Index of /incoming/warehouse/XM
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | PSYCHO/ | 2018-01-04 15:09 | - | |
![[DIR]](/icons/folder.gif) | SLDENRGY/ | 2018-01-04 15:09 | - | |
![[DIR]](/icons/folder.gif) | SWOOP/ | 2018-01-04 15:09 | - | |
![[DIR]](/icons/folder.gif) | TFC_PM/ | 2018-01-04 15:09 | - | |
![[DIR]](/icons/folder.gif) | TFC_SKAV/ | 2018-01-04 15:09 | - | |
![[DIR]](/icons/folder.gif) | Terauseser (grupp)/ | 2018-01-04 15:09 | - | |
![[DIR]](/icons/folder.gif) | ungersk techno/ | 2025-06-09 09:01 | - | |
![[SND]](/icons/sound2.gif) | retrn of the regress.xm | 2018-01-04 15:09 | 6.5K | |
![[SND]](/icons/sound2.gif) | march.xm | 2018-01-04 15:09 | 7.5K | |
![[SND]](/icons/sound2.gif) | limbid linage.xm | 2018-01-04 15:09 | 7.6K | |
![[SND]](/icons/sound2.gif) | lofi 4.xm | 2018-01-04 15:09 | 7.9K | |
![[SND]](/icons/sound2.gif) | nero2000 game theme.xm | 2018-01-04 15:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | dhscene 04 invitro.xm | 2018-01-04 15:09 | 8.7K | |
![[SND]](/icons/sound2.gif) | commando highscore.xm | 2018-01-04 15:09 | 9.1K | |
![[SND]](/icons/sound2.gif) | die kunst der fuge 1.xm | 2018-01-04 15:09 | 9.7K | |
![[SND]](/icons/sound2.gif) | toiletter.xm | 2018-01-04 15:09 | 9.9K | |
![[SND]](/icons/sound2.gif) | jb makes an ass of.xm | 2018-01-04 15:09 | 11K | |
![[SND]](/icons/sound2.gif) | hohum-la.xm | 2018-01-04 15:09 | 11K | |
![[SND]](/icons/sound2.gif) | thomthing swampthing.xm | 2018-01-04 15:09 | 11K | |
![[SND]](/icons/sound2.gif) | shrat 1.xm | 2018-01-04 15:09 | 11K | |
![[SND]](/icons/sound2.gif) | in-trip.xm | 2018-01-04 15:09 | 12K | |
![[SND]](/icons/sound2.gif) | gocart racers.jam.96.xm | 2018-01-04 15:09 | 12K | |
![[SND]](/icons/sound2.gif) | jb makes... (part1).xm | 2018-01-04 15:09 | 13K | |
![[SND]](/icons/sound2.gif) | sq - morgon.xm | 2018-01-04 15:09 | 13K | |
![[SND]](/icons/sound2.gif) | dice.xm | 2018-01-04 15:09 | 13K | |
![[SND]](/icons/sound2.gif) | insert 99kt.xm | 2018-01-04 15:09 | 14K | |
![[SND]](/icons/sound2.gif) | tasty chips.xm | 2018-01-04 15:09 | 14K | |
![[SND]](/icons/sound2.gif) | mummon kaataja.xm | 2018-01-04 15:09 | 14K | |
![[SND]](/icons/sound2.gif) | jb makes... (part2).xm | 2018-01-04 15:09 | 14K | |
![[SND]](/icons/sound2.gif) | icecream pa rymmen.xm | 2018-01-04 15:09 | 14K | |
![[SND]](/icons/sound2.gif) | r 1stlst.xm | 2018-01-04 15:09 | 14K | |
![[SND]](/icons/sound2.gif) | tadekine.xm | 2018-01-04 15:09 | 14K | |
![[SND]](/icons/sound2.gif) | crylithic two.xm | 2018-01-04 15:09 | 15K | |
![[SND]](/icons/sound2.gif) | the overlord..xm | 2018-01-04 15:09 | 15K | |
![[SND]](/icons/sound2.gif) | hk sininen penkki.xm | 2018-01-04 15:09 | 15K | |
![[SND]](/icons/sound2.gif) | sunshine me.xm | 2018-01-04 15:09 | 15K | |
![[SND]](/icons/sound2.gif) | gappy-run.xm | 2018-01-04 15:09 | 15K | |
![[SND]](/icons/sound2.gif) | siegstig.xm | 2018-01-04 15:09 | 15K | |
![[SND]](/icons/sound2.gif) | ltv - night at miska.xm | 2018-01-04 15:09 | 16K | |
![[SND]](/icons/sound2.gif) | conan.xm | 2018-01-04 15:09 | 16K | |
![[SND]](/icons/sound2.gif) | chipgyver.xm | 2018-01-04 15:09 | 17K | |
![[SND]](/icons/sound2.gif) | super mario land.xm | 2018-01-04 15:09 | 17K | |
![[SND]](/icons/sound2.gif) | trive (close open mi..> | 2018-01-04 15:09 | 17K | |
![[SND]](/icons/sound2.gif) | earith death chip.xm | 2018-01-04 15:09 | 17K | |
![[SND]](/icons/sound2.gif) | mega man 3 skull ca.xm | 2018-01-04 15:09 | 17K | |
![[SND]](/icons/sound2.gif) | lmnrid . crim.xm | 2018-01-04 15:09 | 17K | |
![[SND]](/icons/sound2.gif) | mys.xm | 2018-01-04 15:09 | 17K | |
![[SND]](/icons/sound2.gif) | hannu on 14v trader.xm | 2018-01-04 15:09 | 17K | |
![[SND]](/icons/sound2.gif) | megashit 2.xm | 2018-01-04 15:09 | 18K | |
![[SND]](/icons/sound2.gif) | fth-yuck.xm | 2018-01-04 15:09 | 18K | |
![[SND]](/icons/sound2.gif) | lmnrid . crim (1).xm | 2018-01-04 15:09 | 18K | |
![[SND]](/icons/sound2.gif) | shining like a star!.xm | 2018-01-04 15:09 | 18K | |
![[SND]](/icons/sound2.gif) | fth-hsif.xm | 2018-01-04 15:09 | 19K | |
![[SND]](/icons/sound2.gif) | sfe installer 1.xm | 2018-01-04 15:09 | 19K | |
![[SND]](/icons/sound2.gif) | tetris themesong.jam.xm | 2018-01-04 15:09 | 19K | |
![[SND]](/icons/sound2.gif) | the angel.jam.96.xm | 2018-01-04 15:09 | 19K | |
![[SND]](/icons/sound2.gif) | meltronix.xm | 2018-01-04 15:09 | 19K | |
![[SND]](/icons/sound2.gif) | evil spawn of satan.xm | 2018-01-04 15:09 | 19K | |
![[SND]](/icons/sound2.gif) | chip.xm | 2018-01-04 15:09 | 19K | |
![[SND]](/icons/sound2.gif) | cherrytea.xm | 2018-01-04 15:09 | 19K | |
![[SND]](/icons/sound2.gif) | chip on a journey.xm | 2018-01-04 15:09 | 19K | |
![[SND]](/icons/sound2.gif) | dna warrior.xm | 2018-01-04 15:09 | 19K | |
![[SND]](/icons/sound2.gif) | driv 1.xm | 2018-01-04 15:09 | 19K | |
![[SND]](/icons/sound2.gif) | sun goes down.xm | 2018-01-04 15:09 | 19K | |
![[SND]](/icons/sound2.gif) | lmnrid . crim~1.xm | 2018-01-04 15:09 | 20K | |
![[SND]](/icons/sound2.gif) | toothache is gone!.xm | 2018-01-04 15:09 | 20K | |
![[SND]](/icons/sound2.gif) | dn relt.xm | 2018-01-04 15:09 | 21K | |
![[SND]](/icons/sound2.gif) | crm derteddybaer.xm | 2018-01-04 15:09 | 21K | |
![[SND]](/icons/sound2.gif) | damn car lights.xm | 2018-01-04 15:09 | 21K | |
![[SND]](/icons/sound2.gif) | neo-psfnr1.xm | 2018-01-04 15:09 | 21K | |
![[SND]](/icons/sound2.gif) | gummibåt til salgs ..> | 2018-01-04 15:09 | 21K | |
![[SND]](/icons/sound2.gif) | guardian legend main.xm | 2018-01-04 15:09 | 21K | |
![[SND]](/icons/sound2.gif) | the entertainer (1).xm | 2018-01-04 15:09 | 22K | |
![[SND]](/icons/sound2.gif) | silius - stage 1.xm | 2018-01-04 15:09 | 22K | |
![[SND]](/icons/sound2.gif) | sippi-22.xm | 2018-01-04 15:09 | 22K | |
![[SND]](/icons/sound2.gif) | grooviee in da house.xm | 2018-01-04 15:09 | 22K | |
![[SND]](/icons/sound2.gif) | megaman 4 bright man.xm | 2018-01-04 15:09 | 22K | |
![[SND]](/icons/sound2.gif) | mega man 6 flame man.xm | 2018-01-04 15:09 | 23K | |
![[SND]](/icons/sound2.gif) | mega man elec man s.xm | 2018-01-04 15:09 | 23K | |
![[SND]](/icons/sound2.gif) | life goes on..xm | 2018-01-04 15:09 | 23K | |
![[SND]](/icons/sound2.gif) | i r an blueberry.xm | 2018-01-04 15:09 | 24K | |
![[SND]](/icons/sound2.gif) | monday forever.xm | 2018-01-04 15:09 | 24K | |
![[SND]](/icons/sound2.gif) | computericed world.xm | 2018-01-04 15:09 | 24K | |
![[SND]](/icons/sound2.gif) | joulupukki.xm | 2018-01-04 15:09 | 24K | |
![[SND]](/icons/sound2.gif) | drifitng away.xm | 2018-01-04 15:09 | 24K | |
![[SND]](/icons/sound2.gif) | traveller's chrono 2.xm | 2018-01-04 15:09 | 24K | |
![[SND]](/icons/sound2.gif) | estrellado.xm | 2018-01-04 15:09 | 24K | |
![[SND]](/icons/sound2.gif) | charcoal entropy.xm | 2018-01-04 15:09 | 25K | |
![[SND]](/icons/sound2.gif) | i wanna walk with u.xm | 2018-01-04 15:09 | 25K | |
![[SND]](/icons/sound2.gif) | rzr 0xx00.xm | 2018-01-04 15:09 | 25K | |
![[SND]](/icons/sound2.gif) | circle it muffin.xm | 2018-01-04 15:09 | 26K | |
![[SND]](/icons/sound2.gif) | chiptechno.xm | 2018-01-04 15:09 | 26K | |
![[SND]](/icons/sound2.gif) | cowboy.xm | 2018-01-04 15:09 | 26K | |
![[SND]](/icons/sound2.gif) | lullaby zetesisaa.xm | 2018-01-04 15:09 | 26K | |
![[SND]](/icons/sound2.gif) | commandoz...ut tune.xm | 2018-01-04 15:09 | 26K | |
![[SND]](/icons/sound2.gif) | singapore.xm | 2018-01-04 15:09 | 27K | |
![[SND]](/icons/sound2.gif) | santa arabia.xm | 2018-01-04 15:09 | 27K | |
![[SND]](/icons/sound2.gif) | sq-nostalgi.xm | 2018-01-04 15:09 | 28K | |
![[SND]](/icons/sound2.gif) | mm4 cossack 3 & 4.xm | 2018-01-04 15:09 | 28K | |
![[SND]](/icons/sound2.gif) | turhin2.xm | 2018-01-04 15:09 | 28K | |
![[SND]](/icons/sound2.gif) | don't know its name.xm | 2018-01-04 15:09 | 28K | |
![[SND]](/icons/sound2.gif) | souly chipy.xm | 2018-01-04 15:09 | 28K | |
![[SND]](/icons/sound2.gif) | rain-on-sunday.xm | 2018-01-04 15:09 | 29K | |
![[SND]](/icons/sound2.gif) | town.xm | 2018-01-04 15:09 | 29K | |
![[SND]](/icons/sound2.gif) | tetris 2 intermissi.xm | 2018-01-04 15:09 | 29K | |
![[SND]](/icons/sound2.gif) | pw-submergence.xm | 2018-01-04 15:09 | 29K | |
![[SND]](/icons/sound2.gif) | chip the evil.xm | 2018-01-04 15:09 | 30K | |
![[SND]](/icons/sound2.gif) | muug.xm | 2018-01-04 15:09 | 30K | |
![[SND]](/icons/sound2.gif) | octopussy to the par..> | 2018-01-04 15:09 | 30K | |
![[SND]](/icons/sound2.gif) | mm3spark.xm | 2018-01-04 15:09 | 31K | |
![[SND]](/icons/sound2.gif) | turhin.xm | 2018-01-04 15:09 | 31K | |
![[SND]](/icons/sound2.gif) | dissolve.xm | 2018-01-04 15:09 | 31K | |
![[SND]](/icons/sound2.gif) | optima 32k.xm | 2018-01-04 15:09 | 31K | |
![[SND]](/icons/sound2.gif) | mus2.xm | 2018-01-04 15:09 | 31K | |
![[SND]](/icons/sound2.gif) | zion gates.xm | 2018-01-04 15:09 | 31K | |
![[SND]](/icons/sound2.gif) | hoak - kernkraft 400.xm | 2018-01-04 15:09 | 32K | |
![[SND]](/icons/sound2.gif) | whiterose.xm | 2018-01-04 15:09 | 32K | |
![[SND]](/icons/sound2.gif) | hitchhike.xm | 2018-01-04 15:09 | 32K | |
![[SND]](/icons/sound2.gif) | deep anal expedition.xm | 2018-01-04 15:09 | 32K | |
![[SND]](/icons/sound2.gif) | have a cigarr !.xm | 2018-01-04 15:09 | 33K | |
![[SND]](/icons/sound2.gif) | forward (1).xm | 2018-01-04 15:09 | 33K | |
![[SND]](/icons/sound2.gif) | ™pjs,eseev!.xm | 2018-01-04 15:09 | 33K | |
![[SND]](/icons/sound2.gif) | melkein.xm | 2018-01-04 15:09 | 34K | |
![[SND]](/icons/sound2.gif) | daj pian.xm | 2018-01-04 15:09 | 34K | |
![[SND]](/icons/sound2.gif) | team haze keygen 2.xm | 2018-01-04 15:09 | 34K | |
![[SND]](/icons/sound2.gif) | the unknowingness.xm | 2018-01-04 15:09 | 35K | |
![[SND]](/icons/sound2.gif) | zak theme...xm | 2018-01-04 15:09 | 35K | |
![[SND]](/icons/sound2.gif) | letkis.xm | 2018-01-04 15:09 | 35K | |
![[SND]](/icons/sound2.gif) | out of imagination.xm | 2018-01-04 15:09 | 35K | |
![[SND]](/icons/sound2.gif) | microchip.xm | 2018-01-04 15:09 | 36K | |
![[SND]](/icons/sound2.gif) | rampage.xm | 2018-01-04 15:09 | 36K | |
![[SND]](/icons/sound2.gif) | x2 - theme.xm | 2018-01-04 15:09 | 37K | |
![[SND]](/icons/sound2.gif) | ic-1, k-01, tb-303.xm | 2018-01-04 15:09 | 38K | |
![[SND]](/icons/sound2.gif) | hidup bersama.xm | 2018-01-04 15:09 | 38K | |
![[SND]](/icons/sound2.gif) | crm save my soul.xm | 2018-01-04 15:09 | 38K | |
![[SND]](/icons/sound2.gif) | truddelutt.xm | 2018-01-04 15:09 | 38K | |
![[SND]](/icons/sound2.gif) | gus version.xm | 2018-01-04 15:09 | 38K | |
![[SND]](/icons/sound2.gif) | tomten brinner.xm | 2018-01-04 15:09 | 38K | |
![[SND]](/icons/sound2.gif) | plv-trax.xm | 2018-01-04 15:09 | 38K | |
![[SND]](/icons/sound2.gif) | starlite schnooz.xm | 2018-01-04 15:09 | 39K | |
![[SND]](/icons/sound2.gif) | moment of agony.xm | 2018-01-04 15:09 | 40K | |
![[SND]](/icons/sound2.gif) | ignition 2331.xm | 2018-01-04 15:09 | 40K | |
![[SND]](/icons/sound2.gif) | hongkong kongbong.xm | 2018-01-04 15:09 | 40K | |
![[SND]](/icons/sound2.gif) | mrgfunk3.xm | 2018-01-04 15:09 | 41K | |
![[SND]](/icons/sound2.gif) | stal-heh.xm | 2018-01-04 15:09 | 42K | |
![[SND]](/icons/sound2.gif) | treasure iland dizzy.xm | 2018-01-04 15:09 | 42K | |
![[SND]](/icons/sound2.gif) | extrodyle.xm | 2018-01-04 15:09 | 43K | |
![[SND]](/icons/sound2.gif) | dn next.xm | 2018-01-04 15:09 | 44K | |
![[SND]](/icons/sound2.gif) | your touch.xm | 2018-01-04 15:09 | 44K | |
![[SND]](/icons/sound2.gif) | shiftless.xm | 2018-01-04 15:09 | 45K | |
![[SND]](/icons/sound2.gif) | sa heidi.xm | 2018-01-04 15:09 | 45K | |
![[SND]](/icons/sound2.gif) | flow.xm | 2018-01-04 15:09 | 45K | |
![[SND]](/icons/sound2.gif) | welcome.xm | 2018-01-04 15:09 | 45K | |
![[SND]](/icons/sound2.gif) | m-fp.xm | 2018-01-04 15:09 | 46K | |
![[SND]](/icons/sound2.gif) | maxtestsong.xm | 2018-01-04 15:09 | 46K | |
![[SND]](/icons/sound2.gif) | DUST (1).XM | 2018-01-04 15:09 | 46K | |
![[SND]](/icons/sound2.gif) | metalman stage.xm | 2018-01-04 15:09 | 46K | |
![[SND]](/icons/sound2.gif) | chips22.xm | 2018-01-04 15:09 | 46K | |
![[SND]](/icons/sound2.gif) | the fortress.jam.96.xm | 2018-01-04 15:09 | 46K | |
![[SND]](/icons/sound2.gif) | gewrhem.xm | 2018-01-04 15:09 | 47K | |
![[SND]](/icons/sound2.gif) | likwit motha.xm | 2018-01-04 15:09 | 47K | |
![[SND]](/icons/sound2.gif) | crm teenagerlove.xm | 2018-01-04 15:09 | 47K | |
![[SND]](/icons/sound2.gif) | exceptance.xm | 2018-01-04 15:09 | 47K | |
![[SND]](/icons/sound2.gif) | JULEMI~2.XM | 2018-01-04 15:09 | 47K | |
![[SND]](/icons/sound2.gif) | plimputus!.xm | 2018-01-04 15:09 | 47K | |
![[SND]](/icons/sound2.gif) | noname1.xm | 2018-01-04 15:09 | 47K | |
![[SND]](/icons/sound2.gif) | village smile.xm | 2018-01-04 15:09 | 48K | |
![[SND]](/icons/sound2.gif) | zap.xm | 2018-01-04 15:09 | 49K | |
![[SND]](/icons/sound2.gif) | tuporkuloosi.xm | 2018-01-04 15:09 | 49K | |
![[SND]](/icons/sound2.gif) | tutu.xm | 2018-01-04 15:09 | 49K | |
![[SND]](/icons/sound2.gif) | we go....xm | 2018-01-04 15:09 | 50K | |
![[SND]](/icons/sound2.gif) | crm sinceyouleft.xm | 2018-01-04 15:09 | 50K | |
![[SND]](/icons/sound2.gif) | visions.xm | 2018-01-04 15:09 | 51K | |
![[SND]](/icons/sound2.gif) | yes i do (all 4 u).xm | 2018-01-04 15:09 | 51K | |
![[SND]](/icons/sound2.gif) | farewell.xm | 2018-01-04 15:09 | 52K | |
![[SND]](/icons/sound2.gif) | mom.xm | 2018-01-04 15:09 | 52K | |
![[SND]](/icons/sound2.gif) | melod mania by uct.xm | 2018-01-04 15:09 | 52K | |
![[SND]](/icons/sound2.gif) | hunppa.xm | 2018-01-04 15:09 | 52K | |
![[SND]](/icons/sound2.gif) | the lonely bird (p).xm | 2018-01-04 15:09 | 54K | |
![[SND]](/icons/sound2.gif) | go go!.xm | 2018-01-04 15:09 | 54K | |
![[SND]](/icons/sound2.gif) | rumnpeis.xm | 2018-01-04 15:09 | 54K | |
![[SND]](/icons/sound2.gif) | sm64 ending remix.xm | 2018-01-04 15:09 | 55K | |
![[SND]](/icons/sound2.gif) | echoes of darkness.xm | 2018-01-04 15:09 | 55K | |
![[SND]](/icons/sound2.gif) | gothacia.xm | 2018-01-04 15:09 | 55K | |
![[SND]](/icons/sound2.gif) | not beck!.xm | 2018-01-04 15:09 | 55K | |
![[SND]](/icons/sound2.gif) | sur skog.xm | 2018-01-04 15:09 | 56K | |
![[SND]](/icons/sound2.gif) | tmp 1.xm | 2018-01-04 15:09 | 56K | |
![[SND]](/icons/sound2.gif) | crappaclappa.xm | 2018-01-04 15:09 | 56K | |
![[SND]](/icons/sound2.gif) | trinaty quest iv.xm | 2018-01-04 15:09 | 56K | |
![[SND]](/icons/sound2.gif) | folky song.xm | 2018-01-04 15:09 | 56K | |
![[SND]](/icons/sound2.gif) | why i can't go away.xm | 2018-01-04 15:09 | 57K | |
![[SND]](/icons/sound2.gif) | swingin'on my rainbo.xm | 2018-01-04 15:09 | 57K | |
![[SND]](/icons/sound2.gif) | nelpel four.xm | 2018-01-04 15:09 | 57K | |
![[SND]](/icons/sound2.gif) | s l u r f v.11b.xm | 2018-01-04 15:09 | 57K | |
![[SND]](/icons/sound2.gif) | imagine -punkk remix.xm | 2018-01-04 15:09 | 58K | |
![[SND]](/icons/sound2.gif) | when i was out...xm | 2018-01-04 15:09 | 58K | |
![[SND]](/icons/sound2.gif) | looseronlaugh.xm | 2018-01-04 15:09 | 58K | |
![[SND]](/icons/sound2.gif) | listentosd.xm | 2018-01-04 15:09 | 58K | |
![[SND]](/icons/sound2.gif) | imperfect.xm | 2018-01-04 15:09 | 58K | |
![[SND]](/icons/sound2.gif) | mrtvy ma klid.xm | 2018-01-04 15:09 | 59K | |
![[SND]](/icons/sound2.gif) | don't fight anymore.xm | 2018-01-04 15:09 | 59K | |
![[SND]](/icons/sound2.gif) | defcon disk-mag.xm | 2018-01-04 15:09 | 59K | |
![[SND]](/icons/sound2.gif) | humpf 1.xm | 2018-01-04 15:09 | 59K | |
![[SND]](/icons/sound2.gif) | in stuma (v. 11c).xm | 2018-01-04 15:09 | 61K | |
![[SND]](/icons/sound2.gif) | groove-a-thon.xm | 2018-01-04 15:09 | 62K | |
![[SND]](/icons/sound2.gif) | the new giff.xm | 2018-01-04 15:09 | 62K | |
![[SND]](/icons/sound2.gif) | leach - garagedz.xm | 2018-01-04 15:09 | 62K | |
![[SND]](/icons/sound2.gif) | inner of myself.xm | 2018-01-04 15:09 | 63K | |
![[SND]](/icons/sound2.gif) | the inner of myself.xm | 2018-01-04 15:09 | 63K | |
![[SND]](/icons/sound2.gif) | quandihacom.xm | 2018-01-04 15:09 | 63K | |
![[SND]](/icons/sound2.gif) | dance mania 2.xm | 2018-01-04 15:09 | 63K | |
![[SND]](/icons/sound2.gif) | landscapes.xm | 2018-01-04 15:09 | 63K | |
![[SND]](/icons/sound2.gif) | time wasting contest.xm | 2018-01-04 15:09 | 63K | |
![[SND]](/icons/sound2.gif) | chipsynch.xm | 2018-01-04 15:09 | 64K | |
![[SND]](/icons/sound2.gif) | harmonia.xm | 2018-01-04 15:09 | 64K | |
![[SND]](/icons/sound2.gif) | ufoflow.xm | 2018-01-04 15:09 | 64K | |
![[SND]](/icons/sound2.gif) | the future and the p.xm | 2018-01-04 15:09 | 66K | |
![[SND]](/icons/sound2.gif) | kovat pojat.xm | 2018-01-04 15:09 | 66K | |
![[SND]](/icons/sound2.gif) | ninna-nanna.xm | 2018-01-04 15:09 | 66K | |
![[SND]](/icons/sound2.gif) | majvor & friends.xm | 2018-01-04 15:09 | 66K | |
![[SND]](/icons/sound2.gif) | holding my thoughts.xm | 2018-01-04 15:09 | 66K | |
![[SND]](/icons/sound2.gif) | trinaty quest ii.xm | 2018-01-04 15:09 | 67K | |
![[SND]](/icons/sound2.gif) | turha.xm | 2018-01-04 15:09 | 67K | |
![[SND]](/icons/sound2.gif) | cold brain.xm | 2018-01-04 15:09 | 67K | |
![[SND]](/icons/sound2.gif) | depth.xm | 2018-01-04 15:09 | 67K | |
![[SND]](/icons/sound2.gif) | raining in heaven.xm | 2018-01-04 15:09 | 67K | |
![[SND]](/icons/sound2.gif) | nukkumatti.xm | 2018-01-04 15:09 | 68K | |
![[SND]](/icons/sound2.gif) | tw-on707.xm | 2018-01-04 15:09 | 68K | |
![[SND]](/icons/sound2.gif) | xmas - remix.xm | 2018-01-04 15:09 | 68K | |
![[SND]](/icons/sound2.gif) | taccsdam.xm | 2018-01-04 15:09 | 68K | |
![[SND]](/icons/sound2.gif) | giana sisters.xm | 2018-01-04 15:09 | 69K | |
![[SND]](/icons/sound2.gif) | dosong.xm | 2018-01-04 15:09 | 70K | |
![[SND]](/icons/sound2.gif) | zombie.xm | 2018-01-04 15:09 | 70K | |
![[SND]](/icons/sound2.gif) | doctor who - mix ).xm | 2018-01-04 15:09 | 71K | |
![[SND]](/icons/sound2.gif) | wizardry -by raccoon.xm | 2018-01-04 15:09 | 71K | |
![[SND]](/icons/sound2.gif) | lk cancl.xm | 2018-01-04 15:09 | 71K | |
![[SND]](/icons/sound2.gif) | i'm in love!.xm | 2018-01-04 15:09 | 71K | |
![[SND]](/icons/sound2.gif) | timmy alltkan.xm | 2018-01-04 15:09 | 71K | |
![[SND]](/icons/sound2.gif) | electric beat.xm | 2018-01-04 15:09 | 71K | |
![[SND]](/icons/sound2.gif) | shame (031).xm | 2018-01-04 15:09 | 72K | |
![[SND]](/icons/sound2.gif) | úmarks way downú.xm | 2018-01-04 15:09 | 72K | |
![[SND]](/icons/sound2.gif) | minejaaaa!!!!!!.xm | 2018-01-04 15:09 | 72K | |
![[SND]](/icons/sound2.gif) | nice fruitdenkade.xm | 2018-01-04 15:09 | 72K | |
![[SND]](/icons/sound2.gif) | grims.xm | 2018-01-04 15:09 | 73K | |
![[SND]](/icons/sound2.gif) | mark's klingon-remix.xm | 2018-01-04 15:09 | 73K | |
![[SND]](/icons/sound2.gif) | fade to water.xm | 2018-01-04 15:09 | 73K | |
![[SND]](/icons/sound2.gif) | giana sisters ingame.xm | 2018-01-04 15:09 | 75K | |
![[SND]](/icons/sound2.gif) | stcold.xm | 2018-01-04 15:09 | 75K | |
![[SND]](/icons/sound2.gif) | swedish ghey music.xm | 2018-01-04 15:09 | 75K | |
![[SND]](/icons/sound2.gif) | jolly! =).xm | 2018-01-04 15:09 | 75K | |
![[SND]](/icons/sound2.gif) | desolate the castle.xm | 2018-01-04 15:09 | 75K | |
![[SND]](/icons/sound2.gif) | elastic plastic.xm | 2018-01-04 15:09 | 76K | |
![[SND]](/icons/sound2.gif) | nitro8.xm | 2018-01-04 15:09 | 76K | |
![[SND]](/icons/sound2.gif) | song of storms.xm | 2018-01-04 15:09 | 76K | |
![[SND]](/icons/sound2.gif) | t o r a k k a - song.xm | 2018-01-04 15:09 | 77K | |
![[SND]](/icons/sound2.gif) | v hlave mam hovno.xm | 2018-01-04 15:09 | 77K | |
![[SND]](/icons/sound2.gif) | timmy chips3.xm | 2018-01-04 15:09 | 77K | |
![[SND]](/icons/sound2.gif) | mechanical and super.xm | 2018-01-04 15:09 | 78K | |
![[SND]](/icons/sound2.gif) | time for sale.xm | 2018-01-04 15:09 | 78K | |
![[SND]](/icons/sound2.gif) | gudrun.xm | 2018-01-04 15:09 | 78K | |
![[SND]](/icons/sound2.gif) | imagine.xm | 2018-01-04 15:09 | 78K | |
![[SND]](/icons/sound2.gif) | smashing settlers.xm | 2018-01-04 15:09 | 80K | |
![[SND]](/icons/sound2.gif) | the old piano rag.xm | 2018-01-04 15:09 | 80K | |
![[SND]](/icons/sound2.gif) | piece of cake.xm | 2018-01-04 15:09 | 81K | |
![[SND]](/icons/sound2.gif) | summer song spiikki.xm | 2018-01-04 15:09 | 81K | |
![[SND]](/icons/sound2.gif) | moonshine intro ().xm | 2018-01-04 15:09 | 81K | |
![[SND]](/icons/sound2.gif) | short song by a.soft.xm | 2018-01-04 15:09 | 81K | |
![[SND]](/icons/sound2.gif) | chips.xm | 2018-01-04 15:09 | 81K | |
![[SND]](/icons/sound2.gif) | timmy chips.xm | 2018-01-04 15:09 | 81K | |
![[SND]](/icons/sound2.gif) | good night!.xm | 2018-01-04 15:09 | 81K | |
![[SND]](/icons/sound2.gif) | gangsta's paradise.xm | 2018-01-04 15:09 | 82K | |
![[SND]](/icons/sound2.gif) | jule-p0ttp0rri.xm | 2018-01-04 15:09 | 82K | |
![[SND]](/icons/sound2.gif) | sto lat.xm | 2018-01-04 15:09 | 82K | |
![[SND]](/icons/sound2.gif) | i w0nder(mix).xm | 2018-01-04 15:09 | 83K | |
![[SND]](/icons/sound2.gif) | coco jamboo.xm | 2018-01-04 15:09 | 83K | |
![[SND]](/icons/sound2.gif) | circle of shit.xm | 2018-01-04 15:09 | 83K | |
![[SND]](/icons/sound2.gif) | rememberance.xm | 2018-01-04 15:09 | 83K | |
![[SND]](/icons/sound2.gif) | jesty.xm | 2018-01-04 15:09 | 83K | |
![[SND]](/icons/sound2.gif) | donna lee v1.0.xm | 2018-01-04 15:09 | 84K | |
![[SND]](/icons/sound2.gif) | she relaxes (1).xm | 2018-01-04 15:09 | 84K | |
![[SND]](/icons/sound2.gif) | limecity.xm | 2018-01-04 15:09 | 85K | |
![[SND]](/icons/sound2.gif) | return of the........xm | 2018-01-04 15:09 | 85K | |
![[SND]](/icons/sound2.gif) | sndrv2.xm | 2018-01-04 15:09 | 86K | |
![[SND]](/icons/sound2.gif) | tetris000b.xm | 2018-01-04 15:09 | 87K | |
![[SND]](/icons/sound2.gif) | fate in haze.xm | 2018-01-04 15:09 | 88K | |
![[SND]](/icons/sound2.gif) | darksonic theme.xm | 2018-01-04 15:09 | 88K | |
![[SND]](/icons/sound2.gif) | lord determination.xm | 2018-01-04 15:09 | 88K | |
![[SND]](/icons/sound2.gif) | super mario 2.xm | 2018-01-04 15:09 | 89K | |
![[SND]](/icons/sound2.gif) | ns.xm | 2018-01-04 15:09 | 90K | |
![[SND]](/icons/sound2.gif) | synphonique.xm | 2018-01-04 15:09 | 90K | |
![[SND]](/icons/sound2.gif) | toon boost double.xm | 2018-01-04 15:09 | 91K | |
![[SND]](/icons/sound2.gif) | sld-teqi.xm | 2018-01-04 15:09 | 92K | |
![[SND]](/icons/sound2.gif) | maverick.xm | 2018-01-04 15:09 | 92K | |
![[SND]](/icons/sound2.gif) | computerwelt.xm | 2018-01-04 15:09 | 92K | |
![[SND]](/icons/sound2.gif) | gla a fin.xm | 2018-01-04 15:09 | 93K | |
![[SND]](/icons/sound2.gif) | horrooorr.xm | 2018-01-04 15:09 | 93K | |
![[SND]](/icons/sound2.gif) | what h-h !no shit!.xm | 2018-01-04 15:09 | 94K | |
![[SND]](/icons/sound2.gif) | lady with a gun.xm | 2018-01-04 15:09 | 94K | |
![[SND]](/icons/sound2.gif) | in da junga -spk.xm | 2018-01-04 15:09 | 94K | |
![[SND]](/icons/sound2.gif) | furelis2.xm | 2018-01-04 15:09 | 95K | |
![[SND]](/icons/sound2.gif) | fury.xm | 2018-01-04 15:09 | 96K | |
![[SND]](/icons/sound2.gif) | total control.xm | 2018-01-04 15:09 | 96K | |
![[SND]](/icons/sound2.gif) | song 41.xm | 2018-01-04 15:09 | 97K | |
![[SND]](/icons/sound2.gif) | divine.xm | 2018-01-04 15:09 | 97K | |
![[SND]](/icons/sound2.gif) | fuck no jaymz! ext.xm | 2018-01-04 15:09 | 97K | |
![[SND]](/icons/sound2.gif) | ei itketä lauantain..> | 2018-01-04 15:09 | 97K | |
![[SND]](/icons/sound2.gif) | sfunpa.xm | 2018-01-04 15:09 | 98K | |
![[SND]](/icons/sound2.gif) | kiss from a rose.xm | 2018-01-04 15:09 | 98K | |
![[SND]](/icons/sound2.gif) | rising sun f0r helve..> | 2018-01-04 15:09 | 98K | |
![[SND]](/icons/sound2.gif) | constructor x.xm | 2018-01-04 15:09 | 98K | |
![[SND]](/icons/sound2.gif) | no limit (rmx).xm | 2018-01-04 15:09 | 98K | |
![[SND]](/icons/sound2.gif) | whatta.xm | 2018-01-04 15:09 | 98K | |
![[SND]](/icons/sound2.gif) | fuck.xm | 2018-01-04 15:09 | 98K | |
![[SND]](/icons/sound2.gif) | twofaces.xm | 2018-01-04 15:09 | 98K | |
![[SND]](/icons/sound2.gif) | shikaku - free.xm | 2018-01-04 15:09 | 98K | |
![[SND]](/icons/sound2.gif) | what to do now.xm | 2018-01-04 15:09 | 99K | |
![[SND]](/icons/sound2.gif) | me ollaan kuninkaita.xm | 2018-01-04 15:09 | 99K | |
![[SND]](/icons/sound2.gif) | periodance.xm | 2018-01-04 15:09 | 99K | |
![[SND]](/icons/sound2.gif) | my friends - r.h.c.p.xm | 2018-01-04 15:09 | 100K | |
![[SND]](/icons/sound2.gif) | memories...~1.xm | 2018-01-04 15:09 | 100K | |
![[SND]](/icons/sound2.gif) | cognition.xm | 2018-01-04 15:09 | 101K | |
![[SND]](/icons/sound2.gif) | JL08.XM | 2018-01-04 15:09 | 103K | |
![[SND]](/icons/sound2.gif) | neo-rene.xm | 2018-01-04 15:09 | 103K | |
![[SND]](/icons/sound2.gif) | guitaris.xm | 2018-01-04 15:09 | 104K | |
![[SND]](/icons/sound2.gif) | ground mezt - sub 96.xm | 2018-01-04 15:09 | 104K | |
![[SND]](/icons/sound2.gif) | smokin.xm | 2018-01-04 15:09 | 105K | |
![[SND]](/icons/sound2.gif) | new beginning.xm | 2018-01-04 15:09 | 105K | |
![[SND]](/icons/sound2.gif) | hypnotised.xm | 2018-01-04 15:09 | 105K | |
![[SND]](/icons/sound2.gif) | the reactor.xm | 2018-01-04 15:09 | 105K | |
![[SND]](/icons/sound2.gif) | rock da crematorium!.xm | 2018-01-04 15:09 | 105K | |
![[SND]](/icons/sound2.gif) | eye.xm | 2018-01-04 15:09 | 106K | |
![[SND]](/icons/sound2.gif) | trauma comun -uctumi.xm | 2018-01-04 15:09 | 106K | |
![[SND]](/icons/sound2.gif) | w3wp.xm | 2018-01-04 15:09 | 107K | |
![[SND]](/icons/sound2.gif) | no-name.xm | 2018-01-04 15:09 | 107K | |
![[SND]](/icons/sound2.gif) | so far away.xm | 2018-01-04 15:09 | 108K | |
![[SND]](/icons/sound2.gif) | grace.xm | 2018-01-04 15:09 | 108K | |
![[SND]](/icons/sound2.gif) | hooreur !!!.xm | 2018-01-04 15:09 | 109K | |
![[SND]](/icons/sound2.gif) | kong college.xm | 2018-01-04 15:09 | 109K | |
![[SND]](/icons/sound2.gif) | head of amatourship.xm | 2018-01-04 15:09 | 109K | |
![[SND]](/icons/sound2.gif) | train 231.xm | 2018-01-04 15:09 | 109K | |
![[SND]](/icons/sound2.gif) | legalize it.xm | 2018-01-04 15:09 | 109K | |
![[SND]](/icons/sound2.gif) | companhia do pagode.xm | 2018-01-04 15:09 | 109K | |
![[SND]](/icons/sound2.gif) | jungel techno!.xm | 2018-01-04 15:09 | 110K | |
![[SND]](/icons/sound2.gif) | fd.xm | 2018-01-04 15:09 | 111K | |
![[SND]](/icons/sound2.gif) | landos.xm | 2018-01-04 15:09 | 111K | |
![[SND]](/icons/sound2.gif) | darkm5.xm.xpk | 2018-01-04 15:09 | 111K | |
![[SND]](/icons/sound2.gif) | christmasmod.xm | 2018-01-04 15:09 | 111K | |
![[SND]](/icons/sound2.gif) | marching at dawn.xm | 2018-01-04 15:09 | 112K | |
![[SND]](/icons/sound2.gif) | triphop.xm | 2018-01-04 15:09 | 113K | |
![[SND]](/icons/sound2.gif) | proc - ss1.xm | 2018-01-04 15:09 | 114K | |
![[SND]](/icons/sound2.gif) | mr code funk 506.xm | 2018-01-04 15:09 | 114K | |
![[SND]](/icons/sound2.gif) | dream (1).xm | 2018-01-04 15:09 | 114K | |
![[SND]](/icons/sound2.gif) | in trance... (c) sr.xm | 2018-01-04 15:09 | 117K | |
![[SND]](/icons/sound2.gif) | human arrival.xm | 2018-01-04 15:09 | 117K | |
![[SND]](/icons/sound2.gif) | guitar ballad.xm | 2018-01-04 15:09 | 117K | |
![[SND]](/icons/sound2.gif) | modemulance.xm | 2018-01-04 15:09 | 118K | |
![[SND]](/icons/sound2.gif) | happy land.xm | 2018-01-04 15:09 | 118K | |
![[SND]](/icons/sound2.gif) | kikapoo.xm | 2018-01-04 15:09 | 119K | |
![[SND]](/icons/sound2.gif) | fiesta (1).xm | 2018-01-04 15:09 | 119K | |
![[SND]](/icons/sound2.gif) | nakilah.xm | 2018-01-04 15:09 | 119K | |
![[SND]](/icons/sound2.gif) | forest battle part 1.xm | 2018-01-04 15:09 | 120K | |
![[SND]](/icons/sound2.gif) | silence of mind..xm | 2018-01-04 15:09 | 120K | |
![[SND]](/icons/sound2.gif) | reflectivity.xm | 2018-01-04 15:09 | 121K | |
![[SND]](/icons/sound2.gif) | confession.xm | 2018-01-04 15:09 | 121K | |
![[SND]](/icons/sound2.gif) | fine experimental.xm | 2018-01-04 15:09 | 121K | |
![[SND]](/icons/sound2.gif) | trinaty quest iii.xm | 2018-01-04 15:09 | 121K | |
![[SND]](/icons/sound2.gif) | tomorrow is payday.xm | 2018-01-04 15:09 | 121K | |
![[SND]](/icons/sound2.gif) | endowment [p1].xm | 2018-01-04 15:09 | 122K | |
![[SND]](/icons/sound2.gif) | what!!!!.xm | 2018-01-04 15:09 | 122K | |
![[SND]](/icons/sound2.gif) | tetrorels.xm | 2018-01-04 15:09 | 123K | |
![[SND]](/icons/sound2.gif) | icq.xm | 2018-01-04 15:09 | 124K | |
![[SND]](/icons/sound2.gif) | tiny toons.xm | 2018-01-04 15:09 | 124K | |
![[SND]](/icons/sound2.gif) | menardi (o o).xm | 2018-01-04 15:09 | 125K | |
![[SND]](/icons/sound2.gif) | heroes.xm | 2018-01-04 15:09 | 125K | |
![[SND]](/icons/sound2.gif) | ost etude.xm | 2018-01-04 15:09 | 125K | |
![[SND]](/icons/sound2.gif) | sisaso.xm | 2018-01-04 15:09 | 125K | |
![[SND]](/icons/sound2.gif) | pulsation.xm | 2018-01-04 15:09 | 125K | |
![[SND]](/icons/sound2.gif) | every day is a trip.xm | 2018-01-04 15:09 | 126K | |
![[SND]](/icons/sound2.gif) | circle of sounds.xm | 2018-01-04 15:09 | 126K | |
![[SND]](/icons/sound2.gif) | echodreaminloudnoise.xm | 2018-01-04 15:09 | 126K | |
![[SND]](/icons/sound2.gif) | hardcore attack !now.xm | 2018-01-04 15:09 | 126K | |
![[SND]](/icons/sound2.gif) | christie road.xm | 2018-01-04 15:09 | 126K | |
![[SND]](/icons/sound2.gif) | forest battle part 2.xm | 2018-01-04 15:09 | 127K | |
![[SND]](/icons/sound2.gif) | doomsday.xm | 2018-01-04 15:09 | 127K | |
![[SND]](/icons/sound2.gif) | dreamon by it-alien.xm | 2018-01-04 15:09 | 127K | |
![[SND]](/icons/sound2.gif) | loco.xm | 2018-01-04 15:09 | 127K | |
![[SND]](/icons/sound2.gif) | i love u '96 re-edit.xm | 2018-01-04 15:09 | 127K | |
![[SND]](/icons/sound2.gif) | track6-r-mixed.xm | 2018-01-04 15:09 | 128K | |
![[SND]](/icons/sound2.gif) | peace.xm | 2018-01-04 15:09 | 128K | |
![[SND]](/icons/sound2.gif) | ep-noname.xm | 2018-01-04 15:09 | 128K | |
![[SND]](/icons/sound2.gif) | mondeo.xm | 2018-01-04 15:09 | 129K | |
![[SND]](/icons/sound2.gif) | sad.xm | 2018-01-04 15:09 | 129K | |
![[SND]](/icons/sound2.gif) | mundane -- tempest.xm | 2018-01-04 15:09 | 130K | |
![[SND]](/icons/sound2.gif) | looks like jazzy man.xm | 2018-01-04 15:09 | 130K | |
![[SND]](/icons/sound2.gif) | ravintelin pojat.xm | 2018-01-04 15:09 | 130K | |
![[SND]](/icons/sound2.gif) | suckness (cubik).xm | 2018-01-04 15:09 | 131K | |
![[SND]](/icons/sound2.gif) | trinaty quest i.xm | 2018-01-04 15:09 | 131K | |
![[SND]](/icons/sound2.gif) | go higher.xm | 2018-01-04 15:09 | 131K | |
![[SND]](/icons/sound2.gif) | moons and satellites.xm | 2018-01-04 15:09 | 131K | |
![[SND]](/icons/sound2.gif) | hoffman.xm | 2018-01-04 15:09 | 131K | |
![[SND]](/icons/sound2.gif) | nemesis 2 - metalion.xm | 2018-01-04 15:09 | 131K | |
![[SND]](/icons/sound2.gif) | magus's theme.xm | 2018-01-04 15:09 | 132K | |
![[SND]](/icons/sound2.gif) | make you happy.xm | 2018-01-04 15:09 | 132K | |
![[SND]](/icons/sound2.gif) | rave beats [p2].xm | 2018-01-04 15:09 | 133K | |
![[SND]](/icons/sound2.gif) | less is more !.xm | 2018-01-04 15:09 | 133K | |
![[SND]](/icons/sound2.gif) | hurt (255).xm | 2018-01-04 15:09 | 134K | |
![[SND]](/icons/sound2.gif) | pali1st.xm | 2018-01-04 15:09 | 134K | |
![[SND]](/icons/sound2.gif) | ingame2.xm | 2018-01-04 15:09 | 134K | |
![[SND]](/icons/sound2.gif) | wowdance.xm | 2018-01-04 15:09 | 135K | |
