![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 76 trombones.sndh | 2018-01-06 16:27 | 6.1K | |
| sommarhack 2011 unkn..> | 2011-11-02 19:43 | 1.6K | |
| tiger road.sndh | 2009-05-24 21:35 | 3.3K | |
| european soccer chal..> | 2009-05-24 21:35 | 4.5K | |
| night dawn.sndh | 2009-05-24 16:51 | 5.1K | |
| star spangled banner..> | 2009-05-18 23:59 | 6.1K | |
| pachelbels canon in ..> | 2009-05-18 23:59 | 5.7K | |
| world trophy soccer...> | 2009-05-18 23:59 | 3.2K | |
| wolfchild.sndh | 2009-05-18 23:59 | 4.0K | |
| tango.sndh | 2009-05-18 23:59 | 799 | |
| sailor.sndh | 2009-05-18 23:59 | 1.1K | |
| pub trivia simulator..> | 2009-05-18 23:59 | 1.7K | |
| prelude.sndh | 2009-05-18 23:59 | 753 | |
| medway boys 11.sndh | 2009-05-18 23:59 | 862 | |
| international soccer..> | 2009-05-18 23:59 | 1.4K | |
| huno demo.sndh | 2009-05-18 23:59 | 2.5K | |
| gloc esd intro.sndh | 2009-05-18 23:59 | 4.7K | |
| dampf.sndh | 2009-05-18 23:59 | 888 | |
| bsw 121.sndh | 2009-05-18 23:59 | 4.5K | |
| ballade.sndh | 2009-05-18 23:59 | 475 | |
| bach.sndh | 2009-05-18 23:59 | 654 | |
| test.sndh | 2007-11-12 17:47 | 2.5K | |
| wolf pack.sndh | 2007-09-27 14:32 | 3.9K | |
| super space invaders..> | 2007-09-27 14:32 | 4.7K | |
| sleeping gods lie.sndh | 2007-09-27 14:32 | 1.6K | |
| quiz construction ki..> | 2007-09-27 14:32 | 2.9K | |
| noddy's playtime.sndh | 2007-09-27 14:32 | 3.0K | |
| maze.sndh | 2007-09-27 14:31 | 4.1K | |
| henriettas book of s..> | 2007-09-27 14:31 | 2.2K | |
| final command.sndh | 2007-09-27 14:31 | 3.3K | |
| dick tracy.sndh | 2007-09-27 14:31 | 6.9K | |
| countout.sndh | 2007-09-27 14:31 | 3.0K | |
| yoda's theme.sndh | 2007-08-18 14:24 | 6.0K | |
| yankee doodle boy.sndh | 2007-08-18 14:24 | 6.2K | |
| william tell overtur..> | 2007-08-18 14:24 | 5.4K | |
| where have all the f..> | 2007-08-18 14:24 | 5.5K | |
| what child is this.sndh | 2007-08-18 14:24 | 5.3K | |
| we are the world.sndh | 2007-08-18 14:24 | 8.1K | |
| watch girl.sndh | 2007-08-18 14:24 | 6.0K | |
| up on the house top...> | 2007-08-18 14:24 | 5.2K | |
| two part invention b..> | 2007-08-18 14:24 | 5.9K | |
| two part invention #..> | 2007-08-18 14:24 | 6.0K | |
| today randy sparks.sndh | 2007-08-18 14:24 | 6.0K | |
| they call it the blu..> | 2007-08-18 14:24 | 6.2K | |
| the windmills of you..> | 2007-08-18 14:24 | 5.7K | |
| the spider dance - t..> | 2007-08-18 14:24 | 5.5K | |
| theme from ''star tr..> | 2007-08-18 14:24 | 5.4K | |
| the imperial death m..> | 2007-08-18 14:24 | 5.6K | |
| the first noel the a..> | 2007-08-18 14:24 | 5.3K | |
| the entertainer-scot..> | 2007-08-18 14:24 | 5.9K | |
| talk to me - by stev..> | 2007-08-18 14:24 | 6.4K | |
| studio music by davi..> | 2007-08-18 14:24 | 6.5K | |
| stealing the enterpr..> | 2007-08-18 14:24 | 6.1K | |
| star wars -- main th..> | 2007-08-18 14:24 | 6.1K | |
| stand by me.sndh | 2007-08-18 14:24 | 5.0K | |
| st. elsewhere by dav..> | 2007-08-18 14:24 | 5.9K | |
| spanish eyes.sndh | 2007-08-18 14:24 | 5.5K | |
| sound of silence by ..> | 2007-08-18 14:24 | 5.9K | |
