2018-01-04 15:09 | 567K | |
![[SND]](/icons/sound2.gif) | sighs by telperion o..> | 2018-01-04 15:09 | 333K | |
![[SND]](/icons/sound2.gif) | sight for sore eyes.s3m | 2018-01-04 15:09 | 165K | |
![[SND]](/icons/sound2.gif) | signs of life.s3m | 2018-01-04 15:09 | 68K | |
![[SND]](/icons/sound2.gif) | silence.s3m | 2018-01-04 15:09 | 611K | |
![[SND]](/icons/sound2.gif) | silents.s3m | 2018-01-04 15:09 | 49K | |
![[SND]](/icons/sound2.gif) | silent tribute.s3m | 2018-01-04 15:09 | 138K | |
![[SND]](/icons/sound2.gif) | silicon sun by xfood..> | 2018-01-04 15:09 | 97K | |
![[SND]](/icons/sound2.gif) | silicon wraiths.s3m | 2018-01-04 15:09 | 465K | |
![[SND]](/icons/sound2.gif) | silky water.s3m | 2018-01-04 15:09 | 37K | |
![[SND]](/icons/sound2.gif) | silmaosasto silmasta..> | 2018-01-04 15:09 | 180K | |
![[SND]](/icons/sound2.gif) | silstar.energy-bl.s3m | 2018-01-04 15:09 | 66K | |
![[SND]](/icons/sound2.gif) | silver.s3m | 2018-01-04 15:09 | 115K | |
![[SND]](/icons/sound2.gif) | silver acid box (egg..> | 2018-01-04 15:09 | 274K | |
![[SND]](/icons/sound2.gif) | simon said simon - m..> | 2018-01-04 15:09 | 301K | |
![[SND]](/icons/sound2.gif) | sine wave )qvlc96(.s3m | 2018-01-04 15:09 | 410K | |
![[SND]](/icons/sound2.gif) | sinister sky.s3m | 2018-01-04 15:09 | 58K | |
![[SND]](/icons/sound2.gif) | sitrushedelm„.s3m | 2018-01-04 15:09 | 474K | |
![[SND]](/icons/sound2.gif) | six(hundred)six(ty)s..> | 2018-01-04 15:09 | 104K | |
![[SND]](/icons/sound2.gif) | sk-dunno.s3m | 2018-01-04 15:09 | 6.2K | |
![[SND]](/icons/sound2.gif) | sk-netrunner tracker..> | 2018-01-04 15:09 | 11K | |
![[SND]](/icons/sound2.gif) | skewed morality.s3m | 2018-01-04 15:09 | 144K | |
![[SND]](/icons/sound2.gif) | sky $kating------h...> | 2018-01-04 15:09 | 391K | |
![[SND]](/icons/sound2.gif) | sky dancers.s3m | 2018-01-04 15:09 | 146K | |
![[SND]](/icons/sound2.gif) | skyline movement.s3m | 2018-01-04 15:09 | 239K | |
![[SND]](/icons/sound2.gif) | slap me silly.s3m | 2018-01-04 15:09 | 286K | |
![[SND]](/icons/sound2.gif) | sleeping baby.s3m | 2018-01-04 15:09 | 331K | |
![[SND]](/icons/sound2.gif) | slideshow.s3m | 2018-01-04 15:09 | 86K | |
![[SND]](/icons/sound2.gif) | slightly wounded.s3m | 2018-01-04 15:09 | 91K | |
![[SND]](/icons/sound2.gif) | slowly duke.s3m | 2018-01-04 15:09 | 58K | |
![[SND]](/icons/sound2.gif) | slow speed.s3m | 2018-01-04 15:09 | 30K | |
![[SND]](/icons/sound2.gif) | smile!.s3m | 2018-01-04 15:09 | 286K | |
![[SND]](/icons/sound2.gif) | smiling guitar assau..> | 2018-01-04 15:09 | 220K | |
![[SND]](/icons/sound2.gif) | smoke.s3m | 2018-01-04 15:09 | 357K | |
![[SND]](/icons/sound2.gif) | smoke [remixed by dk..> | 2018-01-04 15:09 | 121K | |
![[SND]](/icons/sound2.gif) | smukke bent - mcfdg.s3m | 2018-01-04 15:09 | 145K | |
![[SND]](/icons/sound2.gif) | sob stuf.s3m | 2018-01-04 15:09 | 263K | |
![[SND]](/icons/sound2.gif) | soft machine.s3m | 2018-01-04 15:09 | 70K | |
![[SND]](/icons/sound2.gif) | solar flare.s3m | 2018-01-04 15:09 | 197K | |
![[SND]](/icons/sound2.gif) | solar flare v2.0.s3m | 2018-01-04 15:09 | 113K | |
![[SND]](/icons/sound2.gif) | solarwars - introtun..> | 2018-01-04 15:09 | 60K | |
![[SND]](/icons/sound2.gif) | solonglowsong.tr.s3m | 2018-01-04 15:09 | 43K | |
![[SND]](/icons/sound2.gif) | somebody to shove - ..> | 2018-01-04 15:09 | 123K | |
![[SND]](/icons/sound2.gif) | someday....s3m | 2018-01-04 15:09 | 157K | |
![[SND]](/icons/sound2.gif) | sometimes -darkwolf ..> | 2018-01-04 15:09 | 556K | |
![[SND]](/icons/sound2.gif) | somewhere.s3m | 2018-01-04 15:09 | 23K | |
![[SND]](/icons/sound2.gif) | somuchstatic.s3m | 2018-01-04 15:09 | 145K | |
![[SND]](/icons/sound2.gif) | sonata v in c-major.s3m | 2018-01-04 15:09 | 18K | |
![[SND]](/icons/sound2.gif) | song1.s3m | 2018-01-04 15:09 | 54K | |
![[SND]](/icons/sound2.gif) | song3.s3m | 2018-01-04 15:09 | 170K | |