![[SND]](/icons/sound2.gif) | did you love me.xm | 2018-01-04 15:09 | 135K | |
![[SND]](/icons/sound2.gif) | the badtrip pt2.xm | 2018-01-04 15:09 | 135K | |
![[SND]](/icons/sound2.gif) | negative time.xm | 2018-01-04 15:09 | 135K | |
![[SND]](/icons/sound2.gif) | dungeon xplorers.xm | 2018-01-04 15:09 | 135K | |
![[SND]](/icons/sound2.gif) | time is over !!!.xm | 2018-01-04 15:09 | 136K | |
![[SND]](/icons/sound2.gif) | devilcore.xm | 2018-01-04 15:09 | 136K | |
![[SND]](/icons/sound2.gif) | fatal experiment.xm | 2018-01-04 15:09 | 136K | |
![[SND]](/icons/sound2.gif) | toredek.xm | 2018-01-04 15:09 | 136K | |
![[SND]](/icons/sound2.gif) | differetiate.xm | 2018-01-04 15:09 | 137K | |
![[SND]](/icons/sound2.gif) | i give up! cruel.xm | 2018-01-04 15:09 | 137K | |
![[SND]](/icons/sound2.gif) | cyco.xm | 2018-01-04 15:09 | 137K | |
![[SND]](/icons/sound2.gif) | lars.xm | 2018-01-04 15:09 | 137K | |
![[SND]](/icons/sound2.gif) | endless.xm | 2018-01-04 15:09 | 137K | |
![[SND]](/icons/sound2.gif) | hermanni is flying.xm | 2018-01-04 15:09 | 137K | |
![[SND]](/icons/sound2.gif) | sunshine in the dawn.xm | 2018-01-04 15:09 | 138K | |
![[SND]](/icons/sound2.gif) | htrance.xm | 2018-01-04 15:09 | 138K | |
![[SND]](/icons/sound2.gif) | classic bluebeat.xm | 2018-01-04 15:09 | 138K | |
![[SND]](/icons/sound2.gif) | experiment-1.xm | 2018-01-04 15:09 | 138K | |
![[SND]](/icons/sound2.gif) | mxm.xm | 2018-01-04 15:09 | 138K | |
![[SND]](/icons/sound2.gif) | hymn to the amiga.xm | 2018-01-04 15:09 | 139K | |
![[SND]](/icons/sound2.gif) | entersandman.xm | 2018-01-04 15:09 | 139K | |
![[SND]](/icons/sound2.gif) | i was me.xm | 2018-01-04 15:09 | 139K | |
![[SND]](/icons/sound2.gif) | leaving sanity.xm | 2018-01-04 15:09 | 140K | |
![[SND]](/icons/sound2.gif) | pajaros de vapor.xm | 2018-01-04 15:09 | 140K | |
![[SND]](/icons/sound2.gif) | rythm is.xm | 2018-01-04 15:09 | 140K | |
![[SND]](/icons/sound2.gif) | peanuts theme.xm | 2018-01-04 15:09 | 140K | |
![[SND]](/icons/sound2.gif) | warrior pt.2.xm | 2018-01-04 15:09 | 141K | |
![[SND]](/icons/sound2.gif) | x - tasy.xm | 2018-01-04 15:09 | 141K | |
![[SND]](/icons/sound2.gif) | future anticipation.xm | 2018-01-04 15:09 | 141K | |
![[SND]](/icons/sound2.gif) | escape in the fog.xm | 2018-01-04 15:09 | 142K | |
![[SND]](/icons/sound2.gif) | res menc.xm | 2018-01-04 15:09 | 143K | |
![[SND]](/icons/sound2.gif) | terminal noise.xm | 2018-01-04 15:09 | 144K | |
![[SND]](/icons/sound2.gif) | starlight-r-mixed.xm | 2018-01-04 15:09 | 145K | |
![[SND]](/icons/sound2.gif) | jungle rain.xm | 2018-01-04 15:09 | 145K | |
![[SND]](/icons/sound2.gif) | possum.xm | 2018-01-04 15:09 | 146K | |
![[SND]](/icons/sound2.gif) | freezerr.xm | 2018-01-04 15:09 | 146K | |
![[SND]](/icons/sound2.gif) | twisting brains.xm | 2018-01-04 15:09 | 146K | |
![[SND]](/icons/sound2.gif) | thoughts from mind.xm | 2018-01-04 15:09 | 146K | |
![[SND]](/icons/sound2.gif) | nelena's world.xm | 2018-01-04 15:09 | 146K | |
![[SND]](/icons/sound2.gif) | dont you... voguemix.xm | 2018-01-04 15:09 | 147K | |
![[SND]](/icons/sound2.gif) | suckerrunner.xm | 2018-01-04 15:09 | 147K | |
![[SND]](/icons/sound2.gif) | out of nowhere.xm | 2018-01-04 15:09 | 147K | |
![[SND]](/icons/sound2.gif) | charly - remix.xm | 2018-01-04 15:09 | 148K | |
![[SND]](/icons/sound2.gif) | pyroclasm.xm | 2018-01-04 15:09 | 148K | |
![[SND]](/icons/sound2.gif) | conspiration.xm | 2018-01-04 15:09 | 148K | |
![[SND]](/icons/sound2.gif) | kick ass 1st.xm | 2018-01-04 15:09 | 149K | |
![[SND]](/icons/sound2.gif) | for great justice.xm | 2018-01-04 15:09 | 149K | |
![[SND]](/icons/sound2.gif) | moonlight sonata.xm | 2018-01-04 15:09 | 149K | |
![[SND]](/icons/sound2.gif) | phroxen cysta.xm | 2018-01-04 15:09 | 150K | |
![[SND]](/icons/sound2.gif) | kung-fu.xm | 2018-01-04 15:09 | 150K | |
![[SND]](/icons/sound2.gif) | the urban dance!!!.xm | 2018-01-04 15:09 | 150K | |
![[SND]](/icons/sound2.gif) | input.data.in.mind.xm | 2018-01-04 15:09 | 150K | |
![[SND]](/icons/sound2.gif) | faster.xm | 2018-01-04 15:09 | 150K | |
![[SND]](/icons/sound2.gif) | the dog called sheba.xm | 2018-01-04 15:09 | 150K | |
![[SND]](/icons/sound2.gif) | krazyness for piano.xm | 2018-01-04 15:09 | 150K | |
![[SND]](/icons/sound2.gif) | unfocused gaze.xm | 2018-01-04 15:09 | 150K | |
![[SND]](/icons/sound2.gif) | southern.xm | 2018-01-04 15:09 | 151K | |
![[SND]](/icons/sound2.gif) | d - base (446).xm | 2018-01-04 15:09 | 151K | |
![[SND]](/icons/sound2.gif) | techno-toccata.xm | 2018-01-04 15:09 | 151K | |
![[SND]](/icons/sound2.gif) | whyare.xm | 2018-01-04 15:09 | 152K | |
![[SND]](/icons/sound2.gif) | presencia lunar.xm | 2018-01-04 15:09 | 152K | |
![[SND]](/icons/sound2.gif) | perturbations.xm | 2018-01-04 15:09 | 152K | |
![[SND]](/icons/sound2.gif) | nitro4.xm | 2018-01-04 15:09 | 153K | |
![[SND]](/icons/sound2.gif) | love !!!.xm | 2018-01-04 15:09 | 153K | |
![[SND]](/icons/sound2.gif) | dreamspace.xm | 2018-01-04 15:09 | 153K | |
![[SND]](/icons/sound2.gif) | the underworld.xm | 2018-01-04 15:09 | 153K | |
![[SND]](/icons/sound2.gif) | so lonely '2000.xm | 2018-01-04 15:09 | 154K | |
![[SND]](/icons/sound2.gif) | stylistic blur.xm | 2018-01-04 15:09 | 154K | |
![[SND]](/icons/sound2.gif) | metal man i.xm | 2018-01-04 15:09 | 154K | |
![[SND]](/icons/sound2.gif) | hesalive.xm | 2018-01-04 15:09 | 154K | |
![[SND]](/icons/sound2.gif) | classic (bakh).xm | 2018-01-04 15:09 | 154K | |
![[SND]](/icons/sound2.gif) | i have a dream.xm | 2018-01-04 15:09 | 155K | |
![[SND]](/icons/sound2.gif) | groove ya.xm | 2018-01-04 15:09 | 155K | |
![[SND]](/icons/sound2.gif) | mvfn.xm | 2018-01-04 15:09 | 155K | |
![[SND]](/icons/sound2.gif) | my wave.xm | 2018-01-04 15:09 | 156K | |
![[SND]](/icons/sound2.gif) | the arrival.xm | 2018-01-04 15:09 | 156K | |
![[SND]](/icons/sound2.gif) | green onions rio.xm | 2018-01-04 15:09 | 156K | |
![[SND]](/icons/sound2.gif) | why me (1).xm | 2018-01-04 15:09 | 157K | |
![[SND]](/icons/sound2.gif) | JL09.XM | 2018-01-04 15:09 | 157K | |
![[SND]](/icons/sound2.gif) | stomach acid.xm | 2018-01-04 15:09 | 157K | |
![[SND]](/icons/sound2.gif) | let's rumble!.xm | 2018-01-04 15:09 | 157K | |
![[SND]](/icons/sound2.gif) | tower of babel(doom).xm | 2018-01-04 15:09 | 157K | |
![[SND]](/icons/sound2.gif) | last1eye4mad8.xm | 2018-01-04 15:09 | 157K | |
![[SND]](/icons/sound2.gif) | jatek a fenyben.xm | 2018-01-04 15:09 | 158K | |
![[SND]](/icons/sound2.gif) | curse the... part1.xm | 2018-01-04 15:09 | 158K | |
![[SND]](/icons/sound2.gif) | toxicity.xm | 2018-01-04 15:09 | 158K | |
![[SND]](/icons/sound2.gif) | funky clouds.xm | 2018-01-04 15:09 | 158K | |
![[SND]](/icons/sound2.gif) | launchpad by csonic.xm | 2018-01-04 15:09 | 158K | |
![[SND]](/icons/sound2.gif) | magestic.xm | 2018-01-04 15:09 | 159K | |
![[SND]](/icons/sound2.gif) | slender c.t.g.xm | 2018-01-04 15:09 | 159K | |
![[SND]](/icons/sound2.gif) | mehtna-pmeh....xm | 2018-01-04 15:09 | 159K | |
![[SND]](/icons/sound2.gif) | love dreams.xm | 2018-01-04 15:09 | 159K | |
![[SND]](/icons/sound2.gif) | fantasie for piano#1.xm | 2018-01-04 15:09 | 160K | |
![[SND]](/icons/sound2.gif) | war of ru'tikor.xm | 2018-01-04 15:09 | 160K | |
![[SND]](/icons/sound2.gif) | for.xm | 2018-01-04 15:09 | 160K | |
![[SND]](/icons/sound2.gif) | olli and lisa iii.xm | 2018-01-04 15:09 | 161K | |
![[SND]](/icons/sound2.gif) | ice 333 - crusader.xm | 2018-01-04 15:09 | 161K | |
![[SND]](/icons/sound2.gif) | energy generation.xm | 2018-01-04 15:09 | 162K | |
![[SND]](/icons/sound2.gif) | the mushroom dance.xm | 2018-01-04 15:09 | 162K | |
![[SND]](/icons/sound2.gif) | gypsy hell dance.xm | 2018-01-04 15:09 | 163K | |
![[SND]](/icons/sound2.gif) | demolition.xm | 2018-01-04 15:09 | 163K | |
![[SND]](/icons/sound2.gif) | shore.xm | 2018-01-04 15:09 | 163K | |
![[SND]](/icons/sound2.gif) | till i come hardcor.xm | 2018-01-04 15:09 | 163K | |
![[SND]](/icons/sound2.gif) | new biz.xm | 2018-01-04 15:09 | 163K | |
![[SND]](/icons/sound2.gif) | kap 2348 (cru!x).xm | 2018-01-04 15:09 | 164K | |
![[SND]](/icons/sound2.gif) | motraction.xm | 2018-01-04 15:09 | 164K | |
![[SND]](/icons/sound2.gif) | injuns dj xyth.xm | 2018-01-04 15:09 | 164K | |
![[SND]](/icons/sound2.gif) | rabhi root2.xm | 2018-01-04 15:09 | 164K | |
![[SND]](/icons/sound2.gif) | WHAAAAA.XM | 2018-01-04 15:09 | 165K | |
![[SND]](/icons/sound2.gif) | devastation (rmx).xm | 2018-01-04 15:09 | 165K | |
![[SND]](/icons/sound2.gif) | the old windmill.xm | 2018-01-04 15:09 | 165K | |
![[SND]](/icons/sound2.gif) | let's jam.xm | 2018-01-04 15:09 | 165K | |
![[SND]](/icons/sound2.gif) | void ftf.xm | 2018-01-04 15:09 | 165K | |
![[SND]](/icons/sound2.gif) | enhanced intuition.xm | 2018-01-04 15:09 | 165K | |
![[SND]](/icons/sound2.gif) | t2 - happy mix.xm | 2018-01-04 15:09 | 166K | |
![[SND]](/icons/sound2.gif) | pihanoi 3.20m.xm | 2018-01-04 15:09 | 166K | |
![[SND]](/icons/sound2.gif) | e-z going.xm | 2018-01-04 15:09 | 166K | |
![[SND]](/icons/sound2.gif) | heavy metal.xm | 2018-01-04 15:09 | 166K | |
![[SND]](/icons/sound2.gif) | the magic tone.xm | 2018-01-04 15:09 | 166K | |
![[SND]](/icons/sound2.gif) | experimental circus.xm | 2018-01-04 15:09 | 167K | |
![[SND]](/icons/sound2.gif) | digivator.xm | 2018-01-04 15:09 | 167K | |
![[SND]](/icons/sound2.gif) | el rock by kuky.xm | 2018-01-04 15:09 | 167K | |
![[SND]](/icons/sound2.gif) | old game-r-mixed.xm | 2018-01-04 15:09 | 167K | |
![[SND]](/icons/sound2.gif) | sunset ride.xm | 2018-01-04 15:09 | 167K | |
![[SND]](/icons/sound2.gif) | playing for angels.xm | 2018-01-04 15:09 | 167K | |
![[SND]](/icons/sound2.gif) | tycho techno.xm | 2018-01-04 15:09 | 167K | |
![[SND]](/icons/sound2.gif) | insomniarmx - ngs.xm | 2018-01-04 15:09 | 168K | |
![[SND]](/icons/sound2.gif) | onthego-noisfctr1030.xm | 2018-01-04 15:09 | 168K | |
![[SND]](/icons/sound2.gif) | december will come.xm | 2018-01-04 15:09 | 169K | |
![[SND]](/icons/sound2.gif) | take on me rmx.xm | 2018-01-04 15:09 | 169K | |
![[SND]](/icons/sound2.gif) | return of capt. zero.xm | 2018-01-04 15:09 | 169K | |
![[SND]](/icons/sound2.gif) | toxid cloud.xm | 2018-01-04 15:09 | 169K | |
![[SND]](/icons/sound2.gif) | genesis(greetz).xm | 2018-01-04 15:09 | 169K | |
![[SND]](/icons/sound2.gif) | phmaidlp00 (058).xm | 2018-01-04 15:09 | 169K | |
![[SND]](/icons/sound2.gif) | cloudhead.xm | 2018-01-04 15:09 | 170K | |
![[SND]](/icons/sound2.gif) | mellotrans.xm | 2018-01-04 15:09 | 170K | |
![[SND]](/icons/sound2.gif) | toms megamix.mod.xm | 2018-01-04 15:09 | 171K | |
![[SND]](/icons/sound2.gif) | TRULS.XM | 2018-01-04 15:09 | 171K | |
![[SND]](/icons/sound2.gif) | fucking noise 2.xm | 2018-01-04 15:09 | 171K | |
![[SND]](/icons/sound2.gif) | utter treachery!.xm | 2018-01-04 15:09 | 172K | |
![[SND]](/icons/sound2.gif) | my dream.xm | 2018-01-04 15:09 | 172K | |
![[SND]](/icons/sound2.gif) | odetheo.xm | 2018-01-04 15:09 | 172K | |
![[SND]](/icons/sound2.gif) | marlow's mind.xm | 2018-01-04 15:09 | 172K | |
![[SND]](/icons/sound2.gif) | the underworld 2.xm | 2018-01-04 15:09 | 172K | |
![[SND]](/icons/sound2.gif) | supersonic.xm | 2018-01-04 15:09 | 172K | |
![[SND]](/icons/sound2.gif) | spooky-dance.xm | 2018-01-04 15:09 | 172K | |
![[SND]](/icons/sound2.gif) | max tetris~1.xm | 2018-01-04 15:09 | 173K | |
![[SND]](/icons/sound2.gif) | tyrian.xm | 2018-01-04 15:09 | 173K | |
![[SND]](/icons/sound2.gif) | lovesong.xm | 2018-01-04 15:09 | 173K | |
![[SND]](/icons/sound2.gif) | manysheepinmongolia.xm | 2018-01-04 15:09 | 173K | |
![[SND]](/icons/sound2.gif) | the offspring.xm | 2018-01-04 15:09 | 173K | |
![[SND]](/icons/sound2.gif) | le dance macabre.xm | 2018-01-04 15:09 | 173K | |
![[SND]](/icons/sound2.gif) | giana sisters-64nost.xm | 2018-01-04 15:09 | 174K | |
![[SND]](/icons/sound2.gif) | sky world.xm | 2018-01-04 15:09 | 174K | |
![[SND]](/icons/sound2.gif) | huomaan lintuni.xm | 2018-01-04 15:09 | 175K | |
![[SND]](/icons/sound2.gif) | hawk.xm | 2018-01-04 15:09 | 175K | |
![[SND]](/icons/sound2.gif) | kick back.xm | 2018-01-04 15:09 | 175K | |
![[SND]](/icons/sound2.gif) | strive for acc..xm | 2018-01-04 15:09 | 175K | |
![[SND]](/icons/sound2.gif) | dexion demo.xm | 2018-01-04 15:09 | 176K | |
![[SND]](/icons/sound2.gif) | settlers cover.xm | 2018-01-04 15:09 | 176K | |
![[SND]](/icons/sound2.gif) | tetraman le sauveur.xm | 2018-01-04 15:09 | 176K | |
![[SND]](/icons/sound2.gif) | concow 1.xm | 2018-01-04 15:09 | 176K | |
![[SND]](/icons/sound2.gif) | xtro.xm | 2018-01-04 15:09 | 177K | |
![[SND]](/icons/sound2.gif) | eeky sue.xm | 2018-01-04 15:09 | 177K | |
![[SND]](/icons/sound2.gif) | untitled 1 (1).xm | 2018-01-04 15:09 | 177K | |
![[SND]](/icons/sound2.gif) | feeling free.xm | 2018-01-04 15:09 | 178K | |
![[SND]](/icons/sound2.gif) | drum beat.xm | 2018-01-04 15:09 | 179K | |
![[SND]](/icons/sound2.gif) | yesterdays.xm | 2018-01-04 15:09 | 179K | |
![[SND]](/icons/sound2.gif) | i love you (1).xm | 2018-01-04 15:09 | 179K | |
![[SND]](/icons/sound2.gif) | photographic 1992.xm | 2018-01-04 15:09 | 180K | |
![[SND]](/icons/sound2.gif) | techn'o'cat-pixn!p.xm | 2018-01-04 15:09 | 180K | |
![[SND]](/icons/sound2.gif) | caf.xm | 2018-01-04 15:09 | 180K | |
![[SND]](/icons/sound2.gif) | space dimension.xm | 2018-01-04 15:09 | 180K | |
![[SND]](/icons/sound2.gif) | sum.xm | 2018-01-04 15:09 | 180K | |
![[SND]](/icons/sound2.gif) | kw-thigp.xm | 2018-01-04 15:09 | 180K | |
![[SND]](/icons/sound2.gif) | listening the wind.xm | 2018-01-04 15:09 | 181K | |
![[SND]](/icons/sound2.gif) | visions~1.xm | 2018-01-04 15:09 | 181K | |
![[SND]](/icons/sound2.gif) | italian wave.xm | 2018-01-04 15:09 | 181K | |
![[SND]](/icons/sound2.gif) | death.xm | 2018-01-04 15:09 | 181K | |
![[SND]](/icons/sound2.gif) | gray area.xm | 2018-01-04 15:09 | 182K | |
![[SND]](/icons/sound2.gif) | DEVEL4~2.XM | 2018-01-04 15:09 | 182K | |
![[SND]](/icons/sound2.gif) | overnight.xm | 2018-01-04 15:09 | 182K | |
![[SND]](/icons/sound2.gif) | new life.xm | 2018-01-04 15:09 | 183K | |
![[SND]](/icons/sound2.gif) | nälkämaan laulu!.xm | 2018-01-04 15:09 | 183K | |
![[SND]](/icons/sound2.gif) | dj khan - can touch.xm | 2018-01-04 15:09 | 183K | |
![[SND]](/icons/sound2.gif) | realm of the gods.xm | 2018-01-04 15:09 | 183K | |
![[SND]](/icons/sound2.gif) | TECNOH~1.XM | 2018-01-04 15:09 | 183K | |
![[SND]](/icons/sound2.gif) | untitled~4.xm | 2018-01-04 15:09 | 184K | |
![[SND]](/icons/sound2.gif) | variations.xm | 2018-01-04 15:09 | 184K | |
![[SND]](/icons/sound2.gif) | downspee.xm | 2018-01-04 15:09 | 184K | |
![[SND]](/icons/sound2.gif) | tkd down.xm | 2018-01-04 15:09 | 184K | |
![[SND]](/icons/sound2.gif) | super mario-64.xm | 2018-01-04 15:09 | 185K | |
![[SND]](/icons/sound2.gif) | this is a dream.xm | 2018-01-04 15:09 | 185K | |
![[SND]](/icons/sound2.gif) | rytmhouse.xm | 2018-01-04 15:09 | 186K | |
![[SND]](/icons/sound2.gif) | let it be.xm | 2018-01-04 15:09 | 186K | |
![[SND]](/icons/sound2.gif) | mineral kick.xm | 2018-01-04 15:09 | 186K | |
![[SND]](/icons/sound2.gif) | zero degrees.xm | 2018-01-04 15:09 | 187K | |
![[SND]](/icons/sound2.gif) | the good times.xm | 2018-01-04 15:09 | 187K | |
![[SND]](/icons/sound2.gif) | rising soul.xm | 2018-01-04 15:09 | 187K | |
![[SND]](/icons/sound2.gif) | the crew!.xm | 2018-01-04 15:09 | 187K | |
![[SND]](/icons/sound2.gif) | f groove.xm | 2018-01-04 15:09 | 188K | |
![[SND]](/icons/sound2.gif) | keu board.xm | 2018-01-04 15:09 | 188K | |
![[SND]](/icons/sound2.gif) | shadowrunbysrrichie.xm | 2018-01-04 15:09 | 188K | |
![[SND]](/icons/sound2.gif) | picnic on uranus.xm | 2018-01-04 15:09 | 188K | |
![[SND]](/icons/sound2.gif) | raining again.xm | 2018-01-04 15:09 | 188K | |
![[SND]](/icons/sound2.gif) | seven days, one week.xm | 2018-01-04 15:09 | 188K | |
![[SND]](/icons/sound2.gif) | defying the forces.xm | 2018-01-04 15:09 | 189K | |
![[SND]](/icons/sound2.gif) | fortepercussion.xm | 2018-01-04 15:09 | 190K | |
![[SND]](/icons/sound2.gif) | haste.xm | 2018-01-04 15:09 | 190K | |
![[SND]](/icons/sound2.gif) | i am.xm | 2018-01-04 15:09 | 190K | |
![[SND]](/icons/sound2.gif) | evakkomummoremix.xm | 2018-01-04 15:09 | 190K | |
![[SND]](/icons/sound2.gif) | crypt of time.xm | 2018-01-04 15:09 | 190K | |
![[SND]](/icons/sound2.gif) | mellow.xm | 2018-01-04 15:09 | 190K | |
![[SND]](/icons/sound2.gif) | neverstop.xm | 2018-01-04 15:09 | 191K | |
![[SND]](/icons/sound2.gif) | the a-team.xm | 2018-01-04 15:09 | 191K | |
![[SND]](/icons/sound2.gif) | sunrise (1).xm | 2018-01-04 15:09 | 192K | |
![[SND]](/icons/sound2.gif) | narshe overture.xm | 2018-01-04 15:09 | 192K | |
![[SND]](/icons/sound2.gif) | davaj-davaj.xm | 2018-01-04 15:09 | 192K | |
![[SND]](/icons/sound2.gif) | thequiet.xm | 2018-01-04 15:09 | 192K | |
![[SND]](/icons/sound2.gif) | misty morning.xm | 2018-01-04 15:09 | 193K | |
![[SND]](/icons/sound2.gif) | kraftpsn.xm | 2018-01-04 15:09 | 193K | |
![[SND]](/icons/sound2.gif) | solemn night -zk-.xm | 2018-01-04 15:09 | 193K | |
![[SND]](/icons/sound2.gif) | vlad dracl rave #2.xm | 2018-01-04 15:09 | 194K | |
![[SND]](/icons/sound2.gif) | jus' diggin.....xm | 2018-01-04 15:09 | 194K | |
![[SND]](/icons/sound2.gif) | outro 'flat story'.xm | 2018-01-04 15:09 | 195K | |
![[SND]](/icons/sound2.gif) | spiderbots.xm | 2018-01-04 15:09 | 195K | |
![[SND]](/icons/sound2.gif) | ultra.xm | 2018-01-04 15:09 | 195K | |
![[SND]](/icons/sound2.gif) | popcoren.xm | 2018-01-04 15:09 | 195K | |
![[SND]](/icons/sound2.gif) | don't go away.xm | 2018-01-04 15:09 | 196K | |
![[SND]](/icons/sound2.gif) | preod.xm | 2018-01-04 15:09 | 196K | |
![[SND]](/icons/sound2.gif) | tetris000d.xm | 2018-01-04 15:09 | 196K | |
![[SND]](/icons/sound2.gif) | horny.xm | 2018-01-04 15:09 | 196K | |
![[SND]](/icons/sound2.gif) | crimewave.xm | 2018-01-04 15:09 | 196K | |
![[SND]](/icons/sound2.gif) | das boot.xm | 2018-01-04 15:09 | 196K | |
![[SND]](/icons/sound2.gif) | nlf.xm | 2018-01-04 15:09 | 197K | |
![[SND]](/icons/sound2.gif) | in your house.xm | 2018-01-04 15:09 | 197K | |
![[SND]](/icons/sound2.gif) | flower power =).xm | 2018-01-04 15:09 | 197K | |
![[SND]](/icons/sound2.gif) | dn duska.xm | 2018-01-04 15:09 | 197K | |
![[SND]](/icons/sound2.gif) | duryodhana.xm | 2018-01-04 15:09 | 197K | |
![[SND]](/icons/sound2.gif) | dawning.xm | 2018-01-04 15:09 | 197K | |
![[SND]](/icons/sound2.gif) | lone star -spk.xm | 2018-01-04 15:09 | 198K | |
![[SND]](/icons/sound2.gif) | escape in phantasy.xm | 2018-01-04 15:09 | 198K | |
![[SND]](/icons/sound2.gif) | t2 dancing day.xm | 2018-01-04 15:09 | 198K | |
![[SND]](/icons/sound2.gif) | fealing = null.xm | 2018-01-04 15:09 | 199K | |
![[SND]](/icons/sound2.gif) | last minute.xm | 2018-01-04 15:09 | 199K | |
![[SND]](/icons/sound2.gif) | trilium high.xm | 2018-01-04 15:09 | 200K | |
![[SND]](/icons/sound2.gif) | pou drmnbss.xm | 2018-01-04 15:09 | 200K | |
![[SND]](/icons/sound2.gif) | want to be a hippo.xm | 2018-01-04 15:09 | 200K | |
![[SND]](/icons/sound2.gif) | hubba-bubbah.xm | 2018-01-04 15:09 | 200K | |
![[SND]](/icons/sound2.gif) | maxwels barnehage.xm | 2018-01-04 15:09 | 200K | |
![[SND]](/icons/sound2.gif) | come play with me.xm | 2018-01-04 15:09 | 201K | |
![[SND]](/icons/sound2.gif) | escape 2025.xm | 2018-01-04 15:09 | 201K | |
![[SND]](/icons/sound2.gif) | leap not sense.xm | 2018-01-04 15:09 | 201K | |
![[SND]](/icons/sound2.gif) | dreamz by stevie'98.xm | 2018-01-04 15:09 | 202K | |
![[SND]](/icons/sound2.gif) | i miss you.xm | 2018-01-04 15:09 | 202K | |
![[SND]](/icons/sound2.gif) | dukepro by peti.xm | 2018-01-04 15:09 | 202K | |
![[SND]](/icons/sound2.gif) | the druid's valley.xm | 2018-01-04 15:09 | 203K | |
![[SND]](/icons/sound2.gif) | nitro6.xm | 2018-01-04 15:09 | 203K | |
![[SND]](/icons/sound2.gif) | the green goo.xm | 2018-01-04 15:09 | 203K | |
![[SND]](/icons/sound2.gif) | spheare (opbk).xm | 2018-01-04 15:09 | 203K | |
![[SND]](/icons/sound2.gif) | feathers fell.xm | 2018-01-04 15:09 | 203K | |
![[SND]](/icons/sound2.gif) | laze.xm | 2018-01-04 15:09 | 203K | |
![[SND]](/icons/sound2.gif) | meditation song.xm | 2018-01-04 15:09 | 203K | |
![[SND]](/icons/sound2.gif) | oncedy.xm | 2018-01-04 15:09 | 203K | |
![[SND]](/icons/sound2.gif) | the harsh wave.xm | 2018-01-04 15:09 | 203K | |
![[SND]](/icons/sound2.gif) | lookeyes.xm | 2018-01-04 15:09 | 204K | |
![[SND]](/icons/sound2.gif) | cocojam.xm | 2018-01-04 15:09 | 205K | |
![[SND]](/icons/sound2.gif) | sun --- fbs 3s demo.xm | 2018-01-04 15:09 | 205K | |
![[SND]](/icons/sound2.gif) | little ghoul lost.xm | 2018-01-04 15:09 | 205K | |
![[SND]](/icons/sound2.gif) | one hour later - a.t.xm | 2018-01-04 15:09 | 205K | |
![[SND]](/icons/sound2.gif) | sun - by mercure.xm | 2018-01-04 15:09 | 205K | |
![[SND]](/icons/sound2.gif) | dreamx.xm | 2018-01-04 15:09 | 205K | |
![[SND]](/icons/sound2.gif) | garbage.xm | 2018-01-04 15:09 | 205K | |
![[SND]](/icons/sound2.gif) | tungmetall.xm | 2018-01-04 15:09 | 207K | |
![[SND]](/icons/sound2.gif) | tyran wave.xm | 2018-01-04 15:09 | 207K | |
![[SND]](/icons/sound2.gif) | visions of christal.xm | 2018-01-04 15:09 | 207K | |
![[SND]](/icons/sound2.gif) | mukke.xm | 2018-01-04 15:09 | 207K | |
![[SND]](/icons/sound2.gif) | mon - lioness.xm | 2018-01-04 15:09 | 207K | |
![[SND]](/icons/sound2.gif) | shikaku-free (edit).xm | 2018-01-04 15:09 | 207K | |
![[SND]](/icons/sound2.gif) | expejetsettra&nostar.xm | 2018-01-04 15:09 | 207K | |
![[SND]](/icons/sound2.gif) | sob sob oh dear c64.xm | 2018-01-04 15:09 | 208K | |
![[SND]](/icons/sound2.gif) | startup (1).xm | 2018-01-04 15:09 | 209K | |
![[SND]](/icons/sound2.gif) | vamonos.xm | 2018-01-04 15:09 | 209K | |
![[SND]](/icons/sound2.gif) | subchaos-psychedelic.xm | 2018-01-04 15:09 | 209K | |
![[SND]](/icons/sound2.gif) | meeb's theme.xm | 2018-01-04 15:09 | 209K | |
![[SND]](/icons/sound2.gif) | treasury.xm | 2018-01-04 15:09 | 210K | |
![[SND]](/icons/sound2.gif) | dust.xm | 2018-01-04 15:09 | 210K | |
![[SND]](/icons/sound2.gif) | the fortress.2.jam...xm | 2018-01-04 15:09 | 210K | |
![[SND]](/icons/sound2.gif) | nervously-marioremix.xm | 2018-01-04 15:09 | 210K | |
![[SND]](/icons/sound2.gif) | somewhere on air2.xm | 2018-01-04 15:09 | 211K | |
![[SND]](/icons/sound2.gif) | under the sea (150).xm | 2018-01-04 15:09 | 211K | |
![[SND]](/icons/sound2.gif) | new planet - lmt.xm | 2018-01-04 15:09 | 211K | |
![[SND]](/icons/sound2.gif) | insomniacosis.....xm | 2018-01-04 15:09 | 211K | |
![[SND]](/icons/sound2.gif) | saga. 1144.xm | 2018-01-04 15:09 | 211K | |
![[SND]](/icons/sound2.gif) | wisdom.xm | 2018-01-04 15:09 | 212K | |
![[SND]](/icons/sound2.gif) | DKE3DK~1.XM | 2018-01-04 15:09 | 212K | |
![[SND]](/icons/sound2.gif) | probleme.xm | 2018-01-04 15:09 | 212K | |
![[SND]](/icons/sound2.gif) | DKE3DK~2.XM | 2018-01-04 15:09 | 213K | |
![[SND]](/icons/sound2.gif) | loop097 ed 1996.xm | 2018-01-04 15:09 | 213K | |
![[SND]](/icons/sound2.gif) | revolution-restart.xm | 2018-01-04 15:09 | 213K | |
![[SND]](/icons/sound2.gif) | celebration & genera.xm | 2018-01-04 15:09 | 213K | |
![[SND]](/icons/sound2.gif) | compo pscally.xm | 2018-01-04 15:09 | 214K | |
![[SND]](/icons/sound2.gif) | evil empire.xm | 2018-01-04 15:09 | 214K | |
![[SND]](/icons/sound2.gif) | mag.xm | 2018-01-04 15:09 | 214K | |
![[SND]](/icons/sound2.gif) | ff1 ovrwrld remix v2.xm | 2018-01-04 15:09 | 214K | |
![[SND]](/icons/sound2.gif) | something bongo.xm | 2018-01-04 15:09 | 214K | |
![[SND]](/icons/sound2.gif) | void-r-mixed.xm | 2018-01-04 15:09 | 214K | |
![[SND]](/icons/sound2.gif) | happy day in xland.xm | 2018-01-04 15:09 | 214K | |
![[SND]](/icons/sound2.gif) | reggie.xm | 2018-01-04 15:09 | 215K | |
![[SND]](/icons/sound2.gif) | landscapes (1).xm | 2018-01-04 15:09 | 215K | |
![[SND]](/icons/sound2.gif) | on my own.xm | 2018-01-04 15:09 | 216K | |
![[SND]](/icons/sound2.gif) | wild nights.xm | 2018-01-04 15:09 | 216K | |
![[SND]](/icons/sound2.gif) | check c.t.g.xm | 2018-01-04 15:09 | 216K | |
![[SND]](/icons/sound2.gif) | cyber china.xm | 2018-01-04 15:09 | 216K | |
![[SND]](/icons/sound2.gif) | letsgo.xm | 2018-01-04 15:09 | 216K | |
![[SND]](/icons/sound2.gif) | r&b2.xm | 2018-01-04 15:09 | 217K | |
![[SND]](/icons/sound2.gif) | socks for the king.xm | 2018-01-04 15:09 | 217K | |
![[SND]](/icons/sound2.gif) | out there somewhere.xm | 2018-01-04 15:09 | 217K | |
![[SND]](/icons/sound2.gif) | i can fly (1).xm | 2018-01-04 15:09 | 217K | |
![[SND]](/icons/sound2.gif) | proj1.xm | 2018-01-04 15:09 | 217K | |
![[SND]](/icons/sound2.gif) | intergalactxx.xm | 2018-01-04 15:09 | 217K | |
![[SND]](/icons/sound2.gif) | let there be houze.xm | 2018-01-04 15:09 | 217K | |
![[SND]](/icons/sound2.gif) | hangover.xm | 2018-01-04 15:09 | 218K | |
![[SND]](/icons/sound2.gif) | damn exam.xm | 2018-01-04 15:09 | 218K | |
![[SND]](/icons/sound2.gif) | rode schoentjes.xm | 2018-01-04 15:09 | 218K | |
![[SND]](/icons/sound2.gif) | groovy kaos.xm | 2018-01-04 15:09 | 219K | |
![[SND]](/icons/sound2.gif) | excess.xm | 2018-01-04 15:09 | 220K | |
![[SND]](/icons/sound2.gif) | el greek.xm | 2018-01-04 15:09 | 220K | |
![[SND]](/icons/sound2.gif) | disturbed illusions.xm | 2018-01-04 15:09 | 220K | |
![[SND]](/icons/sound2.gif) | floater by werty.xm | 2018-01-04 15:09 | 221K | |
![[SND]](/icons/sound2.gif) | get dance by....xm | 2018-01-04 15:09 | 221K | |
![[SND]](/icons/sound2.gif) | desperate years.xm | 2018-01-04 15:09 | 221K | |
![[SND]](/icons/sound2.gif) | love will come.xm | 2018-01-04 15:09 | 222K | |
![[SND]](/icons/sound2.gif) | sj-adv.starts-ragtag.xm | 2018-01-04 15:09 | 222K | |
![[SND]](/icons/sound2.gif) | leiawrath.xm | 2018-01-04 15:09 | 222K | |
![[SND]](/icons/sound2.gif) | pohj2.xm | 2018-01-04 15:09 | 222K | |
![[SND]](/icons/sound2.gif) | ovation.xm | 2018-01-04 15:09 | 222K | |
![[SND]](/icons/sound2.gif) | upbeat.xm | 2018-01-04 15:09 | 223K | |
![[SND]](/icons/sound2.gif) | rondo alla turca (1).xm | 2018-01-04 15:09 | 223K | |
![[SND]](/icons/sound2.gif) | experimental nr. 1.xm | 2018-01-04 15:09 | 224K | |
![[SND]](/icons/sound2.gif) | mindworks.xm | 2018-01-04 15:09 | 224K | |
![[SND]](/icons/sound2.gif) | life's like sea -lga.xm | 2018-01-04 15:09 | 224K | |
![[SND]](/icons/sound2.gif) | lost in time~1.xm | 2018-01-04 15:09 | 224K | |
![[SND]](/icons/sound2.gif) | pollution school.xm | 2018-01-04 15:09 | 224K | |
![[SND]](/icons/sound2.gif) | neo-tv.xm | 2018-01-04 15:09 | 224K | |
![[SND]](/icons/sound2.gif) | force.xm | 2018-01-04 15:09 | 224K | |
![[SND]](/icons/sound2.gif) | duckjako.xm | 2018-01-04 15:09 | 224K | |
![[SND]](/icons/sound2.gif) | inside my sick brain.xm | 2018-01-04 15:09 | 225K | |
![[SND]](/icons/sound2.gif) | level zero.xm | 2018-01-04 15:09 | 225K | |
![[SND]](/icons/sound2.gif) | euphoria.xm | 2018-01-04 15:09 | 225K | |
![[SND]](/icons/sound2.gif) | midsummer's night.xm | 2018-01-04 15:09 | 226K | |
![[SND]](/icons/sound2.gif) | depends on u.xm | 2018-01-04 15:09 | 227K | |
![[SND]](/icons/sound2.gif) | touge.xm | 2018-01-04 15:09 | 227K | |
![[SND]](/icons/sound2.gif) | rap4.xm | 2018-01-04 15:09 | 227K | |
![[SND]](/icons/sound2.gif) | flying throu da air.xm | 2018-01-04 15:09 | 227K | |
![[SND]](/icons/sound2.gif) | the golden rose.xm | 2018-01-04 15:09 | 228K | |
![[SND]](/icons/sound2.gif) | indescribable love.xm | 2018-01-04 15:09 | 228K | |
![[SND]](/icons/sound2.gif) | tangible insanity.xm | 2018-01-04 15:09 | 228K | |
![[SND]](/icons/sound2.gif) | untitled (14).xm | 2018-01-04 15:09 | 229K | |
![[SND]](/icons/sound2.gif) | metal junk.xm | 2018-01-04 15:09 | 229K | |
![[SND]](/icons/sound2.gif) | housemaster-house pe.xm | 2018-01-04 15:09 | 229K | |
![[SND]](/icons/sound2.gif) | lost souls.xm | 2018-01-04 15:09 | 229K | |
![[SND]](/icons/sound2.gif) | jasnita baby.xm | 2018-01-04 15:09 | 230K | |
![[SND]](/icons/sound2.gif) | protonic.xm | 2018-01-04 15:09 | 230K | |
![[SND]](/icons/sound2.gif) | try again ethnic mi.xm | 2018-01-04 15:09 | 230K | |
![[SND]](/icons/sound2.gif) | it's comming....xm | 2018-01-04 15:09 | 230K | |
![[SND]](/icons/sound2.gif) | nikolaus.xm | 2018-01-04 15:09 | 230K | |
![[SND]](/icons/sound2.gif) | in the woods (lp).xm | 2018-01-04 15:09 | 231K | |
![[SND]](/icons/sound2.gif) | chiem3.xm | 2018-01-04 15:09 | 231K | |
![[SND]](/icons/sound2.gif) | incubi tranquilli.xm | 2018-01-04 15:09 | 231K | |
![[SND]](/icons/sound2.gif) | gueulin maf.xm | 2018-01-04 15:09 | 231K | |
![[SND]](/icons/sound2.gif) | friday13th luckyday.xm | 2018-01-04 15:09 | 232K | |
![[SND]](/icons/sound2.gif) | mystic oberture.xm | 2018-01-04 15:09 | 232K | |
![[SND]](/icons/sound2.gif) | flying.xm | 2018-01-04 15:09 | 233K | |
![[SND]](/icons/sound2.gif) | night wolf.xm | 2018-01-04 15:09 | 233K | |
![[SND]](/icons/sound2.gif) | out of coke.xm | 2018-01-04 15:09 | 233K | |
![[SND]](/icons/sound2.gif) | farewell to chaos.xm | 2018-01-04 15:09 | 233K | |
![[SND]](/icons/sound2.gif) | svv-ngh.xm | 2018-01-04 15:09 | 233K | |
![[SND]](/icons/sound2.gif) | hokusphocus.xm | 2018-01-04 15:09 | 234K | |
![[SND]](/icons/sound2.gif) | tintin goes turtles.xm | 2018-01-04 15:09 | 234K | |
![[SND]](/icons/sound2.gif) | clown march.xm | 2018-01-04 15:09 | 234K | |
![[SND]](/icons/sound2.gif) | falling stars.xm | 2018-01-04 15:09 | 234K | |
![[SND]](/icons/sound2.gif) | don't mind your mind.xm | 2018-01-04 15:09 | 234K | |
![[SND]](/icons/sound2.gif) | i cant have u.xm | 2018-01-04 15:09 | 235K | |
![[SND]](/icons/sound2.gif) | gone by.xm | 2018-01-04 15:09 | 235K | |
![[SND]](/icons/sound2.gif) | tmp 3.xm | 2018-01-04 15:09 | 235K | |
![[SND]](/icons/sound2.gif) | funky town (remx).xm | 2018-01-04 15:09 | 236K | |
![[SND]](/icons/sound2.gif) | movitup.xm | 2018-01-04 15:09 | 236K | |
![[SND]](/icons/sound2.gif) | trolls.xm | 2018-01-04 15:09 | 238K | |
![[SND]](/icons/sound2.gif) | mice.xm | 2018-01-04 15:09 | 238K | |
![[SND]](/icons/sound2.gif) | uninvited an unknown.xm | 2018-01-04 15:09 | 238K | |
![[SND]](/icons/sound2.gif) | missed.xm | 2018-01-04 15:09 | 238K | |
![[SND]](/icons/sound2.gif) | into the mindspace.xm | 2018-01-04 15:09 | 239K | |
![[SND]](/icons/sound2.gif) | mania.xm | 2018-01-04 15:09 | 239K | |
![[SND]](/icons/sound2.gif) | some metal song.xm | 2018-01-04 15:09 | 239K | |
![[SND]](/icons/sound2.gif) | mellow and insayne.xm | 2018-01-04 15:09 | 240K | |
![[SND]](/icons/sound2.gif) | j aciduc.xm | 2018-01-04 15:09 | 240K | |
![[SND]](/icons/sound2.gif) | weist du es - ngs.xm | 2018-01-04 15:09 | 240K | |
![[SND]](/icons/sound2.gif) | citadel.xm | 2018-01-04 15:09 | 240K | |
![[SND]](/icons/sound2.gif) | that was random....xm | 2018-01-04 15:09 | 241K | |
![[SND]](/icons/sound2.gif) | ekosse 96.xm | 2018-01-04 15:09 | 241K | |
![[SND]](/icons/sound2.gif) | floating.xm | 2018-01-04 15:09 | 242K | |
![[SND]](/icons/sound2.gif) | insomnia.xm | 2018-01-04 15:09 | 242K | |
![[SND]](/icons/sound2.gif) | dj khan - dream out.xm | 2018-01-04 15:09 | 242K | |
![[SND]](/icons/sound2.gif) | out.xm.xm | 2018-01-04 15:09 | 242K | |
![[SND]](/icons/sound2.gif) | SWITCHBA.XM | 2018-01-04 15:09 | 242K | |