| soon it's gonna rain..> | 2007-08-18 14:24 | 7.1K | |
| somewhere, my love.sndh | 2007-08-18 14:24 | 5.3K | |
| silent night - franz..> | 2007-08-18 14:24 | 5.3K | |
| sidestep by davidow...> | 2007-08-18 14:24 | 6.8K | |
| the rock island line..> | 2007-08-18 14:24 | 5.3K | |
| she's always a woman..> | 2007-08-18 14:24 | 5.9K | |
| sensation.sndh | 2007-08-18 14:24 | 6.6K | |
| santa claus is comin..> | 2007-08-18 14:24 | 5.8K | |
| sailor's boogie.sndh | 2007-08-18 14:24 | 6.0K | |
| russian.sndh | 2007-08-18 14:24 | 5.2K | |
| rest life.sndh | 2007-08-18 14:24 | 5.9K | |
| rainbows by davidow...> | 2007-08-18 14:24 | 5.7K | |
| peter gunn by jfs.sndh | 2007-08-18 14:24 | 5.5K | |
| orange blossom speci..> | 2007-08-18 14:24 | 32K | |
| o little town of bet..> | 2007-08-18 14:24 | 5.2K | |
| old joe clark's boog..> | 2007-08-18 14:24 | 5.5K | |
| off to school boogie..> | 2007-08-18 14:24 | 5.3K | |
| night moves by maril..> | 2007-08-18 14:24 | 6.8K | |
| music box dancer - f..> | 2007-08-18 14:24 | 5.3K | |
| money for nothing.sndh | 2007-08-18 14:24 | 5.8K | |
| minuet in g by j.s. ..> | 2007-08-18 14:24 | 5.3K | |
| mini dance.sndh | 2007-08-18 14:24 | 5.0K | |
| michelle-lennon'mcca..> | 2007-08-18 14:24 | 5.4K | |
| maggie may.sndh | 2007-08-18 14:24 | 6.2K | |
| life in a northern t..> | 2007-08-18 14:24 | 5.8K | |
| la virgen de la maca..> | 2007-08-18 14:24 | 5.6K | |
| jump.sndh | 2007-08-18 14:24 | 6.8K | |
| joy to the world.sndh | 2007-08-18 14:24 | 5.2K | |
| it came upon a midni..> | 2007-08-18 14:24 | 13K | |
| i just called tosay ..> | 2007-08-18 14:24 | 6.3K | |
| i honestly love you...> | 2007-08-18 14:24 | 6.0K | |
| i heard the bells.sndh | 2007-08-18 14:24 | 5.1K | |
| i can see clearly no..> | 2007-08-18 14:24 | 5.5K | |
| i am a rock p.simon...> | 2007-08-18 14:24 | 5.4K | |
| honkitnk.sndh | 2007-08-18 14:24 | 5.7K | |
| homage to andres seg..> | 2007-08-18 14:24 | 6.9K | |
| hey hey,my my - neil..> | 2007-08-18 14:24 | 5.9K | |
| he played realgood f..> | 2007-08-18 14:24 | 5.8K | |
| have yourself'merry ..> | 2007-08-18 14:24 | 5.6K | |
| han solo and the pri..> | 2007-08-18 14:24 | 5.8K | |
| good time charlie.sndh | 2007-08-18 14:24 | 6.2K | |
| goodnight saigon by ..> | 2007-08-18 14:24 | 7.0K | |
| goodbye yellow brick..> | 2007-08-18 14:24 | 7.3K | |
| god father.sndh | 2007-08-18 14:24 | 5.2K | |
| fur elise by l. v. b..> | 2007-08-18 14:24 | 5.3K | |
| flashdance...what a ..> | 2007-08-18 14:24 | 7.7K | |
| eye sky.sndh | 2007-08-18 14:24 | 5.3K | |
| believe it or not! m..> | 2007-08-18 14:24 | 6.0K | |
| every breath you tak..> | 2007-08-18 14:24 | 5.9K | |
| estrel.sndh | 2007-08-18 14:24 | 5.9K | |
| entry of the gladiat..> | 2007-08-18 14:24 | 7.3K | |
| eastenders - may'osb..> | 2007-08-18 14:24 | 5.4K | |
| don't stop believing..> | 2007-08-18 14:24 | 5.1K | |
| daybreaker-elo.sndh | 2007-08-18 14:24 | 5.4K | |
| children's corner # ..> | 2007-08-18 14:24 | 6.5K | |
| children's corner # ..> | 2007-08-18 14:24 | 5.6K | |