![[SND]](/icons/sound2.gif) | song4.s3m | 2018-01-04 15:09 | 143K | |
![[SND]](/icons/sound2.gif) | song6.s3m | 2018-01-04 15:09 | 45K | |
![[SND]](/icons/sound2.gif) | song7.s3m | 2018-01-04 15:09 | 107K | |
![[SND]](/icons/sound2.gif) | song13.s3m | 2018-01-04 15:09 | 60K | |
![[SND]](/icons/sound2.gif) | sonic -.s3m | 2018-01-04 15:09 | 274K | |
![[SND]](/icons/sound2.gif) | sonic.s3m | 2018-01-04 15:09 | 65K | |
![[SND]](/icons/sound2.gif) | sonic dreams.s3m | 2018-01-04 15:09 | 60K | |
![[SND]](/icons/sound2.gif) | sonic phantasm.s3m | 2018-01-04 15:09 | 357K | |
![[SND]](/icons/sound2.gif) | sonni.s3m | 2018-01-04 15:09 | 551K | |
![[SND]](/icons/sound2.gif) | sounds.s3m | 2018-01-04 15:09 | 87K | |
![[SND]](/icons/sound2.gif) | soundtrack.s3m | 2018-01-04 15:09 | 417K | |
![[SND]](/icons/sound2.gif) | space-dance2 by socr..> | 2018-01-04 15:09 | 98K | |
![[SND]](/icons/sound2.gif) | space-fly.s3m | 2018-01-04 15:09 | 143K | |
![[SND]](/icons/sound2.gif) | spacechild.s3m | 2018-01-04 15:09 | 650K | |
![[SND]](/icons/sound2.gif) | space crusade.s3m | 2018-01-04 15:09 | 275K | |
![[SND]](/icons/sound2.gif) | spaced out maaan ¨..> | 2018-01-04 15:09 | 90K | |
![[SND]](/icons/sound2.gif) | space madness.s3m | 2018-01-04 15:09 | 421K | |
![[SND]](/icons/sound2.gif) | spaceport one-final.s3m | 2018-01-04 15:09 | 57K | |
![[SND]](/icons/sound2.gif) | space tang (alpha mi..> | 2018-01-04 15:09 | 484K | |
![[SND]](/icons/sound2.gif) | space techno by qmp.s3m | 2018-01-04 15:09 | 43K | |
![[SND]](/icons/sound2.gif) | spacewalk.s3m | 2018-01-04 15:09 | 257K | |
![[SND]](/icons/sound2.gif) | spasm '95.s3m | 2018-01-04 15:09 | 960K | |
![[SND]](/icons/sound2.gif) | spectro euggie.s3m | 2018-01-04 15:09 | 144K | |
![[SND]](/icons/sound2.gif) | speed is good.s3m | 2018-01-04 15:09 | 408K | |
![[SND]](/icons/sound2.gif) | speed up.s3m | 2018-01-04 15:09 | 383K | |
![[SND]](/icons/sound2.gif) | spin cycle bubblegum..> | 2018-01-04 15:09 | 87K | |
![[SND]](/icons/sound2.gif) | spirits talking -nex..> | 2018-01-04 15:09 | 430K | |
![[SND]](/icons/sound2.gif) | spomienka na spse zo..> | 2018-01-04 15:09 | 281K | |
![[SND]](/icons/sound2.gif) | spoonerism - ccw!.s3m | 2018-01-04 15:09 | 120K | |
![[SND]](/icons/sound2.gif) | square trance.s3m | 2018-01-04 15:09 | 299K | |
![[SND]](/icons/sound2.gif) | stain.s3m | 2018-01-04 15:09 | 89K | |
![[SND]](/icons/sound2.gif) | star lamer.s3m | 2018-01-04 15:09 | 93K | |
![[SND]](/icons/sound2.gif) | star of darkness - s..> | 2018-01-04 15:09 | 388K | |
![[SND]](/icons/sound2.gif) | steady ground.s3m | 2018-01-04 15:09 | 67K | |
![[SND]](/icons/sound2.gif) | stepback.s3m | 2018-01-04 15:09 | 380K | |
![[SND]](/icons/sound2.gif) | stop drinking.s3m | 2018-01-04 15:09 | 54K | |
![[SND]](/icons/sound2.gif) | storm front.s3m | 2018-01-04 15:09 | 131K | |
![[SND]](/icons/sound2.gif) | str.eet.tran.ce.s3m | 2018-01-04 15:09 | 388K | |
![[SND]](/icons/sound2.gif) | straight trippin'.s3m | 2018-01-04 15:09 | 425K | |
![[SND]](/icons/sound2.gif) | strange city.s3m | 2018-01-04 15:09 | 126K | |
![[SND]](/icons/sound2.gif) | strange ii.s3m | 2018-01-04 15:09 | 269K | |
![[SND]](/icons/sound2.gif) | stratus.s3m | 2018-01-04 15:09 | 86K | |
![[SND]](/icons/sound2.gif) | stream flight.s3m | 2018-01-04 15:09 | 21K | |
![[SND]](/icons/sound2.gif) | street1.s3m | 2018-01-04 15:09 | 21K | |
![[SND]](/icons/sound2.gif) | street2.s3m | 2018-01-04 15:09 | 33K | |
![[SND]](/icons/sound2.gif) | string remix.s3m | 2018-01-04 15:09 | 70K | |
![[SND]](/icons/sound2.gif) | striped white line..s3m | 2018-01-04 15:09 | 127K | |
![[SND]](/icons/sound2.gif) | strollin' da city - ..> | 2018-01-04 15:09 | 265K | |
![[SND]](/icons/sound2.gif) | strumbling.s3m | 2018-01-04 15:09 | 319K | |
![[SND]](/icons/sound2.gif) | studio machine.s3m | 2018-01-04 15:09 | 265K | |
![[SND]](/icons/sound2.gif) | stun-runner.s3m | 2018-01-04 15:09 | 148K | |