![[SND]](/icons/sound2.gif) | teknoslave.xm | 2018-01-04 15:09 | 243K | |
![[SND]](/icons/sound2.gif) | dasse - tuttifrutti.xm | 2018-01-04 15:09 | 243K | |
![[SND]](/icons/sound2.gif) | close the sky.xm | 2018-01-04 15:09 | 243K | |
![[SND]](/icons/sound2.gif) | step.xm | 2018-01-04 15:09 | 243K | |
![[SND]](/icons/sound2.gif) | fictive forest.xm | 2018-01-04 15:09 | 243K | |
![[SND]](/icons/sound2.gif) | masterma.xm | 2018-01-04 15:09 | 244K | |
![[SND]](/icons/sound2.gif) | technis.xm | 2018-01-04 15:09 | 245K | |
![[SND]](/icons/sound2.gif) | deep thoughts-nofa.xm | 2018-01-04 15:09 | 245K | |
![[SND]](/icons/sound2.gif) | i want mo' (1).xm | 2018-01-04 15:09 | 245K | |
![[SND]](/icons/sound2.gif) | chimera.xm | 2018-01-04 15:09 | 245K | |
![[SND]](/icons/sound2.gif) | selection of life.xm | 2018-01-04 15:09 | 246K | |
![[SND]](/icons/sound2.gif) | christmas '98.xm | 2018-01-04 15:09 | 246K | |
![[SND]](/icons/sound2.gif) | james bond theme.xm | 2018-01-04 15:09 | 246K | |
![[SND]](/icons/sound2.gif) | my bare roots.xm | 2018-01-04 15:09 | 246K | |
![[SND]](/icons/sound2.gif) | timewarp.xm | 2018-01-04 15:09 | 247K | |
![[SND]](/icons/sound2.gif) | feelbass.xm | 2018-01-04 15:09 | 247K | |
![[SND]](/icons/sound2.gif) | on the waves.xm | 2018-01-04 15:09 | 247K | |
![[SND]](/icons/sound2.gif) | yucky piano.xm | 2018-01-04 15:09 | 247K | |
![[SND]](/icons/sound2.gif) | cybeborn.xm | 2018-01-04 15:09 | 247K | |
![[SND]](/icons/sound2.gif) | reality in 2d.xm | 2018-01-04 15:09 | 247K | |
![[SND]](/icons/sound2.gif) | sea ---- fbs 3s demo.xm | 2018-01-04 15:09 | 247K | |
![[SND]](/icons/sound2.gif) | the evil devil.xm | 2018-01-04 15:09 | 248K | |
![[SND]](/icons/sound2.gif) | fairies.xm | 2018-01-04 15:09 | 248K | |
![[SND]](/icons/sound2.gif) | rave fantasy.xm | 2018-01-04 15:09 | 249K | |
![[SND]](/icons/sound2.gif) | looped song!.xm | 2018-01-04 15:09 | 249K | |
![[SND]](/icons/sound2.gif) | seconds.xm | 2018-01-04 15:09 | 249K | |
![[SND]](/icons/sound2.gif) | desert storm.xm | 2018-01-04 15:09 | 249K | |
![[SND]](/icons/sound2.gif) | irreparableperdition.xm | 2018-01-04 15:09 | 249K | |
![[SND]](/icons/sound2.gif) | gb303 (bnd).xm | 2018-01-04 15:09 | 250K | |
![[SND]](/icons/sound2.gif) | purity of heart (tmi.xm | 2018-01-04 15:09 | 250K | |
![[SND]](/icons/sound2.gif) | everyday i love you.xm | 2018-01-04 15:09 | 250K | |
![[SND]](/icons/sound2.gif) | ocean sound waves.xm | 2018-01-04 15:09 | 250K | |
![[SND]](/icons/sound2.gif) | the golden rings.xm | 2018-01-04 15:09 | 251K | |
![[SND]](/icons/sound2.gif) | up to the sky.xm | 2018-01-04 15:09 | 251K | |
![[SND]](/icons/sound2.gif) | somera.xm | 2018-01-04 15:09 | 251K | |
![[SND]](/icons/sound2.gif) | sea - by mercure.xm | 2018-01-04 15:09 | 251K | |
![[SND]](/icons/sound2.gif) | calecon long part 2.xm | 2018-01-04 15:09 | 251K | |
![[SND]](/icons/sound2.gif) | changes 1.xm | 2018-01-04 15:09 | 251K | |
![[SND]](/icons/sound2.gif) | rythm central.xm | 2018-01-04 15:09 | 251K | |
![[SND]](/icons/sound2.gif) | teletopia nopac.xm | 2018-01-04 15:09 | 252K | |
![[SND]](/icons/sound2.gif) | duke nukem v2.0.xm | 2018-01-04 15:09 | 252K | |
![[SND]](/icons/sound2.gif) | maja culture.xm | 2018-01-04 15:09 | 252K | |
![[SND]](/icons/sound2.gif) | pozitron rumba.xm | 2018-01-04 15:09 | 252K | |
![[SND]](/icons/sound2.gif) | composed in 4 chnls.xm | 2018-01-04 15:09 | 252K | |
![[SND]](/icons/sound2.gif) | torse fanfares.xm | 2018-01-04 15:09 | 252K | |
![[SND]](/icons/sound2.gif) | mystic voyage.xm | 2018-01-04 15:09 | 253K | |
![[SND]](/icons/sound2.gif) | slyfield&sendrew.xm | 2018-01-04 15:09 | 253K | |
![[SND]](/icons/sound2.gif) | melting blood.xm | 2018-01-04 15:09 | 253K | |
![[SND]](/icons/sound2.gif) | memories -by lgaga.xm | 2018-01-04 15:09 | 253K | |
![[SND]](/icons/sound2.gif) | dmc-ama1.xm | 2018-01-04 15:09 | 254K | |
![[SND]](/icons/sound2.gif) | kicker.xm | 2018-01-04 15:09 | 254K | |
![[SND]](/icons/sound2.gif) | cibola dance.xm | 2018-01-04 15:09 | 255K | |
![[SND]](/icons/sound2.gif) | sphcp - song02.xm | 2018-01-04 15:09 | 255K | |
![[SND]](/icons/sound2.gif) | dm light of day.xm | 2018-01-04 15:09 | 257K | |
![[SND]](/icons/sound2.gif) | to win go towing.xm | 2018-01-04 15:09 | 257K | |
![[SND]](/icons/sound2.gif) | ready for release.xm | 2018-01-04 15:09 | 258K | |
![[SND]](/icons/sound2.gif) | dark side.xm | 2018-01-04 15:09 | 258K | |
![[SND]](/icons/sound2.gif) | phase iii.xm | 2018-01-04 15:09 | 259K | |
![[SND]](/icons/sound2.gif) | the vanishing.xm | 2018-01-04 15:09 | 260K | |
![[SND]](/icons/sound2.gif) | escape long version.xm | 2018-01-04 15:09 | 260K | |
![[SND]](/icons/sound2.gif) | freezeall style!.xm | 2018-01-04 15:09 | 260K | |
![[SND]](/icons/sound2.gif) | redline.xm | 2018-01-04 15:09 | 260K | |
![[SND]](/icons/sound2.gif) | the doll.xm | 2018-01-04 15:09 | 260K | |
![[SND]](/icons/sound2.gif) | fade to black.xm | 2018-01-04 15:09 | 261K | |
![[SND]](/icons/sound2.gif) | where is your love.xm | 2018-01-04 15:09 | 261K | |
![[SND]](/icons/sound2.gif) | the probe.xm | 2018-01-04 15:09 | 261K | |
![[SND]](/icons/sound2.gif) | rain -diztance.xm | 2018-01-04 15:09 | 262K | |
![[SND]](/icons/sound2.gif) | fallen from grace.xm | 2018-01-04 15:09 | 263K | |
![[SND]](/icons/sound2.gif) | lana's rock-n-roll.xm | 2018-01-04 15:09 | 263K | |
![[SND]](/icons/sound2.gif) | my name is sid.xm | 2018-01-04 15:09 | 263K | |
![[SND]](/icons/sound2.gif) | dancing elks.xm | 2018-01-04 15:09 | 263K | |
![[SND]](/icons/sound2.gif) | cyber space.xm | 2018-01-04 15:09 | 264K | |
![[SND]](/icons/sound2.gif) | hijack.xm | 2018-01-04 15:09 | 264K | |
![[SND]](/icons/sound2.gif) | no fear.xm | 2018-01-04 15:09 | 264K | |
![[SND]](/icons/sound2.gif) | tornado.xm | 2018-01-04 15:09 | 264K | |
![[SND]](/icons/sound2.gif) | robbo - merry trance.xm | 2018-01-04 15:09 | 264K | |
![[SND]](/icons/sound2.gif) | rytmstar.xm | 2018-01-04 15:09 | 265K | |
![[SND]](/icons/sound2.gif) | hiw giga.xm | 2018-01-04 15:09 | 265K | |
![[SND]](/icons/sound2.gif) | jehros gone mad....!.xm | 2018-01-04 15:09 | 265K | |
![[SND]](/icons/sound2.gif) | head injury 548.xm | 2018-01-04 15:09 | 265K | |
![[SND]](/icons/sound2.gif) | equinoxe iv by jmj.xm | 2018-01-04 15:09 | 265K | |
![[SND]](/icons/sound2.gif) | the jsb mix.xm | 2018-01-04 15:09 | 265K | |
![[SND]](/icons/sound2.gif) | nitro7.xm | 2018-01-04 15:09 | 266K | |
![[SND]](/icons/sound2.gif) | the pain within.xm | 2018-01-04 15:09 | 266K | |
![[SND]](/icons/sound2.gif) | quicksilver.xm | 2018-01-04 15:09 | 266K | |
![[SND]](/icons/sound2.gif) | wildstyl.xm | 2018-01-04 15:09 | 266K | |
![[SND]](/icons/sound2.gif) | ministry of light.xm | 2018-01-04 15:09 | 266K | |
![[SND]](/icons/sound2.gif) | exodus¶dise.xm | 2018-01-04 15:09 | 266K | |
![[SND]](/icons/sound2.gif) | zac's ska number one.xm | 2018-01-04 15:09 | 266K | |
![[SND]](/icons/sound2.gif) | dj.fizo- ez a tnc.xm | 2018-01-04 15:09 | 266K | |
![[SND]](/icons/sound2.gif) | moongate xm remix.xm | 2018-01-04 15:09 | 267K | |
![[SND]](/icons/sound2.gif) | relax.xm | 2018-01-04 15:09 | 267K | |
![[SND]](/icons/sound2.gif) | sexual fantasy.xm | 2018-01-04 15:09 | 267K | |
![[SND]](/icons/sound2.gif) | miracles.xm | 2018-01-04 15:09 | 267K | |
![[SND]](/icons/sound2.gif) | don't_st.xm | 2018-01-04 15:09 | 268K | |
![[SND]](/icons/sound2.gif) | techno-af remix, io.xm | 2018-01-04 15:09 | 268K | |
![[SND]](/icons/sound2.gif) | duckyou.xm | 2018-01-04 15:09 | 269K | |
![[SND]](/icons/sound2.gif) | colourstream.xm | 2018-01-04 15:09 | 269K | |
![[SND]](/icons/sound2.gif) | limit.xm | 2018-01-04 15:09 | 270K | |
![[SND]](/icons/sound2.gif) | the end of this.xm | 2018-01-04 15:09 | 270K | |
![[SND]](/icons/sound2.gif) | nobody knows.xm | 2018-01-04 15:09 | 270K | |
![[SND]](/icons/sound2.gif) | jaska2.xm | 2018-01-04 15:09 | 270K | |
![[SND]](/icons/sound2.gif) | makin' love- csats.xm | 2018-01-04 15:09 | 270K | |
![[SND]](/icons/sound2.gif) | oddity of nature.xm | 2018-01-04 15:09 | 270K | |
![[SND]](/icons/sound2.gif) | freakybirthdaym00g.xm | 2018-01-04 15:09 | 271K | |
![[SND]](/icons/sound2.gif) | lost.xm | 2018-01-04 15:09 | 271K | |
![[SND]](/icons/sound2.gif) | fly high.xm | 2018-01-04 15:09 | 271K | |
![[SND]](/icons/sound2.gif) | COKE2.XM | 2018-01-04 15:09 | 271K | |
![[SND]](/icons/sound2.gif) | melancholy dance.xm | 2018-01-04 15:09 | 272K | |
![[SND]](/icons/sound2.gif) | screaming.xm | 2018-01-04 15:09 | 272K | |
![[SND]](/icons/sound2.gif) | STRANGE.XM | 2018-01-04 15:09 | 272K | |
![[SND]](/icons/sound2.gif) | for you.xm | 2018-01-04 15:09 | 273K | |
![[SND]](/icons/sound2.gif) | newl.xm | 2018-01-04 15:09 | 273K | |
![[SND]](/icons/sound2.gif) | live for life.xm | 2018-01-04 15:09 | 273K | |
![[SND]](/icons/sound2.gif) | homesickness.xm | 2018-01-04 15:09 | 274K | |
![[SND]](/icons/sound2.gif) | gyroteknika.xm | 2018-01-04 15:09 | 274K | |
![[SND]](/icons/sound2.gif) | tales from magic.xm | 2018-01-04 15:09 | 274K | |
![[SND]](/icons/sound2.gif) | trumpton.xm | 2018-01-04 15:09 | 274K | |
![[SND]](/icons/sound2.gif) | youngah brothah beat.xm | 2018-01-04 15:09 | 275K | |
![[SND]](/icons/sound2.gif) | speaker week nikko.xm | 2018-01-04 15:09 | 276K | |
![[SND]](/icons/sound2.gif) | gparty chiton mix.xm | 2018-01-04 15:09 | 276K | |
![[SND]](/icons/sound2.gif) | moon crystals.xm | 2018-01-04 15:09 | 276K | |
![[SND]](/icons/sound2.gif) | the aura.xm | 2018-01-04 15:09 | 276K | |
![[SND]](/icons/sound2.gif) | djzen-probadancepol.xm | 2018-01-04 15:09 | 276K | |
![[SND]](/icons/sound2.gif) | feelings.xm | 2018-01-04 15:09 | 276K | |
![[SND]](/icons/sound2.gif) | technotrax.xm | 2018-01-04 15:09 | 276K | |
![[SND]](/icons/sound2.gif) | technotrax... (1).xm | 2018-01-04 15:09 | 277K | |
![[SND]](/icons/sound2.gif) | the fiddle - remix.xm | 2018-01-04 15:09 | 277K | |
![[SND]](/icons/sound2.gif) | virtual guitar.xm | 2018-01-04 15:09 | 277K | |
![[SND]](/icons/sound2.gif) | friends - scooter.xm | 2018-01-04 15:09 | 277K | |
![[SND]](/icons/sound2.gif) | hivolt.xm | 2018-01-04 15:09 | 278K | |
![[SND]](/icons/sound2.gif) | cz reald.xm | 2018-01-04 15:09 | 278K | |
![[SND]](/icons/sound2.gif) | nu pot sa uit.xm | 2018-01-04 15:09 | 279K | |
![[SND]](/icons/sound2.gif) | excluded.xm | 2018-01-04 15:09 | 279K | |
![[SND]](/icons/sound2.gif) | devistate.xm | 2018-01-04 15:09 | 279K | |
![[SND]](/icons/sound2.gif) | rapid beating.xm | 2018-01-04 15:09 | 279K | |
![[SND]](/icons/sound2.gif) | rosa's theme.xm | 2018-01-04 15:09 | 279K | |
![[SND]](/icons/sound2.gif) | koulu.xm | 2018-01-04 15:09 | 280K | |
![[SND]](/icons/sound2.gif) | the reincarnation.xm | 2018-01-04 15:09 | 280K | |
![[SND]](/icons/sound2.gif) | go round & round.xm | 2018-01-04 15:09 | 280K | |
![[SND]](/icons/sound2.gif) | on.xm | 2018-01-04 15:09 | 280K | |
![[SND]](/icons/sound2.gif) | nightfall.xm | 2018-01-04 15:09 | 281K | |
![[SND]](/icons/sound2.gif) | fanta4 andi y.xm | 2018-01-04 15:09 | 281K | |
![[SND]](/icons/sound2.gif) | metal22.xm | 2018-01-04 15:09 | 282K | |
![[SND]](/icons/sound2.gif) | metal58.xm | 2018-01-04 15:09 | 282K | |
![[SND]](/icons/sound2.gif) | happy new year 1998.xm | 2018-01-04 15:09 | 282K | |
![[SND]](/icons/sound2.gif) | steelmill.xm | 2018-01-04 15:09 | 282K | |
![[SND]](/icons/sound2.gif) | sea flutes.xm | 2018-01-04 15:09 | 282K | |
![[SND]](/icons/sound2.gif) | the janice.xm | 2018-01-04 15:09 | 282K | |
![[SND]](/icons/sound2.gif) | imperios.xm | 2018-01-04 15:09 | 282K | |
![[SND]](/icons/sound2.gif) | unknown waters.xm | 2018-01-04 15:09 | 282K | |
![[SND]](/icons/sound2.gif) | vpiano.xm | 2018-01-04 15:09 | 282K | |
![[SND]](/icons/sound2.gif) | popcorn in the mix.xm | 2018-01-04 15:09 | 282K | |
![[SND]](/icons/sound2.gif) | mali i.xm | 2018-01-04 15:09 | 284K | |
![[SND]](/icons/sound2.gif) | pure as water.xm | 2018-01-04 15:09 | 284K | |
![[SND]](/icons/sound2.gif) | pocoloco.xm | 2018-01-04 15:09 | 284K | |
![[SND]](/icons/sound2.gif) | terminate infinity.xm | 2018-01-04 15:09 | 285K | |
![[SND]](/icons/sound2.gif) | werewolf cry.xm | 2018-01-04 15:09 | 285K | |
![[SND]](/icons/sound2.gif) | phr34(k5 0f n47ur3.xm | 2018-01-04 15:09 | 285K | |
![[SND]](/icons/sound2.gif) | forty cups of coffee.xm | 2018-01-04 15:09 | 285K | |
![[SND]](/icons/sound2.gif) | mink fur coat - ohc.xm | 2018-01-04 15:09 | 285K | |
![[SND]](/icons/sound2.gif) | xitoruen dna zzub.xm | 2018-01-04 15:09 | 285K | |
![[SND]](/icons/sound2.gif) | vsrings.xm | 2018-01-04 15:09 | 285K | |
![[SND]](/icons/sound2.gif) | imajica.xm | 2018-01-04 15:09 | 285K | |
![[SND]](/icons/sound2.gif) | in love with three.xm | 2018-01-04 15:09 | 286K | |
![[SND]](/icons/sound2.gif) | man who sold the wld.xm | 2018-01-04 15:09 | 287K | |
![[SND]](/icons/sound2.gif) | the quest.xm | 2018-01-04 15:09 | 287K | |
![[SND]](/icons/sound2.gif) | trip to mars.xm | 2018-01-04 15:09 | 287K | |
![[SND]](/icons/sound2.gif) | tsunami of the west.xm | 2018-01-04 15:09 | 287K | |
![[SND]](/icons/sound2.gif) | speak to me.xm | 2018-01-04 15:09 | 287K | |
![[SND]](/icons/sound2.gif) | levis505 jeans-r i o.xm | 2018-01-04 15:09 | 288K | |
![[SND]](/icons/sound2.gif) | world1 (1).xm | 2018-01-04 15:09 | 288K | |
![[SND]](/icons/sound2.gif) | dive under.xm | 2018-01-04 15:09 | 288K | |
![[SND]](/icons/sound2.gif) | ff vii fanfare remix.xm | 2018-01-04 15:09 | 288K | |
![[SND]](/icons/sound2.gif) | linder”sgris.xm | 2018-01-04 15:09 | 289K | |
![[SND]](/icons/sound2.gif) | plush mood.xm | 2018-01-04 15:09 | 289K | |
![[SND]](/icons/sound2.gif) | time of credence.xm | 2018-01-04 15:09 | 289K | |
![[SND]](/icons/sound2.gif) | regenerated synapse.xm | 2018-01-04 15:09 | 290K | |
![[SND]](/icons/sound2.gif) | continuum (1).xm | 2018-01-04 15:09 | 291K | |
![[SND]](/icons/sound2.gif) | composed by eye.xm | 2018-01-04 15:09 | 291K | |
![[SND]](/icons/sound2.gif) | life reverb.xm | 2018-01-04 15:09 | 291K | |
![[SND]](/icons/sound2.gif) | cosmic motion.xm | 2018-01-04 15:09 | 292K | |
![[SND]](/icons/sound2.gif) | hole of madness.xm | 2018-01-04 15:09 | 292K | |
![[SND]](/icons/sound2.gif) | i'm nothing....xm | 2018-01-04 15:09 | 292K | |
![[SND]](/icons/sound2.gif) | i want only her.xm | 2018-01-04 15:09 | 293K | |
![[SND]](/icons/sound2.gif) | the techno t(h)ree.xm | 2018-01-04 15:09 | 293K | |
![[SND]](/icons/sound2.gif) | waterst1.xm | 2018-01-04 15:09 | 293K | |
![[SND]](/icons/sound2.gif) | q.xm | 2018-01-04 15:09 | 293K | |
![[SND]](/icons/sound2.gif) | hordes of hell.xm | 2018-01-04 15:09 | 295K | |
![[SND]](/icons/sound2.gif) | hordes of hell (1).xm | 2018-01-04 15:09 | 295K | |
![[SND]](/icons/sound2.gif) | push me well!.xm | 2018-01-04 15:09 | 295K | |
![[SND]](/icons/sound2.gif) | the call of devil.xm | 2018-01-04 15:09 | 296K | |
![[SND]](/icons/sound2.gif) | pitchsifter....xm | 2018-01-04 15:09 | 296K | |
![[SND]](/icons/sound2.gif) | littlepr.xm | 2018-01-04 15:09 | 296K | |
![[SND]](/icons/sound2.gif) | mixed feelings.xm | 2018-01-04 15:09 | 296K | |
![[SND]](/icons/sound2.gif) | lost da words !.xm | 2018-01-04 15:09 | 296K | |
![[SND]](/icons/sound2.gif) | music is my life.xm | 2018-01-04 15:09 | 296K | |
![[SND]](/icons/sound2.gif) | creation x.xm | 2018-01-04 15:09 | 296K | |
![[SND]](/icons/sound2.gif) | lemmings.soundalike2.xm | 2018-01-04 15:09 | 296K | |
![[SND]](/icons/sound2.gif) | dejected.xm | 2018-01-04 15:09 | 296K | |
![[SND]](/icons/sound2.gif) | here i go again.xm | 2018-01-04 15:09 | 297K | |
![[SND]](/icons/sound2.gif) | computerwelt (1).xm | 2018-01-04 15:09 | 297K | |
![[SND]](/icons/sound2.gif) | mnl.xm | 2018-01-04 15:09 | 298K | |
![[SND]](/icons/sound2.gif) | djzen-part of rave.xm | 2018-01-04 15:09 | 299K | |
![[SND]](/icons/sound2.gif) | nude staircase.xm | 2018-01-04 15:09 | 299K | |
![[SND]](/icons/sound2.gif) | dream (4).xm | 2018-01-04 15:09 | 299K | |
![[SND]](/icons/sound2.gif) | stick.xm | 2018-01-04 15:09 | 300K | |
![[SND]](/icons/sound2.gif) | rinkidinki.xm | 2018-01-04 15:09 | 300K | |
![[SND]](/icons/sound2.gif) | tokyo.xm | 2018-01-04 15:09 | 300K | |
![[SND]](/icons/sound2.gif) | weekend.xm | 2018-01-04 15:09 | 300K | |
![[SND]](/icons/sound2.gif) | sunlight shadow.xm | 2018-01-04 15:09 | 300K | |
![[SND]](/icons/sound2.gif) | waves.xm | 2018-01-04 15:09 | 301K | |
![[SND]](/icons/sound2.gif) | explosive reality.xm | 2018-01-04 15:09 | 302K | |
![[SND]](/icons/sound2.gif) | depression 1.xm | 2018-01-04 15:09 | 302K | |
![[SND]](/icons/sound2.gif) | s a star.xm | 2018-01-04 15:09 | 303K | |
![[SND]](/icons/sound2.gif) | t.w.ctppt.t.t..xm | 2018-01-04 15:09 | 303K | |
![[SND]](/icons/sound2.gif) | dorisimo.xm | 2018-01-04 15:09 | 303K | |
![[SND]](/icons/sound2.gif) | rising sun (1).xm | 2018-01-04 15:09 | 303K | |
![[SND]](/icons/sound2.gif) | sleepless nights.xm | 2018-01-04 15:09 | 303K | |
![[SND]](/icons/sound2.gif) | the ocean song.xm | 2018-01-04 15:09 | 303K | |
![[SND]](/icons/sound2.gif) | vpiano2.xm | 2018-01-04 15:09 | 303K | |
![[SND]](/icons/sound2.gif) | lords of the boards.xm | 2018-01-04 15:09 | 303K | |
![[SND]](/icons/sound2.gif) | u r krushed.xm | 2018-01-04 15:09 | 304K | |
![[SND]](/icons/sound2.gif) | joydance.xm | 2018-01-04 15:09 | 304K | |
![[SND]](/icons/sound2.gif) | interspace.xm | 2018-01-04 15:09 | 304K | |
![[SND]](/icons/sound2.gif) | orinoco flow enya.xm | 2018-01-04 15:09 | 304K | |
![[SND]](/icons/sound2.gif) | televinken revenge.xm | 2018-01-04 15:09 | 304K | |
![[SND]](/icons/sound2.gif) | metal 2000.xm | 2018-01-04 15:09 | 304K | |
![[SND]](/icons/sound2.gif) | technoreverbshortmix.xm | 2018-01-04 15:09 | 305K | |
![[SND]](/icons/sound2.gif) | revive-r-mixed.xm | 2018-01-04 15:09 | 305K | |
![[SND]](/icons/sound2.gif) | essential emus.xm | 2018-01-04 15:09 | 306K | |
![[SND]](/icons/sound2.gif) | higgeldy-piggeldy.xm | 2018-01-04 15:09 | 306K | |
![[SND]](/icons/sound2.gif) | dreamless 1.xm | 2018-01-04 15:09 | 306K | |
![[SND]](/icons/sound2.gif) | the 10th horal.xm | 2018-01-04 15:09 | 306K | |
![[SND]](/icons/sound2.gif) | tetris000a.xm | 2018-01-04 15:09 | 306K | |
![[SND]](/icons/sound2.gif) | outta this world.xm | 2018-01-04 15:09 | 306K | |
![[SND]](/icons/sound2.gif) | the kid stuff.xm | 2018-01-04 15:09 | 307K | |
![[SND]](/icons/sound2.gif) | stunts thm (dah rmx).xm | 2018-01-04 15:09 | 307K | |
![[SND]](/icons/sound2.gif) | come l'acqua al dese.xm | 2018-01-04 15:09 | 308K | |
![[SND]](/icons/sound2.gif) | water shaper.xm | 2018-01-04 15:09 | 308K | |
![[SND]](/icons/sound2.gif) | n'o 1.xm | 2018-01-04 15:09 | 309K | |
![[SND]](/icons/sound2.gif) | smurffit.xm | 2018-01-04 15:09 | 309K | |
![[SND]](/icons/sound2.gif) | foziak - dark age.xm | 2018-01-04 15:09 | 309K | |
![[SND]](/icons/sound2.gif) | untitled~1 (1).xm | 2018-01-04 15:09 | 309K | |
![[SND]](/icons/sound2.gif) | hmm.xm | 2018-01-04 15:09 | 309K | |
![[SND]](/icons/sound2.gif) | hmmf!.xm | 2018-01-04 15:09 | 309K | |
![[SND]](/icons/sound2.gif) | infinity melody.xm | 2018-01-04 15:09 | 311K | |
![[SND]](/icons/sound2.gif) | lucy.xm | 2018-01-04 15:09 | 311K | |
![[SND]](/icons/sound2.gif) | going to las indias.xm | 2018-01-04 15:09 | 311K | |
![[SND]](/icons/sound2.gif) | grejder.jam.96.xm | 2018-01-04 15:09 | 311K | |
![[SND]](/icons/sound2.gif) | the clean dump.xm | 2018-01-04 15:09 | 312K | |
![[SND]](/icons/sound2.gif) | lordlaz.xm | 2018-01-04 15:09 | 312K | |
![[SND]](/icons/sound2.gif) | mike's creepy remix.xm | 2018-01-04 15:09 | 312K | |
![[SND]](/icons/sound2.gif) | exploition.xm | 2018-01-04 15:09 | 312K | |
![[SND]](/icons/sound2.gif) | fucking druming.xm | 2018-01-04 15:09 | 313K | |
![[SND]](/icons/sound2.gif) | kids in america.xm | 2018-01-04 15:09 | 313K | |
![[SND]](/icons/sound2.gif) | pork!.xm | 2018-01-04 15:09 | 313K | |
![[SND]](/icons/sound2.gif) | wave input.xm | 2018-01-04 15:09 | 313K | |
![[SND]](/icons/sound2.gif) | stunned world iii.xm | 2018-01-04 15:09 | 313K | |
![[SND]](/icons/sound2.gif) | silver rain.xm | 2018-01-04 15:09 | 313K | |
![[SND]](/icons/sound2.gif) | staring at the ocean.xm | 2018-01-04 15:09 | 314K | |
![[SND]](/icons/sound2.gif) | lazerline - 0210.xm | 2018-01-04 15:09 | 314K | |
![[SND]](/icons/sound2.gif) | koroma.xm | 2018-01-04 15:09 | 314K | |
![[SND]](/icons/sound2.gif) | track 1.xm | 2018-01-04 15:09 | 314K | |
![[SND]](/icons/sound2.gif) | spectral memories.xm | 2018-01-04 15:09 | 314K | |
![[SND]](/icons/sound2.gif) | pipes of princes st.xm | 2018-01-04 15:09 | 314K | |
![[SND]](/icons/sound2.gif) | venture.xm | 2018-01-04 15:09 | 315K | |
![[SND]](/icons/sound2.gif) | flying astronauts.xm | 2018-01-04 15:09 | 315K | |
![[SND]](/icons/sound2.gif) | grejder2.jam.96.xm | 2018-01-04 15:09 | 315K | |
![[SND]](/icons/sound2.gif) | f a r.xm | 2018-01-04 15:09 | 316K | |
![[SND]](/icons/sound2.gif) | xjungle.xm | 2018-01-04 15:09 | 316K | |
![[SND]](/icons/sound2.gif) | spring.xm | 2018-01-04 15:09 | 316K | |
![[SND]](/icons/sound2.gif) | holyhell.xm | 2018-01-04 15:09 | 317K | |
![[SND]](/icons/sound2.gif) | just in time.xm | 2018-01-04 15:09 | 317K | |
![[SND]](/icons/sound2.gif) | trance of whale.xm | 2018-01-04 15:09 | 317K | |
![[SND]](/icons/sound2.gif) | secret behind.xm | 2018-01-04 15:09 | 317K | |
![[SND]](/icons/sound2.gif) | the k-man.xm | 2018-01-04 15:09 | 318K | |
![[SND]](/icons/sound2.gif) | ravster.xm | 2018-01-04 15:09 | 318K | |
![[SND]](/icons/sound2.gif) | introtune stone zone.xm | 2018-01-04 15:09 | 318K | |
![[SND]](/icons/sound2.gif) | the gianna sisters.xm | 2018-01-04 15:09 | 318K | |
![[SND]](/icons/sound2.gif) | wind.xm | 2018-01-04 15:09 | 319K | |
![[SND]](/icons/sound2.gif) | satan chan-sfx-angst.xm | 2018-01-04 15:09 | 319K | |
![[SND]](/icons/sound2.gif) | the 1st space colony.xm | 2018-01-04 15:09 | 319K | |
![[SND]](/icons/sound2.gif) | funk patrol.xm | 2018-01-04 15:09 | 319K | |
![[SND]](/icons/sound2.gif) | mental journey -spk.xm | 2018-01-04 15:09 | 320K | |
![[SND]](/icons/sound2.gif) | lifeforms 6.xm | 2018-01-04 15:09 | 321K | |
![[SND]](/icons/sound2.gif) | djzen-russia (trans).xm | 2018-01-04 15:09 | 321K | |
![[SND]](/icons/sound2.gif) | goa steam.xm | 2018-01-04 15:09 | 321K | |
![[SND]](/icons/sound2.gif) | starwars.xm | 2018-01-04 15:09 | 322K | |
![[SND]](/icons/sound2.gif) | dungeon.xm | 2018-01-04 15:09 | 322K | |
![[SND]](/icons/sound2.gif) | sadness.xm | 2018-01-04 15:09 | 322K | |
![[SND]](/icons/sound2.gif) | retro-tek.xm | 2018-01-04 15:09 | 322K | |
![[SND]](/icons/sound2.gif) | forest by amorf.xm | 2018-01-04 15:09 | 322K | |
![[SND]](/icons/sound2.gif) | floating dimension x.xm | 2018-01-04 15:09 | 323K | |
![[SND]](/icons/sound2.gif) | sexual control.xm | 2018-01-04 15:09 | 323K | |
![[SND]](/icons/sound2.gif) | trip to trance (shor..> | 2018-01-04 15:09 | 323K | |
![[SND]](/icons/sound2.gif) | deep beep avator.xm | 2018-01-04 15:09 | 323K | |
![[SND]](/icons/sound2.gif) | memory of love.xm | 2018-01-04 15:09 | 324K | |
![[SND]](/icons/sound2.gif) | somethingnew.xm | 2018-01-04 15:09 | 324K | |
![[SND]](/icons/sound2.gif) | lam.xm | 2018-01-04 15:09 | 324K | |
![[SND]](/icons/sound2.gif) | riders in the house.xm | 2018-01-04 15:09 | 324K | |
![[SND]](/icons/sound2.gif) | kill my fuckin brain.xm | 2018-01-04 15:09 | 325K | |
![[SND]](/icons/sound2.gif) | electric night.xm | 2018-01-04 15:09 | 325K | |
![[SND]](/icons/sound2.gif) | nightf.xm | 2018-01-04 15:09 | 326K | |
![[SND]](/icons/sound2.gif) | instant heartbeat.xm | 2018-01-04 15:09 | 326K | |
![[SND]](/icons/sound2.gif) | noname hardcore.xm | 2018-01-04 15:09 | 327K | |
![[SND]](/icons/sound2.gif) | sonarboy.xm | 2018-01-04 15:09 | 327K | |
![[SND]](/icons/sound2.gif) | flight over theearth.xm | 2018-01-04 15:09 | 327K | |
![[SND]](/icons/sound2.gif) | rahamies spede.xm | 2018-01-04 15:09 | 328K | |
![[SND]](/icons/sound2.gif) | robbast.xm | 2018-01-04 15:09 | 328K | |
![[SND]](/icons/sound2.gif) | silent brainfall.xm | 2018-01-04 15:09 | 329K | |
![[SND]](/icons/sound2.gif) | songe.xm | 2018-01-04 15:09 | 329K | |
![[SND]](/icons/sound2.gif) | strangeforcesrising.xm | 2018-01-04 15:09 | 329K | |
![[SND]](/icons/sound2.gif) | seamusisthecat.xm | 2018-01-04 15:09 | 330K | |
![[SND]](/icons/sound2.gif) | crunch.xm | 2018-01-04 15:09 | 330K | |
![[SND]](/icons/sound2.gif) | waiting for nothing.xm | 2018-01-04 15:09 | 330K | |
![[SND]](/icons/sound2.gif) | rising leaf.xm | 2018-01-04 15:09 | 330K | |
![[SND]](/icons/sound2.gif) | limitless expanse.xm | 2018-01-04 15:09 | 330K | |
![[SND]](/icons/sound2.gif) | water shaper (1).xm | 2018-01-04 15:09 | 331K | |
![[SND]](/icons/sound2.gif) | lahal mix.xm | 2018-01-04 15:09 | 331K | |
![[SND]](/icons/sound2.gif) | wise owl.xm | 2018-01-04 15:09 | 331K | |
![[SND]](/icons/sound2.gif) | get you.xm | 2018-01-04 15:09 | 331K | |
![[SND]](/icons/sound2.gif) | popcorn world.xm | 2018-01-04 15:09 | 331K | |
![[SND]](/icons/sound2.gif) | scre-aaaa!m.xm | 2018-01-04 15:09 | 331K | |
![[SND]](/icons/sound2.gif) | deep satisfaction.xm | 2018-01-04 15:09 | 331K | |
![[SND]](/icons/sound2.gif) | there'll b no destr.xm | 2018-01-04 15:09 | 332K | |
![[SND]](/icons/sound2.gif) | think.xm | 2018-01-04 15:09 | 332K | |
![[SND]](/icons/sound2.gif) | hors d'oeuvre.xm | 2018-01-04 15:09 | 332K | |
![[SND]](/icons/sound2.gif) | cz silence.xm | 2018-01-04 15:09 | 332K | |
![[SND]](/icons/sound2.gif) | lifelike.xm | 2018-01-04 15:09 | 332K | |
![[SND]](/icons/sound2.gif) | trying chip.xm | 2018-01-04 15:09 | 333K | |
![[SND]](/icons/sound2.gif) | noisy am... (.90).xm | 2018-01-04 15:09 | 333K | |
![[SND]](/icons/sound2.gif) | stig5.xm | 2018-01-04 15:09 | 333K | |
![[SND]](/icons/sound2.gif) | virtual reality.xm | 2018-01-04 15:09 | 333K | |
![[SND]](/icons/sound2.gif) | montgom.xm | 2018-01-04 15:09 | 334K | |
![[SND]](/icons/sound2.gif) | i feel good!!!.xm | 2018-01-04 15:09 | 334K | |
![[SND]](/icons/sound2.gif) | failure (306).xm | 2018-01-04 15:09 | 334K | |
![[SND]](/icons/sound2.gif) | liquid (1).xm | 2018-01-04 15:09 | 334K | |
![[SND]](/icons/sound2.gif) | triphop part 4.xm | 2018-01-04 15:09 | 334K | |
![[SND]](/icons/sound2.gif) | summertime.xm | 2018-01-04 15:09 | 334K | |
![[SND]](/icons/sound2.gif) | tetris000c.xm | 2018-01-04 15:09 | 334K | |
![[SND]](/icons/sound2.gif) | loseit.xm | 2018-01-04 15:09 | 335K | |
![[SND]](/icons/sound2.gif) | split level -spk.xm | 2018-01-04 15:09 | 335K | |
![[SND]](/icons/sound2.gif) | statik1.xm | 2018-01-04 15:09 | 335K | |
![[SND]](/icons/sound2.gif) | dreamland.xm | 2018-01-04 15:09 | 335K | |
![[SND]](/icons/sound2.gif) | slc-imposibl.xm | 2018-01-04 15:09 | 335K | |
![[SND]](/icons/sound2.gif) | the rock.xm | 2018-01-04 15:09 | 335K | |
![[SND]](/icons/sound2.gif) | chris and the clones..> | 2018-01-04 15:09 | 336K | |
![[SND]](/icons/sound2.gif) | morphic resonance.xm | 2018-01-04 15:09 | 336K | |
![[SND]](/icons/sound2.gif) | mysteric past.xm | 2018-01-04 15:09 | 336K | |
![[SND]](/icons/sound2.gif) | the end of times.xm | 2018-01-04 15:09 | 337K | |
![[SND]](/icons/sound2.gif) | hybridx's theme.xm | 2018-01-04 15:09 | 337K | |
![[SND]](/icons/sound2.gif) | cold soul.xm | 2018-01-04 15:09 | 337K | |
![[SND]](/icons/sound2.gif) | dream of childhood.xm | 2018-01-04 15:09 | 338K | |
![[SND]](/icons/sound2.gif) | untitled (11).xm | 2018-01-04 15:09 | 338K | |
![[SND]](/icons/sound2.gif) | happy hardcore high.xm | 2018-01-04 15:09 | 338K | |
![[SND]](/icons/sound2.gif) | i gotta pee!.xm | 2018-01-04 15:09 | 338K | |
![[SND]](/icons/sound2.gif) | pou bloow.xm | 2018-01-04 15:09 | 340K | |
![[SND]](/icons/sound2.gif) | into the unknown.xm | 2018-01-04 15:09 | 340K | |
![[SND]](/icons/sound2.gif) | year2003 stomach.xm | 2018-01-04 15:09 | 341K | |
![[SND]](/icons/sound2.gif) | FA-BUNG.XM | 2018-01-04 15:09 | 341K | |
![[SND]](/icons/sound2.gif) | JEMM.XM | 2018-01-04 15:09 | 342K | |
![[SND]](/icons/sound2.gif) | nek.xm | 2018-01-04 15:09 | 342K | |
![[SND]](/icons/sound2.gif) | engine of evil race.xm | 2018-01-04 15:09 | 342K | |
![[SND]](/icons/sound2.gif) | state of enchantment.xm | 2018-01-04 15:09 | 343K | |
![[SND]](/icons/sound2.gif) | little concert op.1.xm | 2018-01-04 15:09 | 343K | |
![[SND]](/icons/sound2.gif) | GANI.XM | 2018-01-04 15:09 | 343K | |
![[SND]](/icons/sound2.gif) | DEVEL3.XM | 2018-01-04 15:09 | 344K | |
![[SND]](/icons/sound2.gif) | DEVEL34.XM | 2018-01-04 15:09 | 344K | |
![[SND]](/icons/sound2.gif) | ustupidfuckingcunt!.xm | 2018-01-04 15:09 | 345K | |
![[SND]](/icons/sound2.gif) | disfusion (1).xm | 2018-01-04 15:09 | 345K | |
![[SND]](/icons/sound2.gif) | journey to the skyto.xm | 2018-01-04 15:09 | 345K | |
![[SND]](/icons/sound2.gif) | stormy sabbath.xm | 2018-01-04 15:09 | 346K | |
![[SND]](/icons/sound2.gif) | saturday in the park.xm | 2018-01-04 15:09 | 346K | |
![[SND]](/icons/sound2.gif) | still happy.xm | 2018-01-04 15:09 | 346K | |
![[SND]](/icons/sound2.gif) | songe 2.xm | 2018-01-04 15:09 | 346K | |
![[SND]](/icons/sound2.gif) | never ending dream.xm | 2018-01-04 15:09 | 346K | |
![[SND]](/icons/sound2.gif) | here comes the sun.xm | 2018-01-04 15:09 | 346K | |
![[SND]](/icons/sound2.gif) | witch doctor.xm | 2018-01-04 15:09 | 346K | |
![[SND]](/icons/sound2.gif) | lk trep your head.xm | 2018-01-04 15:09 | 347K | |
![[SND]](/icons/sound2.gif) | JL10.XM | 2018-01-04 15:09 | 347K | |
![[SND]](/icons/sound2.gif) | rain-r-mixed.xm | 2018-01-04 15:09 | 347K | |
![[SND]](/icons/sound2.gif) | flatbeat rmx.xm | 2018-01-04 15:09 | 347K | |
![[SND]](/icons/sound2.gif) | the stolen part by h..> | 2018-01-04 15:09 | 348K | |
![[SND]](/icons/sound2.gif) | DYRE.XM | 2018-01-04 15:09 | 348K | |
![[SND]](/icons/sound2.gif) | nomad.xm | 2018-01-04 15:09 | 348K | |
![[SND]](/icons/sound2.gif) | goin2die.xm | 2018-01-04 15:09 | 348K | |
![[SND]](/icons/sound2.gif) | swamps of dunkerton.xm | 2018-01-04 15:09 | 349K | |
![[SND]](/icons/sound2.gif) | the new day.xm | 2018-01-04 15:09 | 349K | |
![[SND]](/icons/sound2.gif) | perspective.xm | 2018-01-04 15:09 | 349K | |
![[SND]](/icons/sound2.gif) | dream of you.xm | 2018-01-04 15:09 | 349K | |
![[SND]](/icons/sound2.gif) | wandering water.xm | 2018-01-04 15:09 | 350K | |
![[SND]](/icons/sound2.gif) | three little birds.xm | 2018-01-04 15:09 | 350K | |
![[SND]](/icons/sound2.gif) | enogh love.xm | 2018-01-04 15:09 | 350K | |
![[SND]](/icons/sound2.gif) | hand-energy 2.6.xm | 2018-01-04 15:09 | 351K | |
![[SND]](/icons/sound2.gif) | hardcore renaissance.xm | 2018-01-04 15:09 | 351K | |
![[SND]](/icons/sound2.gif) | relax ii.xm | 2018-01-04 15:09 | 351K | |
![[SND]](/icons/sound2.gif) | syssy.xm | 2018-01-04 15:09 | 351K | |
![[SND]](/icons/sound2.gif) | surface boy.xm | 2018-01-04 15:09 | 351K | |
![[SND]](/icons/sound2.gif) | DEVEL2.XM | 2018-01-04 15:09 | 351K | |
![[SND]](/icons/sound2.gif) | magnetic mind.xm | 2018-01-04 15:09 | 352K | |
![[SND]](/icons/sound2.gif) | KK.XM | 2018-01-04 15:09 | 352K | |
![[SND]](/icons/sound2.gif) | decryption....xm | 2018-01-04 15:09 | 352K | |
![[SND]](/icons/sound2.gif) | dirtmarch.xm | 2018-01-04 15:09 | 352K | |
![[SND]](/icons/sound2.gif) | dream of the flood.xm | 2018-01-04 15:09 | 352K | |