| children's corner # ..> | 2007-08-18 14:24 | 6.5K | |
| children's corner # ..> | 2007-08-18 14:24 | 6.9K | |
| children's corner # ..> | 2007-08-18 14:24 | 6.3K | |
| children's corner # ..> | 2007-08-18 14:24 | 6.4K | |
| cavlary.sndh | 2007-08-18 14:24 | 5.7K | |
| carry on.sndh | 2007-08-18 14:24 | 5.9K | |
| california girls.sndh | 2007-08-18 14:24 | 6.0K | |
| both sides now.sndh | 2007-08-18 14:24 | 5.3K | |
| ben hur chariot race..> | 2007-08-18 14:24 | 7.6K | |
| away in a manger.sndh | 2007-08-18 14:24 | 5.2K | |
| 12 bar blues-irk.sndh | 2007-08-18 14:24 | 6.2K | |
| metrocross.sndh | 2007-08-18 14:24 | 6.0K | |
| wanderer 3d.sndh | 2007-07-28 16:58 | 12K | |
| heroes of the lance...> | 2007-07-28 16:58 | 3.0K | |
| vampire's empire.sndh | 2006-08-20 11:11 | 4.3K | |
| the karate kid - par..> | 2006-08-20 11:11 | 2.3K | |
| lemmings 2 - the tri..> | 2006-08-20 11:11 | 22K | |
| jigsaw.sndh | 2006-08-20 11:11 | 6.2K | |
| international karate..> | 2006-08-20 11:11 | 1.5K | |
| xbios music-stupid.sndh | 2004-09-13 22:12 | 1.4K | |
| xbios music-ruby.sndh | 2004-09-13 22:12 | 2.1K | |
| xbios music-popcorni..> | 2004-09-13 22:12 | 4.8K | |
| xbios music-micelle...> | 2004-09-13 22:12 | 1.2K | |
| xbios music-king of ..> | 2004-09-13 22:12 | 2.3K | |
| xbios music-city roa..> | 2004-09-13 22:12 | 2.2K | |
| xbios music-beguine...> | 2004-09-13 22:12 | 1.8K | |
| xbios music-badine.sndh | 2004-09-13 22:12 | 2.1K | |
| xbios music-ala turk..> | 2004-09-13 22:12 | 3.9K | |
| xbios music-acc song..> | 2004-09-13 22:12 | 2.1K | |
| wwf 2.sndh | 2004-09-13 22:12 | 3.4K | |
| where time stood sti..> | 2004-09-13 22:12 | 1.6K | |
| vision.sndh | 2004-09-13 22:12 | 3.5K | |
| tsc.sndh | 2004-09-13 22:12 | 7.2K | |
| trailblazer.sndh | 2004-09-13 22:12 | 1.1K | |
| total eclypse.sndh | 2004-09-13 22:12 | 3.1K | |
| torment-24 hours scr..> | 2004-09-13 22:12 | 3.1K | |
| times of lore-title ..> | 2004-09-13 22:12 | 5.2K | |
| times of lore-intro ..> | 2004-09-13 22:12 | 1.2K | |
| times of lore-intro ..> | 2004-09-13 22:12 | 1.0K | |
| times of lore-intro ..> | 2004-09-13 22:12 | 872 | |
| times of lore-intro ..> | 2004-09-13 22:12 | 840 | |
| times of lore-intro ..> | 2004-09-13 22:12 | 1.5K | |
| times of lore-intro ..> | 2004-09-13 22:12 | 642 | |
| times of lore-end mu..> | 2004-09-13 22:12 | 1.8K | |
| times of lore-end mu..> | 2004-09-13 22:12 | 1.2K | |
| times of lore-choose..> | 2004-09-13 22:12 | 787 | |
| super hang on-winnin..> | 2004-09-13 22:12 | 4.5K | |
| super hang on-title...> | 2004-09-13 22:12 | 710 | |
| super hang on-sprint..> | 2004-09-13 22:12 | 3.8K | |
| super hang on-outrid..> | 2004-09-13 22:12 | 4.5K | |
| super hang on-hard r..> | 2004-09-13 22:12 | 7.2K | |
| streetfighter 2.sndh | 2004-09-13 22:12 | 4.3K | |
| stephani.sndh | 2004-09-13 22:12 | 4.3K | |
| starfire.sndh | 2004-09-13 22:12 | 2.9K | |
| special forces intro..> | 2004-09-13 22:12 | 1.3K | |
| space harrier.sndh | 2004-09-13 22:12 | 1.1K | |
| sernsima.sndh | 2004-09-13 22:12 | 3.2K | |