![[SND]](/icons/sound2.gif) | subcontrol.s3m | 2018-01-04 15:09 | 143K | |
![[SND]](/icons/sound2.gif) | suber mario.s3m | 2018-01-04 15:09 | 15K | |
![[SND]](/icons/sound2.gif) | substance.s3m | 2018-01-04 15:09 | 391K | |
![[SND]](/icons/sound2.gif) | succes4.s3m | 2018-01-04 15:09 | 186K | |
![[SND]](/icons/sound2.gif) | suger.s3m | 2018-01-04 15:09 | 78K | |
![[SND]](/icons/sound2.gif) | sukkaimuri.s3m | 2018-01-04 15:09 | 172K | |
![[SND]](/icons/sound2.gif) | summer 97 by muscle.s3m | 2018-01-04 15:09 | 230K | |
![[SND]](/icons/sound2.gif) | summer`s exclain mf..> | 2018-01-04 15:09 | 174K | |
![[SND]](/icons/sound2.gif) | summer of '69.s3m | 2018-01-04 15:09 | 151K | |
![[SND]](/icons/sound2.gif) | sun (remix).s3m | 2018-01-04 15:09 | 257K | |
![[SND]](/icons/sound2.gif) | sun dreams.s3m | 2018-01-04 15:09 | 149K | |
![[SND]](/icons/sound2.gif) | sunny day.s3m | 2018-01-04 15:09 | 141K | |
![[SND]](/icons/sound2.gif) | supermobius {mobius}..> | 2018-01-04 15:09 | 390K | |
![[SND]](/icons/sound2.gif) | supersoft circle ely..> | 2018-01-04 15:09 | 866K | |
![[SND]](/icons/sound2.gif) | susi does it worse.s3m | 2018-01-04 15:09 | 245K | |
![[SND]](/icons/sound2.gif) | sweet dreams.s3m | 2018-01-04 15:09 | 574K | |
![[SND]](/icons/sound2.gif) | switchblade - title.s3m | 2018-01-04 15:09 | 393K | |
![[SND]](/icons/sound2.gif) | sycos.s3m | 2018-01-04 15:09 | 50K | |
![[SND]](/icons/sound2.gif) | sygma.s3m | 2018-01-04 15:09 | 67K | |
![[SND]](/icons/sound2.gif) | symbiosis.s3m | 2018-01-04 15:09 | 52K | |
![[SND]](/icons/sound2.gif) | symphony for disc-st..> | 2018-01-04 15:09 | 545K | |
![[SND]](/icons/sound2.gif) | t-mies kari3117.s3m | 2018-01-04 15:09 | 67K | |
![[SND]](/icons/sound2.gif) | t.r.t - the profile.s3m | 2018-01-04 15:09 | 356K | |
![[SND]](/icons/sound2.gif) | take a deep breath.s3m | 2018-01-04 15:09 | 248K | |
![[SND]](/icons/sound2.gif) | take my music.s3m | 2018-01-04 15:09 | 144K | |
![[SND]](/icons/sound2.gif) | tap demo theme 1.s3m | 2018-01-04 15:09 | 274K | |
![[SND]](/icons/sound2.gif) | tarzan mamma mia.s3m | 2018-01-04 15:09 | 72K | |
![[SND]](/icons/sound2.gif) | taurus.s3m | 2018-01-04 15:09 | 87K | |
![[SND]](/icons/sound2.gif) | tech.s3m | 2018-01-04 15:09 | 8.9K | |
![[SND]](/icons/sound2.gif) | techal.s3m | 2018-01-04 15:09 | 98K | |
![[SND]](/icons/sound2.gif) | technik.s3m | 2018-01-04 15:09 | 116K | |
![[SND]](/icons/sound2.gif) | techno-fright-theme.s3m | 2018-01-04 15:09 | 140K | |
![[SND]](/icons/sound2.gif) | techno-man.s3m | 2018-01-04 15:09 | 242K | |
![[SND]](/icons/sound2.gif) | techno is in the air..> | 2018-01-04 15:09 | 369K | |
![[SND]](/icons/sound2.gif) | technomania.s3m | 2018-01-04 15:09 | 82K | |
![[SND]](/icons/sound2.gif) | technomusic.s3m | 2018-01-04 15:09 | 148K | |
![[SND]](/icons/sound2.gif) | techno premier.s3m | 2018-01-04 15:09 | 159K | |
![[SND]](/icons/sound2.gif) | techno rave lxxxiii.s3m | 2018-01-04 15:09 | 525K | |
![[SND]](/icons/sound2.gif) | technostyle 2 remix.s3m | 2018-01-04 15:09 | 78K | |
![[SND]](/icons/sound2.gif) | technoworld.s3m | 2018-01-04 15:09 | 713K | |
![[SND]](/icons/sound2.gif) | tek-digi.s3m | 2018-01-04 15:09 | 184K | |
![[SND]](/icons/sound2.gif) | telephonic soulsap.s3m | 2018-01-04 15:09 | 630K | |
![[SND]](/icons/sound2.gif) | temple of sword.s3m | 2018-01-04 15:09 | 508K | |
![[SND]](/icons/sound2.gif) | temptation from blac..> | 2018-01-04 15:09 | 507K | |
![[SND]](/icons/sound2.gif) | ten years after.s3m | 2018-01-04 15:09 | 248K | |
![[SND]](/icons/sound2.gif) | tequila worm.s3m | 2018-01-04 15:09 | 138K | |
![[SND]](/icons/sound2.gif) | terminally ill.s3m | 2018-01-04 15:09 | 170K | |
![[SND]](/icons/sound2.gif) | terminator 2 theme.s3m | 2018-01-04 15:09 | 101K | |
![[SND]](/icons/sound2.gif) | terrpic.s3m | 2018-01-04 15:09 | 53K | |
![[SND]](/icons/sound2.gif) | test4.s3m | 2018-01-04 15:09 | 380K | |