![[SND]](/icons/sound2.gif) | the art of remember.xm | 2018-01-04 15:09 | 353K | |
![[SND]](/icons/sound2.gif) | the universal proxy.xm | 2018-01-04 15:09 | 353K | |
![[SND]](/icons/sound2.gif) | the unveiled game.xm | 2018-01-04 15:09 | 353K | |
![[SND]](/icons/sound2.gif) | monkey business.xm | 2018-01-04 15:09 | 353K | |
![[SND]](/icons/sound2.gif) | sinth rules.xm | 2018-01-04 15:09 | 353K | |
![[SND]](/icons/sound2.gif) | damage, incorporated.xm | 2018-01-04 15:09 | 354K | |
![[SND]](/icons/sound2.gif) | cowrun.xm | 2018-01-04 15:09 | 354K | |
![[SND]](/icons/sound2.gif) | voodoo.xm | 2018-01-04 15:09 | 355K | |
![[SND]](/icons/sound2.gif) | into the silence!.xm | 2018-01-04 15:09 | 356K | |
![[SND]](/icons/sound2.gif) | in a world of butter.xm | 2018-01-04 15:09 | 356K | |
![[SND]](/icons/sound2.gif) | synthetic radii.xm | 2018-01-04 15:09 | 356K | |
![[SND]](/icons/sound2.gif) | while im gonna dance.xm | 2018-01-04 15:09 | 356K | |
![[SND]](/icons/sound2.gif) | dj khan - taksim sqr.xm | 2018-01-04 15:09 | 356K | |
![[SND]](/icons/sound2.gif) | escape 2 -the funk.xm | 2018-01-04 15:09 | 357K | |
![[SND]](/icons/sound2.gif) | hawaii 5.0.xm | 2018-01-04 15:09 | 357K | |
![[SND]](/icons/sound2.gif) | pegasus.xm | 2018-01-04 15:09 | 358K | |
![[SND]](/icons/sound2.gif) | piros alma.xm | 2018-01-04 15:09 | 358K | |
![[SND]](/icons/sound2.gif) | midnight stream.xm | 2018-01-04 15:09 | 359K | |
![[SND]](/icons/sound2.gif) | escape the terror.xm | 2018-01-04 15:09 | 359K | |
![[SND]](/icons/sound2.gif) | still remeber.xm | 2018-01-04 15:09 | 359K | |
![[SND]](/icons/sound2.gif) | shot in the ass!!.xm | 2018-01-04 15:09 | 359K | |
![[SND]](/icons/sound2.gif) | temple of goa.xm | 2018-01-04 15:09 | 359K | |
![[SND]](/icons/sound2.gif) | razzia.xm | 2018-01-04 15:09 | 360K | |
![[SND]](/icons/sound2.gif) | gabbermaster.xm | 2018-01-04 15:09 | 360K | |
![[SND]](/icons/sound2.gif) | my pain.xm | 2018-01-04 15:09 | 360K | |
![[SND]](/icons/sound2.gif) | crossthesky -sublmnl.xm | 2018-01-04 15:09 | 360K | |
![[SND]](/icons/sound2.gif) | dissolution.xm | 2018-01-04 15:09 | 361K | |
![[SND]](/icons/sound2.gif) | DEVEL.XM | 2018-01-04 15:09 | 361K | |
![[SND]](/icons/sound2.gif) | escape from earth (1..> | 2018-01-04 15:09 | 361K | |
![[SND]](/icons/sound2.gif) | cloudwalking.xm | 2018-01-04 15:09 | 361K | |
![[SND]](/icons/sound2.gif) | join my brain ntx.xm | 2018-01-04 15:09 | 362K | |
![[SND]](/icons/sound2.gif) | true feelings.xm | 2018-01-04 15:09 | 363K | |
![[SND]](/icons/sound2.gif) | moshi moshi....xm | 2018-01-04 15:09 | 363K | |
![[SND]](/icons/sound2.gif) | spiral infection.xm | 2018-01-04 15:09 | 364K | |
![[SND]](/icons/sound2.gif) | satans drang.xm | 2018-01-04 15:09 | 364K | |
![[SND]](/icons/sound2.gif) | journey to unknown.xm | 2018-01-04 15:09 | 364K | |
![[SND]](/icons/sound2.gif) | find the strength.xm | 2018-01-04 15:09 | 364K | |
![[SND]](/icons/sound2.gif) | live forever.xm | 2018-01-04 15:09 | 365K | |
![[SND]](/icons/sound2.gif) | slc-finito.xm | 2018-01-04 15:09 | 366K | |
![[SND]](/icons/sound2.gif) | thriller-r-mixed.xm | 2018-01-04 15:09 | 366K | |
![[SND]](/icons/sound2.gif) | mental extrusion.xm | 2018-01-04 15:09 | 366K | |
![[SND]](/icons/sound2.gif) | wanderlust (dj howrd.xm | 2018-01-04 15:09 | 367K | |
![[SND]](/icons/sound2.gif) | last battle (pns).xm | 2018-01-04 15:09 | 367K | |
![[SND]](/icons/sound2.gif) | tranceby e.sheep.xm | 2018-01-04 15:09 | 367K | |
![[SND]](/icons/sound2.gif) | regurgitate.xm | 2018-01-04 15:09 | 367K | |
![[SND]](/icons/sound2.gif) | li dl.xm | 2018-01-04 15:09 | 368K | |
![[SND]](/icons/sound2.gif) | the virtual reality.xm | 2018-01-04 15:09 | 368K | |
![[SND]](/icons/sound2.gif) | dj torzo.xm | 2018-01-04 15:09 | 368K | |
![[SND]](/icons/sound2.gif) | kohtalo.xm | 2018-01-04 15:09 | 369K | |
![[SND]](/icons/sound2.gif) | the last new age.xm | 2018-01-04 15:09 | 369K | |
![[SND]](/icons/sound2.gif) | rockin.xm | 2018-01-04 15:09 | 369K | |
![[SND]](/icons/sound2.gif) | shakin' woman 412.xm | 2018-01-04 15:09 | 369K | |
![[SND]](/icons/sound2.gif) | logic.xm | 2018-01-04 15:09 | 370K | |
![[SND]](/icons/sound2.gif) | the journey (1).xm | 2018-01-04 15:09 | 370K | |
![[SND]](/icons/sound2.gif) | transmission.xm | 2018-01-04 15:09 | 370K | |
![[SND]](/icons/sound2.gif) | hug back.xm | 2018-01-04 15:09 | 370K | |
![[SND]](/icons/sound2.gif) | medel.xm | 2018-01-04 15:09 | 370K | |
![[SND]](/icons/sound2.gif) | twilight eternal.xm | 2018-01-04 15:09 | 370K | |
![[SND]](/icons/sound2.gif) | closer 1.xm | 2018-01-04 15:09 | 370K | |
![[SND]](/icons/sound2.gif) | gabberized funk.xm | 2018-01-04 15:09 | 371K | |
![[SND]](/icons/sound2.gif) | hymn.xm | 2018-01-04 15:09 | 371K | |
![[SND]](/icons/sound2.gif) | new generation.xm | 2018-01-04 15:09 | 371K | |
![[SND]](/icons/sound2.gif) | enjoy the beat.xm | 2018-01-04 15:09 | 371K | |
![[SND]](/icons/sound2.gif) | teen usa - csats.xm | 2018-01-04 15:09 | 372K | |
![[SND]](/icons/sound2.gif) | lazar dog 316.xm | 2018-01-04 15:09 | 372K | |
![[SND]](/icons/sound2.gif) | waterworld.xm | 2018-01-04 15:09 | 372K | |
![[SND]](/icons/sound2.gif) | firestar.xm | 2018-01-04 15:09 | 373K | |
![[SND]](/icons/sound2.gif) | we can fly.xm | 2018-01-04 15:09 | 373K | |
![[SND]](/icons/sound2.gif) | theend theme.xm | 2018-01-04 15:09 | 373K | |
![[SND]](/icons/sound2.gif) | just you and me.xm | 2018-01-04 15:09 | 374K | |
![[SND]](/icons/sound2.gif) | noise in ass rmx.xm | 2018-01-04 15:09 | 374K | |
![[SND]](/icons/sound2.gif) | cyborgmania.xm | 2018-01-04 15:09 | 374K | |
![[SND]](/icons/sound2.gif) | rubbits in da sky.xm | 2018-01-04 15:09 | 374K | |
![[SND]](/icons/sound2.gif) | lillie & sussie 98.xm | 2018-01-04 15:09 | 374K | |
![[SND]](/icons/sound2.gif) | you must dance remix.xm | 2018-01-04 15:09 | 374K | |
![[SND]](/icons/sound2.gif) | cyber nova.xm | 2018-01-04 15:09 | 375K | |
![[SND]](/icons/sound2.gif) | raving the planet.xm | 2018-01-04 15:09 | 375K | |
![[SND]](/icons/sound2.gif) | journey to earth.xm | 2018-01-04 15:09 | 375K | |
![[SND]](/icons/sound2.gif) | mustard.xm | 2018-01-04 15:09 | 376K | |
![[SND]](/icons/sound2.gif) | witbread - 3.52.xm | 2018-01-04 15:09 | 376K | |
![[SND]](/icons/sound2.gif) | presentstate of mind.xm | 2018-01-04 15:09 | 376K | |
![[SND]](/icons/sound2.gif) | savedbyadesertpixie.xm | 2018-01-04 15:09 | 377K | |
![[SND]](/icons/sound2.gif) | no name machine.xm | 2018-01-04 15:09 | 377K | |
![[SND]](/icons/sound2.gif) | perelix.xm | 2018-01-04 15:09 | 378K | |
![[SND]](/icons/sound2.gif) | niagara falls -spk.xm | 2018-01-04 15:09 | 378K | |
![[SND]](/icons/sound2.gif) | stay happy!.xm | 2018-01-04 15:09 | 378K | |
![[SND]](/icons/sound2.gif) | stars & earth.xm | 2018-01-04 15:09 | 378K | |
![[SND]](/icons/sound2.gif) | going down~1.xm | 2018-01-04 15:09 | 378K | |
![[SND]](/icons/sound2.gif) | matti.xm | 2018-01-04 15:09 | 379K | |
![[SND]](/icons/sound2.gif) | magic dream.xm | 2018-01-04 15:09 | 379K | |
![[SND]](/icons/sound2.gif) | kyoto song.xm | 2018-01-04 15:09 | 379K | |
![[SND]](/icons/sound2.gif) | tho-nordic trance.xm | 2018-01-04 15:09 | 380K | |
![[SND]](/icons/sound2.gif) | ol' skool harmony.xm | 2018-01-04 15:09 | 381K | |
![[SND]](/icons/sound2.gif) | triphop part 3.xm | 2018-01-04 15:09 | 381K | |
![[SND]](/icons/sound2.gif) | dedicated 2 you.xm | 2018-01-04 15:09 | 382K | |
![[SND]](/icons/sound2.gif) | hardcore vibes mix.xm | 2018-01-04 15:09 | 382K | |
![[SND]](/icons/sound2.gif) | the great zoo riot.xm | 2018-01-04 15:09 | 382K | |
![[SND]](/icons/sound2.gif) | life culture.xm | 2018-01-04 15:09 | 383K | |
![[SND]](/icons/sound2.gif) | down the breakbiet.xm | 2018-01-04 15:09 | 383K | |
![[SND]](/icons/sound2.gif) | second reality.xm | 2018-01-04 15:09 | 383K | |
![[SND]](/icons/sound2.gif) | for milea.xm | 2018-01-04 15:09 | 383K | |
![[SND]](/icons/sound2.gif) | stories - mr. b.xm | 2018-01-04 15:09 | 384K | |
![[SND]](/icons/sound2.gif) | solicuturis.xm | 2018-01-04 15:09 | 384K | |
![[SND]](/icons/sound2.gif) | funeral march.xm | 2018-01-04 15:09 | 384K | |
![[SND]](/icons/sound2.gif) | song for cassiopeia.xm | 2018-01-04 15:09 | 384K | |
![[SND]](/icons/sound2.gif) | forever.xm | 2018-01-04 15:09 | 384K | |
![[SND]](/icons/sound2.gif) | dragon celestial.xm | 2018-01-04 15:09 | 385K | |
![[SND]](/icons/sound2.gif) | when i'm with you.xm | 2018-01-04 15:09 | 386K | |
![[SND]](/icons/sound2.gif) | comes with me.xm | 2018-01-04 15:09 | 386K | |
![[SND]](/icons/sound2.gif) | vodka martinic9.xm | 2018-01-04 15:09 | 386K | |
![[SND]](/icons/sound2.gif) | tarmkrampe.xm | 2018-01-04 15:09 | 387K | |
![[SND]](/icons/sound2.gif) | x2-mdlat.xm | 2018-01-04 15:09 | 387K | |
![[SND]](/icons/sound2.gif) | untitled (6).xm | 2018-01-04 15:09 | 387K | |
![[SND]](/icons/sound2.gif) | the saint mix.xm | 2018-01-04 15:09 | 388K | |
![[SND]](/icons/sound2.gif) | hardcore imagination.xm | 2018-01-04 15:09 | 388K | |
![[SND]](/icons/sound2.gif) | popcorn.xm | 2018-01-04 15:09 | 388K | |
![[SND]](/icons/sound2.gif) | russian.xm | 2018-01-04 15:09 | 389K | |
![[SND]](/icons/sound2.gif) | drumbass.xm | 2018-01-04 15:09 | 389K | |
![[SND]](/icons/sound2.gif) | midnight run.xm | 2018-01-04 15:09 | 390K | |
![[SND]](/icons/sound2.gif) | sunlab.xm | 2018-01-04 15:09 | 390K | |
![[SND]](/icons/sound2.gif) | chrono.foundations.xm | 2018-01-04 15:09 | 390K | |
![[SND]](/icons/sound2.gif) | mother's pride (g.m).xm | 2018-01-04 15:09 | 390K | |
![[SND]](/icons/sound2.gif) | viper-newcomers.xm | 2018-01-04 15:09 | 390K | |
![[SND]](/icons/sound2.gif) | one-r-mixed.xm | 2018-01-04 15:09 | 390K | |
![[SND]](/icons/sound2.gif) | hollyday.xm | 2018-01-04 15:09 | 391K | |
![[SND]](/icons/sound2.gif) | disco nation!.xm | 2018-01-04 15:09 | 391K | |
![[SND]](/icons/sound2.gif) | industrial motherf.xm | 2018-01-04 15:09 | 391K | |
![[SND]](/icons/sound2.gif) | grimes.xm | 2018-01-04 15:09 | 391K | |
![[SND]](/icons/sound2.gif) | happyland (1).xm | 2018-01-04 15:09 | 392K | |
![[SND]](/icons/sound2.gif) | funk it up-dj katana.xm | 2018-01-04 15:09 | 392K | |
![[SND]](/icons/sound2.gif) | waitingforthelight.xm | 2018-01-04 15:09 | 392K | |
![[SND]](/icons/sound2.gif) | elev8.xm | 2018-01-04 15:09 | 392K | |
![[SND]](/icons/sound2.gif) | väska.xm | 2018-01-04 15:09 | 393K | |
![[SND]](/icons/sound2.gif) | space hopper.xm | 2018-01-04 15:09 | 393K | |
![[SND]](/icons/sound2.gif) | ready or not [edit].xm | 2018-01-04 15:09 | 393K | |
![[SND]](/icons/sound2.gif) | two d.xm | 2018-01-04 15:09 | 393K | |
![[SND]](/icons/sound2.gif) | k-trans.xm | 2018-01-04 15:09 | 394K | |
![[SND]](/icons/sound2.gif) | h~out.xm | 2018-01-04 15:09 | 394K | |
![[SND]](/icons/sound2.gif) | omg-angl.xm | 2018-01-04 15:09 | 394K | |
![[SND]](/icons/sound2.gif) | dreamer (headphones).xm | 2018-01-04 15:09 | 394K | |
![[SND]](/icons/sound2.gif) | no badboy intentions.xm | 2018-01-04 15:09 | 394K | |
![[SND]](/icons/sound2.gif) | lonoise.xm | 2018-01-04 15:09 | 396K | |
![[SND]](/icons/sound2.gif) | junglizm.xm | 2018-01-04 15:09 | 396K | |
![[SND]](/icons/sound2.gif) | right into the stars.xm | 2018-01-04 15:09 | 397K | |
![[SND]](/icons/sound2.gif) | phoncall.xm | 2018-01-04 15:09 | 397K | |
![[SND]](/icons/sound2.gif) | recoils.xm | 2018-01-04 15:09 | 397K | |
![[SND]](/icons/sound2.gif) | cri.xm | 2018-01-04 15:09 | 397K | |
![[SND]](/icons/sound2.gif) | witexmas.xm | 2018-01-04 15:09 | 398K | |
![[SND]](/icons/sound2.gif) | megamix.xm | 2018-01-04 15:09 | 398K | |
![[SND]](/icons/sound2.gif) | clockwork.xm | 2018-01-04 15:09 | 398K | |
![[SND]](/icons/sound2.gif) | greece - part i.xm | 2018-01-04 15:09 | 398K | |
![[SND]](/icons/sound2.gif) | simbiosis.xm | 2018-01-04 15:09 | 398K | |
![[SND]](/icons/sound2.gif) | limbo colors.xm | 2018-01-04 15:09 | 398K | |
![[SND]](/icons/sound2.gif) | djungel adventure(tn.xm | 2018-01-04 15:09 | 398K | |
![[SND]](/icons/sound2.gif) | shadows of the rock.xm | 2018-01-04 15:09 | 399K | |
![[SND]](/icons/sound2.gif) | touch down.xm | 2018-01-04 15:09 | 399K | |
![[SND]](/icons/sound2.gif) | chaos again.xm | 2018-01-04 15:09 | 399K | |
![[SND]](/icons/sound2.gif) | dizzy-r-mixed.xm | 2018-01-04 15:09 | 399K | |
![[SND]](/icons/sound2.gif) | shades of light 418.xm | 2018-01-04 15:09 | 399K | |
![[SND]](/icons/sound2.gif) | pata2 (rave remix)v2.xm | 2018-01-04 15:09 | 399K | |
![[SND]](/icons/sound2.gif) | FAST.XM | 2018-01-04 15:09 | 400K | |
![[SND]](/icons/sound2.gif) | hammarin3.xm | 2018-01-04 15:09 | 400K | |
![[SND]](/icons/sound2.gif) | rave-.0.-lution.xm | 2018-01-04 15:09 | 401K | |
![[SND]](/icons/sound2.gif) | lost in the riddles.xm | 2018-01-04 15:09 | 401K | |
![[SND]](/icons/sound2.gif) | outbreak.xm | 2018-01-04 15:09 | 402K | |
![[SND]](/icons/sound2.gif) | surprise.xm | 2018-01-04 15:09 | 403K | |
![[SND]](/icons/sound2.gif) | iraz—.xm | 2018-01-04 15:09 | 403K | |
![[SND]](/icons/sound2.gif) | oriental dream.xm | 2018-01-04 15:09 | 403K | |
![[SND]](/icons/sound2.gif) | vol92.xm | 2018-01-04 15:09 | 404K | |
![[SND]](/icons/sound2.gif) | very bad things.xm | 2018-01-04 15:09 | 404K | |
![[SND]](/icons/sound2.gif) | moonlight shadow rmx..> | 2018-01-04 15:09 | 404K | |
![[SND]](/icons/sound2.gif) | confess.xm | 2018-01-04 15:09 | 404K | |
![[SND]](/icons/sound2.gif) | next bulbulations.xm | 2018-01-04 15:09 | 404K | |
![[SND]](/icons/sound2.gif) | xymex.xm | 2018-01-04 15:09 | 405K | |
![[SND]](/icons/sound2.gif) | teknnologicall.xm | 2018-01-04 15:09 | 405K | |
![[SND]](/icons/sound2.gif) | the lost scout.xm | 2018-01-04 15:09 | 405K | |
![[SND]](/icons/sound2.gif) | stig6.xm | 2018-01-04 15:09 | 405K | |
![[SND]](/icons/sound2.gif) | forest fire...ver1.xm | 2018-01-04 15:09 | 405K | |
![[SND]](/icons/sound2.gif) | over the clouds-uxmi.xm | 2018-01-04 15:09 | 406K | |
![[SND]](/icons/sound2.gif) | j gnissi.xm | 2018-01-04 15:09 | 406K | |
![[SND]](/icons/sound2.gif) | in progress.xm | 2018-01-04 15:09 | 406K | |
![[SND]](/icons/sound2.gif) | dreem.xm | 2018-01-04 15:09 | 407K | |
![[SND]](/icons/sound2.gif) | demo4.xm | 2018-01-04 15:09 | 407K | |
![[SND]](/icons/sound2.gif) | psycho quest i.xm | 2018-01-04 15:09 | 407K | |
![[SND]](/icons/sound2.gif) | race of discovery.xm | 2018-01-04 15:09 | 407K | |
![[SND]](/icons/sound2.gif) | short house track.xm | 2018-01-04 15:09 | 408K | |
![[SND]](/icons/sound2.gif) | texp(ia).xm | 2018-01-04 15:09 | 408K | |
![[SND]](/icons/sound2.gif) | j-faith.xm | 2018-01-04 15:09 | 408K | |
![[SND]](/icons/sound2.gif) | compose.xm | 2018-01-04 15:09 | 408K | |
![[SND]](/icons/sound2.gif) | marcom0.xm | 2018-01-04 15:09 | 408K | |
![[SND]](/icons/sound2.gif) | v-surviv.xm | 2018-01-04 15:09 | 409K | |
![[SND]](/icons/sound2.gif) | rixobenafrox - ntx.xm | 2018-01-04 15:09 | 409K | |
![[SND]](/icons/sound2.gif) | pian2o.xm | 2018-01-04 15:09 | 409K | |
![[SND]](/icons/sound2.gif) | closing link (k-mix).xm | 2018-01-04 15:09 | 409K | |
![[SND]](/icons/sound2.gif) | incomplete.xm | 2018-01-04 15:09 | 409K | |
![[SND]](/icons/sound2.gif) | power.xm | 2018-01-04 15:09 | 409K | |
![[SND]](/icons/sound2.gif) | rider (1).xm | 2018-01-04 15:09 | 409K | |
![[SND]](/icons/sound2.gif) | schrumm schrumm.xm | 2018-01-04 15:09 | 410K | |
![[SND]](/icons/sound2.gif) | discerning.xm | 2018-01-04 15:09 | 410K | |
![[SND]](/icons/sound2.gif) | fucitout.xm | 2018-01-04 15:09 | 410K | |
![[SND]](/icons/sound2.gif) | lz-beynd.xm | 2018-01-04 15:09 | 411K | |
![[SND]](/icons/sound2.gif) | drift away (137).xm | 2018-01-04 15:09 | 411K | |
![[SND]](/icons/sound2.gif) | jbells.xm | 2018-01-04 15:09 | 411K | |
![[SND]](/icons/sound2.gif) | www.vortexcrew.tk.xm | 2018-01-04 15:09 | 412K | |
![[SND]](/icons/sound2.gif) | triphop evolution.xm | 2018-01-04 15:09 | 412K | |
![[SND]](/icons/sound2.gif) | dungeon xplorers ii.xm | 2018-01-04 15:09 | 412K | |
![[SND]](/icons/sound2.gif) | fairy folk.xm | 2018-01-04 15:09 | 412K | |
![[SND]](/icons/sound2.gif) | ROAR.XM | 2018-01-04 15:09 | 412K | |
![[SND]](/icons/sound2.gif) | cute 1.xm | 2018-01-04 15:09 | 412K | |
![[SND]](/icons/sound2.gif) | monkey in the jungle.xm | 2018-01-04 15:09 | 413K | |
![[SND]](/icons/sound2.gif) | never stop.xm | 2018-01-04 15:09 | 414K | |
![[SND]](/icons/sound2.gif) | trance thru the nigh.xm | 2018-01-04 15:09 | 414K | |
![[SND]](/icons/sound2.gif) | easy street.xm | 2018-01-04 15:09 | 414K | |
![[SND]](/icons/sound2.gif) | mission.xm | 2018-01-04 15:09 | 414K | |
![[SND]](/icons/sound2.gif) | noisy atmosphere.xm | 2018-01-04 15:09 | 414K | |
![[SND]](/icons/sound2.gif) | thuderdoomed ii.xm | 2018-01-04 15:09 | 415K | |
![[SND]](/icons/sound2.gif) | dasboot.xm | 2018-01-04 15:09 | 416K | |
![[SND]](/icons/sound2.gif) | loop 027 xdd 1996.xm | 2018-01-04 15:09 | 417K | |
![[SND]](/icons/sound2.gif) | prepid ahlo erchetua.xm | 2018-01-04 15:09 | 418K | |
![[SND]](/icons/sound2.gif) | poc2wind.xm | 2018-01-04 15:09 | 418K | |
![[SND]](/icons/sound2.gif) | flying with you.xm | 2018-01-04 15:09 | 419K | |
![[SND]](/icons/sound2.gif) | distance.xm | 2018-01-04 15:09 | 419K | |
![[SND]](/icons/sound2.gif) | the lost legends.xm | 2018-01-04 15:09 | 419K | |
![[SND]](/icons/sound2.gif) | krac5 in da houz.xm | 2018-01-04 15:09 | 419K | |
![[SND]](/icons/sound2.gif) | nescafe by rusboy.xm | 2018-01-04 15:09 | 419K | |
![[SND]](/icons/sound2.gif) | when twilight comes.xm | 2018-01-04 15:09 | 420K | |
![[SND]](/icons/sound2.gif) | lfswhtymakt.xm | 2018-01-04 15:09 | 420K | |
![[SND]](/icons/sound2.gif) | mission impossible (..> | 2018-01-04 15:09 | 420K | |
![[SND]](/icons/sound2.gif) | sensations.xm | 2018-01-04 15:09 | 420K | |
![[SND]](/icons/sound2.gif) | musicbi.xm | 2018-01-04 15:09 | 421K | |
![[SND]](/icons/sound2.gif) | falling.xm | 2018-01-04 15:09 | 421K | |
![[SND]](/icons/sound2.gif) | reconciliation.xm | 2018-01-04 15:09 | 421K | |
![[SND]](/icons/sound2.gif) | pat str9.xm | 2018-01-04 15:09 | 421K | |
![[SND]](/icons/sound2.gif) | underground vision.xm | 2018-01-04 15:09 | 422K | |
![[SND]](/icons/sound2.gif) | the wizards dream.xm | 2018-01-04 15:09 | 422K | |
![[SND]](/icons/sound2.gif) | space landscape.xm | 2018-01-04 15:09 | 422K | |
![[SND]](/icons/sound2.gif) | pink panther-kmprod.xm | 2018-01-04 15:09 | 423K | |
![[SND]](/icons/sound2.gif) | this is a dream - mm.xm | 2018-01-04 15:09 | 423K | |
![[SND]](/icons/sound2.gif) | reprezint romania.xm | 2018-01-04 15:09 | 423K | |
![[SND]](/icons/sound2.gif) | kokkodzsambo.xm | 2018-01-04 15:09 | 423K | |
![[SND]](/icons/sound2.gif) | novo nordeste.xm | 2018-01-04 15:09 | 424K | |
![[SND]](/icons/sound2.gif) | kursiv.xm | 2018-01-04 15:09 | 424K | |
![[SND]](/icons/sound2.gif) | vrancea.xm | 2018-01-04 15:09 | 424K | |
![[SND]](/icons/sound2.gif) | not finnished yet.xm | 2018-01-04 15:09 | 424K | |
![[SND]](/icons/sound2.gif) | living.xm | 2018-01-04 15:09 | 424K | |
![[SND]](/icons/sound2.gif) | epic.xm | 2018-01-04 15:09 | 425K | |
![[SND]](/icons/sound2.gif) | newbond.xm | 2018-01-04 15:09 | 425K | |
![[SND]](/icons/sound2.gif) | metratron.xm | 2018-01-04 15:09 | 425K | |
![[SND]](/icons/sound2.gif) | outside my window.xm | 2018-01-04 15:09 | 425K | |
![[SND]](/icons/sound2.gif) | oldtimes.xm | 2018-01-04 15:09 | 426K | |
![[SND]](/icons/sound2.gif) | cosmic lullabye rmx.xm | 2018-01-04 15:09 | 426K | |
![[SND]](/icons/sound2.gif) | somet1.xm | 2018-01-04 15:09 | 426K | |
![[SND]](/icons/sound2.gif) | die with honor.xm | 2018-01-04 15:09 | 426K | |
![[SND]](/icons/sound2.gif) | sunrise africa.xm | 2018-01-04 15:09 | 426K | |
![[SND]](/icons/sound2.gif) | cure for the remedy.xm | 2018-01-04 15:09 | 426K | |
![[SND]](/icons/sound2.gif) | the bored wind.xm | 2018-01-04 15:09 | 427K | |
![[SND]](/icons/sound2.gif) | d kombat.xm | 2018-01-04 15:09 | 427K | |
![[SND]](/icons/sound2.gif) | lahal.xm | 2018-01-04 15:09 | 428K | |
![[SND]](/icons/sound2.gif) | wuzzin' overflow.xm | 2018-01-04 15:09 | 428K | |
![[SND]](/icons/sound2.gif) | moonshin.xm | 2018-01-04 15:09 | 428K | |
![[SND]](/icons/sound2.gif) | subway.xm | 2018-01-04 15:09 | 428K | |
![[SND]](/icons/sound2.gif) | loop law.xm | 2018-01-04 15:09 | 429K | |
![[SND]](/icons/sound2.gif) | hazard.xm | 2018-01-04 15:09 | 429K | |
![[SND]](/icons/sound2.gif) | tear.xm | 2018-01-04 15:09 | 429K | |
![[SND]](/icons/sound2.gif) | cubicdr.xm | 2018-01-04 15:09 | 429K | |
![[SND]](/icons/sound2.gif) | the niggers.xm | 2018-01-04 15:09 | 430K | |
![[SND]](/icons/sound2.gif) | friends.xm | 2018-01-04 15:09 | 430K | |
![[SND]](/icons/sound2.gif) | charly ( fat mix.xm | 2018-01-04 15:09 | 430K | |
![[SND]](/icons/sound2.gif) | restless beauty.xm | 2018-01-04 15:09 | 430K | |
![[SND]](/icons/sound2.gif) | winter nights.xm | 2018-01-04 15:09 | 430K | |
![[SND]](/icons/sound2.gif) | mr-raja3.xm | 2018-01-04 15:09 | 431K | |
![[SND]](/icons/sound2.gif) | s3k specialstage.xm | 2018-01-04 15:09 | 431K | |
![[SND]](/icons/sound2.gif) | egome!.xm | 2018-01-04 15:09 | 432K | |
![[SND]](/icons/sound2.gif) | lemmin.xm | 2018-01-04 15:09 | 432K | |
![[SND]](/icons/sound2.gif) | raven.xm | 2018-01-04 15:09 | 432K | |
![[SND]](/icons/sound2.gif) | dreaming for love.xm | 2018-01-04 15:09 | 433K | |
![[SND]](/icons/sound2.gif) | ill-r-mixed.xm | 2018-01-04 15:09 | 433K | |
![[SND]](/icons/sound2.gif) | rainbow to the stars.xm | 2018-01-04 15:09 | 434K | |
![[SND]](/icons/sound2.gif) | heart - alone.xm | 2018-01-04 15:09 | 434K | |
![[SND]](/icons/sound2.gif) | what i$ it--magc.xm | 2018-01-04 15:09 | 434K | |
![[SND]](/icons/sound2.gif) | desintegration+001.xm | 2018-01-04 15:09 | 435K | |
![[SND]](/icons/sound2.gif) | ravers.xm | 2018-01-04 15:09 | 435K | |
![[SND]](/icons/sound2.gif) | war component.xm | 2018-01-04 15:09 | 435K | |
![[SND]](/icons/sound2.gif) | just flow....xm | 2018-01-04 15:09 | 435K | |
![[SND]](/icons/sound2.gif) | compo 01.xm | 2018-01-04 15:09 | 436K | |
![[SND]](/icons/sound2.gif) | deconstruct.status.q.xm | 2018-01-04 15:09 | 436K | |
![[SND]](/icons/sound2.gif) | mine.xm | 2018-01-04 15:09 | 436K | |
![[SND]](/icons/sound2.gif) | let me come to you.xm | 2018-01-04 15:09 | 437K | |
![[SND]](/icons/sound2.gif) | highland.xm | 2018-01-04 15:09 | 437K | |
![[SND]](/icons/sound2.gif) | futurecity.xm | 2018-01-04 15:09 | 437K | |
![[SND]](/icons/sound2.gif) | untitled (15).xm | 2018-01-04 15:09 | 437K | |
![[SND]](/icons/sound2.gif) | karijoukkio.xm | 2018-01-04 15:09 | 437K | |
![[SND]](/icons/sound2.gif) | ct credits theme.xm | 2018-01-04 15:09 | 438K | |
![[SND]](/icons/sound2.gif) | jazzy blue vs.3.xm | 2018-01-04 15:09 | 440K | |
![[SND]](/icons/sound2.gif) | pump the brain 2.xm | 2018-01-04 15:09 | 440K | |
![[SND]](/icons/sound2.gif) | paul.xm | 2018-01-04 15:09 | 440K | |
![[SND]](/icons/sound2.gif) | part-1.xm | 2018-01-04 15:09 | 440K | |
![[SND]](/icons/sound2.gif) | zate le ... rave rmx.xm | 2018-01-04 15:09 | 441K | |
![[SND]](/icons/sound2.gif) | datruthisoutthere.xm | 2018-01-04 15:09 | 442K | |
![[SND]](/icons/sound2.gif) | inny swiat.xm | 2018-01-04 15:09 | 442K | |
![[SND]](/icons/sound2.gif) | fable - remix.xm | 2018-01-04 15:09 | 442K | |
![[SND]](/icons/sound2.gif) | really no name!.xm | 2018-01-04 15:09 | 442K | |
![[SND]](/icons/sound2.gif) | gorganzolada.xm | 2018-01-04 15:09 | 443K | |
![[SND]](/icons/sound2.gif) | underwor.xm | 2018-01-04 15:09 | 444K | |
![[SND]](/icons/sound2.gif) | ongoing -tc.xm | 2018-01-04 15:09 | 444K | |
![[SND]](/icons/sound2.gif) | loop105 h 1996.xm | 2018-01-04 15:09 | 444K | |
![[SND]](/icons/sound2.gif) | silent night.xm | 2018-01-04 15:09 | 444K | |
![[SND]](/icons/sound2.gif) | specload.xm | 2018-01-04 15:09 | 444K | |
![[SND]](/icons/sound2.gif) | funk the army!!.xm | 2018-01-04 15:09 | 444K | |
![[SND]](/icons/sound2.gif) | newgen.xm | 2018-01-04 15:09 | 445K | |
![[SND]](/icons/sound2.gif) | off.xm | 2018-01-04 15:09 | 445K | |
![[SND]](/icons/sound2.gif) | the last day.xm | 2018-01-04 15:09 | 445K | |
![[SND]](/icons/sound2.gif) | lovely rainbow.xm | 2018-01-04 15:09 | 445K | |
![[SND]](/icons/sound2.gif) | coffee bean.xm | 2018-01-04 15:09 | 445K | |
![[SND]](/icons/sound2.gif) | suffering thickening.xm | 2018-01-04 15:09 | 445K | |
![[SND]](/icons/sound2.gif) | mega mix '97.xm | 2018-01-04 15:09 | 445K | |
![[SND]](/icons/sound2.gif) | polka #5.xm | 2018-01-04 15:09 | 446K | |
![[SND]](/icons/sound2.gif) | nuna.xm | 2018-01-04 15:09 | 446K | |
![[SND]](/icons/sound2.gif) | polka #3.xm | 2018-01-04 15:09 | 446K | |
![[SND]](/icons/sound2.gif) | pop-ligato 2.xm | 2018-01-04 15:09 | 446K | |
![[SND]](/icons/sound2.gif) | waiting for that day.xm | 2018-01-04 15:09 | 447K | |
![[SND]](/icons/sound2.gif) | just believe.xm | 2018-01-04 15:09 | 447K | |
![[SND]](/icons/sound2.gif) | r`bgrmx.xm | 2018-01-04 15:09 | 447K | |
![[SND]](/icons/sound2.gif) | new hopes.xm | 2018-01-04 15:09 | 447K | |
![[SND]](/icons/sound2.gif) | october (1).xm | 2018-01-04 15:09 | 447K | |
![[SND]](/icons/sound2.gif) | polka #2.xm | 2018-01-04 15:09 | 447K | |
![[SND]](/icons/sound2.gif) | vas.xm | 2018-01-04 15:09 | 448K | |
![[SND]](/icons/sound2.gif) | life of piano.xm | 2018-01-04 15:09 | 448K | |
![[SND]](/icons/sound2.gif) | shattered.xm | 2018-01-04 15:09 | 448K | |
![[SND]](/icons/sound2.gif) | primirea dj vais.xm | 2018-01-04 15:09 | 448K | |
![[SND]](/icons/sound2.gif) | gonga (h)oemp.xm | 2018-01-04 15:09 | 449K | |
![[SND]](/icons/sound2.gif) | midnight misery.xm | 2018-01-04 15:09 | 449K | |
![[SND]](/icons/sound2.gif) | polka #6 kaustisten.xm | 2018-01-04 15:09 | 449K | |
![[SND]](/icons/sound2.gif) | long time of nothing.xm | 2018-01-04 15:09 | 450K | |
![[SND]](/icons/sound2.gif) | overload.xm | 2018-01-04 15:09 | 450K | |
![[SND]](/icons/sound2.gif) | rising sun.xm | 2018-01-04 15:09 | 450K | |
![[SND]](/icons/sound2.gif) | tears in the rain~1.xm | 2018-01-04 15:09 | 450K | |
![[SND]](/icons/sound2.gif) | light ribbon.xm | 2018-01-04 15:09 | 450K | |
![[SND]](/icons/sound2.gif) | spacelab.xm | 2018-01-04 15:09 | 450K | |
![[SND]](/icons/sound2.gif) | tears in the rain.xm | 2018-01-04 15:09 | 450K | |
![[SND]](/icons/sound2.gif) | guitar in paradise.xm | 2018-01-04 15:09 | 451K | |
![[SND]](/icons/sound2.gif) | tot-r-mixed.xm | 2018-01-04 15:09 | 451K | |
![[SND]](/icons/sound2.gif) | daydreamer.xm | 2018-01-04 15:09 | 452K | |
![[SND]](/icons/sound2.gif) | tequilla 20002001.xm | 2018-01-04 15:09 | 452K | |
![[SND]](/icons/sound2.gif) | consummation.xm | 2018-01-04 15:09 | 453K | |
![[SND]](/icons/sound2.gif) | cosmic loop (edit).xm | 2018-01-04 15:09 | 454K | |
![[SND]](/icons/sound2.gif) | life`s a baby.xm | 2018-01-04 15:09 | 454K | |
![[SND]](/icons/sound2.gif) | lolitdwn.xm | 2018-01-04 15:09 | 454K | |
![[SND]](/icons/sound2.gif) | fatal emotion.xm | 2018-01-04 15:09 | 454K | |
![[SND]](/icons/sound2.gif) | when i was.xm | 2018-01-04 15:09 | 455K | |
![[SND]](/icons/sound2.gif) | trends.xm | 2018-01-04 15:09 | 455K | |
![[SND]](/icons/sound2.gif) | unknown origin.xm | 2018-01-04 15:09 | 455K | |
![[SND]](/icons/sound2.gif) | sound.xm | 2018-01-04 15:09 | 456K | |
![[SND]](/icons/sound2.gif) | the encounters.xm | 2018-01-04 15:09 | 456K | |
![[SND]](/icons/sound2.gif) | integration (1).xm | 2018-01-04 15:09 | 456K | |
![[SND]](/icons/sound2.gif) | larndow (starfield).xm | 2018-01-04 15:09 | 457K | |
![[SND]](/icons/sound2.gif) | untitled (7).xm | 2018-01-04 15:09 | 457K | |
![[SND]](/icons/sound2.gif) | sarcastic shuffle.xm | 2018-01-04 15:09 | 457K | |
![[SND]](/icons/sound2.gif) | indian middle ages.xm | 2018-01-04 15:09 | 457K | |
![[SND]](/icons/sound2.gif) | hi internet users !.xm | 2018-01-04 15:09 | 457K | |
![[SND]](/icons/sound2.gif) | hot nippleturner^hbe.xm | 2018-01-04 15:09 | 458K | |
![[SND]](/icons/sound2.gif) | flying bluebird.xm | 2018-01-04 15:09 | 459K | |
![[SND]](/icons/sound2.gif) | demons.xm | 2018-01-04 15:09 | 459K | |
![[SND]](/icons/sound2.gif) | exercise mode.xm | 2018-01-04 15:09 | 460K | |
![[SND]](/icons/sound2.gif) | loathe.xm | 2018-01-04 15:09 | 460K | |
![[SND]](/icons/sound2.gif) | written by telepathy.xm | 2018-01-04 15:09 | 460K | |
![[SND]](/icons/sound2.gif) | the way it is.xm | 2018-01-04 15:09 | 460K | |
![[SND]](/icons/sound2.gif) | extreme.xm | 2018-01-04 15:09 | 461K | |
![[SND]](/icons/sound2.gif) | thestory of my music.xm | 2018-01-04 15:09 | 461K | |
![[SND]](/icons/sound2.gif) | grindsto.xm | 2018-01-04 15:09 | 462K | |
![[SND]](/icons/sound2.gif) | combinations.xm | 2018-01-04 15:09 | 462K | |
![[SND]](/icons/sound2.gif) | dj pharad.xm | 2018-01-04 15:09 | 462K | |
![[SND]](/icons/sound2.gif) | d-stop.xm | 2018-01-04 15:09 | 462K | |
![[SND]](/icons/sound2.gif) | images.xm | 2018-01-04 15:09 | 462K | |
![[SND]](/icons/sound2.gif) | d1 - club bizarre.xm | 2018-01-04 15:09 | 464K | |
![[SND]](/icons/sound2.gif) | jungletus.xm | 2018-01-04 15:09 | 464K | |
![[SND]](/icons/sound2.gif) | hard beat.xm | 2018-01-04 15:09 | 464K | |
![[SND]](/icons/sound2.gif) | wicked.xm | 2018-01-04 15:09 | 465K | |
![[SND]](/icons/sound2.gif) | tune1.xm | 2018-01-04 15:09 | 465K | |
![[SND]](/icons/sound2.gif) | devilame.xm | 2018-01-04 15:09 | 465K | |
![[SND]](/icons/sound2.gif) | forsought.xm | 2018-01-04 15:09 | 465K | |
![[SND]](/icons/sound2.gif) | cool.xm | 2018-01-04 15:09 | 465K | |
![[SND]](/icons/sound2.gif) | critical-r-mixed.xm | 2018-01-04 15:09 | 466K | |
![[SND]](/icons/sound2.gif) | peacy shit.xm | 2018-01-04 15:09 | 466K | |
![[SND]](/icons/sound2.gif) | simulated.xm | 2018-01-04 15:09 | 466K | |
![[SND]](/icons/sound2.gif) | yet another popcorn.xm | 2018-01-04 15:09 | 466K | |
![[SND]](/icons/sound2.gif) | dj khan - piano ball.xm | 2018-01-04 15:09 | 466K | |
![[SND]](/icons/sound2.gif) | holy break.xm | 2018-01-04 15:09 | 467K | |
![[SND]](/icons/sound2.gif) | robiney v1.0 maf.xm | 2018-01-04 15:09 | 467K | |
![[SND]](/icons/sound2.gif) | common sense.xm | 2018-01-04 15:09 | 467K | |
![[SND]](/icons/sound2.gif) | the eager ones.xm | 2018-01-04 15:09 | 469K | |
![[SND]](/icons/sound2.gif) | seek-r-mixed.xm | 2018-01-04 15:09 | 469K | |
![[SND]](/icons/sound2.gif) | world of funk.xm | 2018-01-04 15:09 | 469K | |
![[SND]](/icons/sound2.gif) | everybody.xm | 2018-01-04 15:09 | 470K | |
![[SND]](/icons/sound2.gif) | heps heijjaa!!!!!.xm | 2018-01-04 15:09 | 470K | |
![[SND]](/icons/sound2.gif) | gleeful melody.xm | 2018-01-04 15:09 | 471K | |
![[SND]](/icons/sound2.gif) | karmic decadence.xm | 2018-01-04 15:09 | 471K | |
![[SND]](/icons/sound2.gif) | forces of darkness.xm | 2018-01-04 15:09 | 471K | |
![[SND]](/icons/sound2.gif) | unexpected visitor...xm | 2018-01-04 15:09 | 471K | |
![[SND]](/icons/sound2.gif) | gabbermaster's born.xm | 2018-01-04 15:09 | 471K | |
![[SND]](/icons/sound2.gif) | h~bi.xm | 2018-01-04 15:09 | 471K | |
![[SND]](/icons/sound2.gif) | go orbital -spk.xm | 2018-01-04 15:09 | 472K | |
![[SND]](/icons/sound2.gif) | masquerade.xm | 2018-01-04 15:09 | 472K | |
![[SND]](/icons/sound2.gif) | thesearchforsoreness.xm | 2018-01-04 15:09 | 472K | |
![[SND]](/icons/sound2.gif) | joy of life -rmx-.xm | 2018-01-04 15:09 | 472K | |
![[SND]](/icons/sound2.gif) | happy with honda.xm | 2018-01-04 15:09 | 472K | |