| saint and greavsie.sndh | 2004-09-13 22:12 | 1.4K | |
| rolling.sndh | 2004-09-13 22:12 | 5.8K | |
| pyramid.sndh | 2004-09-13 22:12 | 2.0K | |
| phantasie3title.sndh | 2004-09-13 22:12 | 2.4K | |
| oohyeah.sndh | 2004-09-13 22:12 | 1.5K | |
| nanani.sndh | 2004-09-13 22:12 | 3.5K | |
| metrocross-song 2.sndh | 2004-09-13 22:12 | 891 | |
| metrocross-song 1.sndh | 2004-09-13 22:12 | 1.8K | |
| logical gametune 02...> | 2004-09-13 22:12 | 6.9K | |
| logical gametune 01...> | 2004-09-13 22:12 | 8.7K | |
| loader2.sndh | 2004-09-13 22:12 | 2.9K | |
| loader (1).sndh | 2004-09-13 22:12 | 4.4K | |
| legend.sndh | 2004-09-13 22:12 | 1.1K | |
| lands of havoc.sndh | 2004-09-13 22:12 | 1.3K | |
| lagaf aventures de m..> | 2004-09-13 22:12 | 1.5K | |
| lagaf aventures de m..> | 2004-09-13 22:12 | 1.5K | |
| lagaf aventures de m..> | 2004-09-13 22:12 | 1.6K | |
| kult.sndh | 2004-09-13 22:12 | 16K | |
| kidney bean 08 remix..> | 2004-09-13 22:12 | 2.8K | |
| kg2-song 7.sndh | 2004-09-13 22:12 | 2.8K | |
| kg2-song 6.sndh | 2004-09-13 22:12 | 6.6K | |
| kg2-song 5.sndh | 2004-09-13 22:12 | 4.6K | |
| kg2-song 4.sndh | 2004-09-13 22:12 | 3.9K | |
| kg2-song 3.sndh | 2004-09-13 22:12 | 3.2K | |
| kg2-song 2.sndh | 2004-09-13 22:12 | 3.6K | |
| kg2-song 1.sndh | 2004-09-13 22:12 | 2.9K | |
| hudson hawk-loading...> | 2004-09-13 22:12 | 1.1K | |
| hudson hawk-intro.sndh | 2004-09-13 22:12 | 2.2K | |
| horror zombies.sndh | 2004-09-13 22:12 | 3.4K | |
| hellbent.sndh | 2004-09-13 22:12 | 2.0K | |
| grumbler in rutling ..> | 2004-09-13 22:12 | 3.8K | |
| groovy.sndh | 2004-09-13 22:12 | 1.8K | |
| griff 24 hours scree..> | 2004-09-13 22:12 | 4.1K | |
| gameover 2.sndh | 2004-09-13 22:12 | 900 | |
| fuck.sndh | 2004-09-13 22:12 | 3.3K | |
| fedrqust.sndh | 2004-09-13 22:12 | 7.4K | |
| fastlane.sndh | 2004-09-13 22:12 | 2.4K | |
| f15 2 2.sndh | 2004-09-13 22:12 | 862 | |
| f-15 strike eagle.sndh | 2004-09-13 22:12 | 1.1K | |
| exited.sndh | 2004-09-13 22:12 | 3.6K | |
| equinox empire intro..> | 2004-09-13 22:12 | 3.5K | |
| elite 1.sndh | 2004-09-13 22:12 | 3.5K | |
| eco-song 3.sndh | 2004-09-13 22:12 | 1.1K | |
| eco-song 2.sndh | 2004-09-13 22:12 | 3.1K | |
| eco-song 1.sndh | 2004-09-13 22:12 | 2.4K | |
| dr who-tune 7.sndh | 2004-09-13 22:12 | 2.7K | |
| dr who-tune 6.sndh | 2004-09-13 22:12 | 3.1K | |
| dr who-tune 5.sndh | 2004-09-13 22:12 | 3.2K | |
| dr who-tune 4.sndh | 2004-09-13 22:12 | 3.2K | |
| dr who-tune 3.sndh | 2004-09-13 22:12 | 3.0K | |
| dr who-tune 2.sndh | 2004-09-13 22:12 | 3.3K | |
| dr who-tune 1.sndh | 2004-09-13 22:12 | 3.6K | |
| dedicace.sndh | 2004-09-13 22:12 | 3.2K | |
| crafton and xunk.sndh | 2004-09-13 22:12 | 1.5K | |
| crackdown-song 8.sndh | 2004-09-13 22:12 | 597 | |
| crackdown-song 7.sndh | 2004-09-13 22:12 | 936 | |
| crackdown-song 6.sndh | 2004-09-13 22:12 | 1.2K | |
| crackdown-song 5.sndh | 2004-09-13 22:12 | 1.7K | |
| crackdown-song 4.sndh | 2004-09-13 22:12 | 1.5K | |
| crackdown-song 3.sndh | 2004-09-13 22:12 | 1.1K | |
| crackdown-song 2.sndh | 2004-09-13 22:12 | 1.4K | |