![[SND]](/icons/sound2.gif) | test tube dna-groov..> | 2018-01-04 15:09 | 234K | |
![[SND]](/icons/sound2.gif) | tet.s3m | 2018-01-04 15:09 | 88K | |
![[SND]](/icons/sound2.gif) | thî sž¥dz oÿ tim..> | 2018-01-04 15:09 | 373K | |
![[SND]](/icons/sound2.gif) | tha party mix - deid..> | 2018-01-04 15:09 | 540K | |
![[SND]](/icons/sound2.gif) | the.lone.ranger.s3m | 2018-01-04 15:09 | 105K | |
![[SND]](/icons/sound2.gif) | the alunis project [..> | 2018-01-04 15:09 | 372K | |
![[SND]](/icons/sound2.gif) | the amalgamation.s3m | 2018-01-04 15:09 | 160K | |
![[SND]](/icons/sound2.gif) | the assasin.s3m | 2018-01-04 15:09 | 129K | |
![[SND]](/icons/sound2.gif) | the avatar.s3m | 2018-01-04 15:09 | 260K | |
![[SND]](/icons/sound2.gif) | the ballad of zombie..> | 2018-01-04 15:09 | 492K | |
![[SND]](/icons/sound2.gif) | the beat of tranquil..> | 2018-01-04 15:09 | 176K | |
![[SND]](/icons/sound2.gif) | thebeat v1.1 by hell..> | 2018-01-04 15:09 | 52K | |
![[SND]](/icons/sound2.gif) | the birdcage 3'54.s3m | 2018-01-04 15:09 | 300K | |
![[SND]](/icons/sound2.gif) | the boingy song.s3m | 2018-01-04 15:09 | 23K | |
![[SND]](/icons/sound2.gif) | the call of ktulu.s3m | 2018-01-04 15:09 | 185K | |
![[SND]](/icons/sound2.gif) | the cobwebs upstairs..> | 2018-01-04 15:09 | 348K | |
![[SND]](/icons/sound2.gif) | the dancing chip ..> | 2018-01-04 15:09 | 15K | |
![[SND]](/icons/sound2.gif) | the darkest night.s3m | 2018-01-04 15:09 | 238K | |
![[SND]](/icons/sound2.gif) | the deads.s3m | 2018-01-04 15:09 | 357K | |
![[SND]](/icons/sound2.gif) | the death - war conc..> | 2018-01-04 15:09 | 287K | |
![[SND]](/icons/sound2.gif) | the departure.s3m | 2018-01-04 15:09 | 258K | |
![[SND]](/icons/sound2.gif) | the derelicts.s3m | 2018-01-04 15:09 | 93K | |
![[SND]](/icons/sound2.gif) | the devil's dance!.s3m | 2018-01-04 15:09 | 314K | |
![[SND]](/icons/sound2.gif) | the doors.s3m | 2018-01-04 15:09 | 114K | |
![[SND]](/icons/sound2.gif) | the dream ....s3m | 2018-01-04 15:09 | 152K | |
![[SND]](/icons/sound2.gif) | the edge of eternity..> | 2018-01-04 15:09 | 115K | |
![[SND]](/icons/sound2.gif) | the end (1).s3m | 2018-01-04 15:09 | 199K | |
![[SND]](/icons/sound2.gif) | the end.s3m | 2018-01-04 15:09 | 76K | |
![[SND]](/icons/sound2.gif) | the end of tommorow...> | 2018-01-04 15:09 | 130K | |
![[SND]](/icons/sound2.gif) | the entity.s3m | 2018-01-04 15:09 | 290K | |
![[SND]](/icons/sound2.gif) | the eternal halls.s3m | 2018-01-04 15:09 | 164K | |
![[SND]](/icons/sound2.gif) | theevilforces.s3m | 2018-01-04 15:09 | 171K | |
![[SND]](/icons/sound2.gif) | the exiting monopoly..> | 2018-01-04 15:09 | 176K | |
![[SND]](/icons/sound2.gif) | the fight for surviv..> | 2018-01-04 15:09 | 316K | |
![[SND]](/icons/sound2.gif) | the final battle.s3m | 2018-01-04 15:09 | 212K | |
![[SND]](/icons/sound2.gif) | the final countdown.s3m | 2018-01-04 15:09 | 116K | |
![[SND]](/icons/sound2.gif) | the first.s3m | 2018-01-04 15:09 | 170K | |
![[SND]](/icons/sound2.gif) | the forgotten civiza..> | 2018-01-04 15:09 | 242K | |
![[SND]](/icons/sound2.gif) | the four housefrauen..> | 2018-01-04 15:09 | 340K | |
![[SND]](/icons/sound2.gif) | the funky schizo.s3m | 2018-01-04 15:09 | 111K | |
![[SND]](/icons/sound2.gif) | the game.s3m | 2018-01-04 15:09 | 214K | |
![[SND]](/icons/sound2.gif) | the good wallpaper d..> | 2018-01-04 15:09 | 194K | |
![[SND]](/icons/sound2.gif) | the goonies ii.s3m | 2018-01-04 15:09 | 25K | |
![[SND]](/icons/sound2.gif) | the great giana sist..> | 2018-01-04 15:09 | 164K | |
![[SND]](/icons/sound2.gif) | the great heavy meta..> | 2018-01-04 15:09 | 259K | |
![[SND]](/icons/sound2.gif) | the guardian. aidg i..> | 2018-01-04 15:09 | 44K | |
![[SND]](/icons/sound2.gif) | the guardian. mbs in..> | 2018-01-04 15:09 | 39K | |
![[SND]](/icons/sound2.gif) | the house of the ris..> | 2018-01-04 15:09 | 121K | |