![[SND]](/icons/sound2.gif) | the roswell message.xm | 2018-01-04 15:09 | 472K | |
![[SND]](/icons/sound2.gif) | photographic.xm | 2018-01-04 15:09 | 473K | |
![[SND]](/icons/sound2.gif) | my dark reign over u.xm | 2018-01-04 15:09 | 474K | |
![[SND]](/icons/sound2.gif) | water flows [bert].xm | 2018-01-04 15:09 | 475K | |
![[SND]](/icons/sound2.gif) | night.xm | 2018-01-04 15:09 | 475K | |
![[SND]](/icons/sound2.gif) | master of terra.xm | 2018-01-04 15:09 | 475K | |
![[SND]](/icons/sound2.gif) | i say to you.xm | 2018-01-04 15:09 | 475K | |
![[SND]](/icons/sound2.gif) | jingle bells by as33.xm | 2018-01-04 15:09 | 475K | |
![[SND]](/icons/sound2.gif) | untitled~2.xm | 2018-01-04 15:09 | 476K | |
![[SND]](/icons/sound2.gif) | tribal celebrations.xm | 2018-01-04 15:09 | 476K | |
![[SND]](/icons/sound2.gif) | still out there.xm | 2018-01-04 15:09 | 477K | |
![[SND]](/icons/sound2.gif) | the simpsons.xm | 2018-01-04 15:09 | 477K | |
![[SND]](/icons/sound2.gif) | from heaven to hell.xm | 2018-01-04 15:09 | 477K | |
![[SND]](/icons/sound2.gif) | hq.xm | 2018-01-04 15:09 | 478K | |
![[SND]](/icons/sound2.gif) | musci.xm | 2018-01-04 15:09 | 478K | |
![[SND]](/icons/sound2.gif) | guit.xm | 2018-01-04 15:09 | 478K | |
![[SND]](/icons/sound2.gif) | critical path.xm | 2018-01-04 15:09 | 479K | |
![[SND]](/icons/sound2.gif) | space dino from moon.xm | 2018-01-04 15:09 | 479K | |
![[SND]](/icons/sound2.gif) | union.xm | 2018-01-04 15:09 | 479K | |
![[SND]](/icons/sound2.gif) | perfect beat i.xm | 2018-01-04 15:09 | 479K | |
![[SND]](/icons/sound2.gif) | spaghetti western.xm | 2018-01-04 15:09 | 480K | |
![[SND]](/icons/sound2.gif) | replica.xm | 2018-01-04 15:09 | 480K | |
![[SND]](/icons/sound2.gif) | mig och min penis.xm | 2018-01-04 15:09 | 480K | |
![[SND]](/icons/sound2.gif) | the road to paradise.xm | 2018-01-04 15:09 | 480K | |
![[SND]](/icons/sound2.gif) | horror.xm | 2018-01-04 15:09 | 480K | |
![[SND]](/icons/sound2.gif) | this is a dream rmx.xm | 2018-01-04 15:09 | 481K | |
![[SND]](/icons/sound2.gif) | loop 033 xdii 1996.xm | 2018-01-04 15:09 | 481K | |
![[SND]](/icons/sound2.gif) | denial of the truth.xm | 2018-01-04 15:09 | 482K | |
![[SND]](/icons/sound2.gif) | the j-thing.xm | 2018-01-04 15:09 | 482K | |
![[SND]](/icons/sound2.gif) | funktrip.xm | 2018-01-04 15:09 | 483K | |
![[SND]](/icons/sound2.gif) | tranquility within.xm | 2018-01-04 15:09 | 483K | |
![[SND]](/icons/sound2.gif) | oppositivity.xm | 2018-01-04 15:09 | 484K | |
![[SND]](/icons/sound2.gif) | waterporridge.xm | 2018-01-04 15:09 | 485K | |
![[SND]](/icons/sound2.gif) | errors in space.xm | 2018-01-04 15:09 | 486K | |
![[SND]](/icons/sound2.gif) | one man's dream.xm | 2018-01-04 15:09 | 486K | |
![[SND]](/icons/sound2.gif) | ease-r-mixed.xm | 2018-01-04 15:09 | 486K | |
![[SND]](/icons/sound2.gif) | vioper-good-.xm | 2018-01-04 15:09 | 486K | |
![[SND]](/icons/sound2.gif) | lovestru.xm | 2018-01-04 15:09 | 487K | |
![[SND]](/icons/sound2.gif) | civilian deth.xm | 2018-01-04 15:09 | 487K | |
![[SND]](/icons/sound2.gif) | my 12th try.....xm | 2018-01-04 15:09 | 487K | |
![[SND]](/icons/sound2.gif) | flames of fury.xm | 2018-01-04 15:09 | 487K | |
![[SND]](/icons/sound2.gif) | hide u - koshen.xm | 2018-01-04 15:09 | 487K | |
![[SND]](/icons/sound2.gif) | radioactive zone.xm | 2018-01-04 15:09 | 487K | |
![[SND]](/icons/sound2.gif) | synthesizer megamix.xm | 2018-01-04 15:09 | 487K | |
![[SND]](/icons/sound2.gif) | i'll be missing you.xm | 2018-01-04 15:09 | 488K | |
![[SND]](/icons/sound2.gif) | nw-twili.xm | 2018-01-04 15:09 | 488K | |
![[SND]](/icons/sound2.gif) | muddly deep trance @.xm | 2018-01-04 15:09 | 488K | |
![[SND]](/icons/sound2.gif) | the end of muesli.xm | 2018-01-04 15:09 | 489K | |
![[SND]](/icons/sound2.gif) | kw-thcol.xm | 2018-01-04 15:09 | 489K | |
![[SND]](/icons/sound2.gif) | ludwig's castle.xm | 2018-01-04 15:09 | 489K | |
![[SND]](/icons/sound2.gif) | KÖDD_303.XM | 2018-01-04 15:09 | 490K | |
![[SND]](/icons/sound2.gif) | loom.xm | 2018-01-04 15:09 | 490K | |
![[SND]](/icons/sound2.gif) | the sacred oak.xm | 2018-01-04 15:09 | 490K | |
![[SND]](/icons/sound2.gif) | funk out the xmas 97.xm | 2018-01-04 15:09 | 490K | |
![[SND]](/icons/sound2.gif) | tranze contamination.xm | 2018-01-04 15:09 | 490K | |
![[SND]](/icons/sound2.gif) | fuck you mellow m.f.xm | 2018-01-04 15:09 | 490K | |
![[SND]](/icons/sound2.gif) | rosie.xm | 2018-01-04 15:09 | 491K | |
![[SND]](/icons/sound2.gif) | last time.xm | 2018-01-04 15:09 | 491K | |
![[SND]](/icons/sound2.gif) | new beginnig.xm | 2018-01-04 15:09 | 491K | |
![[SND]](/icons/sound2.gif) | clement and ricky.xm | 2018-01-04 15:09 | 492K | |
![[SND]](/icons/sound2.gif) | tigerman y2k.xm | 2018-01-04 15:09 | 492K | |
![[SND]](/icons/sound2.gif) | co6.xm | 2018-01-04 15:09 | 492K | |
![[SND]](/icons/sound2.gif) | moments in trance.xm | 2018-01-04 15:09 | 492K | |
![[SND]](/icons/sound2.gif) | night crawlers.jam.xm | 2018-01-04 15:09 | 493K | |
![[SND]](/icons/sound2.gif) | mallok.xm | 2018-01-04 15:09 | 493K | |
![[SND]](/icons/sound2.gif) | jungle theme ii.xm | 2018-01-04 15:09 | 493K | |
![[SND]](/icons/sound2.gif) | differential conscio.xm | 2018-01-04 15:09 | 494K | |
![[SND]](/icons/sound2.gif) | megalopolis.xm | 2018-01-04 15:09 | 494K | |
![[SND]](/icons/sound2.gif) | imaginary unit.xm | 2018-01-04 15:09 | 494K | |
![[SND]](/icons/sound2.gif) | optimistic octopuss.xm | 2018-01-04 15:09 | 494K | |
![[SND]](/icons/sound2.gif) | reach for the sky.xm | 2018-01-04 15:09 | 495K | |
![[SND]](/icons/sound2.gif) | cyn - 80's.xm | 2018-01-04 15:09 | 495K | |
![[SND]](/icons/sound2.gif) | ear attack.xm | 2018-01-04 15:09 | 495K | |
![[SND]](/icons/sound2.gif) | dead lock.xm | 2018-01-04 15:09 | 495K | |
![[SND]](/icons/sound2.gif) | david001.xm | 2018-01-04 15:09 | 495K | |
![[SND]](/icons/sound2.gif) | modular.xm | 2018-01-04 15:09 | 496K | |
![[SND]](/icons/sound2.gif) | dead trial.xm | 2018-01-04 15:09 | 496K | |
![[SND]](/icons/sound2.gif) | forever (1).xm | 2018-01-04 15:09 | 496K | |
![[SND]](/icons/sound2.gif) | mellow club-life.xm | 2018-01-04 15:09 | 496K | |
![[SND]](/icons/sound2.gif) | earthed fusion (#2).xm | 2018-01-04 15:09 | 497K | |
![[SND]](/icons/sound2.gif) | mandarin.xm | 2018-01-04 15:09 | 497K | |
![[SND]](/icons/sound2.gif) | scared of the dark.xm | 2018-01-04 15:09 | 498K | |
![[SND]](/icons/sound2.gif) | cz battle.xm | 2018-01-04 15:09 | 499K | |
![[SND]](/icons/sound2.gif) | gazing minds.xm | 2018-01-04 15:09 | 499K | |
![[SND]](/icons/sound2.gif) | inject.xm | 2018-01-04 15:09 | 499K | |
![[SND]](/icons/sound2.gif) | russia's news 95.xm | 2018-01-04 15:09 | 500K | |
![[SND]](/icons/sound2.gif) | rock.xm | 2018-01-04 15:09 | 500K | |
![[SND]](/icons/sound2.gif) | hit the gas ! ! ! !.xm | 2018-01-04 15:09 | 501K | |
![[SND]](/icons/sound2.gif) | narcosis (1).xm | 2018-01-04 15:09 | 501K | |
![[SND]](/icons/sound2.gif) | mad-waltz.xm | 2018-01-04 15:09 | 501K | |
![[SND]](/icons/sound2.gif) | world of dragons.xm | 2018-01-04 15:09 | 502K | |
![[SND]](/icons/sound2.gif) | happy thoughts!.xm | 2018-01-04 15:09 | 502K | |
![[SND]](/icons/sound2.gif) | dark and bright.xm | 2018-01-04 15:09 | 502K | |
![[SND]](/icons/sound2.gif) | d a s b o o t.xm | 2018-01-04 15:09 | 502K | |
![[SND]](/icons/sound2.gif) | denial part iv.xm | 2018-01-04 15:09 | 502K | |
![[SND]](/icons/sound2.gif) | corsair.xm | 2018-01-04 15:09 | 502K | |
![[SND]](/icons/sound2.gif) | undercaves.xm | 2018-01-04 15:09 | 503K | |
![[SND]](/icons/sound2.gif) | newbr.xm | 2018-01-04 15:09 | 504K | |
![[SND]](/icons/sound2.gif) | pl goa01.xm | 2018-01-04 15:09 | 504K | |
![[SND]](/icons/sound2.gif) | chryseidopolis.xm | 2018-01-04 15:09 | 504K | |
![[SND]](/icons/sound2.gif) | overload (1).xm | 2018-01-04 15:09 | 505K | |
![[SND]](/icons/sound2.gif) | nubes del sur.xm | 2018-01-04 15:09 | 505K | |
![[SND]](/icons/sound2.gif) | perk.xm | 2018-01-04 15:09 | 506K | |
![[SND]](/icons/sound2.gif) | celtic force.xm | 2018-01-04 15:09 | 506K | |
![[SND]](/icons/sound2.gif) | melodious aq1.xm | 2018-01-04 15:09 | 507K | |
![[SND]](/icons/sound2.gif) | computa.xm | 2018-01-04 15:09 | 507K | |
![[SND]](/icons/sound2.gif) | evil world.xm | 2018-01-04 15:09 | 507K | |
![[SND]](/icons/sound2.gif) | what is love.xm | 2018-01-04 15:09 | 509K | |
![[SND]](/icons/sound2.gif) | gd poiso.xm | 2018-01-04 15:09 | 509K | |
![[SND]](/icons/sound2.gif) | deadmolefunk.xm | 2018-01-04 15:09 | 510K | |
![[SND]](/icons/sound2.gif) | terror in kgst.xm | 2018-01-04 15:09 | 510K | |
![[SND]](/icons/sound2.gif) | myzze & ufus.xm | 2018-01-04 15:09 | 510K | |
![[SND]](/icons/sound2.gif) | d-fab = bzrk!!!.xm | 2018-01-04 15:09 | 510K | |
![[SND]](/icons/sound2.gif) | robbas-clan.xm | 2018-01-04 15:09 | 511K | |
![[SND]](/icons/sound2.gif) | decease control.xm | 2018-01-04 15:09 | 511K | |
![[SND]](/icons/sound2.gif) | the holiday anthem.xm | 2018-01-04 15:09 | 512K | |
![[SND]](/icons/sound2.gif) | sunshine p.m.xm | 2018-01-04 15:09 | 512K | |
![[SND]](/icons/sound2.gif) | the green waterfall.xm | 2018-01-04 15:09 | 513K | |
![[SND]](/icons/sound2.gif) | upon a hate fill day.xm | 2018-01-04 15:09 | 513K | |
![[SND]](/icons/sound2.gif) | calcutta neuveux.xm | 2018-01-04 15:09 | 513K | |
![[SND]](/icons/sound2.gif) | life.xm | 2018-01-04 15:09 | 513K | |
![[SND]](/icons/sound2.gif) | having fun -).xm | 2018-01-04 15:09 | 513K | |
![[SND]](/icons/sound2.gif) | reflectional.xm | 2018-01-04 15:09 | 513K | |
![[SND]](/icons/sound2.gif) | v-ruff6.xm | 2018-01-04 15:09 | 513K | |
![[SND]](/icons/sound2.gif) | living on video 3-44.xm | 2018-01-04 15:09 | 514K | |
![[SND]](/icons/sound2.gif) | cursed partyland.xm | 2018-01-04 15:09 | 514K | |
![[SND]](/icons/sound2.gif) | dj valley diana.xm | 2018-01-04 15:09 | 515K | |
![[SND]](/icons/sound2.gif) | desiree.xm | 2018-01-04 15:09 | 515K | |
![[SND]](/icons/sound2.gif) | dream (3).xm | 2018-01-04 15:09 | 516K | |
![[SND]](/icons/sound2.gif) | drowning.xm | 2018-01-04 15:09 | 516K | |
![[SND]](/icons/sound2.gif) | drowning 1.xm | 2018-01-04 15:09 | 516K | |
![[SND]](/icons/sound2.gif) | dreams00.xm | 2018-01-04 15:09 | 516K | |
![[SND]](/icons/sound2.gif) | t.h.a.n.k.s.xm | 2018-01-04 15:09 | 517K | |
![[SND]](/icons/sound2.gif) | tuho.xm | 2018-01-04 15:09 | 517K | |
![[SND]](/icons/sound2.gif) | phallery.xm | 2018-01-04 15:09 | 518K | |
![[SND]](/icons/sound2.gif) | energy blow-nazgul.xm | 2018-01-04 15:09 | 519K | |
![[SND]](/icons/sound2.gif) | wake up to reality!.xm | 2018-01-04 15:09 | 519K | |
![[SND]](/icons/sound2.gif) | fredrichs loss.xm | 2018-01-04 15:09 | 519K | |
![[SND]](/icons/sound2.gif) | max tetris.xm | 2018-01-04 15:09 | 520K | |
![[SND]](/icons/sound2.gif) | new wave voice rmx.xm | 2018-01-04 15:09 | 520K | |
![[SND]](/icons/sound2.gif) | jules, more stories.xm | 2018-01-04 15:09 | 520K | |
![[SND]](/icons/sound2.gif) | flying on a dragon.xm | 2018-01-04 15:09 | 521K | |
![[SND]](/icons/sound2.gif) | sick muddafucka.xm | 2018-01-04 15:09 | 521K | |
![[SND]](/icons/sound2.gif) | oldtimes (1).xm | 2018-01-04 15:09 | 521K | |
![[SND]](/icons/sound2.gif) | dj khan - after sund.xm | 2018-01-04 15:09 | 522K | |
![[SND]](/icons/sound2.gif) | marooned -spk.xm | 2018-01-04 15:09 | 522K | |
![[SND]](/icons/sound2.gif) | smilin' jungle.xm | 2018-01-04 15:09 | 522K | |
![[SND]](/icons/sound2.gif) | synth c electricthie..> | 2018-01-04 15:09 | 522K | |
![[SND]](/icons/sound2.gif) | trade of fear.xm | 2018-01-04 15:09 | 522K | |
![[SND]](/icons/sound2.gif) | onelove.xm | 2018-01-04 15:09 | 522K | |
![[SND]](/icons/sound2.gif) | jaufinal.xm | 2018-01-04 15:09 | 522K | |
![[SND]](/icons/sound2.gif) | new frequencies.xm | 2018-01-04 15:09 | 523K | |
![[SND]](/icons/sound2.gif) | lostit.xm | 2018-01-04 15:09 | 523K | |
![[SND]](/icons/sound2.gif) | ptb4 m3.xm | 2018-01-04 15:09 | 523K | |
![[SND]](/icons/sound2.gif) | odyssey.xm | 2018-01-04 15:09 | 524K | |
![[SND]](/icons/sound2.gif) | chaos 96.xm | 2018-01-04 15:09 | 524K | |
![[SND]](/icons/sound2.gif) | swivel master - help.xm | 2018-01-04 15:09 | 525K | |
![[SND]](/icons/sound2.gif) | red lest.xm | 2018-01-04 15:09 | 525K | |
![[SND]](/icons/sound2.gif) | totally mad!.xm | 2018-01-04 15:09 | 526K | |
![[SND]](/icons/sound2.gif) | pointless (407).xm | 2018-01-04 15:09 | 526K | |
![[SND]](/icons/sound2.gif) | TB-DTTB.XM | 2018-01-04 15:09 | 526K | |
![[SND]](/icons/sound2.gif) | da symbol.xm | 2018-01-04 15:09 | 527K | |
![[SND]](/icons/sound2.gif) | the lonely piano.xm | 2018-01-04 15:09 | 527K | |
![[SND]](/icons/sound2.gif) | quality man.xm | 2018-01-04 15:09 | 527K | |
![[SND]](/icons/sound2.gif) | mwg-od.xm | 2018-01-04 15:09 | 528K | |
![[SND]](/icons/sound2.gif) | horny mutant jazz.xm | 2018-01-04 15:09 | 529K | |
![[SND]](/icons/sound2.gif) | mono.xm | 2018-01-04 15:09 | 529K | |
![[SND]](/icons/sound2.gif) | faded love - ngs.xm | 2018-01-04 15:09 | 529K | |
![[SND]](/icons/sound2.gif) | dead by dawn.xm | 2018-01-04 15:09 | 530K | |
![[SND]](/icons/sound2.gif) | cloud spirit.xm | 2018-01-04 15:09 | 530K | |
![[SND]](/icons/sound2.gif) | conclusion(kurz)343.xm | 2018-01-04 15:09 | 530K | |
![[SND]](/icons/sound2.gif) | october.xm | 2018-01-04 15:09 | 530K | |
![[SND]](/icons/sound2.gif) | cz disco.xm | 2018-01-04 15:09 | 531K | |
![[SND]](/icons/sound2.gif) | together - cr. edit.xm | 2018-01-04 15:09 | 531K | |
![[SND]](/icons/sound2.gif) | lodanum (the irony).xm | 2018-01-04 15:09 | 531K | |
![[SND]](/icons/sound2.gif) | head on.xm | 2018-01-04 15:09 | 531K | |
![[SND]](/icons/sound2.gif) | classical.xm | 2018-01-04 15:09 | 532K | |
![[SND]](/icons/sound2.gif) | low spirit.xm | 2018-01-04 15:09 | 532K | |
![[SND]](/icons/sound2.gif) | only just begun.xm | 2018-01-04 15:09 | 533K | |
![[SND]](/icons/sound2.gif) | sweet stuff.xm | 2018-01-04 15:09 | 533K | |
![[SND]](/icons/sound2.gif) | time passing.xm | 2018-01-04 15:09 | 533K | |
![[SND]](/icons/sound2.gif) | mf phantom.xm | 2018-01-04 15:09 | 533K | |
![[SND]](/icons/sound2.gif) | my insanity - blurry..> | 2018-01-04 15:09 | 533K | |
![[SND]](/icons/sound2.gif) | flying on a dragon (..> | 2018-01-04 15:09 | 533K | |
![[SND]](/icons/sound2.gif) | some dumb fish!.xm | 2018-01-04 15:09 | 533K | |
![[SND]](/icons/sound2.gif) | electric flow.xm | 2018-01-04 15:09 | 534K | |
![[SND]](/icons/sound2.gif) | my insanity - blurry.xm | 2018-01-04 15:09 | 534K | |
![[SND]](/icons/sound2.gif) | peaceful love.xm | 2018-01-04 15:09 | 534K | |
![[SND]](/icons/sound2.gif) | southern aurora - ce.xm | 2018-01-04 15:09 | 534K | |
![[SND]](/icons/sound2.gif) | tearsinapuddle.xm | 2018-01-04 15:09 | 534K | |
![[SND]](/icons/sound2.gif) | dispair remake.xm | 2018-01-04 15:09 | 535K | |
![[SND]](/icons/sound2.gif) | fairyland - d. t.xm | 2018-01-04 15:09 | 535K | |
![[SND]](/icons/sound2.gif) | lc saff.xm | 2018-01-04 15:09 | 536K | |
![[SND]](/icons/sound2.gif) | mar citats.xm | 2018-01-04 15:09 | 537K | |
![[SND]](/icons/sound2.gif) | the comp'96 remix.xm | 2018-01-04 15:09 | 537K | |
![[SND]](/icons/sound2.gif) | organic.xm | 2018-01-04 15:09 | 538K | |
![[SND]](/icons/sound2.gif) | millenium.xm | 2018-01-04 15:09 | 538K | |
![[SND]](/icons/sound2.gif) | little tune (le doc).xm | 2018-01-04 15:09 | 539K | |
![[SND]](/icons/sound2.gif) | deep dreams.xm | 2018-01-04 15:09 | 539K | |
![[SND]](/icons/sound2.gif) | oo the 'cat' club.xm | 2018-01-04 15:09 | 540K | |
![[SND]](/icons/sound2.gif) | sputnik.xm | 2018-01-04 15:09 | 540K | |
![[SND]](/icons/sound2.gif) | the flutedance.xm | 2018-01-04 15:09 | 540K | |
![[SND]](/icons/sound2.gif) | louize on the moon.xm | 2018-01-04 15:09 | 540K | |
![[SND]](/icons/sound2.gif) | falling for love.xm | 2018-01-04 15:09 | 540K | |
![[SND]](/icons/sound2.gif) | macgiver remix.xm | 2018-01-04 15:09 | 541K | |
![[SND]](/icons/sound2.gif) | luna b.xm | 2018-01-04 15:09 | 541K | |
![[SND]](/icons/sound2.gif) | tantrum - ck.xm | 2018-01-04 15:09 | 541K | |
![[SND]](/icons/sound2.gif) | rain~1.xm | 2018-01-04 15:09 | 541K | |
![[SND]](/icons/sound2.gif) | untitled (12).xm | 2018-01-04 15:09 | 544K | |
![[SND]](/icons/sound2.gif) | neurosis pt1.xm | 2018-01-04 15:09 | 544K | |
![[SND]](/icons/sound2.gif) | future music.xm | 2018-01-04 15:09 | 545K | |
![[SND]](/icons/sound2.gif) | i am valdor.xm | 2018-01-04 15:09 | 545K | |
![[SND]](/icons/sound2.gif) | erotika.xm | 2018-01-04 15:09 | 545K | |
![[SND]](/icons/sound2.gif) | saatana.xm | 2018-01-04 15:09 | 546K | |
![[SND]](/icons/sound2.gif) | ville sallinen.xm | 2018-01-04 15:09 | 546K | |
![[SND]](/icons/sound2.gif) | the forgottentrumpet.xm | 2018-01-04 15:09 | 546K | |
![[SND]](/icons/sound2.gif) | oceaniac.xm | 2018-01-04 15:09 | 546K | |
![[SND]](/icons/sound2.gif) | pure sensation.xm | 2018-01-04 15:09 | 547K | |
![[SND]](/icons/sound2.gif) | songe 3.xm | 2018-01-04 15:09 | 548K | |
![[SND]](/icons/sound2.gif) | cradle song of devil.xm | 2018-01-04 15:09 | 549K | |
![[SND]](/icons/sound2.gif) | thunderdome-=ghost=-.xm | 2018-01-04 15:09 | 550K | |
![[SND]](/icons/sound2.gif) | the needs of the few.xm | 2018-01-04 15:09 | 550K | |
![[SND]](/icons/sound2.gif) | dragon cave.xm | 2018-01-04 15:09 | 550K | |
![[SND]](/icons/sound2.gif) | oppositions setting.xm | 2018-01-04 15:09 | 551K | |
![[SND]](/icons/sound2.gif) | polka #1.xm | 2018-01-04 15:09 | 551K | |
![[SND]](/icons/sound2.gif) | the returning back.xm | 2018-01-04 15:09 | 551K | |
![[SND]](/icons/sound2.gif) | mft29.xm | 2018-01-04 15:09 | 551K | |
![[SND]](/icons/sound2.gif) | the breed.xm | 2018-01-04 15:09 | 552K | |
![[SND]](/icons/sound2.gif) | mermaid's song-house.xm | 2018-01-04 15:09 | 552K | |
![[SND]](/icons/sound2.gif) | mormon's song(house).xm | 2018-01-04 15:09 | 552K | |
![[SND]](/icons/sound2.gif) | summer.xm | 2018-01-04 15:09 | 552K | |
![[SND]](/icons/sound2.gif) | nevermore.xm | 2018-01-04 15:09 | 553K | |
![[SND]](/icons/sound2.gif) | hcv dance mix.xm | 2018-01-04 15:09 | 553K | |
![[SND]](/icons/sound2.gif) | seizure.xm | 2018-01-04 15:09 | 553K | |
![[SND]](/icons/sound2.gif) | small-faces.xm | 2018-01-04 15:09 | 554K | |
![[SND]](/icons/sound2.gif) | in your dreams.xm | 2018-01-04 15:09 | 554K | |
![[SND]](/icons/sound2.gif) | call from far away...xm | 2018-01-04 15:09 | 554K | |
![[SND]](/icons/sound2.gif) | mixstyle.xm | 2018-01-04 15:09 | 554K | |
![[SND]](/icons/sound2.gif) | experiment-2.xm | 2018-01-04 15:09 | 554K | |
![[SND]](/icons/sound2.gif) | fantozi (pc-ravedup).xm | 2018-01-04 15:09 | 555K | |
![[SND]](/icons/sound2.gif) | youfell.xm | 2018-01-04 15:09 | 555K | |
![[SND]](/icons/sound2.gif) | synth c test02.xm | 2018-01-04 15:09 | 555K | |
![[SND]](/icons/sound2.gif) | pile of pigs.xm | 2018-01-04 15:09 | 556K | |
![[SND]](/icons/sound2.gif) | mr dream.xm | 2018-01-04 15:09 | 556K | |
![[SND]](/icons/sound2.gif) | friend beyond time.xm | 2018-01-04 15:09 | 556K | |
![[SND]](/icons/sound2.gif) | flamingo dance.xm | 2018-01-04 15:09 | 556K | |
![[SND]](/icons/sound2.gif) | diztars new born.xm | 2018-01-04 15:09 | 556K | |
![[SND]](/icons/sound2.gif) | operation milo.xm | 2018-01-04 15:09 | 556K | |
![[SND]](/icons/sound2.gif) | la noche.xm | 2018-01-04 15:09 | 556K | |
![[SND]](/icons/sound2.gif) | passage of time.xm | 2018-01-04 15:09 | 557K | |
![[SND]](/icons/sound2.gif) | dexters trance.xm | 2018-01-04 15:09 | 557K | |
![[SND]](/icons/sound2.gif) | imploration.xm | 2018-01-04 15:09 | 557K | |
![[SND]](/icons/sound2.gif) | heaven.xm | 2018-01-04 15:09 | 557K | |
![[SND]](/icons/sound2.gif) | haaaaate!!!!!! o.xm | 2018-01-04 15:09 | 557K | |
![[SND]](/icons/sound2.gif) | savages of the weak.xm | 2018-01-04 15:09 | 557K | |
![[SND]](/icons/sound2.gif) | no entrance ! ! !.xm | 2018-01-04 15:09 | 558K | |
![[SND]](/icons/sound2.gif) | fa.xm | 2018-01-04 15:09 | 558K | |
![[SND]](/icons/sound2.gif) | with.xm | 2018-01-04 15:09 | 558K | |
![[SND]](/icons/sound2.gif) | oxygen!.xm | 2018-01-04 15:09 | 559K | |
![[SND]](/icons/sound2.gif) | peter gunn - r i o.xm | 2018-01-04 15:09 | 559K | |
![[SND]](/icons/sound2.gif) | having it all.xm | 2018-01-04 15:09 | 559K | |
![[SND]](/icons/sound2.gif) | fury1.xm | 2018-01-04 15:09 | 559K | |
![[SND]](/icons/sound2.gif) | hell sweet hell 8().xm | 2018-01-04 15:09 | 560K | |
![[SND]](/icons/sound2.gif) | impulse rythms.xm | 2018-01-04 15:09 | 560K | |
![[SND]](/icons/sound2.gif) | restoration l4'55.xm | 2018-01-04 15:09 | 560K | |
![[SND]](/icons/sound2.gif) | source-r-mixed.xm | 2018-01-04 15:09 | 561K | |
![[SND]](/icons/sound2.gif) | radiata.xm | 2018-01-04 15:09 | 561K | |
![[SND]](/icons/sound2.gif) | lycra trax #1.xm | 2018-01-04 15:09 | 562K | |
![[SND]](/icons/sound2.gif) | junvoco.xm | 2018-01-04 15:09 | 562K | |
![[SND]](/icons/sound2.gif) | suck it by magc.xm | 2018-01-04 15:09 | 562K | |
![[SND]](/icons/sound2.gif) | laputa (theme song).xm | 2018-01-04 15:09 | 562K | |
![[SND]](/icons/sound2.gif) | czn-park.xm | 2018-01-04 15:09 | 563K | |
![[SND]](/icons/sound2.gif) | mission-incredible.xm | 2018-01-04 15:09 | 564K | |
![[SND]](/icons/sound2.gif) | stones in my bed.xm | 2018-01-04 15:09 | 564K | |
![[SND]](/icons/sound2.gif) | reformation.xm | 2018-01-04 15:09 | 566K | |
![[SND]](/icons/sound2.gif) | try-r-mixed.xm | 2018-01-04 15:09 | 566K | |
![[SND]](/icons/sound2.gif) | vitalityorbital.xm | 2018-01-04 15:09 | 567K | |
![[SND]](/icons/sound2.gif) | ocean night.xm | 2018-01-04 15:09 | 568K | |
![[SND]](/icons/sound2.gif) | neweuro.xm | 2018-01-04 15:09 | 568K | |
![[SND]](/icons/sound2.gif) | dive.xm | 2018-01-04 15:09 | 568K | |
![[SND]](/icons/sound2.gif) | the riot charge.xm | 2018-01-04 15:09 | 569K | |
![[SND]](/icons/sound2.gif) | milano's back.xm | 2018-01-04 15:09 | 569K | |
![[SND]](/icons/sound2.gif) | funeral for god.xm | 2018-01-04 15:09 | 569K | |
![[SND]](/icons/sound2.gif) | six by digitalboy.xm | 2018-01-04 15:09 | 570K | |
![[SND]](/icons/sound2.gif) | evolution.xm | 2018-01-04 15:09 | 570K | |
![[SND]](/icons/sound2.gif) | kerubi cg -96.xm | 2018-01-04 15:09 | 570K | |
![[SND]](/icons/sound2.gif) | time of energy (orig.xm | 2018-01-04 15:09 | 571K | |
![[SND]](/icons/sound2.gif) | you are so realistic.xm | 2018-01-04 15:09 | 571K | |
![[SND]](/icons/sound2.gif) | nisser og tjall.xm | 2018-01-04 15:09 | 571K | |
![[SND]](/icons/sound2.gif) | the word is death.xm | 2018-01-04 15:09 | 572K | |
![[SND]](/icons/sound2.gif) | heaven of harmony.xm | 2018-01-04 15:09 | 572K | |
![[SND]](/icons/sound2.gif) | tempered steel age.xm | 2018-01-04 15:09 | 573K | |
![[SND]](/icons/sound2.gif) | show.xm | 2018-01-04 15:09 | 575K | |
![[SND]](/icons/sound2.gif) | in my mind remix.xm | 2018-01-04 15:09 | 575K | |
![[SND]](/icons/sound2.gif) | dead coffee.xm | 2018-01-04 15:09 | 576K | |
![[SND]](/icons/sound2.gif) | forward.xm | 2018-01-04 15:09 | 576K | |
![[SND]](/icons/sound2.gif) | doom.xm | 2018-01-04 15:09 | 576K | |
![[SND]](/icons/sound2.gif) | gammel venskabremix.xm | 2018-01-04 15:09 | 576K | |
![[SND]](/icons/sound2.gif) | missing.xm | 2018-01-04 15:09 | 576K | |
![[SND]](/icons/sound2.gif) | unconsciousness.xm | 2018-01-04 15:09 | 578K | |
![[SND]](/icons/sound2.gif) | happy summer.xm | 2018-01-04 15:09 | 578K | |
![[SND]](/icons/sound2.gif) | runing over the wall.xm | 2018-01-04 15:09 | 579K | |
![[SND]](/icons/sound2.gif) | shock wawe.xm | 2018-01-04 15:09 | 579K | |
![[SND]](/icons/sound2.gif) | massive style.xm | 2018-01-04 15:09 | 579K | |
![[SND]](/icons/sound2.gif) | dbr forever.xm | 2018-01-04 15:09 | 580K | |
![[SND]](/icons/sound2.gif) | traxmoon.xm | 2018-01-04 15:09 | 580K | |
![[SND]](/icons/sound2.gif) | sandamd.xm | 2018-01-04 15:09 | 580K | |
![[SND]](/icons/sound2.gif) | paranormal.xm | 2018-01-04 15:09 | 581K | |
![[SND]](/icons/sound2.gif) | milesaheadpartyvers.xm | 2018-01-04 15:09 | 581K | |
![[SND]](/icons/sound2.gif) | css3 the lane.xm | 2018-01-04 15:09 | 581K | |
![[SND]](/icons/sound2.gif) | non-stop rave.xm | 2018-01-04 15:09 | 582K | |
![[SND]](/icons/sound2.gif) | towers ndv.xm | 2018-01-04 15:09 | 582K | |
![[SND]](/icons/sound2.gif) | patrid.xm | 2018-01-04 15:09 | 582K | |
![[SND]](/icons/sound2.gif) | sea waves.xm | 2018-01-04 15:09 | 583K | |
![[SND]](/icons/sound2.gif) | viva.xm | 2018-01-04 15:09 | 583K | |
![[SND]](/icons/sound2.gif) | sentient.xm | 2018-01-04 15:09 | 583K | |
![[SND]](/icons/sound2.gif) | stenungsund by dawn.xm | 2018-01-04 15:09 | 584K | |
![[SND]](/icons/sound2.gif) | psykodelik dreams.xm | 2018-01-04 15:09 | 584K | |
![[SND]](/icons/sound2.gif) | sciura.xm | 2018-01-04 15:09 | 584K | |
![[SND]](/icons/sound2.gif) | moonlight pt1.xm | 2018-01-04 15:09 | 584K | |
![[SND]](/icons/sound2.gif) | the laser song.xm | 2018-01-04 15:09 | 584K | |
![[SND]](/icons/sound2.gif) | msk-4.xm | 2018-01-04 15:09 | 585K | |
![[SND]](/icons/sound2.gif) | magic kingdom.xm | 2018-01-04 15:09 | 585K | |
![[SND]](/icons/sound2.gif) | take a new step.xm | 2018-01-04 15:09 | 586K | |
![[SND]](/icons/sound2.gif) | ride like the wind.xm | 2018-01-04 15:09 | 586K | |
![[SND]](/icons/sound2.gif) | secret o mana remix.xm | 2018-01-04 15:09 | 587K | |
![[SND]](/icons/sound2.gif) | r`abduc.xm | 2018-01-04 15:09 | 587K | |
![[SND]](/icons/sound2.gif) | jamigo.xm | 2018-01-04 15:09 | 587K | |
![[SND]](/icons/sound2.gif) | sleep now.xm | 2018-01-04 15:09 | 587K | |
![[SND]](/icons/sound2.gif) | msk-5.xm | 2018-01-04 15:09 | 588K | |
![[SND]](/icons/sound2.gif) | coral reef.xm | 2018-01-04 15:09 | 588K | |
![[SND]](/icons/sound2.gif) | full throttle (mix).xm | 2018-01-04 15:09 | 589K | |
![[SND]](/icons/sound2.gif) | higherstateofdreamin.xm | 2018-01-04 15:09 | 589K | |
![[SND]](/icons/sound2.gif) | my heart queen.xm | 2018-01-04 15:09 | 589K | |
![[SND]](/icons/sound2.gif) | walk.xm | 2018-01-04 15:09 | 590K | |
![[SND]](/icons/sound2.gif) | coagulate me now.xm | 2018-01-04 15:09 | 590K | |
![[SND]](/icons/sound2.gif) | p u r e.xm | 2018-01-04 15:09 | 590K | |
![[SND]](/icons/sound2.gif) | unstoppabletimegear.xm | 2018-01-04 15:09 | 591K | |
![[SND]](/icons/sound2.gif) | way wabbit.xm | 2018-01-04 15:09 | 591K | |
![[SND]](/icons/sound2.gif) | soulless.xm | 2018-01-04 15:09 | 591K | |
![[SND]](/icons/sound2.gif) | stupidity.xm | 2018-01-04 15:09 | 592K | |
![[SND]](/icons/sound2.gif) | mellow rave.xm | 2018-01-04 15:09 | 592K | |
![[SND]](/icons/sound2.gif) | coppfire.xm | 2018-01-04 15:09 | 594K | |
![[SND]](/icons/sound2.gif) | forbidden universe.xm | 2018-01-04 15:09 | 594K | |
![[SND]](/icons/sound2.gif) | morphology.xm | 2018-01-04 15:09 | 594K | |
![[SND]](/icons/sound2.gif) | nixon in china.xm | 2018-01-04 15:09 | 595K | |
![[SND]](/icons/sound2.gif) | world alight.xm | 2018-01-04 15:09 | 596K | |
![[SND]](/icons/sound2.gif) | neuer tag.xm | 2018-01-04 15:09 | 596K | |
![[SND]](/icons/sound2.gif) | the diary.xm | 2018-01-04 15:09 | 596K | |
![[SND]](/icons/sound2.gif) | shock ! 5'09.xm | 2018-01-04 15:09 | 596K | |
![[SND]](/icons/sound2.gif) | neubeat6.xm | 2018-01-04 15:09 | 598K | |
![[SND]](/icons/sound2.gif) | daemon girl.xm | 2018-01-04 15:09 | 598K | |
![[SND]](/icons/sound2.gif) | hunting storm (lp).xm | 2018-01-04 15:09 | 598K | |
![[SND]](/icons/sound2.gif) | smile.xm | 2018-01-04 15:09 | 598K | |
![[SND]](/icons/sound2.gif) | tri.gro.sex.fre.aj.xm | 2018-01-04 15:09 | 598K | |
![[SND]](/icons/sound2.gif) | everything ends..xm | 2018-01-04 15:09 | 598K | |
![[SND]](/icons/sound2.gif) | shadow warior.xm | 2018-01-04 15:09 | 599K | |
![[SND]](/icons/sound2.gif) | soulsucker.xm | 2018-01-04 15:09 | 599K | |
![[SND]](/icons/sound2.gif) | have-a-go hero.xm | 2018-01-04 15:09 | 599K | |
![[SND]](/icons/sound2.gif) | imc-cldm.xm | 2018-01-04 15:09 | 600K | |
![[SND]](/icons/sound2.gif) | journey to silence.xm | 2018-01-04 15:09 | 600K | |
![[SND]](/icons/sound2.gif) | disco 32200.jam.96.xm | 2018-01-04 15:09 | 601K | |
![[SND]](/icons/sound2.gif) | o-sv hc.xm | 2018-01-04 15:09 | 601K | |
![[SND]](/icons/sound2.gif) | perihelion.xm | 2018-01-04 15:09 | 602K | |
![[SND]](/icons/sound2.gif) | just chaos.xm | 2018-01-04 15:09 | 602K | |
![[SND]](/icons/sound2.gif) | vappumarssi.xm | 2018-01-04 15:09 | 603K | |
![[SND]](/icons/sound2.gif) | sadpiano.xm | 2018-01-04 15:09 | 603K | |
![[SND]](/icons/sound2.gif) | infiltrate -dedpewl.xm | 2018-01-04 15:09 | 604K | |
![[SND]](/icons/sound2.gif) | loprd11.xm | 2018-01-04 15:09 | 604K | |
![[SND]](/icons/sound2.gif) | united colors!!!.xm | 2018-01-04 15:09 | 605K | |
![[SND]](/icons/sound2.gif) | h e a r t.xm | 2018-01-04 15:09 | 605K | |
![[SND]](/icons/sound2.gif) | waiting for fall.xm | 2018-01-04 15:09 | 606K | |
![[SND]](/icons/sound2.gif) | changes~1.xm | 2018-01-04 15:09 | 606K | |
![[SND]](/icons/sound2.gif) | pas.xm | 2018-01-04 15:09 | 606K | |
![[SND]](/icons/sound2.gif) | silvergate.xm | 2018-01-04 15:09 | 607K | |
![[SND]](/icons/sound2.gif) | only time will tell.xm | 2018-01-04 15:09 | 607K | |
![[SND]](/icons/sound2.gif) | give yourself . . .xm | 2018-01-04 15:09 | 607K | |
![[SND]](/icons/sound2.gif) | lies (1).xm | 2018-01-04 15:09 | 607K | |
![[SND]](/icons/sound2.gif) | etude.xm | 2018-01-04 15:09 | 607K | |
![[SND]](/icons/sound2.gif) | CYBERS~2.XM | 2018-01-04 15:09 | 608K | |
![[SND]](/icons/sound2.gif) | house house! dc.xm | 2018-01-04 15:09 | 608K | |
![[SND]](/icons/sound2.gif) | hiplashh.xm | 2018-01-04 15:09 | 608K | |
![[SND]](/icons/sound2.gif) | inspiration~1.xm | 2018-01-04 15:09 | 608K | |
![[SND]](/icons/sound2.gif) | untitled (10).xm | 2018-01-04 15:09 | 608K | |
![[SND]](/icons/sound2.gif) | sea bass stew.xm | 2018-01-04 15:09 | 610K | |
![[SND]](/icons/sound2.gif) | medieval believers.xm | 2018-01-04 15:09 | 610K | |
![[SND]](/icons/sound2.gif) | lanscape.xm | 2018-01-04 15:09 | 610K | |
![[SND]](/icons/sound2.gif) | kn goah.xm | 2018-01-04 15:09 | 611K | |
![[SND]](/icons/sound2.gif) | inspiration.xm | 2018-01-04 15:09 | 612K | |
![[SND]](/icons/sound2.gif) | children (heretic).xm | 2018-01-04 15:09 | 613K | |
![[SND]](/icons/sound2.gif) | harmonic groan.xm | 2018-01-04 15:09 | 613K | |
![[SND]](/icons/sound2.gif) | movin' on.xm | 2018-01-04 15:09 | 614K | |
![[SND]](/icons/sound2.gif) | loops&tings re-remix.xm | 2018-01-04 15:09 | 614K | |
![[SND]](/icons/sound2.gif) | my destiny-y3k.xm | 2018-01-04 15:09 | 615K | |
![[SND]](/icons/sound2.gif) | stifled curiosity.xm | 2018-01-04 15:09 | 615K | |
![[SND]](/icons/sound2.gif) | claustrophobia.xm | 2018-01-04 15:09 | 615K | |
![[SND]](/icons/sound2.gif) | sudden death jedi.xm | 2018-01-04 15:09 | 615K | |
![[SND]](/icons/sound2.gif) | waking up my dream.xm | 2018-01-04 15:09 | 615K | |
![[SND]](/icons/sound2.gif) | we are the fungus.xm | 2018-01-04 15:09 | 616K | |
![[SND]](/icons/sound2.gif) | the forbidden forest.xm | 2018-01-04 15:09 | 616K | |
![[SND]](/icons/sound2.gif) | winterland ][.xm | 2018-01-04 15:09 | 616K | |
![[SND]](/icons/sound2.gif) | never ending dream (..> | 2018-01-04 15:09 | 617K | |
![[SND]](/icons/sound2.gif) | experimental vol. 2.xm | 2018-01-04 15:09 | 617K | |
![[SND]](/icons/sound2.gif) | jump.xm | 2018-01-04 15:09 | 617K | |