| crackdown-song 1.sndh | 2004-09-13 22:12 | 1.3K | |
| count duckula.sndh | 2004-09-13 22:12 | 2.3K | |
| cool.sndh | 2004-09-13 22:12 | 3.5K | |
| conflict europe.sndh | 2004-09-13 22:12 | 6.8K | |
| choice of the gods.sndh | 2004-09-13 22:12 | 8.5K | |
| bubble bobble.sndh | 2004-09-13 22:12 | 5.6K | |
| bombuzal.sndh | 2004-09-13 22:12 | 2.2K | |
| blues brothers-selec..> | 2004-09-13 22:12 | 944 | |
| blues brothers-level..> | 2004-09-13 22:12 | 2.2K | |
| bigmuse3.sndh | 2004-09-13 22:12 | 4.0K | |
| beeforol.sndh | 2004-09-13 22:12 | 4.5K | |
| axelfoly.sndh | 2004-09-13 22:12 | 4.5K | |
| automation-menu 157...> | 2004-09-13 22:12 | 5.3K | |
| automation-menu 084...> | 2004-09-13 22:12 | 2.1K | |
| zombi.sndh | 2004-09-13 22:11 | 2.2K | |
| zeta2.sndh | 2004-09-13 22:11 | 2.1K | |
| zaptball.sndh | 2004-09-13 22:11 | 2.6K | |
| zaptbal3.sndh | 2004-09-13 22:11 | 1.3K | |
| zaptbal2.sndh | 2004-09-13 22:11 | 1.7K | |
| yeah.sndh | 2004-09-13 22:11 | 967 | |
| xtreme71.sndh | 2004-09-13 22:11 | 1.2K | |
| xmas.sndh | 2004-09-13 22:11 | 2.0K | |
| woodpeck.sndh | 2004-09-13 22:11 | 5.1K | |
| winter.sndh | 2004-09-13 22:11 | 1.3K | |
| winsurf.sndh | 2004-09-13 22:11 | 1.8K | |
| wedge.sndh | 2004-09-13 22:11 | 3.9K | |
| untouch1.sndh | 2004-09-13 22:11 | 1.0K | |
| turrican 2.sndh | 2004-09-13 22:11 | 5.5K | |
| turrican 1 intro.sndh | 2004-09-13 22:11 | 3.5K | |
| trantor.sndh | 2004-09-13 22:11 | 3.1K | |
| tranez.sndh | 2004-09-13 22:11 | 7.0K | |
| toyota.sndh | 2004-09-13 22:11 | 3.1K | |
| tn2.sndh | 2004-09-13 22:11 | 6.0K | |
| titlemus.sndh | 2004-09-13 22:11 | 1.6K | |
| thriller.sndh | 2004-09-13 22:11 | 1.3K | |
| the light corridor #..> | 2004-09-13 22:11 | 1.0K | |
| thefrog.sndh | 2004-09-13 22:11 | 1.8K | |
| thebeat.sndh | 2004-09-13 22:11 | 1.7K | |
| musican.sndh | 2004-09-13 22:11 | 2.2K | |
| modell.sndh | 2004-09-13 22:11 | 1.9K | |
| elmibub.sndh | 2004-09-13 22:11 | 2.6K | |
| dynablas.sndh | 2004-09-13 22:11 | 1.8K | |
| the addams family.sndh | 2004-09-13 22:11 | 1.4K | |
| testwest.sndh | 2004-09-13 22:11 | 1.3K | |
| terminator 2.sndh | 2004-09-13 22:11 | 1.2K | |
| takeonme.sndh | 2004-09-13 22:11 | 5.0K | |
| swtchldo.sndh | 2004-09-13 22:11 | 2.5K | |
| sweet child o mine.sndh | 2004-09-13 22:11 | 2.5K | |
| suprbass.sndh | 2004-09-13 22:11 | 1.0K | |
| stormlord.sndh | 2004-09-13 22:11 | 5.0K | |
| sspcinva.sndh | 2004-09-13 22:11 | 2.8K | |
| spheric.sndh | 2004-09-13 22:11 | 7.3K | |
| spellbnd.sndh | 2004-09-13 22:11 | 3.2K | |
| spaceb2.sndh | 2004-09-13 22:11 | 884 | |
| snake2.sndh | 2004-09-13 22:11 | 1.3K | |
| simone.sndh | 2004-09-13 22:11 | 2.0K | |
| shadtit.sndh | 2004-09-13 22:11 | 2.7K | |
| sdemo.sndh | 2004-09-13 22:11 | 2.1K | |
| scoopxt5.sndh | 2004-09-13 22:11 | 1.4K | |
| scoopxt4.sndh | 2004-09-13 22:11 | 3.4K | |
| running.sndh | 2004-09-13 22:11 | 1.0K | |
| riff-raff.sndh | 2004-09-13 22:11 | 2.6K | |
| renaud.sndh | 2004-09-13 22:11 | 3.2K | |
| rbi2.sndh | 2004-09-13 22:11 | 1.9K | |
| raf-mega.sndh | 2004-09-13 22:11 | 1.7K | |