![[SND]](/icons/sound2.gif) | the hunt.s3m | 2018-01-04 15:09 | 131K | |
![[SND]](/icons/sound2.gif) | the hunt ..> | 2018-01-04 15:09 | 246K | |
![[SND]](/icons/sound2.gif) | the immortal.s3m | 2018-01-04 15:09 | 311K | |
![[SND]](/icons/sound2.gif) | the journey.s3m | 2018-01-04 15:09 | 205K | |
![[SND]](/icons/sound2.gif) | the jungle of death.s3m | 2018-01-04 15:09 | 294K | |
![[SND]](/icons/sound2.gif) | the last crusade.s3m | 2018-01-04 15:09 | 51K | |
![[SND]](/icons/sound2.gif) | the last sunset.s3m | 2018-01-04 15:09 | 134K | |
![[SND]](/icons/sound2.gif) | the light of the nig..> | 2018-01-04 15:09 | 512K | |
![[SND]](/icons/sound2.gif) | the little drummer b..> | 2018-01-04 15:09 | 119K | |
![[SND]](/icons/sound2.gif) | the marines.s3m | 2018-01-04 15:09 | 247K | |
![[SND]](/icons/sound2.gif) | theme from fort boya..> | 2018-01-04 15:09 | 215K | |
![[SND]](/icons/sound2.gif) | the model.s3m | 2018-01-04 15:09 | 68K | |
![[SND]](/icons/sound2.gif) | the movement (4chn).s3m | 2018-01-04 15:09 | 144K | |
![[SND]](/icons/sound2.gif) | the one word story..s3m | 2018-01-04 15:09 | 553K | |
![[SND]](/icons/sound2.gif) | the passage of time ..> | 2018-01-04 15:09 | 528K | |
![[SND]](/icons/sound2.gif) | the passion of hate!..> | 2018-01-04 15:09 | 247K | |
![[SND]](/icons/sound2.gif) | the path i take.s3m | 2018-01-04 15:09 | 226K | |
![[SND]](/icons/sound2.gif) | the power of hard be..> | 2018-01-04 15:09 | 280K | |
![[SND]](/icons/sound2.gif) | the proxima mission.s3m | 2018-01-04 15:09 | 302K | |
![[SND]](/icons/sound2.gif) | the push.s3m | 2018-01-04 15:09 | 161K | |
![[SND]](/icons/sound2.gif) | the quite night.s3m | 2018-01-04 15:09 | 310K | |
![[SND]](/icons/sound2.gif) | the return of the br..> | 2018-01-04 15:09 | 368K | |
![[SND]](/icons/sound2.gif) | the return of yeti.s3m | 2018-01-04 15:09 | 138K | |
![[SND]](/icons/sound2.gif) | the rhythm of music.s3m | 2018-01-04 15:09 | 100K | |
![[SND]](/icons/sound2.gif) | the second dream.s3m | 2018-01-04 15:09 | 111K | |
![[SND]](/icons/sound2.gif) | the shallow, the dee..> | 2018-01-04 15:09 | 163K | |
![[SND]](/icons/sound2.gif) | the silent foes.s3m | 2018-01-04 15:09 | 188K | |
![[SND]](/icons/sound2.gif) | the simpsons theme.s3m | 2018-01-04 15:09 | 347K | |
![[SND]](/icons/sound2.gif) | the song.s3m | 2018-01-04 15:09 | 218K | |
![[SND]](/icons/sound2.gif) | the songtitle for a ..> | 2018-01-04 15:09 | 299K | |
![[SND]](/icons/sound2.gif) | the sound of progres..> | 2018-01-04 15:09 | 125K | |
![[SND]](/icons/sound2.gif) | the tale of infinity..> | 2018-01-04 15:09 | 329K | |
![[SND]](/icons/sound2.gif) | the tension - voider..> | 2018-01-04 15:09 | 230K | |
![[SND]](/icons/sound2.gif) | the thang called but..> | 2018-01-04 15:09 | 321K | |
![[SND]](/icons/sound2.gif) | the timeswitch.s3m | 2018-01-04 15:09 | 315K | |
![[SND]](/icons/sound2.gif) | the tired song.s3m | 2018-01-04 15:09 | 128K | |
![[SND]](/icons/sound2.gif) | the truth of the min..> | 2018-01-04 15:09 | 261K | |
![[SND]](/icons/sound2.gif) | the ultimate maxmixx..> | 2018-01-04 15:09 | 338K | |
![[SND]](/icons/sound2.gif) | the universal ones.s3m | 2018-01-04 15:09 | 132K | |
![[SND]](/icons/sound2.gif) | the void.s3m | 2018-01-04 15:09 | 529K | |
![[SND]](/icons/sound2.gif) | the way acid goes el..> | 2018-01-04 15:09 | 341K | |
![[SND]](/icons/sound2.gif) | the white wolf of me..> | 2018-01-04 15:09 | 122K | |
![[SND]](/icons/sound2.gif) | the wiggler.s3m | 2018-01-04 15:09 | 361K | |
![[SND]](/icons/sound2.gif) | the wolfden.s3m | 2018-01-04 15:09 | 263K | |
![[SND]](/icons/sound2.gif) | they're watchin' me!..> | 2018-01-04 15:09 | 278K | |
![[SND]](/icons/sound2.gif) | things.s3m | 2018-01-04 15:09 | 211K | |
![[SND]](/icons/sound2.gif) | things i don't think..> | 2018-01-04 15:09 | 288K | |
![[SND]](/icons/sound2.gif) | thinking by the beac..> | 2018-01-04 15:09 | 141K | |