![[SND]](/icons/sound2.gif) | underworld conf -rl.xm | 2018-01-04 15:09 | 618K | |
![[SND]](/icons/sound2.gif) | ease.xm | 2018-01-04 15:09 | 618K | |
![[SND]](/icons/sound2.gif) | the ancient ones.xm | 2018-01-04 15:09 | 618K | |
![[SND]](/icons/sound2.gif) | dlpmt.xm | 2018-01-04 15:09 | 619K | |
![[SND]](/icons/sound2.gif) | freedom.xm | 2018-01-04 15:09 | 619K | |
![[SND]](/icons/sound2.gif) | kw-behav.xm | 2018-01-04 15:09 | 619K | |
![[SND]](/icons/sound2.gif) | oasisesque.xm | 2018-01-04 15:09 | 619K | |
![[SND]](/icons/sound2.gif) | remixsed by make.xm | 2018-01-04 15:09 | 619K | |
![[SND]](/icons/sound2.gif) | sunshine.xm | 2018-01-04 15:09 | 620K | |
![[SND]](/icons/sound2.gif) | sorry for itself.xm | 2018-01-04 15:09 | 621K | |
![[SND]](/icons/sound2.gif) | danceoi.xm | 2018-01-04 15:09 | 622K | |
![[SND]](/icons/sound2.gif) | fountain of sighs.xm | 2018-01-04 15:09 | 622K | |
![[SND]](/icons/sound2.gif) | tj's dream.xm | 2018-01-04 15:09 | 623K | |
![[SND]](/icons/sound2.gif) | space seeds - nexu.xm | 2018-01-04 15:09 | 623K | |
![[SND]](/icons/sound2.gif) | dark detective - d.t.xm | 2018-01-04 15:09 | 623K | |
![[SND]](/icons/sound2.gif) | chaos 4.xm | 2018-01-04 15:09 | 625K | |
![[SND]](/icons/sound2.gif) | gabba.xm | 2018-01-04 15:09 | 625K | |
![[SND]](/icons/sound2.gif) | xthem.xm | 2018-01-04 15:09 | 626K | |
![[SND]](/icons/sound2.gif) | impact imminent.xm | 2018-01-04 15:09 | 626K | |
![[SND]](/icons/sound2.gif) | prima-facie evidence.xm | 2018-01-04 15:09 | 627K | |
![[SND]](/icons/sound2.gif) | ciccilleju's sound.xm | 2018-01-04 15:09 | 627K | |
![[SND]](/icons/sound2.gif) | serenity in massacre.xm | 2018-01-04 15:09 | 627K | |
![[SND]](/icons/sound2.gif) | grunge cocktail.xm | 2018-01-04 15:09 | 629K | |
![[SND]](/icons/sound2.gif) | red.eye.music.xm | 2018-01-04 15:09 | 629K | |
![[SND]](/icons/sound2.gif) | lunarcycle(fullmoon).xm | 2018-01-04 15:09 | 629K | |
![[SND]](/icons/sound2.gif) | itself - swiggledor.xm | 2018-01-04 15:09 | 629K | |
![[SND]](/icons/sound2.gif) | living night.xm | 2018-01-04 15:09 | 629K | |
![[SND]](/icons/sound2.gif) | l.r. i feel nervous.xm | 2018-01-04 15:09 | 629K | |
![[SND]](/icons/sound2.gif) | d.shaker - symphony.xm | 2018-01-04 15:09 | 630K | |
![[SND]](/icons/sound2.gif) | ww627 [fading echo].xm | 2018-01-04 15:09 | 630K | |
![[SND]](/icons/sound2.gif) | faction - spirit.xm | 2018-01-04 15:09 | 630K | |
![[SND]](/icons/sound2.gif) | poppen 1000.xm | 2018-01-04 15:09 | 630K | |
![[SND]](/icons/sound2.gif) | snowdance.xm | 2018-01-04 15:09 | 631K | |
![[SND]](/icons/sound2.gif) | hours.xm | 2018-01-04 15:09 | 631K | |
![[SND]](/icons/sound2.gif) | life & jesus.xm | 2018-01-04 15:09 | 631K | |
![[SND]](/icons/sound2.gif) | fs soul.xm | 2018-01-04 15:09 | 631K | |
![[SND]](/icons/sound2.gif) | djspook17.xm | 2018-01-04 15:09 | 631K | |
![[SND]](/icons/sound2.gif) | theunderground.xm | 2018-01-04 15:09 | 633K | |
![[SND]](/icons/sound2.gif) | memories by mad sub.xm | 2018-01-04 15:09 | 633K | |
![[SND]](/icons/sound2.gif) | fuckedup.xm | 2018-01-04 15:09 | 633K | |
![[SND]](/icons/sound2.gif) | hyvä - täydellinen.xm | 2018-01-04 15:09 | 634K | |
![[SND]](/icons/sound2.gif) | dreams of a bitch.xm | 2018-01-04 15:09 | 634K | |
![[SND]](/icons/sound2.gif) | cosmos.xm | 2018-01-04 15:09 | 634K | |
![[SND]](/icons/sound2.gif) | hcl sky.xm | 2018-01-04 15:09 | 635K | |
![[SND]](/icons/sound2.gif) | mysteries of giza 2.xm | 2018-01-04 15:09 | 635K | |
![[SND]](/icons/sound2.gif) | fuk vst!.xm | 2018-01-04 15:09 | 635K | |
![[SND]](/icons/sound2.gif) | daftpunk megamix.xm | 2018-01-04 15:09 | 635K | |
![[SND]](/icons/sound2.gif) | coroner 1.xm | 2018-01-04 15:09 | 635K | |
![[SND]](/icons/sound2.gif) | the long way . . ..xm | 2018-01-04 15:09 | 636K | |
![[SND]](/icons/sound2.gif) | rebound.xm | 2018-01-04 15:09 | 636K | |
![[SND]](/icons/sound2.gif) | dea.xm | 2018-01-04 15:09 | 636K | |
![[SND]](/icons/sound2.gif) | stricktly cmerz.xm | 2018-01-04 15:09 | 636K | |
![[SND]](/icons/sound2.gif) | let's dance.xm | 2018-01-04 15:09 | 636K | |
![[SND]](/icons/sound2.gif) | in the air.xm | 2018-01-04 15:09 | 637K | |
![[SND]](/icons/sound2.gif) | mountain dreams.xm | 2018-01-04 15:09 | 637K | |
![[SND]](/icons/sound2.gif) | krohe.xm | 2018-01-04 15:09 | 637K | |
![[SND]](/icons/sound2.gif) | impedance.xm | 2018-01-04 15:09 | 637K | |
![[SND]](/icons/sound2.gif) | make me bleed....xm | 2018-01-04 15:09 | 638K | |
![[SND]](/icons/sound2.gif) | the dreamer..xm | 2018-01-04 15:09 | 638K | |
![[SND]](/icons/sound2.gif) | poisoned.xm | 2018-01-04 15:09 | 638K | |
![[SND]](/icons/sound2.gif) | lovely norway.xm | 2018-01-04 15:09 | 638K | |
![[SND]](/icons/sound2.gif) | neo-digrev.xm | 2018-01-04 15:09 | 638K | |
![[SND]](/icons/sound2.gif) | outside the galaxy.xm | 2018-01-04 15:09 | 638K | |
![[SND]](/icons/sound2.gif) | radition.xm | 2018-01-04 15:09 | 639K | |
![[SND]](/icons/sound2.gif) | in your brown eyes.xm | 2018-01-04 15:09 | 639K | |
![[SND]](/icons/sound2.gif) | salama 1.xm | 2018-01-04 15:09 | 639K | |
![[SND]](/icons/sound2.gif) | factory of evil.xm | 2018-01-04 15:09 | 639K | |
![[SND]](/icons/sound2.gif) | hajk.xm | 2018-01-04 15:09 | 639K | |
![[SND]](/icons/sound2.gif) | thinking of you.xm | 2018-01-04 15:09 | 640K | |
![[SND]](/icons/sound2.gif) | luminance 1.xm | 2018-01-04 15:09 | 640K | |
![[SND]](/icons/sound2.gif) | tube-r-mixed.xm | 2018-01-04 15:09 | 640K | |
![[SND]](/icons/sound2.gif) | DEVIL5~1.XM | 2018-01-04 15:09 | 641K | |
![[SND]](/icons/sound2.gif) | desert rose.xm | 2018-01-04 15:09 | 642K | |
![[SND]](/icons/sound2.gif) | drain damage!.xm | 2018-01-04 15:09 | 642K | |
![[SND]](/icons/sound2.gif) | lisbet.xm | 2018-01-04 15:09 | 642K | |
![[SND]](/icons/sound2.gif) | sage 1.xm | 2018-01-04 15:09 | 644K | |
![[SND]](/icons/sound2.gif) | the ballad of life.xm | 2018-01-04 15:09 | 644K | |
![[SND]](/icons/sound2.gif) | destruction....(!).xm | 2018-01-04 15:09 | 645K | |
![[SND]](/icons/sound2.gif) | hotroad.xm | 2018-01-04 15:09 | 645K | |
![[SND]](/icons/sound2.gif) | left for dead.xm | 2018-01-04 15:09 | 646K | |
![[SND]](/icons/sound2.gif) | wind it up.xm | 2018-01-04 15:09 | 647K | |
![[SND]](/icons/sound2.gif) | conquest of feelings.xm | 2018-01-04 15:09 | 648K | |
![[SND]](/icons/sound2.gif) | signal.xm | 2018-01-04 15:09 | 648K | |
![[SND]](/icons/sound2.gif) | pioneers of the sky.xm | 2018-01-04 15:09 | 649K | |
![[SND]](/icons/sound2.gif) | just.xm | 2018-01-04 15:09 | 649K | |
![[SND]](/icons/sound2.gif) | untitled (4).xm | 2018-01-04 15:09 | 650K | |
![[SND]](/icons/sound2.gif) | the sun will shine.xm | 2018-01-04 15:09 | 651K | |
![[SND]](/icons/sound2.gif) | jul-zen.xm | 2018-01-04 15:09 | 652K | |
![[SND]](/icons/sound2.gif) | love is a paradise.xm | 2018-01-04 15:09 | 652K | |
![[SND]](/icons/sound2.gif) | uranium from africa.xm | 2018-01-04 15:09 | 653K | |
![[SND]](/icons/sound2.gif) | roll.xm | 2018-01-04 15:09 | 653K | |
![[SND]](/icons/sound2.gif) | life n.r.g. dc.xm | 2018-01-04 15:09 | 653K | |
![[SND]](/icons/sound2.gif) | lost paradise.xm | 2018-01-04 15:09 | 653K | |
![[SND]](/icons/sound2.gif) | finale (cmr).xm | 2018-01-04 15:09 | 653K | |
![[SND]](/icons/sound2.gif) | moby's dick by tok.xm | 2018-01-04 15:09 | 653K | |
![[SND]](/icons/sound2.gif) | neuro8.xm | 2018-01-04 15:09 | 654K | |
![[SND]](/icons/sound2.gif) | k synerg.xm | 2018-01-04 15:09 | 655K | |
![[SND]](/icons/sound2.gif) | pitech.xm | 2018-01-04 15:09 | 655K | |
![[SND]](/icons/sound2.gif) | point 88.xm | 2018-01-04 15:09 | 655K | |
![[SND]](/icons/sound2.gif) | old man's curse.xm | 2018-01-04 15:09 | 656K | |
![[SND]](/icons/sound2.gif) | hypnotizer!.xm | 2018-01-04 15:09 | 656K | |
![[SND]](/icons/sound2.gif) | want you to be here.xm | 2018-01-04 15:09 | 656K | |
![[SND]](/icons/sound2.gif) | gabber screams.xm | 2018-01-04 15:09 | 657K | |
![[SND]](/icons/sound2.gif) | phase1 [innermix] 1.xm | 2018-01-04 15:09 | 659K | |
![[SND]](/icons/sound2.gif) | digital (ploter mix).xm | 2018-01-04 15:09 | 659K | |
![[SND]](/icons/sound2.gif) | dg dream n' dance.xm | 2018-01-04 15:09 | 660K | |
![[SND]](/icons/sound2.gif) | theworse.xm | 2018-01-04 15:09 | 660K | |
![[SND]](/icons/sound2.gif) | somewhere in japan.xm | 2018-01-04 15:09 | 661K | |
![[SND]](/icons/sound2.gif) | plus-jam.xm | 2018-01-04 15:09 | 661K | |
![[SND]](/icons/sound2.gif) | lost wanderer.xm | 2018-01-04 15:09 | 661K | |
![[SND]](/icons/sound2.gif) | msk-6.xm | 2018-01-04 15:09 | 662K | |
![[SND]](/icons/sound2.gif) | the bards repreive.xm | 2018-01-04 15:09 | 662K | |
![[SND]](/icons/sound2.gif) | yggdrasil- leroycrs.xm | 2018-01-04 15:09 | 662K | |
![[SND]](/icons/sound2.gif) | funkenstein.xm | 2018-01-04 15:09 | 663K | |
![[SND]](/icons/sound2.gif) | twins.xm | 2018-01-04 15:09 | 663K | |
![[SND]](/icons/sound2.gif) | JL11.XM | 2018-01-04 15:09 | 663K | |
![[SND]](/icons/sound2.gif) | opium.xm | 2018-01-04 15:09 | 663K | |
![[SND]](/icons/sound2.gif) | l.h.t.t..xm | 2018-01-04 15:09 | 663K | |
![[SND]](/icons/sound2.gif) | tribe 0f fiery f0xe$.xm | 2018-01-04 15:09 | 664K | |
![[SND]](/icons/sound2.gif) | texn0 ][ by magc.xm | 2018-01-04 15:09 | 664K | |
![[SND]](/icons/sound2.gif) | highonlove (bassq96).xm | 2018-01-04 15:09 | 664K | |
![[SND]](/icons/sound2.gif) | o.z.z.t.xm | 2018-01-04 15:09 | 665K | |
![[SND]](/icons/sound2.gif) | f e a r by defex.xm | 2018-01-04 15:09 | 666K | |
![[SND]](/icons/sound2.gif) | felicity.xm | 2018-01-04 15:09 | 667K | |
![[SND]](/icons/sound2.gif) | the uberfunkmeister.xm | 2018-01-04 15:09 | 667K | |
![[SND]](/icons/sound2.gif) | horns of jeryho.xm | 2018-01-04 15:09 | 668K | |
![[SND]](/icons/sound2.gif) | give me your mind.xm | 2018-01-04 15:09 | 668K | |
![[SND]](/icons/sound2.gif) | the cheese tribe.xm | 2018-01-04 15:09 | 668K | |
![[SND]](/icons/sound2.gif) | go rappo.xm | 2018-01-04 15:09 | 668K | |
![[SND]](/icons/sound2.gif) | walking in the air.xm | 2018-01-04 15:09 | 668K | |
![[SND]](/icons/sound2.gif) | xperienc.xm | 2018-01-04 15:09 | 669K | |
![[SND]](/icons/sound2.gif) | frost palace intro.xm | 2018-01-04 15:09 | 671K | |
![[SND]](/icons/sound2.gif) | riderang.xm | 2018-01-04 15:09 | 671K | |
![[SND]](/icons/sound2.gif) | the dark death.xm | 2018-01-04 15:09 | 671K | |
![[SND]](/icons/sound2.gif) | exit to the world.xm | 2018-01-04 15:09 | 671K | |
![[SND]](/icons/sound2.gif) | dream.xm | 2018-01-04 15:09 | 671K | |
![[SND]](/icons/sound2.gif) | vampire's sabbath.xm | 2018-01-04 15:09 | 672K | |
![[SND]](/icons/sound2.gif) | terminal state.xm | 2018-01-04 15:09 | 672K | |
![[SND]](/icons/sound2.gif) | praelud 22.xm | 2018-01-04 15:09 | 672K | |
![[SND]](/icons/sound2.gif) | judge party.xm | 2018-01-04 15:09 | 672K | |
![[SND]](/icons/sound2.gif) | dnb4faster.xm | 2018-01-04 15:09 | 672K | |
![[SND]](/icons/sound2.gif) | dreams in the jungle.xm | 2018-01-04 15:09 | 672K | |
![[SND]](/icons/sound2.gif) | missing you.xm | 2018-01-04 15:09 | 673K | |
![[SND]](/icons/sound2.gif) | kalling for death.xm | 2018-01-04 15:09 | 673K | |
![[SND]](/icons/sound2.gif) | over.electric.iceps.xm | 2018-01-04 15:09 | 673K | |
![[SND]](/icons/sound2.gif) | siesta el mexico.xm | 2018-01-04 15:09 | 673K | |
![[SND]](/icons/sound2.gif) | dream land.xm | 2018-01-04 15:09 | 673K | |
![[SND]](/icons/sound2.gif) | to be jubilant.xm | 2018-01-04 15:09 | 673K | |
![[SND]](/icons/sound2.gif) | helve.xm | 2018-01-04 15:09 | 673K | |
![[SND]](/icons/sound2.gif) | hit2.xm | 2018-01-04 15:09 | 674K | |
![[SND]](/icons/sound2.gif) | my version -spk.xm | 2018-01-04 15:09 | 674K | |
![[SND]](/icons/sound2.gif) | morphium trip.xm | 2018-01-04 15:09 | 674K | |
![[SND]](/icons/sound2.gif) | the mountain.xm | 2018-01-04 15:09 | 675K | |
![[SND]](/icons/sound2.gif) | eyegabooom.xm | 2018-01-04 15:09 | 675K | |
![[SND]](/icons/sound2.gif) | mindcent.xm | 2018-01-04 15:09 | 675K | |
![[SND]](/icons/sound2.gif) | m's strakosferic.xm | 2018-01-04 15:09 | 676K | |
![[SND]](/icons/sound2.gif) | nyirfa a reten -km.xm | 2018-01-04 15:09 | 676K | |
![[SND]](/icons/sound2.gif) | dj gary- underattack.xm | 2018-01-04 15:09 | 677K | |
![[SND]](/icons/sound2.gif) | vei ramane vais.xm | 2018-01-04 15:09 | 677K | |
![[SND]](/icons/sound2.gif) | regno delle eliche.xm | 2018-01-04 15:09 | 677K | |
![[SND]](/icons/sound2.gif) | sandokan! -kmprod.xm | 2018-01-04 15:09 | 678K | |
![[SND]](/icons/sound2.gif) | rise of the dark by.xm | 2018-01-04 15:09 | 678K | |
![[SND]](/icons/sound2.gif) | october serenade.xm | 2018-01-04 15:09 | 678K | |
![[SND]](/icons/sound2.gif) | fall of 98 . acidbee.xm | 2018-01-04 15:09 | 678K | |
![[SND]](/icons/sound2.gif) | raps.xm | 2018-01-04 15:09 | 679K | |
![[SND]](/icons/sound2.gif) | hardcore-dance--).xm | 2018-01-04 15:09 | 679K | |
![[SND]](/icons/sound2.gif) | popcorn (trance mix).xm | 2018-01-04 15:09 | 680K | |
![[SND]](/icons/sound2.gif) | trancescan.xm | 2018-01-04 15:09 | 680K | |
![[SND]](/icons/sound2.gif) | lost speed.xm | 2018-01-04 15:09 | 680K | |
![[SND]](/icons/sound2.gif) | doin' it for money.xm | 2018-01-04 15:09 | 681K | |
![[SND]](/icons/sound2.gif) | smooth sensation.xm | 2018-01-04 15:09 | 682K | |
![[SND]](/icons/sound2.gif) | narrow r.xm | 2018-01-04 15:09 | 682K | |
![[SND]](/icons/sound2.gif) | exp. to paradise.xm | 2018-01-04 15:09 | 683K | |
![[SND]](/icons/sound2.gif) | some!.xm | 2018-01-04 15:09 | 683K | |
![[SND]](/icons/sound2.gif) | quiem.xm | 2018-01-04 15:09 | 684K | |
![[SND]](/icons/sound2.gif) | come guilt 1.xm | 2018-01-04 15:09 | 684K | |
![[SND]](/icons/sound2.gif) | h's monikones.xm | 2018-01-04 15:09 | 684K | |
![[SND]](/icons/sound2.gif) | g-r-pian.xm | 2018-01-04 15:09 | 684K | |
![[SND]](/icons/sound2.gif) | doors to heaven!.xm | 2018-01-04 15:09 | 685K | |
![[SND]](/icons/sound2.gif) | titanic.xm | 2018-01-04 15:09 | 685K | |
![[SND]](/icons/sound2.gif) | drowning (feme edit).xm | 2018-01-04 15:09 | 686K | |
![[SND]](/icons/sound2.gif) | digital confusion.xm | 2018-01-04 15:09 | 687K | |
![[SND]](/icons/sound2.gif) | promise.xm | 2018-01-04 15:09 | 687K | |
![[SND]](/icons/sound2.gif) | slow motion-sfx.xm | 2018-01-04 15:09 | 688K | |
![[SND]](/icons/sound2.gif) | slime.xm | 2018-01-04 15:09 | 689K | |
![[SND]](/icons/sound2.gif) | nasty pebreras.xm | 2018-01-04 15:09 | 689K | |
![[SND]](/icons/sound2.gif) | promethee enchaine.xm | 2018-01-04 15:09 | 689K | |
![[SND]](/icons/sound2.gif) | highest grief.xm | 2018-01-04 15:09 | 690K | |
![[SND]](/icons/sound2.gif) | hate!.xm | 2018-01-04 15:09 | 690K | |
![[SND]](/icons/sound2.gif) | chemical plant zone.xm | 2018-01-04 15:09 | 690K | |
![[SND]](/icons/sound2.gif) | mr. mamma.xm | 2018-01-04 15:09 | 691K | |
![[SND]](/icons/sound2.gif) | kurwa.xm | 2018-01-04 15:09 | 691K | |
![[SND]](/icons/sound2.gif) | kurwa14.xm | 2018-01-04 15:09 | 691K | |
![[SND]](/icons/sound2.gif) | fary.xm | 2018-01-04 15:09 | 693K | |
![[SND]](/icons/sound2.gif) | deutchland clubmix.xm | 2018-01-04 15:09 | 694K | |
![[SND]](/icons/sound2.gif) | happycorpse =).xm | 2018-01-04 15:09 | 695K | |
![[SND]](/icons/sound2.gif) | revival project.xm | 2018-01-04 15:09 | 695K | |
![[SND]](/icons/sound2.gif) | future & past.xm | 2018-01-04 15:09 | 695K | |
![[SND]](/icons/sound2.gif) | starting.xm | 2018-01-04 15:09 | 696K | |
![[SND]](/icons/sound2.gif) | haydn goes hakkuh.xm | 2018-01-04 15:09 | 698K | |
![[SND]](/icons/sound2.gif) | liquid rave.xm | 2018-01-04 15:09 | 698K | |
![[SND]](/icons/sound2.gif) | icare.xm | 2018-01-04 15:09 | 698K | |
![[SND]](/icons/sound2.gif) | rock-vi sl†r p† ..> | 2018-01-04 15:09 | 699K | |
![[SND]](/icons/sound2.gif) | szklany swiat.xm | 2018-01-04 15:09 | 699K | |
![[SND]](/icons/sound2.gif) | fear the morning.xm | 2018-01-04 15:09 | 699K | |
![[SND]](/icons/sound2.gif) | kegrier.xm | 2018-01-04 15:09 | 700K | |
![[SND]](/icons/sound2.gif) | k-9 spring search.xm | 2018-01-04 15:09 | 701K | |
![[SND]](/icons/sound2.gif) | z by trap.xm | 2018-01-04 15:09 | 701K | |
![[SND]](/icons/sound2.gif) | heartless.xm | 2018-01-04 15:09 | 701K | |
![[SND]](/icons/sound2.gif) | darkest travel.xm | 2018-01-04 15:09 | 703K | |
![[SND]](/icons/sound2.gif) | need to suffer.xm | 2018-01-04 15:09 | 703K | |
![[SND]](/icons/sound2.gif) | indian s.xm | 2018-01-04 15:09 | 703K | |
![[SND]](/icons/sound2.gif) | w sun.xm | 2018-01-04 15:09 | 705K | |
![[SND]](/icons/sound2.gif) | jaunt.xm | 2018-01-04 15:09 | 705K | |
![[SND]](/icons/sound2.gif) | simulacre.xm | 2018-01-04 15:09 | 705K | |
![[SND]](/icons/sound2.gif) | drum'n'bass #5.xm | 2018-01-04 15:09 | 705K | |
![[SND]](/icons/sound2.gif) | mistery steps.xm | 2018-01-04 15:09 | 706K | |
![[SND]](/icons/sound2.gif) | frequency clear.xm | 2018-01-04 15:09 | 706K | |
![[SND]](/icons/sound2.gif) | you must dance.xm | 2018-01-04 15:09 | 708K | |
![[SND]](/icons/sound2.gif) | message 2 oberhausen.xm | 2018-01-04 15:09 | 709K | |
![[SND]](/icons/sound2.gif) | deszcz.xm | 2018-01-04 15:09 | 710K | |
![[SND]](/icons/sound2.gif) | you never know.xm | 2018-01-04 15:09 | 710K | |
![[SND]](/icons/sound2.gif) | stream (315).xm | 2018-01-04 15:09 | 710K | |
![[SND]](/icons/sound2.gif) | tribute to rio.xm | 2018-01-04 15:09 | 713K | |
![[SND]](/icons/sound2.gif) | holmie talk.xm | 2018-01-04 15:09 | 713K | |
![[SND]](/icons/sound2.gif) | counterparts.xm | 2018-01-04 15:09 | 713K | |
![[SND]](/icons/sound2.gif) | hacekomoe.xm | 2018-01-04 15:09 | 714K | |
![[SND]](/icons/sound2.gif) | dau harddisk!.xm | 2018-01-04 15:09 | 714K | |
![[SND]](/icons/sound2.gif) | district map part ii.xm | 2018-01-04 15:09 | 715K | |
![[SND]](/icons/sound2.gif) | one sweet day.xm | 2018-01-04 15:09 | 715K | |
![[SND]](/icons/sound2.gif) | tr ttnow.xm | 2018-01-04 15:09 | 715K | |
![[SND]](/icons/sound2.gif) | countryman&oldbanjo.xm | 2018-01-04 15:09 | 715K | |
![[SND]](/icons/sound2.gif) | supernova - bassq.xm | 2018-01-04 15:09 | 715K | |
![[SND]](/icons/sound2.gif) | ravers up !!!.xm | 2018-01-04 15:09 | 717K | |
![[SND]](/icons/sound2.gif) | seek'n'destroy.xm | 2018-01-04 15:09 | 717K | |
![[SND]](/icons/sound2.gif) | the leviathan.xm | 2018-01-04 15:09 | 718K | |
![[SND]](/icons/sound2.gif) | med ripp.xm | 2018-01-04 15:09 | 718K | |
![[SND]](/icons/sound2.gif) | sweet dreams.xm | 2018-01-04 15:09 | 719K | |
![[SND]](/icons/sound2.gif) | deep rmx.xm | 2018-01-04 15:09 | 719K | |
![[SND]](/icons/sound2.gif) | storm (1).xm | 2018-01-04 15:09 | 720K | |
![[SND]](/icons/sound2.gif) | the legend of cryden.xm | 2018-01-04 15:09 | 721K | |
![[SND]](/icons/sound2.gif) | njc.xm | 2018-01-04 15:09 | 721K | |
![[SND]](/icons/sound2.gif) | strange days.xm | 2018-01-04 15:09 | 721K | |
![[SND]](/icons/sound2.gif) | quark flow.xm | 2018-01-04 15:09 | 721K | |
![[SND]](/icons/sound2.gif) | mastetrance.xm | 2018-01-04 15:09 | 721K | |
![[SND]](/icons/sound2.gif) | dreamers of dreams.xm | 2018-01-04 15:09 | 722K | |
![[SND]](/icons/sound2.gif) | newt.xm | 2018-01-04 15:09 | 722K | |
![[SND]](/icons/sound2.gif) | vikings.xm | 2018-01-04 15:09 | 723K | |
![[SND]](/icons/sound2.gif) | departuring.xm | 2018-01-04 15:09 | 723K | |
![[SND]](/icons/sound2.gif) | spacedance.xm | 2018-01-04 15:09 | 723K | |
![[SND]](/icons/sound2.gif) | muster pilots~1.xm | 2018-01-04 15:09 | 724K | |
![[SND]](/icons/sound2.gif) | trigger.xm | 2018-01-04 15:09 | 724K | |
![[SND]](/icons/sound2.gif) | cocco jamboo.xm | 2018-01-04 15:09 | 725K | |
![[SND]](/icons/sound2.gif) | coke-mix '97.xm | 2018-01-04 15:09 | 725K | |
![[SND]](/icons/sound2.gif) | lost in another time.xm | 2018-01-04 15:09 | 725K | |
![[SND]](/icons/sound2.gif) | jul-zen-c.xm | 2018-01-04 15:09 | 726K | |
![[SND]](/icons/sound2.gif) | temple of goa(remix).xm | 2018-01-04 15:09 | 726K | |
![[SND]](/icons/sound2.gif) | lullaby.xm | 2018-01-04 15:09 | 726K | |
![[SND]](/icons/sound2.gif) | megatron+troglodyte.xm | 2018-01-04 15:09 | 726K | |
![[SND]](/icons/sound2.gif) | drechno symphony.xm | 2018-01-04 15:09 | 727K | |
![[SND]](/icons/sound2.gif) | norwegian girl.xm | 2018-01-04 15:09 | 727K | |
![[SND]](/icons/sound2.gif) | immerai.xm | 2018-01-04 15:09 | 727K | |
![[SND]](/icons/sound2.gif) | tragedy.xm | 2018-01-04 15:09 | 727K | |
![[SND]](/icons/sound2.gif) | light waves.xm | 2018-01-04 15:09 | 728K | |
![[SND]](/icons/sound2.gif) | sha`re.xm | 2018-01-04 15:09 | 728K | |
![[SND]](/icons/sound2.gif) | hardcore vibes 3-31.xm | 2018-01-04 15:09 | 729K | |
![[SND]](/icons/sound2.gif) | the peterson dilemma.xm | 2018-01-04 15:09 | 729K | |
![[SND]](/icons/sound2.gif) | god's door....xm | 2018-01-04 15:09 | 730K | |
![[SND]](/icons/sound2.gif) | csekirap!.xm | 2018-01-04 15:09 | 730K | |
![[SND]](/icons/sound2.gif) | cyber cycler.xm | 2018-01-04 15:09 | 731K | |
![[SND]](/icons/sound2.gif) | uses 29 channels.xm | 2018-01-04 15:09 | 731K | |
![[SND]](/icons/sound2.gif) | nitro5.xm | 2018-01-04 15:09 | 731K | |
![[SND]](/icons/sound2.gif) | dozens.xm | 2018-01-04 15:09 | 731K | |
![[SND]](/icons/sound2.gif) | draconic dreams pt2.xm | 2018-01-04 15:09 | 731K | |
![[SND]](/icons/sound2.gif) | indef. emulation(ht).xm | 2018-01-04 15:09 | 731K | |
![[SND]](/icons/sound2.gif) | how i feel.xm | 2018-01-04 15:09 | 731K | |
![[SND]](/icons/sound2.gif) | winter1.xm | 2018-01-04 15:09 | 732K | |
![[SND]](/icons/sound2.gif) | frames of passion.xm | 2018-01-04 15:09 | 732K | |
![[SND]](/icons/sound2.gif) | one love [rave mix].xm | 2018-01-04 15:09 | 732K | |
![[SND]](/icons/sound2.gif) | maniacs.xm | 2018-01-04 15:09 | 732K | |
![[SND]](/icons/sound2.gif) | heraten pimeydesta.xm | 2018-01-04 15:09 | 733K | |
![[SND]](/icons/sound2.gif) | the 20th century.xm | 2018-01-04 15:09 | 734K | |
![[SND]](/icons/sound2.gif) | desire - bertkfmf.xm | 2018-01-04 15:09 | 734K | |
![[SND]](/icons/sound2.gif) | expect-cation.xm | 2018-01-04 15:09 | 737K | |
![[SND]](/icons/sound2.gif) | just close your eyes.xm | 2018-01-04 15:09 | 738K | |
![[SND]](/icons/sound2.gif) | proj1 (1).xm | 2018-01-04 15:09 | 738K | |
![[SND]](/icons/sound2.gif) | child of the sun.xm | 2018-01-04 15:09 | 738K | |
![[SND]](/icons/sound2.gif) | neayie.xm | 2018-01-04 15:09 | 739K | |
![[SND]](/icons/sound2.gif) | spring8.xm | 2018-01-04 15:09 | 739K | |
![[SND]](/icons/sound2.gif) | orbit goa (original).xm | 2018-01-04 15:09 | 739K | |
![[SND]](/icons/sound2.gif) | uhb them.xm | 2018-01-04 15:09 | 740K | |
![[SND]](/icons/sound2.gif) | the cold of steel.xm | 2018-01-04 15:09 | 740K | |
![[SND]](/icons/sound2.gif) | i can fly.xm | 2018-01-04 15:09 | 740K | |
![[SND]](/icons/sound2.gif) | virtual strings rmx.xm | 2018-01-04 15:09 | 742K | |
![[SND]](/icons/sound2.gif) | gothic dreams.xm | 2018-01-04 15:09 | 743K | |
![[SND]](/icons/sound2.gif) | going away.xm | 2018-01-04 15:09 | 743K | |
![[SND]](/icons/sound2.gif) | heartatt.xm | 2018-01-04 15:09 | 743K | |
![[SND]](/icons/sound2.gif) | killerbeats - techmi.xm | 2018-01-04 15:09 | 743K | |
![[SND]](/icons/sound2.gif) | happy ever after.xm | 2018-01-04 15:09 | 743K | |
![[SND]](/icons/sound2.gif) | fudge.xm | 2018-01-04 15:09 | 744K | |
![[SND]](/icons/sound2.gif) | imc-andw.xm | 2018-01-04 15:09 | 746K | |
![[SND]](/icons/sound2.gif) | chemical storm.xm | 2018-01-04 15:09 | 746K | |
![[SND]](/icons/sound2.gif) | together sfx!.xm | 2018-01-04 15:09 | 746K | |
![[SND]](/icons/sound2.gif) | mindprobe.xm | 2018-01-04 15:09 | 747K | |
![[SND]](/icons/sound2.gif) | in my dreams.xm | 2018-01-04 15:09 | 747K | |
![[SND]](/icons/sound2.gif) | systems online.xm | 2018-01-04 15:09 | 748K | |
![[SND]](/icons/sound2.gif) | zog-ghast.xm | 2018-01-04 15:09 | 749K | |
![[SND]](/icons/sound2.gif) | theloveifeelinside.xm | 2018-01-04 15:09 | 749K | |
![[SND]](/icons/sound2.gif) | wings 428.xm | 2018-01-04 15:09 | 750K | |
![[SND]](/icons/sound2.gif) | velo city.xm | 2018-01-04 15:09 | 753K | |
![[SND]](/icons/sound2.gif) | fatman's flat.xm | 2018-01-04 15:09 | 753K | |
![[SND]](/icons/sound2.gif) | draconic dreams pt.1.xm | 2018-01-04 15:09 | 754K | |
![[SND]](/icons/sound2.gif) | shine1.xm | 2018-01-04 15:09 | 755K | |
![[SND]](/icons/sound2.gif) | evil eye by -dtm-.xm | 2018-01-04 15:09 | 755K | |
![[SND]](/icons/sound2.gif) | infinite vortex.xm | 2018-01-04 15:09 | 756K | |
![[SND]](/icons/sound2.gif) | guilty world... 418.xm | 2018-01-04 15:09 | 756K | |
![[SND]](/icons/sound2.gif) | pc himnusz ----- mue.xm | 2018-01-04 15:09 | 757K | |
![[SND]](/icons/sound2.gif) | mechanical control.xm | 2018-01-04 15:09 | 758K | |
![[SND]](/icons/sound2.gif) | melodic tune.xm | 2018-01-04 15:09 | 758K | |
![[SND]](/icons/sound2.gif) | liquid.xm | 2018-01-04 15:09 | 758K | |
![[SND]](/icons/sound2.gif) | the snuh..xm | 2018-01-04 15:09 | 758K | |
![[SND]](/icons/sound2.gif) | lost eden.xm | 2018-01-04 15:09 | 758K | |
![[SND]](/icons/sound2.gif) | liquidcrystalgun.xm | 2018-01-04 15:09 | 760K | |
![[SND]](/icons/sound2.gif) | detuch.xm | 2018-01-04 15:09 | 760K | |
![[SND]](/icons/sound2.gif) | LETITBE2.XM | 2018-01-04 15:09 | 760K | |
![[SND]](/icons/sound2.gif) | the headshrinker.xm | 2018-01-04 15:09 | 760K | |
![[SND]](/icons/sound2.gif) | dj ivan - chuvaki.xm | 2018-01-04 15:09 | 760K | |
![[SND]](/icons/sound2.gif) | i can't stop.xm | 2018-01-04 15:09 | 760K | |
![[SND]](/icons/sound2.gif) | mop.xm | 2018-01-04 15:09 | 761K | |
![[SND]](/icons/sound2.gif) | spvoyage.xm | 2018-01-04 15:09 | 762K | |
![[SND]](/icons/sound2.gif) | cosmic disaster.xm | 2018-01-04 15:09 | 762K | |
![[SND]](/icons/sound2.gif) | grabber- tady.xm | 2018-01-04 15:09 | 762K | |
![[SND]](/icons/sound2.gif) | soulkeeper.xm | 2018-01-04 15:09 | 763K | |
![[SND]](/icons/sound2.gif) | summer is over.xm | 2018-01-04 15:09 | 764K | |
![[SND]](/icons/sound2.gif) | outpost.xm | 2018-01-04 15:09 | 764K | |
![[SND]](/icons/sound2.gif) | groove train.xm | 2018-01-04 15:09 | 764K | |
![[SND]](/icons/sound2.gif) | nyan.xm | 2018-01-04 15:09 | 765K | |
![[SND]](/icons/sound2.gif) | cosmic voyage.xm | 2018-01-04 15:09 | 765K | |
![[SND]](/icons/sound2.gif) | the horrible theme.xm | 2018-01-04 15:09 | 767K | |
![[SND]](/icons/sound2.gif) | dance orgy.xm | 2018-01-04 15:09 | 768K | |
![[SND]](/icons/sound2.gif) | cosmic outflow ~1.xm | 2018-01-04 15:09 | 768K | |
![[SND]](/icons/sound2.gif) | nocturner.xm | 2018-01-04 15:09 | 769K | |
![[SND]](/icons/sound2.gif) | getting by (nathan l.xm | 2018-01-04 15:09 | 770K | |
![[SND]](/icons/sound2.gif) | rh!no.xm | 2018-01-04 15:09 | 770K | |
![[SND]](/icons/sound2.gif) | new.unlimitederno.xm | 2018-01-04 15:09 | 770K | |
![[SND]](/icons/sound2.gif) | rgae of the garol.xm | 2018-01-04 15:09 | 772K | |
![[SND]](/icons/sound2.gif) | dreamland - area 51.xm | 2018-01-04 15:09 | 772K | |
![[SND]](/icons/sound2.gif) | oscilators (7edit).xm | 2018-01-04 15:09 | 772K | |
![[SND]](/icons/sound2.gif) | on the run.xm | 2018-01-04 15:09 | 773K | |
![[SND]](/icons/sound2.gif) | deliberation.xm | 2018-01-04 15:09 | 773K | |
![[SND]](/icons/sound2.gif) | heresy rave mix.xm | 2018-01-04 15:09 | 774K | |
![[SND]](/icons/sound2.gif) | run for your life.xm | 2018-01-04 15:09 | 774K | |
![[SND]](/icons/sound2.gif) | digital reality.xm | 2018-01-04 15:09 | 774K | |
![[SND]](/icons/sound2.gif) | party time.xm | 2018-01-04 15:09 | 774K | |
![[SND]](/icons/sound2.gif) | oozepsychopath.xm | 2018-01-04 15:09 | 775K | |
![[SND]](/icons/sound2.gif) | largemouth.xm | 2018-01-04 15:09 | 776K | |
![[SND]](/icons/sound2.gif) | ethnika.xm | 2018-01-04 15:09 | 777K | |
![[SND]](/icons/sound2.gif) | just move.xm | 2018-01-04 15:09 | 778K | |
![[SND]](/icons/sound2.gif) | css1 limbo.xm | 2018-01-04 15:09 | 778K | |
![[SND]](/icons/sound2.gif) | f#&%k!.xm | 2018-01-04 15:09 | 778K | |
![[SND]](/icons/sound2.gif) | sahara nights.xm | 2018-01-04 15:09 | 779K | |
![[SND]](/icons/sound2.gif) | mindofawyvern.xm | 2018-01-04 15:09 | 779K | |
![[SND]](/icons/sound2.gif) | trix of r.s.e 1997.xm | 2018-01-04 15:09 | 779K | |
![[SND]](/icons/sound2.gif) | dub tree.xm | 2018-01-04 15:09 | 779K | |
![[SND]](/icons/sound2.gif) | procrastinate.xm | 2018-01-04 15:09 | 780K | |
![[SND]](/icons/sound2.gif) | o singura data.xm | 2018-01-04 15:09 | 780K | |
![[SND]](/icons/sound2.gif) | fremen.xm | 2018-01-04 15:09 | 781K | |
![[SND]](/icons/sound2.gif) | warlo.xm | 2018-01-04 15:09 | 781K | |
![[SND]](/icons/sound2.gif) | let's party!!!.xm | 2018-01-04 15:09 | 781K | |
![[SND]](/icons/sound2.gif) | power 11.xm | 2018-01-04 15:09 | 782K | |
![[SND]](/icons/sound2.gif) | raspberry poem.xm | 2018-01-04 15:09 | 783K | |
![[SND]](/icons/sound2.gif) | over the seas.xm | 2018-01-04 15:09 | 783K | |
![[SND]](/icons/sound2.gif) | evasive action.xm | 2018-01-04 15:09 | 783K | |
![[SND]](/icons/sound2.gif) | soft metall (by dan).xm | 2018-01-04 15:09 | 786K | |
![[SND]](/icons/sound2.gif) | the mad mile.xm | 2018-01-04 15:09 | 786K | |
![[SND]](/icons/sound2.gif) | loop cycle motion.xm | 2018-01-04 15:09 | 786K | |
![[SND]](/icons/sound2.gif) | css4 diaphanous.xm | 2018-01-04 15:09 | 786K | |
![[SND]](/icons/sound2.gif) | the mission4th.xm | 2018-01-04 15:09 | 787K | |
![[SND]](/icons/sound2.gif) | winter skies.xm | 2018-01-04 15:09 | 787K | |
![[SND]](/icons/sound2.gif) | fog polution.xm | 2018-01-04 15:09 | 788K | |
![[SND]](/icons/sound2.gif) | rainy quest.xm | 2018-01-04 15:09 | 789K | |
![[SND]](/icons/sound2.gif) | windz of the mind.xm | 2018-01-04 15:09 | 790K | |
![[SND]](/icons/sound2.gif) | pull preamp.xm | 2018-01-04 15:09 | 790K | |
![[SND]](/icons/sound2.gif) | myzze & ufus rmx.xm | 2018-01-04 15:09 | 790K | |
![[SND]](/icons/sound2.gif) | corona.xm | 2018-01-04 15:09 | 791K | |
![[SND]](/icons/sound2.gif) | turning into (129).xm | 2018-01-04 15:09 | 791K | |
![[SND]](/icons/sound2.gif) | symphone.xm | 2018-01-04 15:09 | 792K | |
![[SND]](/icons/sound2.gif) | medieval acidity.xm | 2018-01-04 15:09 | 793K | |
![[SND]](/icons/sound2.gif) | piece at last..xm | 2018-01-04 15:09 | 793K | |
![[SND]](/icons/sound2.gif) | sasa j- yo dj!!.xm | 2018-01-04 15:09 | 793K | |
![[SND]](/icons/sound2.gif) | dancefloot attack.xm | 2018-01-04 15:09 | 793K | |
![[SND]](/icons/sound2.gif) | june.xm | 2018-01-04 15:09 | 793K | |
![[SND]](/icons/sound2.gif) | the forest of life.xm | 2018-01-04 15:09 | 794K | |
![[SND]](/icons/sound2.gif) | james is brown.xm | 2018-01-04 15:09 | 794K | |
![[SND]](/icons/sound2.gif) | mitubisi sports.xm | 2018-01-04 15:09 | 795K | |
![[SND]](/icons/sound2.gif) | shutdown.xm | 2018-01-04 15:09 | 795K | |
![[SND]](/icons/sound2.gif) | untitled (5).xm | 2018-01-04 15:09 | 797K | |
![[SND]](/icons/sound2.gif) | come oooooonnn.xm | 2018-01-04 15:09 | 797K | |
![[SND]](/icons/sound2.gif) | kishii's prodrome.xm | 2018-01-04 15:09 | 797K | |
![[SND]](/icons/sound2.gif) | nameless.xm | 2018-01-04 15:09 | 798K | |
![[SND]](/icons/sound2.gif) | night nebular.xm | 2018-01-04 15:09 | 798K | |
![[SND]](/icons/sound2.gif) | jailbreakcryingtree.xm | 2018-01-04 15:09 | 799K | |
![[SND]](/icons/sound2.gif) | underthesea~1.xm | 2018-01-04 15:09 | 799K | |
![[SND]](/icons/sound2.gif) | flagrant - marred.xm | 2018-01-04 15:09 | 800K | |
![[SND]](/icons/sound2.gif) | sweet_a.xm | 2018-01-04 15:09 | 801K | |