| race.sndh | 2004-09-13 22:11 | 4.6K | |
| qjeta.sndh | 2004-09-13 22:11 | 3.1K | |
| python.sndh | 2004-09-13 22:11 | 1.2K | |
| puffysag.sndh | 2004-09-13 22:11 | 2.4K | |
| preventi.sndh | 2004-09-13 22:11 | 1.8K | |
| prehisto.sndh | 2004-09-13 22:11 | 3.9K | |
| prehist1.sndh | 2004-09-13 22:11 | 1.5K | |
| prehi2-1.sndh | 2004-09-13 22:11 | 1.9K | |
| predator.sndh | 2004-09-13 22:11 | 3.8K | |
| penguin adv-special ..> | 2004-09-13 22:11 | 24K | |
| penguin adv-river ru..> | 2004-09-13 22:11 | 37K | |
| penguin adv-forest p..> | 2004-09-13 22:11 | 49K | |
| panther.sndh | 2004-09-13 22:11 | 1.0K | |
| pacte.sndh | 2004-09-13 22:11 | 1.3K | |
| oxygene4.sndh | 2004-09-13 22:11 | 2.3K | |
| opthundr.sndh | 2004-09-13 22:11 | 3.0K | |
| octoplx.sndh | 2004-09-13 22:11 | 3.0K | |
| cpct tunes - space d..> | 2004-09-13 22:11 | 13K | |
| amiga-physical prese..> | 2004-09-13 22:11 | 6.0K | |
| o-nebulu.sndh | 2004-09-13 22:11 | 783 | |
| nosofear.sndh | 2004-09-13 22:11 | 3.0K | |
| nobody.sndh | 2004-09-13 22:11 | 1.2K | |
| never.sndh | 2004-09-13 22:11 | 3.4K | |
| nemesis.sndh | 2004-09-13 22:11 | 1.1K | |
| nebulus.sndh | 2004-09-13 22:11 | 5.8K | |
| nas.sndh | 2004-09-13 22:11 | 859 | |
| my-boy.sndh | 2004-09-13 22:11 | 1.2K | |
| munsters.sndh | 2004-09-13 22:11 | 2.7K | |
| msmarpel.sndh | 2004-09-13 22:11 | 1.6K | |
| mops.sndh | 2004-09-13 22:11 | 2.4K | |
| money.sndh | 2004-09-13 22:11 | 2.1K | |
| monaco.sndh | 2004-09-13 22:11 | 3.2K | |
| moktar.sndh | 2004-09-13 22:11 | 1.5K | |
| minbomb.sndh | 2004-09-13 22:11 | 5.2K | |
| mermaid.sndh | 2004-09-13 22:11 | 1.3K | |
| menfin.sndh | 2004-09-13 22:11 | 2.9K | |
| memoryfl.sndh | 2004-09-13 22:11 | 1.7K | |
| megremix.sndh | 2004-09-13 22:11 | 1.4K | |
| megapab4.sndh | 2004-09-13 22:11 | 1.8K | |
| megapab2.sndh | 2004-09-13 22:11 | 1.9K | |
| megapab1.sndh | 2004-09-13 22:11 | 2.1K | |
| megapaa6.sndh | 2004-09-13 22:11 | 781 | |
| megaintr.sndh | 2004-09-13 22:11 | 4.0K | |
| maxiwest.sndh | 2004-09-13 22:11 | 2.0K | |
| master10.sndh | 2004-09-13 22:11 | 2.1K | |
| magnetic.sndh | 2004-09-13 22:11 | 1.7K | |
| magical.sndh | 2004-09-13 22:11 | 1.3K | |
| magic.sndh | 2004-09-13 22:11 | 1.0K | |
| love.sndh | 2004-09-13 22:11 | 1.3K | |
| looser.sndh | 2004-09-13 22:11 | 1.0K | |
| loader.sndh | 2004-09-13 22:11 | 1.0K | |
| ligcor13.sndh | 2004-09-13 22:11 | 1.7K | |
| ligcor12.sndh | 2004-09-13 22:11 | 2.1K | |
| ligcor11.sndh | 2004-09-13 22:11 | 3.4K | |
| ligcor10.sndh | 2004-09-13 22:11 | 1.4K | |
| ligcor09.sndh | 2004-09-13 22:11 | 1.7K | |
| ligcor08.sndh | 2004-09-13 22:11 | 1.3K | |
| ligcor07.sndh | 2004-09-13 22:11 | 1.8K | |
| ligcor06.sndh | 2004-09-13 22:11 | 4.6K | |
| ligcor05.sndh | 2004-09-13 22:11 | 1.0K | |
| ligcor04.sndh | 2004-09-13 22:11 | 7.1K | |
| ligcor03.sndh | 2004-09-13 22:11 | 7.1K | |
| ligcor02.sndh | 2004-09-13 22:11 | 5.3K | |
| ligcor01.sndh | 2004-09-13 22:11 | 6.1K | |
| lcr.sndh | 2004-09-13 22:11 | 1.7K | |
| layla.sndh | 2004-09-13 22:11 | 1.4K | |
| kpytexno.sndh | 2004-09-13 22:11 | 5.0K | |