![[SND]](/icons/sound2.gif) | this e's for me.s3m | 2018-01-04 15:09 | 355K | |
![[SND]](/icons/sound2.gif) | this end up!.s3m | 2018-01-04 15:09 | 61K | |
![[SND]](/icons/sound2.gif) | this is for you (rem..> | 2018-01-04 15:09 | 268K | |
![[SND]](/icons/sound2.gif) | this little melodee.s3m | 2018-01-04 15:09 | 93K | |
![[SND]](/icons/sound2.gif) | this was the dream.s3m | 2018-01-04 15:09 | 102K | |
![[SND]](/icons/sound2.gif) | this will be.s3m | 2018-01-04 15:09 | 100K | |
![[SND]](/icons/sound2.gif) | thoughts and aspirat..> | 2018-01-04 15:09 | 164K | |
![[SND]](/icons/sound2.gif) | three days.s3m | 2018-01-04 15:09 | 56K | |
![[SND]](/icons/sound2.gif) | three in one.s3m | 2018-01-04 15:09 | 315K | |
![[SND]](/icons/sound2.gif) | through dark woods.s3m | 2018-01-04 15:09 | 107K | |
![[SND]](/icons/sound2.gif) | thunderbull ii inw r..> | 2018-01-04 15:09 | 422K | |
![[SND]](/icons/sound2.gif) | thunder clowns.s3m | 2018-01-04 15:09 | 236K | |
![[SND]](/icons/sound2.gif) | tighter motion.s3m | 2018-01-04 15:09 | 216K | |
![[SND]](/icons/sound2.gif) | tiku ja taku viidako..> | 2018-01-04 15:09 | 420K | |
![[SND]](/icons/sound2.gif) | til death do us part..> | 2018-01-04 15:09 | 174K | |
![[SND]](/icons/sound2.gif) | time's up!.s3m | 2018-01-04 15:09 | 47K | |
![[SND]](/icons/sound2.gif) | time expires.s3m | 2018-01-04 15:09 | 920K | |
![[SND]](/icons/sound2.gif) | timeless lulabye.s3m | 2018-01-04 15:09 | 409K | |
![[SND]](/icons/sound2.gif) | timeout.s3m | 2018-01-04 15:09 | 302K | |
![[SND]](/icons/sound2.gif) | time slips by....s3m | 2018-01-04 15:09 | 374K | |
![[SND]](/icons/sound2.gif) | time tells its tale.s3m | 2018-01-04 15:09 | 199K | |
![[SND]](/icons/sound2.gif) | titanium cranium.s3m | 2018-01-04 15:09 | 421K | |
![[SND]](/icons/sound2.gif) | titelsound.s3m | 2018-01-04 15:09 | 62K | |
![[SND]](/icons/sound2.gif) | title.s3m | 2018-01-04 15:09 | 344K | |
![[SND]](/icons/sound2.gif) | tk-boat music ii.s3m | 2018-01-04 15:09 | 212K | |
![[SND]](/icons/sound2.gif) | tmu fl.s3m | 2018-01-04 15:09 | 134K | |
![[SND]](/icons/sound2.gif) | to all awesome peopl..> | 2018-01-04 15:09 | 258K | |
![[SND]](/icons/sound2.gif) | toga!.s3m | 2018-01-04 15:09 | 304K | |
![[SND]](/icons/sound2.gif) | toivon henki.s3m | 2018-01-04 15:09 | 530K | |
![[SND]](/icons/sound2.gif) | to je ale votravny, ..> | 2018-01-04 15:09 | 151K | |
![[SND]](/icons/sound2.gif) | tollo-mikan tolloilu..> | 2018-01-04 15:09 | 823K | |
![[SND]](/icons/sound2.gif) | tom sawyer - ler95.s3m | 2018-01-04 15:09 | 357K | |
![[SND]](/icons/sound2.gif) | tom wilson.s3m | 2018-01-04 15:09 | 275K | |
![[SND]](/icons/sound2.gif) | to see you fading.s3m | 2018-01-04 15:09 | 622K | |
![[SND]](/icons/sound2.gif) | total quartet.s3m | 2018-01-04 15:09 | 207K | |
![[SND]](/icons/sound2.gif) | towards the clarity.s3m | 2018-01-04 15:09 | 163K | |
![[SND]](/icons/sound2.gif) | trackers.s3m | 2018-01-04 15:09 | 69K | |
![[SND]](/icons/sound2.gif) | tragic march.s3m | 2018-01-04 15:09 | 92K | |
![[SND]](/icons/sound2.gif) | trakfix'96 template ..> | 2018-01-04 15:09 | 4.7K | |
![[SND]](/icons/sound2.gif) | trakfix'96 template ..> | 2018-01-04 15:09 | 5.0K | |
![[SND]](/icons/sound2.gif) | trance-o-mania yearm..> | 2018-01-04 15:09 | 597K | |
![[SND]](/icons/sound2.gif) | trancealarm.s3m | 2018-01-04 15:09 | 362K | |
![[SND]](/icons/sound2.gif) | trance nation - nexu..> | 2018-01-04 15:09 | 255K | |
![[SND]](/icons/sound2.gif) | transmission assimil..> | 2018-01-04 15:09 | 445K | |
![[SND]](/icons/sound2.gif) | trashgay(tm) by tz.s3m | 2018-01-04 15:09 | 133K | |
![[SND]](/icons/sound2.gif) | traum der wirklichke..> | 2018-01-04 15:09 | 207K | |
![[SND]](/icons/sound2.gif) | treat.s3m | 2018-01-04 15:09 | 605K | |
![[SND]](/icons/sound2.gif) | trees.s3m | 2018-01-04 15:09 | 175K | |
![[SND]](/icons/sound2.gif) | trennc2.s3m | 2018-01-04 15:09 | 77K | |