![[SND]](/icons/sound2.gif) | crystal echoes.xm | 2018-01-04 15:09 | 801K | |
![[SND]](/icons/sound2.gif) | untitled (9).xm | 2018-01-04 15:09 | 802K | |
![[SND]](/icons/sound2.gif) | to the nines.xm | 2018-01-04 15:09 | 802K | |
![[SND]](/icons/sound2.gif) | raindrop symphony.xm | 2018-01-04 15:09 | 802K | |
![[SND]](/icons/sound2.gif) | in the end (remix).xm | 2018-01-04 15:09 | 803K | |
![[SND]](/icons/sound2.gif) | i spy.xm | 2018-01-04 15:09 | 803K | |
![[SND]](/icons/sound2.gif) | millennium theme.xm | 2018-01-04 15:09 | 803K | |
![[SND]](/icons/sound2.gif) | hydrochl.xm | 2018-01-04 15:09 | 803K | |
![[SND]](/icons/sound2.gif) | impulse dc.xm | 2018-01-04 15:09 | 803K | |
![[SND]](/icons/sound2.gif) | the land of force.xm | 2018-01-04 15:09 | 804K | |
![[SND]](/icons/sound2.gif) | nitrogenetic++.xm | 2018-01-04 15:09 | 805K | |
![[SND]](/icons/sound2.gif) | homepage fly.toaj.xm | 2018-01-04 15:09 | 805K | |
![[SND]](/icons/sound2.gif) | destroye.xm | 2018-01-04 15:09 | 807K | |
![[SND]](/icons/sound2.gif) | tarz zero.xm | 2018-01-04 15:09 | 808K | |
![[SND]](/icons/sound2.gif) | make u dancing.xm | 2018-01-04 15:09 | 808K | |
![[SND]](/icons/sound2.gif) | lampaan tuska.xm | 2018-01-04 15:09 | 809K | |
![[SND]](/icons/sound2.gif) | deception ignored.xm | 2018-01-04 15:09 | 810K | |
![[SND]](/icons/sound2.gif) | the fire fly - mm.xm | 2018-01-04 15:09 | 810K | |
![[SND]](/icons/sound2.gif) | reckless.xm | 2018-01-04 15:09 | 810K | |
![[SND]](/icons/sound2.gif) | disintro 1.xm | 2018-01-04 15:09 | 810K | |
![[SND]](/icons/sound2.gif) | taxiduck.xm | 2018-01-04 15:09 | 812K | |
![[SND]](/icons/sound2.gif) | just cant get enough.xm | 2018-01-04 15:09 | 812K | |
![[SND]](/icons/sound2.gif) | track 13.xm | 2018-01-04 15:09 | 812K | |
![[SND]](/icons/sound2.gif) | eight.xm | 2018-01-04 15:09 | 812K | |
![[SND]](/icons/sound2.gif) | natetan.xm | 2018-01-04 15:09 | 813K | |
![[SND]](/icons/sound2.gif) | o amalga.xm | 2018-01-04 15:09 | 814K | |
![[SND]](/icons/sound2.gif) | chip & dale rulez !!.xm | 2018-01-04 15:09 | 815K | |
![[SND]](/icons/sound2.gif) | gloomy spirit.xm | 2018-01-04 15:09 | 815K | |
![[SND]](/icons/sound2.gif) | duedel.xm | 2018-01-04 15:09 | 815K | |
![[SND]](/icons/sound2.gif) | hardr rock cafe.xm | 2018-01-04 15:09 | 815K | |
![[SND]](/icons/sound2.gif) | halo.xm | 2018-01-04 15:09 | 815K | |
![[SND]](/icons/sound2.gif) | snowball warfare.xm | 2018-01-04 15:09 | 816K | |
![[SND]](/icons/sound2.gif) | psychotherapy.xm | 2018-01-04 15:09 | 816K | |
![[SND]](/icons/sound2.gif) | frigolit.xm | 2018-01-04 15:09 | 817K | |
![[SND]](/icons/sound2.gif) | dance in to my heart.xm | 2018-01-04 15:09 | 819K | |
![[SND]](/icons/sound2.gif) | untitled 1.xm | 2018-01-04 15:09 | 820K | |
![[SND]](/icons/sound2.gif) | you dont get me.xm | 2018-01-04 15:09 | 821K | |
![[SND]](/icons/sound2.gif) | djnitrogen-the intro.xm | 2018-01-04 15:09 | 822K | |
![[SND]](/icons/sound2.gif) | dj nina guns! powa!.xm | 2018-01-04 15:09 | 822K | |
![[SND]](/icons/sound2.gif) | sabz pearl mix.xm | 2018-01-04 15:09 | 822K | |
![[SND]](/icons/sound2.gif) | raecix acid trans+gl.xm | 2018-01-04 15:09 | 823K | |
![[SND]](/icons/sound2.gif) | last d.xm | 2018-01-04 15:09 | 823K | |
![[SND]](/icons/sound2.gif) | i'm going on.xm | 2018-01-04 15:09 | 823K | |
![[SND]](/icons/sound2.gif) | peacefulness.xm | 2018-01-04 15:09 | 823K | |
![[SND]](/icons/sound2.gif) | fucky death.xm | 2018-01-04 15:09 | 823K | |
![[SND]](/icons/sound2.gif) | teotlnanacatl.xm | 2018-01-04 15:09 | 823K | |
![[SND]](/icons/sound2.gif) | necromancer dance.xm | 2018-01-04 15:09 | 824K | |
![[SND]](/icons/sound2.gif) | le dormeur.xm | 2018-01-04 15:09 | 825K | |
![[SND]](/icons/sound2.gif) | monsterpiece theatre.xm | 2018-01-04 15:09 | 825K | |
![[SND]](/icons/sound2.gif) | popcorn 2000.xm | 2018-01-04 15:09 | 825K | |
![[SND]](/icons/sound2.gif) | demo.xm | 2018-01-04 15:09 | 825K | |
![[SND]](/icons/sound2.gif) | could you feel.xm | 2018-01-04 15:09 | 826K | |
![[SND]](/icons/sound2.gif) | delusional influence.xm | 2018-01-04 15:09 | 826K | |
![[SND]](/icons/sound2.gif) | fuzz funk stomp rmx.xm | 2018-01-04 15:09 | 827K | |
![[SND]](/icons/sound2.gif) | qwertz to hertz.xm | 2018-01-04 15:09 | 827K | |
![[SND]](/icons/sound2.gif) | muus by a pology.xm | 2018-01-04 15:09 | 827K | |
![[SND]](/icons/sound2.gif) | fatality.xm | 2018-01-04 15:09 | 828K | |
![[SND]](/icons/sound2.gif) | inharmony.xm | 2018-01-04 15:09 | 829K | |
![[SND]](/icons/sound2.gif) | my spirit, so weak.xm | 2018-01-04 15:09 | 829K | |
![[SND]](/icons/sound2.gif) | revival.xm | 2018-01-04 15:09 | 829K | |
![[SND]](/icons/sound2.gif) | nuclear winter.xm | 2018-01-04 15:09 | 829K | |
![[SND]](/icons/sound2.gif) | dee liux.xm | 2018-01-04 15:09 | 830K | |
![[SND]](/icons/sound2.gif) | melodic jungle song1.xm | 2018-01-04 15:09 | 830K | |
![[SND]](/icons/sound2.gif) | snowstorm.xm | 2018-01-04 15:09 | 830K | |
![[SND]](/icons/sound2.gif) | wounds.xm | 2018-01-04 15:09 | 832K | |
![[SND]](/icons/sound2.gif) | you are my angel.xm | 2018-01-04 15:09 | 832K | |
![[SND]](/icons/sound2.gif) | l.r. much better.xm | 2018-01-04 15:09 | 833K | |
![[SND]](/icons/sound2.gif) | la pluie qui conte.xm | 2018-01-04 15:09 | 834K | |
![[SND]](/icons/sound2.gif) | cosmiceyes.xm | 2018-01-04 15:09 | 834K | |
![[SND]](/icons/sound2.gif) | she's on my mind.xm | 2018-01-04 15:09 | 835K | |
![[SND]](/icons/sound2.gif) | k xfile.xm | 2018-01-04 15:09 | 835K | |
![[SND]](/icons/sound2.gif) | kc fall8.xm | 2018-01-04 15:09 | 835K | |
![[SND]](/icons/sound2.gif) | ttt la.xm | 2018-01-04 15:09 | 835K | |
![[SND]](/icons/sound2.gif) | mucus inane drivel.xm | 2018-01-04 15:09 | 836K | |
![[SND]](/icons/sound2.gif) | hankering... cmp.xm | 2018-01-04 15:09 | 836K | |
![[SND]](/icons/sound2.gif) | timelock. (v0.01a).xm | 2018-01-04 15:09 | 836K | |
![[SND]](/icons/sound2.gif) | roma tells it all.xm | 2018-01-04 15:09 | 837K | |
![[SND]](/icons/sound2.gif) | imukuppi.xm | 2018-01-04 15:09 | 837K | |
![[SND]](/icons/sound2.gif) | utility.xm | 2018-01-04 15:09 | 837K | |
![[SND]](/icons/sound2.gif) | the final support.xm | 2018-01-04 15:09 | 838K | |
![[SND]](/icons/sound2.gif) | preubank.xm | 2018-01-04 15:09 | 838K | |
![[SND]](/icons/sound2.gif) | prea tarziu 10x.xm | 2018-01-04 15:09 | 841K | |
![[SND]](/icons/sound2.gif) | octane.xm | 2018-01-04 15:09 | 841K | |
![[SND]](/icons/sound2.gif) | under the full moon.xm | 2018-01-04 15:09 | 842K | |
![[SND]](/icons/sound2.gif) | moonston.xm | 2018-01-04 15:09 | 842K | |
![[SND]](/icons/sound2.gif) | rainforestreflection.xm | 2018-01-04 15:09 | 845K | |
![[SND]](/icons/sound2.gif) | nrovia (remix) 245.xm | 2018-01-04 15:09 | 845K | |
![[SND]](/icons/sound2.gif) | locked up in a tun.xm | 2018-01-04 15:09 | 845K | |
![[SND]](/icons/sound2.gif) | livinlacor by rusboy.xm | 2018-01-04 15:09 | 845K | |
![[SND]](/icons/sound2.gif) | sing4u.xm | 2018-01-04 15:09 | 846K | |
![[SND]](/icons/sound2.gif) | unknown music!!!.xm | 2018-01-04 15:09 | 846K | |
![[SND]](/icons/sound2.gif) | lz-esoul.xm | 2018-01-04 15:09 | 846K | |
![[SND]](/icons/sound2.gif) | danced in denver.xm | 2018-01-04 15:09 | 846K | |
![[SND]](/icons/sound2.gif) | d-mixer by seven.xm | 2018-01-04 15:09 | 847K | |
![[SND]](/icons/sound2.gif) | down deep.xm | 2018-01-04 15:09 | 847K | |
![[SND]](/icons/sound2.gif) | cradle of filth.xm | 2018-01-04 15:09 | 848K | |
![[SND]](/icons/sound2.gif) | revolter by msk from.xm | 2018-01-04 15:09 | 848K | |
![[SND]](/icons/sound2.gif) | one episode from sea.xm | 2018-01-04 15:09 | 849K | |
![[SND]](/icons/sound2.gif) | nothing on tv~1.xm | 2018-01-04 15:09 | 849K | |
![[SND]](/icons/sound2.gif) | forest of dreams.xm | 2018-01-04 15:09 | 850K | |
![[SND]](/icons/sound2.gif) | nfskiller.xm | 2018-01-04 15:09 | 850K | |
![[SND]](/icons/sound2.gif) | pianoforte-smooth.xm | 2018-01-04 15:09 | 851K | |
![[SND]](/icons/sound2.gif) | www-2.xm | 2018-01-04 15:09 | 851K | |
![[SND]](/icons/sound2.gif) | my love is true.xm | 2018-01-04 15:09 | 851K | |
![[SND]](/icons/sound2.gif) | sp - viii months.xm | 2018-01-04 15:09 | 852K | |
![[SND]](/icons/sound2.gif) | mind control.xm | 2018-01-04 15:09 | 853K | |
![[SND]](/icons/sound2.gif) | cryogenic chamber.xm | 2018-01-04 15:09 | 853K | |
![[SND]](/icons/sound2.gif) | lady~1.xm | 2018-01-04 15:09 | 854K | |
![[SND]](/icons/sound2.gif) | house deenay.xm | 2018-01-04 15:09 | 854K | |
![[SND]](/icons/sound2.gif) | glass spectre 1.1.xm | 2018-01-04 15:09 | 855K | |
![[SND]](/icons/sound2.gif) | my love is true-y3k~..> | 2018-01-04 15:09 | 855K | |
![[SND]](/icons/sound2.gif) | rave generation.xm | 2018-01-04 15:09 | 855K | |
![[SND]](/icons/sound2.gif) | labor of love.xm | 2018-01-04 15:09 | 857K | |
![[SND]](/icons/sound2.gif) | untitled (3).xm | 2018-01-04 15:09 | 857K | |
![[SND]](/icons/sound2.gif) | rider.xm | 2018-01-04 15:09 | 858K | |
![[SND]](/icons/sound2.gif) | dictature of the ....xm | 2018-01-04 15:09 | 859K | |
![[SND]](/icons/sound2.gif) | what's that sound.xm | 2018-01-04 15:09 | 859K | |
![[SND]](/icons/sound2.gif) | ff6 celes remix.xm | 2018-01-04 15:09 | 860K | |
![[SND]](/icons/sound2.gif) | i love drugs.xm | 2018-01-04 15:09 | 860K | |
![[SND]](/icons/sound2.gif) | pit stop @1999.xm | 2018-01-04 15:09 | 861K | |
![[SND]](/icons/sound2.gif) | valley of innocence.xm | 2018-01-04 15:09 | 862K | |
![[SND]](/icons/sound2.gif) | rockon!.xm | 2018-01-04 15:09 | 862K | |
![[SND]](/icons/sound2.gif) | speed garage tune.xm | 2018-01-04 15:09 | 864K | |
![[SND]](/icons/sound2.gif) | groove.xm | 2018-01-04 15:09 | 865K | |
![[SND]](/icons/sound2.gif) | mortal rage.xm | 2018-01-04 15:09 | 865K | |
![[SND]](/icons/sound2.gif) | petuh on line.xm | 2018-01-04 15:09 | 865K | |
![[SND]](/icons/sound2.gif) | warriors of oz.xm | 2018-01-04 15:09 | 865K | |
![[SND]](/icons/sound2.gif) | tw - tranceperience.xm | 2018-01-04 15:09 | 866K | |
![[SND]](/icons/sound2.gif) | deity 1.xm | 2018-01-04 15:09 | 867K | |
![[SND]](/icons/sound2.gif) | infiniteraver.xm | 2018-01-04 15:09 | 867K | |
![[SND]](/icons/sound2.gif) | dark raver c.2002.xm | 2018-01-04 15:09 | 867K | |
![[SND]](/icons/sound2.gif) | hara.xm | 2018-01-04 15:09 | 867K | |
![[SND]](/icons/sound2.gif) | pain and pleasure..!.xm | 2018-01-04 15:09 | 869K | |
![[SND]](/icons/sound2.gif) | tbi.xm | 2018-01-04 15:09 | 871K | |
![[SND]](/icons/sound2.gif) | cuckoh.xm | 2018-01-04 15:09 | 872K | |
![[SND]](/icons/sound2.gif) | guy's song.xm | 2018-01-04 15:09 | 873K | |
![[SND]](/icons/sound2.gif) | subkultür.xm | 2018-01-04 15:09 | 873K | |
![[SND]](/icons/sound2.gif) | rebha nazzjonalista.xm | 2018-01-04 15:09 | 874K | |
![[SND]](/icons/sound2.gif) | desolate.xm | 2018-01-04 15:09 | 874K | |
![[SND]](/icons/sound2.gif) | funkytonkyplommonpop.xm | 2018-01-04 15:09 | 875K | |
![[SND]](/icons/sound2.gif) | no form. cubico. rqm.xm | 2018-01-04 15:09 | 875K | |
![[SND]](/icons/sound2.gif) | waiting 4 spring (1).xm | 2018-01-04 15:09 | 875K | |
![[SND]](/icons/sound2.gif) | the story continues.xm | 2018-01-04 15:09 | 878K | |
![[SND]](/icons/sound2.gif) | komercijala.xm | 2018-01-04 15:09 | 878K | |
![[SND]](/icons/sound2.gif) | sleepwalk.xm | 2018-01-04 15:09 | 878K | |
![[SND]](/icons/sound2.gif) | secret.xm | 2018-01-04 15:09 | 879K | |
![[SND]](/icons/sound2.gif) | human xtinction.xm | 2018-01-04 15:09 | 879K | |
![[SND]](/icons/sound2.gif) | dial tone.xm | 2018-01-04 15:09 | 880K | |
![[SND]](/icons/sound2.gif) | onlinec9.xm | 2018-01-04 15:09 | 883K | |
![[SND]](/icons/sound2.gif) | mir.xm | 2018-01-04 15:09 | 883K | |
![[SND]](/icons/sound2.gif) | liquid (2).xm | 2018-01-04 15:09 | 883K | |
![[SND]](/icons/sound2.gif) | JL22.XM | 2018-01-04 15:09 | 883K | |
![[SND]](/icons/sound2.gif) | t.n.o.t.o.t.f..xm | 2018-01-04 15:09 | 884K | |
![[SND]](/icons/sound2.gif) | trip (dub).xm | 2018-01-04 15:09 | 884K | |
![[SND]](/icons/sound2.gif) | mind machine.xm | 2018-01-04 15:09 | 885K | |
![[SND]](/icons/sound2.gif) | nxtrip 4.xm | 2018-01-04 15:09 | 885K | |
![[SND]](/icons/sound2.gif) | thumb wars.xm | 2018-01-04 15:09 | 885K | |
![[SND]](/icons/sound2.gif) | dark engine.xm | 2018-01-04 15:09 | 885K | |
![[SND]](/icons/sound2.gif) | illusions.xm | 2018-01-04 15:09 | 885K | |
![[SND]](/icons/sound2.gif) | starfall.xm | 2018-01-04 15:09 | 888K | |
![[SND]](/icons/sound2.gif) | finalv2f.xm | 2018-01-04 15:09 | 888K | |
![[SND]](/icons/sound2.gif) | heijastus.xm | 2018-01-04 15:09 | 888K | |
![[SND]](/icons/sound2.gif) | the ride.xm | 2018-01-04 15:09 | 888K | |
![[SND]](/icons/sound2.gif) | madrid.xm | 2018-01-04 15:09 | 889K | |
![[SND]](/icons/sound2.gif) | mary.xm | 2018-01-04 15:09 | 889K | |
![[SND]](/icons/sound2.gif) | submachine.xm | 2018-01-04 15:09 | 889K | |
![[SND]](/icons/sound2.gif) | dwater.xm | 2018-01-04 15:09 | 889K | |
![[SND]](/icons/sound2.gif) | good bye dee.xm | 2018-01-04 15:09 | 891K | |
![[SND]](/icons/sound2.gif) | denial part iii.xm | 2018-01-04 15:09 | 891K | |
![[SND]](/icons/sound2.gif) | loops and vibes!!!.xm | 2018-01-04 15:09 | 891K | |
![[SND]](/icons/sound2.gif) | rain symphony.xm | 2018-01-04 15:09 | 892K | |
![[SND]](/icons/sound2.gif) | yellow tea.xm | 2018-01-04 15:09 | 893K | |
![[SND]](/icons/sound2.gif) | little black dress.xm | 2018-01-04 15:09 | 894K | |
![[SND]](/icons/sound2.gif) | me and my banjo !!!!.xm | 2018-01-04 15:09 | 894K | |
![[SND]](/icons/sound2.gif) | fyh.01.xm | 2018-01-04 15:09 | 895K | |
![[SND]](/icons/sound2.gif) | lightout.xm | 2018-01-04 15:09 | 895K | |
![[SND]](/icons/sound2.gif) | melting shadows.xm | 2018-01-04 15:09 | 897K | |
![[SND]](/icons/sound2.gif) | tihany express.xm | 2018-01-04 15:09 | 897K | |
![[SND]](/icons/sound2.gif) | out of respect.xm | 2018-01-04 15:09 | 897K | |
![[SND]](/icons/sound2.gif) | the prophet.xm | 2018-01-04 15:09 | 897K | |
![[SND]](/icons/sound2.gif) | vauva-mix.xm | 2018-01-04 15:09 | 897K | |
![[SND]](/icons/sound2.gif) | the return of m.p.b.xm | 2018-01-04 15:09 | 898K | |
![[SND]](/icons/sound2.gif) | title.xm | 2018-01-04 15:09 | 898K | |
![[SND]](/icons/sound2.gif) | lekkerbisken.xm | 2018-01-04 15:09 | 898K | |
![[SND]](/icons/sound2.gif) | thesonofapocalypse.xm | 2018-01-04 15:09 | 899K | |
![[SND]](/icons/sound2.gif) | outofmin.xm | 2018-01-04 15:09 | 900K | |
![[SND]](/icons/sound2.gif) | metal monks' revenge.xm | 2018-01-04 15:09 | 900K | |
![[SND]](/icons/sound2.gif) | evil disruption.xm | 2018-01-04 15:09 | 900K | |
![[SND]](/icons/sound2.gif) | sweet melody.xm | 2018-01-04 15:09 | 901K | |
![[SND]](/icons/sound2.gif) | durex.xm | 2018-01-04 15:09 | 902K | |
![[SND]](/icons/sound2.gif) | debug.xm | 2018-01-04 15:09 | 902K | |
![[SND]](/icons/sound2.gif) | march of the warlord.xm | 2018-01-04 15:09 | 904K | |
![[SND]](/icons/sound2.gif) | fantasia.xm | 2018-01-04 15:09 | 904K | |
![[SND]](/icons/sound2.gif) | dj.droopyin action.xm | 2018-01-04 15:09 | 904K | |
![[SND]](/icons/sound2.gif) | dream 1.xm | 2018-01-04 15:09 | 905K | |
![[SND]](/icons/sound2.gif) | daft punk.xm | 2018-01-04 15:09 | 906K | |
![[SND]](/icons/sound2.gif) | framed.xm | 2018-01-04 15:09 | 907K | |
![[SND]](/icons/sound2.gif) | öl-kork!!! ).xm | 2018-01-04 15:09 | 907K | |
![[SND]](/icons/sound2.gif) | gaze...xm | 2018-01-04 15:09 | 908K | |
![[SND]](/icons/sound2.gif) | good warez.xm | 2018-01-04 15:09 | 909K | |
![[SND]](/icons/sound2.gif) | u. t. circumstancez.xm | 2018-01-04 15:09 | 910K | |
![[SND]](/icons/sound2.gif) | cliffs 1.xm | 2018-01-04 15:09 | 910K | |
![[SND]](/icons/sound2.gif) | human evolution.xm | 2018-01-04 15:09 | 910K | |
![[SND]](/icons/sound2.gif) | mental age (r4s).xm | 2018-01-04 15:09 | 911K | |
![[SND]](/icons/sound2.gif) | djzen-gameland.xm | 2018-01-04 15:09 | 911K | |
![[SND]](/icons/sound2.gif) | konfession.xm | 2018-01-04 15:09 | 911K | |
![[SND]](/icons/sound2.gif) | cyber manifestation.xm | 2018-01-04 15:09 | 911K | |
![[SND]](/icons/sound2.gif) | too much rain.xm | 2018-01-04 15:09 | 912K | |
![[SND]](/icons/sound2.gif) | d-d-fty.xm | 2018-01-04 15:09 | 912K | |
![[SND]](/icons/sound2.gif) | the stargate $.xm | 2018-01-04 15:09 | 912K | |
![[SND]](/icons/sound2.gif) | dr - ufo.xm | 2018-01-04 15:09 | 913K | |
![[SND]](/icons/sound2.gif) | i.o.a.d.s.xm | 2018-01-04 15:09 | 914K | |
![[SND]](/icons/sound2.gif) | paranoia - 4.96 mix.xm | 2018-01-04 15:09 | 914K | |
![[SND]](/icons/sound2.gif) | my new mech.xm | 2018-01-04 15:09 | 914K | |
![[SND]](/icons/sound2.gif) | kilomieswattitunti.xm | 2018-01-04 15:09 | 914K | |
![[SND]](/icons/sound2.gif) | problem in space.xm | 2018-01-04 15:09 | 914K | |
![[SND]](/icons/sound2.gif) | elefants' dance!.xm | 2018-01-04 15:09 | 915K | |
![[SND]](/icons/sound2.gif) | through the nature.xm | 2018-01-04 15:09 | 915K | |
![[SND]](/icons/sound2.gif) | synphonica.xm | 2018-01-04 15:09 | 915K | |
![[SND]](/icons/sound2.gif) | running out of time.xm | 2018-01-04 15:09 | 916K | |
![[SND]](/icons/sound2.gif) | end of the world.xm | 2018-01-04 15:09 | 917K | |
![[SND]](/icons/sound2.gif) | id cr.xm | 2018-01-04 15:09 | 917K | |
![[SND]](/icons/sound2.gif) | darts of peace.xm | 2018-01-04 15:09 | 917K | |
![[SND]](/icons/sound2.gif) | walking on the edge.xm | 2018-01-04 15:09 | 917K | |
![[SND]](/icons/sound2.gif) | crisis denoiser 42.xm | 2018-01-04 15:09 | 918K | |
![[SND]](/icons/sound2.gif) | nightshine.xm | 2018-01-04 15:09 | 918K | |
![[SND]](/icons/sound2.gif) | sinusidal.xm | 2018-01-04 15:09 | 919K | |
![[SND]](/icons/sound2.gif) | si burn.xm | 2018-01-04 15:09 | 919K | |
![[SND]](/icons/sound2.gif) | fire and forget~1.xm | 2018-01-04 15:09 | 919K | |
![[SND]](/icons/sound2.gif) | silentwaters.xm | 2018-01-04 15:09 | 919K | |
![[SND]](/icons/sound2.gif) | rhand.xm | 2018-01-04 15:09 | 919K | |
![[SND]](/icons/sound2.gif) | thoughtoh.xm | 2018-01-04 15:09 | 921K | |
![[SND]](/icons/sound2.gif) | parodia.xm | 2018-01-04 15:09 | 922K | |
![[SND]](/icons/sound2.gif) | gt tower.xm | 2018-01-04 15:09 | 923K | |
![[SND]](/icons/sound2.gif) | talking machine.xm | 2018-01-04 15:09 | 923K | |
![[SND]](/icons/sound2.gif) | snakechrmer by sheri.xm | 2018-01-04 15:09 | 924K | |
![[SND]](/icons/sound2.gif) | you bite!.xm | 2018-01-04 15:09 | 926K | |
![[SND]](/icons/sound2.gif) | floating around.xm | 2018-01-04 15:09 | 926K | |
![[SND]](/icons/sound2.gif) | moood.xm | 2018-01-04 15:09 | 929K | |
![[SND]](/icons/sound2.gif) | remaining memories.xm | 2018-01-04 15:09 | 929K | |
![[SND]](/icons/sound2.gif) | guardians of love.xm | 2018-01-04 15:09 | 930K | |
![[SND]](/icons/sound2.gif) | gnosis.xm | 2018-01-04 15:09 | 932K | |
![[SND]](/icons/sound2.gif) | monkey business (1).xm | 2018-01-04 15:09 | 933K | |
![[SND]](/icons/sound2.gif) | untitled~3.xm | 2018-01-04 15:09 | 934K | |
![[SND]](/icons/sound2.gif) | the feeling..xm | 2018-01-04 15:09 | 935K | |
![[SND]](/icons/sound2.gif) | faccettanera2000.xm | 2018-01-04 15:09 | 936K | |
![[SND]](/icons/sound2.gif) | exit~1.xm | 2018-01-04 15:09 | 938K | |
![[SND]](/icons/sound2.gif) | hungry.xm | 2018-01-04 15:09 | 938K | |
![[SND]](/icons/sound2.gif) | dgt vicrmx.xm | 2018-01-04 15:09 | 939K | |
![[SND]](/icons/sound2.gif) | space rangers.xm | 2018-01-04 15:09 | 940K | |
![[SND]](/icons/sound2.gif) | midnight of techno.xm | 2018-01-04 15:09 | 940K | |
![[SND]](/icons/sound2.gif) | labe ii franky.xm | 2018-01-04 15:09 | 940K | |
![[SND]](/icons/sound2.gif) | drive.xm | 2018-01-04 15:09 | 940K | |
![[SND]](/icons/sound2.gif) | sapphire starlight.xm | 2018-01-04 15:09 | 941K | |
![[SND]](/icons/sound2.gif) | wooden shavings.xm | 2018-01-04 15:09 | 941K | |
![[SND]](/icons/sound2.gif) | dj khan - esrar.xm | 2018-01-04 15:09 | 942K | |
![[SND]](/icons/sound2.gif) | lunar excursion.xm | 2018-01-04 15:09 | 943K | |
![[SND]](/icons/sound2.gif) | g2.xm | 2018-01-04 15:09 | 943K | |
![[SND]](/icons/sound2.gif) | war of the ghostland.xm | 2018-01-04 15:09 | 944K | |
![[SND]](/icons/sound2.gif) | hatred (104).xm | 2018-01-04 15:09 | 944K | |
![[SND]](/icons/sound2.gif) | the chase.xm | 2018-01-04 15:09 | 944K | |
![[SND]](/icons/sound2.gif) | reflecting twins.xm | 2018-01-04 15:09 | 945K | |
![[SND]](/icons/sound2.gif) | stars (1).xm | 2018-01-04 15:09 | 946K | |
![[SND]](/icons/sound2.gif) | dispersion 3.xm | 2018-01-04 15:09 | 947K | |
![[SND]](/icons/sound2.gif) | imaginary voyage....xm | 2018-01-04 15:09 | 948K | |
![[SND]](/icons/sound2.gif) | fires of damnation.xm | 2018-01-04 15:09 | 948K | |
![[SND]](/icons/sound2.gif) | exctacy.xm | 2018-01-04 15:09 | 949K | |
![[SND]](/icons/sound2.gif) | let me tell you what.xm | 2018-01-04 15:09 | 949K | |
![[SND]](/icons/sound2.gif) | timewarp (1).xm | 2018-01-04 15:09 | 949K | |
![[SND]](/icons/sound2.gif) | shutt up and let me ..> | 2018-01-04 15:09 | 951K | |
![[SND]](/icons/sound2.gif) | linnea.xm | 2018-01-04 15:09 | 952K | |
![[SND]](/icons/sound2.gif) | trigger (1).xm | 2018-01-04 15:09 | 952K | |
![[SND]](/icons/sound2.gif) | twistin' mindless.xm | 2018-01-04 15:09 | 952K | |
![[SND]](/icons/sound2.gif) | tides (flood edit).xm | 2018-01-04 15:09 | 952K | |
![[SND]](/icons/sound2.gif) | last crossroads.xm | 2018-01-04 15:09 | 952K | |
![[SND]](/icons/sound2.gif) | misty nights 345.xm | 2018-01-04 15:09 | 953K | |
![[SND]](/icons/sound2.gif) | dark sorcery.xm | 2018-01-04 15:09 | 955K | |
![[SND]](/icons/sound2.gif) | lsd sub number 75.xm | 2018-01-04 15:09 | 956K | |
![[SND]](/icons/sound2.gif) | the feel -john kazuo.xm | 2018-01-04 15:09 | 958K | |
![[SND]](/icons/sound2.gif) | i.xm | 2018-01-04 15:09 | 958K | |
![[SND]](/icons/sound2.gif) | yes i.xm | 2018-01-04 15:09 | 958K | |
![[SND]](/icons/sound2.gif) | flashb.xm | 2018-01-04 15:09 | 959K | |
![[SND]](/icons/sound2.gif) | the plague.xm | 2018-01-04 15:09 | 959K | |
![[SND]](/icons/sound2.gif) | pinkpanther - rio.xm | 2018-01-04 15:09 | 960K | |
![[SND]](/icons/sound2.gif) | lost in space.xm | 2018-01-04 15:09 | 960K | |
![[SND]](/icons/sound2.gif) | flying the matrix by..> | 2018-01-04 15:09 | 960K | |
![[SND]](/icons/sound2.gif) | flight of the dragon.xm | 2018-01-04 15:09 | 961K | |
![[SND]](/icons/sound2.gif) | the final.xm | 2018-01-04 15:09 | 961K | |
![[SND]](/icons/sound2.gif) | frek - s.xm | 2018-01-04 15:09 | 962K | |
![[SND]](/icons/sound2.gif) | kiss in univerce.xm | 2018-01-04 15:09 | 962K | |
![[SND]](/icons/sound2.gif) | keez featuring piano.xm | 2018-01-04 15:09 | 962K | |
![[SND]](/icons/sound2.gif) | life (1).xm | 2018-01-04 15:09 | 964K | |
![[SND]](/icons/sound2.gif) | t4.xm | 2018-01-04 15:09 | 964K | |
![[SND]](/icons/sound2.gif) | sawdust2.xm | 2018-01-04 15:09 | 966K | |
![[SND]](/icons/sound2.gif) | useless.xm | 2018-01-04 15:09 | 966K | |
![[SND]](/icons/sound2.gif) | wireless pedestrians.xm | 2018-01-04 15:09 | 967K | |
![[SND]](/icons/sound2.gif) | liber ivonis.xm | 2018-01-04 15:09 | 967K | |
![[SND]](/icons/sound2.gif) | medithor.xm | 2018-01-04 15:09 | 969K | |
![[SND]](/icons/sound2.gif) | examination summer.xm | 2018-01-04 15:09 | 970K | |
![[SND]](/icons/sound2.gif) | lover.xm | 2018-01-04 15:09 | 970K | |
![[SND]](/icons/sound2.gif) | eil marias frolic.xm | 2018-01-04 15:09 | 970K | |
![[SND]](/icons/sound2.gif) | no good ('96-remix).xm | 2018-01-04 15:09 | 971K | |
![[SND]](/icons/sound2.gif) | on the other side.xm | 2018-01-04 15:09 | 972K | |
![[SND]](/icons/sound2.gif) | valosta varjoon.xm | 2018-01-04 15:09 | 972K | |
![[SND]](/icons/sound2.gif) | struggel.xm | 2018-01-04 15:09 | 972K | |
![[SND]](/icons/sound2.gif) | mareos.xm | 2018-01-04 15:09 | 973K | |
![[SND]](/icons/sound2.gif) | zounds.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | dtn-sl.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | shaker.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | mastermind ep.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | trerpman.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | reasoncruel creator.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | reindeer.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | dj khan - blue room.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | plain trip-r-mixed.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | megamaniimix-jlsoft!..> | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | future phunk 325.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | knu-steppaz delight.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | ins0mnia.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | let the move.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | killin' me softly.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | one man s dream.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | fantasy place.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | hpeer.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | de-mental-fun.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | tjejtjej.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | mist.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | theme from xenox.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | up.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | toybox from hell.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | fm - soha ma'r.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | harmageddon (257).xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | synth c aconrun.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | the spanish passion.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | WHIPLASH.XM | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | take your vet off.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | whouu! (abio-2 frag).xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | good dream - daner.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | katharina.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | revo.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | only play in ft2.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | gitarrenfresser.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | compo bd.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | i'm drowning.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | hostile.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | the portfoolio way.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | make da bass.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | udo 03 heavy mellow.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | kotic system.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | gravity overdose.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | experimental vol. 1.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | everglan.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | nightcity, home of.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | tubthmpn.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | white x-mas (rmx).xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | implant.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | qwe@qwe.com.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | previous life.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | tripwires - vj.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | replicant dreams.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | if i only could(d2k).xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | what the hell!.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | poing - jump mix.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | horizon [tsec ].xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | for whom... live!.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | melodicmutterings2.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | morning.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | g-cooperation~1.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | moulder away.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | mos6581 - sidxmix!.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | rain.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | universe expansion.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | powerbass-macarena(b..> | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | walkaway.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | vinden [punkrock].xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | wikend.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | redhead.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | dance with noone.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | sure shot beats.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | dj cozmic.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | hieromasauna.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | house time.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | kaas or cheese, sir.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | the freak.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | dead & buried.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | changes.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | the border.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | midfields.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | the.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | thinkin' about her.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | midnight's cheer up.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | dac.realm.oph.chaos.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | hero of the day.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | circuit1.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | moon flow.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | when i dream.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | nothing left.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | teflon cloudz.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | panic.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | elements.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | opa opa.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | nerds 'r' us(c).xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | follow da lifestream.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | frozen water.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | unilove.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | timeghost.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | pisang.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | hybridx - moonlight.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | dbcomp.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | take on me.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | mission impossible.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | heavy wind.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | le onde (waves).xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | jettebas.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | the party's here !.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | go get busy.