| koi-zeid.sndh | 2004-09-13 22:11 | 1.5K | |
| knockers.sndh | 2004-09-13 22:11 | 1.4K | |
| klimper.sndh | 2004-09-13 22:11 | 2.1K | |
| kings valley-song 1...> | 2004-09-13 22:11 | 965 | |
| killgump.sndh | 2004-09-13 22:11 | 1.6K | |
| jmjdmo11.sndh | 2004-09-13 22:11 | 5.5K | |
| jmjdmo09.sndh | 2004-09-13 22:11 | 3.9K | |
| jmjdmo08.sndh | 2004-09-13 22:11 | 6.9K | |
| jmjdmo07.sndh | 2004-09-13 22:11 | 5.5K | |
| jmjdmo06.sndh | 2004-09-13 22:11 | 8.4K | |
| jmjdmo05.sndh | 2004-09-13 22:11 | 3.3K | |
| jmjdmo04.sndh | 2004-09-13 22:11 | 5.8K | |
| jmjdmo03.sndh | 2004-09-13 22:11 | 3.4K | |
| jmjdmo02.sndh | 2004-09-13 22:11 | 2.1K | |
| jmjdmo01.sndh | 2004-09-13 22:11 | 2.7K | |
| jass.sndh | 2004-09-13 22:11 | 1.7K | |
| jahangia.sndh | 2004-09-13 22:11 | 2.0K | |
| iss.sndh | 2004-09-13 22:11 | 1.7K | |
| inspir.sndh | 2004-09-13 22:11 | 12K | |
| indochin.sndh | 2004-09-13 22:11 | 1.2K | |
| improv.sndh | 2004-09-13 22:11 | 2.8K | |
| imperial.sndh | 2004-09-13 22:11 | 1.9K | |
| ilovedh.sndh | 2004-09-13 22:11 | 2.3K | |
| hotshot.sndh | 2004-09-13 22:11 | 2.5K | |
| hopper2.sndh | 2004-09-13 22:11 | 2.0K | |
| hopper1.sndh | 2004-09-13 22:11 | 2.6K | |
| hoppeldi.sndh | 2004-09-13 22:11 | 3.1K | |
| harrier.sndh | 2004-09-13 22:11 | 1.2K | |
| hard wired.sndh | 2004-09-13 22:11 | 3.2K | |
| hardlevl.sndh | 2004-09-13 22:11 | 831 | |
| hard.sndh | 2004-09-13 22:11 | 959 | |
| grave3.sndh | 2004-09-13 22:11 | 2.3K | |
| gemini wings.sndh | 2004-09-13 22:11 | 2.6K | |
| g2.sndh | 2004-09-13 22:11 | 729 | |
| future.sndh | 2004-09-13 22:11 | 751 | |
| fronty.sndh | 2004-09-13 22:11 | 1.4K | |
| football.sndh | 2004-09-13 22:11 | 2.9K | |
| folx.sndh | 2004-09-13 22:11 | 1.0K | |
| farty.sndh | 2004-09-13 22:11 | 1.0K | |
| eternal.sndh | 2004-09-13 22:11 | 1.1K | |
| escape.sndh | 2004-09-13 22:11 | 1.9K | |
| equinox.sndh | 2004-09-13 22:11 | 1.1K | |
| enola gay.sndh | 2004-09-13 22:11 | 1.6K | |
| en96-18.sndh | 2004-09-13 22:11 | 5.0K | |
| en96-17.sndh | 2004-09-13 22:11 | 3.0K | |
| en96-16c.sndh | 2004-09-13 22:11 | 6.1K | |
| en96-16.sndh | 2004-09-13 22:11 | 4.8K | |
| en96-13.sndh | 2004-09-13 22:11 | 6.6K | |
| en96-12.sndh | 2004-09-13 22:11 | 5.6K | |
| en96-11b.sndh | 2004-09-13 22:11 | 3.3K | |
| en96-11.sndh | 2004-09-13 22:11 | 1.4K | |
| en96-10.sndh | 2004-09-13 22:11 | 3.5K | |
| en96-07.sndh | 2004-09-13 22:11 | 3.1K | |
| en96-03.sndh | 2004-09-13 22:11 | 6.2K | |
| en96-02.sndh | 2004-09-13 22:11 | 3.5K | |
| en96-01.sndh | 2004-09-13 22:11 | 3.6K | |
| elmar1.sndh | 2004-09-13 22:11 | 1.9K | |
| einmal.sndh | 2004-09-13 22:11 | 1.5K | |
| edd duck.sndh | 2004-09-13 22:11 | 3.1K | |
| ecstacu.sndh | 2004-09-13 22:11 | 2.1K | |
| echo.sndh | 2004-09-13 22:11 | 949 | |
| dunny.sndh | 2004-09-13 22:11 | 1.0K | |
| dull.sndh | 2004-09-13 22:11 | 2.7K | |
| drspirit.sndh | 2004-09-13 22:11 | 3.2K | |
| dream3.sndh | 2004-09-13 22:11 | 2.2K | |
| dragon spirit.sndh | 2004-09-13 22:11 | 3.2K | |
| dotty flowers.sndh | 2004-09-13 22:11 | 1.2K | |