![[SND]](/icons/sound2.gif) | trip to dream's.s3m | 2018-01-04 15:09 | 185K | |
![[SND]](/icons/sound2.gif) | trouble.s3m | 2018-01-04 15:09 | 99K | |
![[SND]](/icons/sound2.gif) | troublesome.s3m | 2018-01-04 15:09 | 133K | |
![[SND]](/icons/sound2.gif) | trymf.s3m | 2018-01-04 15:09 | 103K | |
![[SND]](/icons/sound2.gif) | tuli vaha' leikittyy..> | 2018-01-04 15:09 | 42K | |
![[SND]](/icons/sound2.gif) | tuntemattoman tunnar..> | 2018-01-04 15:09 | 196K | |
![[SND]](/icons/sound2.gif) | turbid-tumour.s3m | 2018-01-04 15:09 | 40K | |
![[SND]](/icons/sound2.gif) | turbospeed.s3m | 2018-01-04 15:09 | 25K | |
![[SND]](/icons/sound2.gif) | turbo truffle 2 ð s..> | 2018-01-04 15:09 | 223K | |
![[SND]](/icons/sound2.gif) | turn of the cent. pa..> | 2018-01-04 15:09 | 211K | |
![[SND]](/icons/sound2.gif) | turn of the tide.s3m | 2018-01-04 15:09 | 303K | |
![[SND]](/icons/sound2.gif) | ultimatum.s3m | 2018-01-04 15:09 | 234K | |
![[SND]](/icons/sound2.gif) | ultrav.s3m | 2018-01-04 15:09 | 379K | |
![[SND]](/icons/sound2.gif) | unacceptable symphon..> | 2018-01-04 15:09 | 308K | |
![[SND]](/icons/sound2.gif) | unbelievable.s3m | 2018-01-04 15:09 | 176K | |
![[SND]](/icons/sound2.gif) | underchip by underta..> | 2018-01-04 15:09 | 12K | |
![[SND]](/icons/sound2.gif) | underground sharewar..> | 2018-01-04 15:09 | 621K | |
![[SND]](/icons/sound2.gif) | undermine.s3m | 2018-01-04 15:09 | 263K | |
![[SND]](/icons/sound2.gif) | unfinished homework.s3m | 2018-01-04 15:09 | 139K | |
![[SND]](/icons/sound2.gif) | unit-a-remix.s3m | 2018-01-04 15:09 | 84K | |
![[SND]](/icons/sound2.gif) | universal groove.s3m | 2018-01-04 15:09 | 379K | |
![[SND]](/icons/sound2.gif) | unlimited power.s3m | 2018-01-04 15:09 | 300K | |
![[SND]](/icons/sound2.gif) | unreal ][ pm.s3m | 2018-01-04 15:09 | 612K | |
![[SND]](/icons/sound2.gif) | unreal symphony.s3m | 2018-01-04 15:09 | 168K | |
![[SND]](/icons/sound2.gif) | unspoken thoughts.pa..> | 2018-01-04 15:09 | 167K | |
![[SND]](/icons/sound2.gif) | untitled (4).s3m | 2018-01-04 15:09 | 19K | |
![[SND]](/icons/sound2.gif) | untitled.s3m | 2018-01-04 15:09 | 83K | |
![[SND]](/icons/sound2.gif) | untitled~1 (2).s3m | 2018-01-04 15:09 | 9.1K | |
![[SND]](/icons/sound2.gif) | untitled~1.s3m | 2018-01-04 15:09 | 3.8K | |
![[SND]](/icons/sound2.gif) | uranus revisited.s3m | 2018-01-04 15:09 | 441K | |
![[SND]](/icons/sound2.gif) | urban safari.s3m | 2018-01-04 15:09 | 39K | |
![[SND]](/icons/sound2.gif) | used 2 b my playgrou..> | 2018-01-04 15:09 | 548K | |
![[SND]](/icons/sound2.gif) | use life!!.s3m | 2018-01-04 15:09 | 433K | |
![[SND]](/icons/sound2.gif) | user.s3m | 2018-01-04 15:09 | 97K | |
![[SND]](/icons/sound2.gif) | utopia.s3m | 2018-01-04 15:09 | 272K | |
![[SND]](/icons/sound2.gif) | valley of love.s3m | 2018-01-04 15:09 | 150K | |
![[SND]](/icons/sound2.gif) | vampires can't dance..> | 2018-01-04 15:09 | 163K | |
![[SND]](/icons/sound2.gif) | vapaa.s3m | 2018-01-04 15:09 | 623K | |
![[SND]](/icons/sound2.gif) | venom stricker back.s3m | 2018-01-04 15:09 | 169K | |
![[SND]](/icons/sound2.gif) | vertigo2.s3m | 2018-01-04 15:09 | 35K | |
![[SND]](/icons/sound2.gif) | viima.s3m | 2018-01-04 15:09 | 364K | |
![[SND]](/icons/sound2.gif) | violin.s3m | 2018-01-04 15:09 | 39K | |
![[SND]](/icons/sound2.gif) | visdom.s3m | 2018-01-04 15:09 | 66K | |
![[SND]](/icons/sound2.gif) | visions of eternity.s3m | 2018-01-04 15:09 | 289K | |
![[SND]](/icons/sound2.gif) | visual paradise v2.s3m | 2018-01-04 15:09 | 837K | |
![[SND]](/icons/sound2.gif) | voxland by asyntote.s3m | 2018-01-04 15:09 | 340K | |
![[SND]](/icons/sound2.gif) | w2b.s3m | 2018-01-04 15:09 | 212K | |
![[SND]](/icons/sound2.gif) | w7-aln1.s3m | 2018-01-04 15:09 | 132K | |
![[SND]](/icons/sound2.gif) | w7-blue.s3m | 2018-01-04 15:09 | 155K | |
![[SND]](/icons/sound2.gif) | w7-mommy.s3m | 2018-01-04 15:09 | 135K | |