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | circular motion.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | mf fdn.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | x-curs-ion.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | radical.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | marble.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | doom trooper.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | tryin'to find heaven.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | one&one remix sonic.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | jungle piper boy.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | original techno trib.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | lulupupp o3.46.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | d brasil.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | way wabbit v2.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | dogs dance.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | eugh.xm | 2018-01-04 15:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | no good (roughness).xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | tetris remix.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | my music.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | the hot mix.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | sunshine (r.buli) rm.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | depths of pain... (d.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | destiny.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | live.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | noized.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | die schopfung.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | psy.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | nineteen.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | immortal.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | piano dreams.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | gastronomic gogo!.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | time to go away.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | follow me.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | pdn-test.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | starscroll remix.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | slowmood.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | revolution~1.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | red light.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | merregnon.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | the floating waves.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | screw.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | corinna.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | diabolo's love.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | the new zone.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | enevitable.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | frankfurt ep.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | visions in the dark ..> | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | the night i died.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | let's got it !!!.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | open.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | t.j.c - ambience.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | ravy happy digital m.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | the final end.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | destination.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | x-files leonid remix.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | woooaauw.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | mds huma.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | riverdance goes elec.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | head first - 2nd ed.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | wareu.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | go get busy !.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | esteem by greatfox.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | imper.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | farwell.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | smalltriptogrinava.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | slowfox - cyberwolf.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | kiss in the storm.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | the sun also rises~1.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | turning back.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | um....xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | holding on.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | newborn [df].xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | more to suffer.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | drift away.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | metros hardcore.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | zzzzzzen.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | make it real.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | the halls of crystal.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | i don't.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | nash.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | nicetrybutnocigar.xm | 2018-01-04 15:09 | 1.1M | |
![[SND]](/icons/sound2.gif) | redemption to jungle.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | karneval.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | nervously - gimme.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | planetaric (mix).xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | db-23 untitled.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | dothiepin.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | joesbird.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | getready.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | fuckntrr.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | the saga of i nârma..> | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | chris and the clones..> | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | keep2c.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | happyh5.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | sundown rain.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | massive energy (pd).xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | the bouncing ball.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | liquid sun.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | the sun also rises.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | lunapark 537mn.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | mikrrobitti!.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | far out~1.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | te intrebi vais.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | kuutti.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | defrocked.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | luv.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | nest in the sky.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | kesh.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | tenhle svet je lodka.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | webber 1 by wild bit..> | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | shrines of honor.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | stone.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | mars n. women. - asu.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | tzmirma.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | dark.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | titf.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | d.s. - deep inside.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | the darkzone xld.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | dj gary - nightmare.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | pan ch'ao.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | lice.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | movin on remix.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | the little bird.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | miranda`s axe.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | earache.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | last day on mars.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | musth.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | e'gbo''l potty...!!!.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | midvinter blot.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | frenzy.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | keine zukunft.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | nibiru's return.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | millenium~3.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | day of mourning.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | veronica.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | no rest (you get).xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | elasticdreams.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | consollus vs edge.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | jovianfunkyjunkieboy.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | fugee.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | want to go home.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | mind blower.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | happyh6.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | dream (2).xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | hyper danceeletric.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | vibe (1).xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | ninja fever.xm | 2018-01-04 15:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | dasup - eternity'99.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | vuohisoturit sodassa.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | filter.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | gardemarines by rb.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | sunshine~1.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | deerhunt.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | happyh7.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | silentdream nj remix.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | impaler.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | lbc hc.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | frogs.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | lost in hell.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | spook.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | cuz vinnie - dj flux.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | fluid combustion.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | heart beat.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | the ocean (2).xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | forbidden fruits.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | goaway.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | seasons change.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | untitled~3 (2).xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | pc antagonism 8bit.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | crowbar.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | i'm running.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | perfect circuit -soc.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | nogoodltmix.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | nogoodlunaticmix.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | lk - sudden thoughts.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | the ragit bunting or.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | elctro75.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | last seconds of life.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | the groove (come on).xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | pure extacy.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | dont ever leave (c).xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | see how i feel.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | ode to anders elmen.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | notice.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | whispering voice.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | death departure.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | gouryella-tenshi mix.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | the issued fight.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | magic tales.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | fireworks.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | fat cat ).xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | powerade.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | kaakaokone.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | the 2nd world.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | resurrection.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | i cant leave you-y3k.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | one daymcf.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | perpetual motion~1.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | phobia.xm | 2018-01-04 15:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | putyourhandsup(333).xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | fantasy.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | siess keresztyen.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | forandi.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | rave-ace 2-30.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | le3.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | k9 wakeu.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | look outside -socep.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | k9 symphony.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | chris and the clones.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | muster pilots.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | fuck the u.s.a.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | the anxiety machine.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | i wanna dance-ikki's.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | pxtreem.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | djgb.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | pf....xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | denial of the truth2.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | contrast 1.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | exodus.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | falling crystals.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | me killa #1.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | paraply theme.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | the devourers.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | liquid god (108).xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | cssf time of mist.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | predominance.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | systeemi on paska.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | eternal kombat.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | dboost.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | denial of the truth3.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | style hardtrance.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | magasin 1.0.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | colours.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | different by traditi.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | fj trax.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | drux2 by athma.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | coolkick by dj keys.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | the fatality.xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | supremacy (of basss).xm | 2018-01-04 15:09 | 1.4M | |
![[SND]](/icons/sound2.gif) | mindcontrol.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | the dragon (1).xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | orb.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | optic sounds.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | true shakers (0340).xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | deep desicion.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | waking nightmare.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | eery cold breeze.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | trigger insanity.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | trippy feedback 5.17.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | evil masquerade.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | thc-greenmagnet.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | trance goes euro.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | p. westerberg 98.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | nitrogens-rock it on.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | tune of fantasy.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | part1im so crazy mix.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | rain and night.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | pekko2 remix.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | faux pas - fortuna.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | heavens of starscape.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | twinpeaks(2001).xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | prodigy no good mix.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | the hunted.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | hel xm.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | untitled (1).xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | fanciful fellow-sfx.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | till i come (9pm).xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | negativity eraser.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | turok.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | mirage people.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | immortal(trance rmx).xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | undr the autumn tree.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | gonewind.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | jinglebells (sweden).xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | goahead.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | metal viper.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | maxilargex.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | luxor.xm | 2018-01-04 15:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | critical levels.xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | firestorm.xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | hey fatty! - tjr.xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | miscall death.xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | first assault.xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | trash 01.xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | houze.xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | true love [miseris].xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | listen to this sound.xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | DJC_STA2.XM | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | harmonix.xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | paralive.xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | circuit breed.xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | the witching hour.xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | weariness.xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | neurotic squid.xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | let it snow.xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | dj khan - rain.xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | last pianodemonio..xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | fp.xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | escape from ant-hill.xm | 2018-01-04 15:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | dj amplitude - kamme.xm | 2018-01-04 15:09 | 1.7M | |
![[SND]](/icons/sound2.gif) | it is your destiny.xm | 2018-01-04 15:09 | 1.7M | |
![[SND]](/icons/sound2.gif) | moby - go (remix).xm | 2018-01-04 15:09 | 1.7M | |
![[SND]](/icons/sound2.gif) | like thiz.xm | 2018-01-04 15:09 | 1.7M | |
![[SND]](/icons/sound2.gif) | distortion focus.xm | 2018-01-04 15:09 | 1.7M | |
![[SND]](/icons/sound2.gif) | ruff step.xm | 2018-01-04 15:09 | 1.7M | |
![[SND]](/icons/sound2.gif) | last day in heaven.xm | 2018-01-04 15:09 | 1.7M | |
![[SND]](/icons/sound2.gif) | jungle industry 9.00.xm | 2018-01-04 15:09 | 1.7M | |
![[SND]](/icons/sound2.gif) | invisrmx.xm | 2018-01-04 15:09 | 1.7M | |
![[SND]](/icons/sound2.gif) | mr. mushy enters.xm | 2018-01-04 15:09 | 1.7M | |
![[SND]](/icons/sound2.gif) | compo guitarmania.xm | 2018-01-04 15:09 | 1.7M | |
![[SND]](/icons/sound2.gif) | my love for you.xm | 2018-01-04 15:09 | 1.7M | |
![[SND]](/icons/sound2.gif) | dn funky.xm | 2018-01-04 15:09 | 1.7M | |
![[SND]](/icons/sound2.gif) | wackafunk.xm | 2018-01-04 15:09 | 1.7M | |
![[SND]](/icons/sound2.gif) | project2.xm | 2018-01-04 15:09 | 1.7M | |
![[SND]](/icons/sound2.gif) | dj snoozebeachball!.xm | 2018-01-04 15:09 | 1.8M | |
![[SND]](/icons/sound2.gif) | the mission~1.xm | 2018-01-04 15:09 | 1.8M | |
![[SND]](/icons/sound2.gif) | demo-s.xm | 2018-01-04 15:09 | 1.8M | |
![[SND]](/icons/sound2.gif) | ttt uts.xm | 2018-01-04 15:09 | 1.8M | |
![[SND]](/icons/sound2.gif) | unity (drum & bass).xm | 2018-01-04 15:09 | 1.8M | |
![[SND]](/icons/sound2.gif) | i hate mr law.xm | 2018-01-04 15:09 | 1.8M | |
![[SND]](/icons/sound2.gif) | dont play in winamp!.xm | 2018-01-04 15:09 | 1.8M | |
![[SND]](/icons/sound2.gif) | laika died in space.xm | 2018-01-04 15:09 | 1.8M | |
![[SND]](/icons/sound2.gif) | ppiano.xm | 2018-01-04 15:09 | 1.8M | |
![[SND]](/icons/sound2.gif) | overdrive.xm | 2018-01-04 15:09 | 1.8M | |
![[SND]](/icons/sound2.gif) | mclate-impression.xm | 2018-01-04 15:09 | 1.8M | |
![[SND]](/icons/sound2.gif) | moonweed.xm | 2018-01-04 15:09 | 1.8M | |
![[SND]](/icons/sound2.gif) | mr kirks remix.xm | 2018-01-04 15:09 | 1.8M | |
![[SND]](/icons/sound2.gif) | human-worm.xm | 2018-01-04 15:09 | 1.8M | |
![[SND]](/icons/sound2.gif) | good morning ben-tov.xm | 2018-01-04 15:09 | 1.8M | |
![[SND]](/icons/sound2.gif) | fucking the dead.xm | 2018-01-04 15:09 | 1.8M | |
![[SND]](/icons/sound2.gif) | the love encounter m.xm | 2018-01-04 15:09 | 1.8M | |
![[SND]](/icons/sound2.gif) | trance.xm | 2018-01-04 15:09 | 1.8M | |
![[SND]](/icons/sound2.gif) | untitled due to me...xm | 2018-01-04 15:09 | 1.8M | |
![[SND]](/icons/sound2.gif) | take.xm | 2018-01-04 15:09 | 1.9M | |
![[SND]](/icons/sound2.gif) | even though death is.xm | 2018-01-04 15:09 | 1.9M | |
![[SND]](/icons/sound2.gif) | untitled~1 (4).xm | 2018-01-04 15:09 | 1.9M | |
![[SND]](/icons/sound2.gif) | envoy of sadness.xm | 2018-01-04 15:09 | 1.9M | |
![[SND]](/icons/sound2.gif) | separated twins.xm | 2018-01-04 15:09 | 1.9M | |
![[SND]](/icons/sound2.gif) | new world v2.0.xm | 2018-01-04 15:09 | 1.9M | |
![[SND]](/icons/sound2.gif) | the last answer.xm | 2018-01-04 15:09 | 1.9M | |
![[SND]](/icons/sound2.gif) | new forms!!!.xm | 2018-01-04 15:09 | 1.9M | |
![[SND]](/icons/sound2.gif) | epidemi.xm | 2018-01-04 15:09 | 1.9M | |
![[SND]](/icons/sound2.gif) | one small step.xm | 2018-01-04 15:09 | 1.9M | |
![[SND]](/icons/sound2.gif) | the wise oak v1.2.xm | 2018-01-04 15:09 | 1.9M | |
![[SND]](/icons/sound2.gif) | here is amor!.xm | 2018-01-04 15:09 | 2.0M | |
![[SND]](/icons/sound2.gif) | mokum.xm | 2018-01-04 15:09 | 2.0M | |
![[SND]](/icons/sound2.gif) | silent running..xm | 2018-01-04 15:09 | 2.0M | |
![[SND]](/icons/sound2.gif) | hardonlo.xm | 2018-01-04 15:09 | 2.0M | |
![[SND]](/icons/sound2.gif) | soulworks - lakeside.xm | 2018-01-04 15:09 | 2.0M | |
![[SND]](/icons/sound2.gif) | lovic66@hotmail.com.xm | 2018-01-04 15:09 | 2.0M | |
![[SND]](/icons/sound2.gif) | rainman.xm | 2018-01-04 15:09 | 2.0M | |
![[SND]](/icons/sound2.gif) | digi-q.xm | 2018-01-04 15:09 | 2.0M | |
![[SND]](/icons/sound2.gif) | hitchinaride.xm | 2018-01-04 15:09 | 2.0M | |
![[SND]](/icons/sound2.gif) | land of imagination.xm | 2018-01-04 15:09 | 2.0M | |
![[SND]](/icons/sound2.gif) | e breath.xm | 2018-01-04 15:09 | 2.0M | |
![[SND]](/icons/sound2.gif) | untitled~1.xm | 2018-01-04 15:09 | 2.0M | |
![[SND]](/icons/sound2.gif) | new air - tranmpeg.xm | 2018-01-04 15:09 | 2.0M | |
![[SND]](/icons/sound2.gif) | our eternal color.xm | 2018-01-04 15:09 | 2.0M | |
![[SND]](/icons/sound2.gif) | untitled 2.xm | 2018-01-04 15:09 | 2.0M | |
![[SND]](/icons/sound2.gif) | hypnotic.xm | 2018-01-04 15:09 | 2.0M | |
![[SND]](/icons/sound2.gif) | the forshadowing.xm | 2018-01-04 15:09 | 2.1M | |
![[SND]](/icons/sound2.gif) | fantasy trip(baby d).xm | 2018-01-04 15:09 | 2.1M | |
![[SND]](/icons/sound2.gif) | tlcno scrubshousemix.xm | 2018-01-04 15:09 | 2.1M | |
![[SND]](/icons/sound2.gif) | dj christmas.xm | 2018-01-04 15:09 | 2.1M | |
![[SND]](/icons/sound2.gif) | gothic4.xm | 2018-01-04 15:09 | 2.1M | |
![[SND]](/icons/sound2.gif) | tigerwookie - lucia.xm | 2018-01-04 15:09 | 2.1M | |
![[SND]](/icons/sound2.gif) | live your life.xm | 2018-01-04 15:09 | 2.1M | |
![[SND]](/icons/sound2.gif) | the hand of allah.xm | 2018-01-04 15:09 | 2.1M | |
![[SND]](/icons/sound2.gif) | night run.xm | 2018-01-04 15:09 | 2.1M | |
![[SND]](/icons/sound2.gif) | metal101.xm | 2018-01-04 15:09 | 2.1M | |
![[SND]](/icons/sound2.gif) | millenium o.s..xm | 2018-01-04 15:09 | 2.1M | |
![[SND]](/icons/sound2.gif) | the mission2nd.xm | 2018-01-04 15:09 | 2.1M | |
![[SND]](/icons/sound2.gif) | your smile in my.xm | 2018-01-04 15:09 | 2.1M | |
![[SND]](/icons/sound2.gif) | the two step.xm | 2018-01-04 15:09 | 2.1M | |
![[SND]](/icons/sound2.gif) | soldier m.i.a.xm | 2018-01-04 15:09 | 2.1M | |
![[SND]](/icons/sound2.gif) | k9- all your secrets.xm | 2018-01-04 15:09 | 2.1M | |
![[SND]](/icons/sound2.gif) | nitrogens-happynesss.xm | 2018-01-04 15:09 | 2.1M | |
![[SND]](/icons/sound2.gif) | no more drama(synop).xm | 2018-01-04 15:09 | 2.2M | |
![[SND]](/icons/sound2.gif) | nervously - lovrtits.xm | 2018-01-04 15:09 | 2.2M | |
![[SND]](/icons/sound2.gif) | one on one.xm | 2018-01-04 15:09 | 2.2M | |
![[SND]](/icons/sound2.gif) | sunnyshades.xm | 2018-01-04 15:09 | 2.2M | |
![[SND]](/icons/sound2.gif) | foziak - hydrangea.xm | 2018-01-04 15:09 | 2.2M | |
![[SND]](/icons/sound2.gif) | funkygv.xm | 2018-01-04 15:09 | 2.2M | |
![[SND]](/icons/sound2.gif) | dazen.xm | 2018-01-04 15:09 | 2.2M | |
![[SND]](/icons/sound2.gif) | world of music.xm | 2018-01-04 15:09 | 2.2M | |
![[SND]](/icons/sound2.gif) | hollow.xm | 2018-01-04 15:09 | 2.2M | |
![[SND]](/icons/sound2.gif) | ganxsta worm -gazsi.xm | 2018-01-04 15:09 | 2.2M | |
![[SND]](/icons/sound2.gif) | mega mix 03.xm | 2018-01-04 15:09 | 2.2M | |
![[SND]](/icons/sound2.gif) | good hk1.xm | 2018-01-04 15:09 | 2.2M | |
![[SND]](/icons/sound2.gif) | sundays thinks.xm | 2018-01-04 15:09 | 2.2M | |
![[SND]](/icons/sound2.gif) | drumcas.xm | 2018-01-04 15:09 | 2.2M | |
![[SND]](/icons/sound2.gif) | persistent pageantry.xm | 2018-01-04 15:09 | 2.3M | |
![[SND]](/icons/sound2.gif) | justanotherhousebeat.xm | 2018-01-04 15:09 | 2.3M | |
![[SND]](/icons/sound2.gif) | pulse.xm | 2018-01-04 15:09 | 2.3M | |
![[SND]](/icons/sound2.gif) | natacha atlas remix.xm | 2018-01-04 15:09 | 2.3M | |
![[SND]](/icons/sound2.gif) | du hast -magnusmix.xm | 2018-01-04 15:09 | 2.3M | |
![[SND]](/icons/sound2.gif) | city voices.xm | 2018-01-04 15:09 | 2.3M | |
![[SND]](/icons/sound2.gif) | radar love.xm | 2018-01-04 15:09 | 2.3M | |
![[SND]](/icons/sound2.gif) | maci laci.xm | 2018-01-04 15:09 | 2.3M | |
![[SND]](/icons/sound2.gif) | whats there.xm | 2018-01-04 15:09 | 2.3M | |
![[SND]](/icons/sound2.gif) | september curtain.xm | 2018-01-04 15:09 | 2.5M | |
![[SND]](/icons/sound2.gif) | kick.xm | 2018-01-04 15:09 | 2.5M | |
![[SND]](/icons/sound2.gif) | in the rain.xm | 2018-01-04 15:09 | 2.5M | |
![[SND]](/icons/sound2.gif) | uno problemo major.xm | 2018-01-04 15:09 | 2.5M | |
![[SND]](/icons/sound2.gif) | dropped on a road.xm | 2018-01-04 15:09 | 2.5M | |
![[SND]](/icons/sound2.gif) | dje-dia.xm | 2018-01-04 15:09 | 2.5M | |
![[SND]](/icons/sound2.gif) | megablast.xm | 2018-01-04 15:09 | 2.5M | |
![[SND]](/icons/sound2.gif) | the dreamer.xm | 2018-01-04 15:09 | 2.5M | |
![[SND]](/icons/sound2.gif) | useless..man (bombb).xm | 2018-01-04 15:09 | 2.5M | |
![[SND]](/icons/sound2.gif) | scent of liberation.xm | 2018-01-04 15:09 | 2.6M | |
![[SND]](/icons/sound2.gif) | nitrogens-cowboy.xm | 2018-01-04 15:09 | 2.6M | |
![[SND]](/icons/sound2.gif) | my2dmom.xm | 2018-01-04 15:09 | 2.6M | |
![[SND]](/icons/sound2.gif) | zero beat.xm | 2018-01-04 15:09 | 2.6M | |
![[SND]](/icons/sound2.gif) | eastern promise.xm | 2018-01-04 15:09 | 2.6M | |
![[SND]](/icons/sound2.gif) | darth 7.xm | 2018-01-04 15:09 | 2.7M | |
![[SND]](/icons/sound2.gif) | housework remix.xm | 2018-01-04 15:09 | 2.7M | |
![[SND]](/icons/sound2.gif) | living in a dream.xm | 2018-01-04 15:09 | 2.7M | |
![[SND]](/icons/sound2.gif) | fire on the sea.xm | 2018-01-04 15:09 | 2.7M | |
![[SND]](/icons/sound2.gif) | sdunknown signal @.xm | 2018-01-04 15:09 | 2.7M | |
![[SND]](/icons/sound2.gif) | metal c chair.xm | 2018-01-04 15:09 | 2.8M | |
![[SND]](/icons/sound2.gif) | genie in a bottle.xm | 2018-01-04 15:09 | 2.9M | |
![[SND]](/icons/sound2.gif) | when the cow said mu.xm | 2018-01-04 15:09 | 2.9M | |
![[SND]](/icons/sound2.gif) | virtual mouton maf.xm | 2018-01-04 15:09 | 2.9M | |
![[SND]](/icons/sound2.gif) | tunnelstriker vtrmix.xm | 2018-01-04 15:09 | 2.9M | |
![[SND]](/icons/sound2.gif) | just do it.xm | 2018-01-04 15:09 | 2.9M | |
![[SND]](/icons/sound2.gif) | maj enjo.xm | 2018-01-04 15:09 | 3.0M | |
![[SND]](/icons/sound2.gif) | rem gf3.xm | 2018-01-04 15:09 | 3.0M | |
![[SND]](/icons/sound2.gif) | terraforming of mars.xm | 2018-01-04 15:09 | 3.0M | |
![[SND]](/icons/sound2.gif) | life, a big trip.xm | 2018-01-04 15:09 | 3.0M | |
![[SND]](/icons/sound2.gif) | rave 2004.xm | 2018-01-04 15:09 | 3.0M | |
![[SND]](/icons/sound2.gif) | holding you.xm | 2018-01-04 15:09 | 3.1M | |
![[SND]](/icons/sound2.gif) | stan.xm | 2018-01-04 15:09 | 3.1M | |
|