| dotty.sndh | 2004-09-13 22:11 | 1.2K | |
| dorgasm2.sndh | 2004-09-13 22:11 | 5.0K | |
| desert.sndh | 2004-09-13 22:11 | 1.3K | |
| demo3mix.sndh | 2004-09-13 22:11 | 2.6K | |
| demo3.sndh | 2004-09-13 22:11 | 1.3K | |
| demo2.sndh | 2004-09-13 22:11 | 1.8K | |
| demo1.sndh | 2004-09-13 22:11 | 2.0K | |
| deltwat1.sndh | 2004-09-13 22:11 | 1.4K | |
| delivrnc.sndh | 2004-09-13 22:11 | 6.9K | |
| dasilva.sndh | 2004-09-13 22:11 | 1.1K | |
| daniele.sndh | 2004-09-13 22:11 | 2.1K | |
| cybernoid-song 2.sndh | 2004-09-13 22:11 | 3.5K | |
| cybernoid-song 1.sndh | 2004-09-13 22:11 | 4.0K | |
| crystal hammer.sndh | 2004-09-13 22:11 | 4.1K | |
| crystal.sndh | 2004-09-13 22:11 | 1.4K | |
| crazy1.sndh | 2004-09-13 22:11 | 1.2K | |
| crafton2.sndh | 2004-09-13 22:11 | 1.4K | |
| crafton.sndh | 2004-09-13 22:11 | 1.6K | |
| cpctl17b.sndh | 2004-09-13 22:11 | 5.1K | |
| cpctl17a.sndh | 2004-09-13 22:11 | 2.1K | |
| cpctl16b.sndh | 2004-09-13 22:11 | 2.0K | |
| cpctl13b.sndh | 2004-09-13 22:11 | 2.9K | |
| cpctl11b.sndh | 2004-09-13 22:11 | 3.0K | |
| cpctl11a.sndh | 2004-09-13 22:11 | 1.8K | |
| cpctl9a.sndh | 2004-09-13 22:11 | 5.1K | |
| cpctl8a.sndh | 2004-09-13 22:11 | 2.5K | |
| cpctl7b.sndh | 2004-09-13 22:11 | 1.6K | |
| cpctl7a.sndh | 2004-09-13 22:11 | 2.1K | |
| cpctl6b.sndh | 2004-09-13 22:11 | 3.1K | |
| cpctl3a.sndh | 2004-09-13 22:11 | 1.8K | |
| cpcchn12.sndh | 2004-09-13 22:11 | 3.8K | |
| countryr.sndh | 2004-09-13 22:11 | 2.0K | |
| constela.sndh | 2004-09-13 22:11 | 2.7K | |
| complications.sndh | 2004-09-13 22:11 | 5.6K | |
| combscho.sndh | 2004-09-13 22:11 | 1.2K | |
| comagain.sndh | 2004-09-13 22:11 | 1.1K | |
| colors.sndh | 2004-09-13 22:11 | 4.0K | |
| change.sndh | 2004-09-13 22:11 | 1.3K | |
| catch-23.sndh | 2004-09-13 22:11 | 942 | |
| camoufla.sndh | 2004-09-13 22:11 | 1.6K | |
| bshadow.sndh | 2004-09-13 22:11 | 1.4K | |
| bravstar.sndh | 2004-09-13 22:11 | 4.1K | |
| blangel.sndh | 2004-09-13 22:11 | 2.2K | |
| bestde.sndh | 2004-09-13 22:11 | 5.4K | |
| beerjoin.sndh | 2004-09-13 22:11 | 6.2K | |
| battleva.sndh | 2004-09-13 22:11 | 7.7K | |
| barthy.sndh | 2004-09-13 22:11 | 1.2K | |
| balnchal.sndh | 2004-09-13 22:11 | 2.5K | |
| badmag4.sndh | 2004-09-13 22:11 | 1.4K | |
| badmag3.sndh | 2004-09-13 22:11 | 4.4K | |
| atomix.sndh | 2004-09-13 22:11 | 9.2K | |
| atf.sndh | 2004-09-13 22:11 | 1.1K | |
| asphalt.sndh | 2004-09-13 22:11 | 1.6K | |
| armagdmn.sndh | 2004-09-13 22:11 | 933 | |
| arabiann.sndh | 2004-09-13 22:11 | 6.3K | |
| anticwld.sndh | 2004-09-13 22:11 | 1.5K | |
| anarchy.sndh | 2004-09-13 22:11 | 2.2K | |
| amaurote.sndh | 2004-09-13 22:11 | 920 | |
| alphaville - big in ..> | 2004-09-13 22:11 | 2.7K | |
| alienall.sndh | 2004-09-13 22:11 | 2.4K | |
| alex.sndh | 2004-09-13 22:11 | 1.6K | |
| afterwar.sndh | 2004-09-13 22:11 | 3.6K | |
| ads2 mix.sndh | 2004-09-13 22:11 | 1.7K | |
| ads1 mix.sndh | 2004-09-13 22:11 | 764 | |
| a.sndh | 2004-09-13 22:11 | 1.3K | |
| 19 mng w.sndh | 2004-09-13 22:11 | 5.7K | |
| 5axe.sndh | 2004-09-13 22:11 | 3.7K | |