![[SND]](/icons/sound2.gif) | walk.s3m | 2018-01-04 15:09 | 56K | |
![[SND]](/icons/sound2.gif) | wandering memories n..> | 2018-01-04 15:09 | 257K | |
![[SND]](/icons/sound2.gif) | war spirit.s3m | 2018-01-04 15:09 | 74K | |
![[SND]](/icons/sound2.gif) | waveline.s3m | 2018-01-04 15:09 | 44K | |
![[SND]](/icons/sound2.gif) | we are the world.s3m | 2018-01-04 15:09 | 141K | |
![[SND]](/icons/sound2.gif) | weed!!!!! -=ðthesn..> | 2018-01-04 15:09 | 200K | |
![[SND]](/icons/sound2.gif) | weekend away from yo..> | 2018-01-04 15:09 | 97K | |
![[SND]](/icons/sound2.gif) | welcome home (sanita..> | 2018-01-04 15:09 | 64K | |
![[SND]](/icons/sound2.gif) | welcome to windows 9..> | 2018-01-04 15:09 | 272K | |
![[SND]](/icons/sound2.gif) | werewolf.s3m | 2018-01-04 15:09 | 150K | |
![[SND]](/icons/sound2.gif) | western title.s3m | 2018-01-04 15:09 | 148K | |
![[SND]](/icons/sound2.gif) | west point peals (be..> | 2018-01-04 15:09 | 42K | |
![[SND]](/icons/sound2.gif) | west south-west - pa..> | 2018-01-04 15:09 | 285K | |
![[SND]](/icons/sound2.gif) | whacked.s3m | 2018-01-04 15:09 | 300K | |
![[SND]](/icons/sound2.gif) | what child is this.s3m | 2018-01-04 15:09 | 86K | |
![[SND]](/icons/sound2.gif) | what do you see.s3m | 2018-01-04 15:09 | 418K | |
![[SND]](/icons/sound2.gif) | what is the meaning.s3m | 2018-01-04 15:09 | 207K | |
![[SND]](/icons/sound2.gif) | what the fk!!!!.s3m | 2018-01-04 15:09 | 82K | |
![[SND]](/icons/sound2.gif) | when death came to t..> | 2018-01-04 15:09 | 272K | |
![[SND]](/icons/sound2.gif) | when hallucination c..> | 2018-01-04 15:09 | 215K | |
![[SND]](/icons/sound2.gif) | whileya.s3m | 2018-01-04 15:09 | 274K | |
![[SND]](/icons/sound2.gif) | white silhouette.s3m | 2018-01-04 15:09 | 406K | |
![[SND]](/icons/sound2.gif) | whutwoodjadoo.s3m | 2018-01-04 15:09 | 436K | |
![[SND]](/icons/sound2.gif) | why the baby cried.s3m | 2018-01-04 15:09 | 103K | |
![[SND]](/icons/sound2.gif) | wierd.s3m | 2018-01-04 15:09 | 127K | |
![[SND]](/icons/sound2.gif) | will i dream.s3m | 2018-01-04 15:09 | 405K | |
![[SND]](/icons/sound2.gif) | wiltshire sands.s3m | 2018-01-04 15:09 | 119K | |
![[SND]](/icons/sound2.gif) | windy world.s3m | 2018-01-04 15:09 | 106K | |
![[SND]](/icons/sound2.gif) | without you.s3m | 2018-01-04 15:09 | 65K | |
![[SND]](/icons/sound2.gif) | wonky1.s3m | 2018-01-04 15:09 | 274K | |
![[SND]](/icons/sound2.gif) | world of mystic (par..> | 2018-01-04 15:09 | 905K | |
![[SND]](/icons/sound2.gif) | worldremix.s3m | 2018-01-04 15:09 | 95K | |
![[SND]](/icons/sound2.gif) | worm needs.s3m | 2018-01-04 15:09 | 289K | |
![[SND]](/icons/sound2.gif) | wrecking crew - mev ..> | 2018-01-04 15:09 | 219K | |
![[SND]](/icons/sound2.gif) | wrong soul,interweak..> | 2018-01-04 15:09 | 242K | |
![[SND]](/icons/sound2.gif) | xaos.s3m | 2018-01-04 15:09 | 387K | |
![[SND]](/icons/sound2.gif) | xemanoid.s3m | 2018-01-04 15:09 | 84K | |
![[SND]](/icons/sound2.gif) | xixit music #1.s3m | 2018-01-04 15:09 | 108K | |
![[SND]](/icons/sound2.gif) | xj-cc2n2.s3m | 2018-01-04 15:09 | 61K | |
![[SND]](/icons/sound2.gif) | xmass jam.s3m | 2018-01-04 15:09 | 439K | |
![[SND]](/icons/sound2.gif) | xs to the ravezone.s3m | 2018-01-04 15:09 | 201K | |
![[SND]](/icons/sound2.gif) | xxxxxxxxxxxxxxxxxxxx..> | 2018-01-04 15:09 | 167K | |
![[SND]](/icons/sound2.gif) | yellow panchos.s3m | 2018-01-04 15:09 | 108K | |
![[SND]](/icons/sound2.gif) | you're my guest!.s3m | 2018-01-04 15:09 | 265K | |
![[SND]](/icons/sound2.gif) | you deserved it..s3m | 2018-01-04 15:09 | 184K | |
![[SND]](/icons/sound2.gif) | you know it's a hous..> | 2018-01-04 15:09 | 132K | |
![[SND]](/icons/sound2.gif) | zep.s3m | 2018-01-04 15:09 | 72K | |
![[SND]](/icons/sound2.gif) | zine sfx.s3m | 2018-01-04 15:09 | 123K | |
![[SND]](/icons/sound2.gif) | zork.s3m | 2018-01-04 15:09 | 205K | |
![[SND]](/icons/sound2.gif) | zs-coke.s3m | 2018-01-04 15:09 | 19K | |
|