![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| sulphuric acid.dbm | 2005-02-24 22:59 | 502K | |
| rukkia.dbm | 2005-02-24 22:59 | 206K | |
| weird welfare.dbm | 2004-09-13 19:52 | 1.3M | |
| the gate of heavens.dbm | 2004-09-13 19:51 | 655K | |
| spotlight.dbm | 2004-09-13 19:51 | 770K | |
| pulsars.dbm | 2004-09-13 19:51 | 291K | |
| outburst3.dbm | 2004-09-13 19:51 | 502K | |
| neverending story.dbm | 2004-09-13 19:51 | 64K | |
| flogging.dbm | 2004-09-13 19:51 | 81K | |
| delphins song remix.dbm | 2004-09-13 19:51 | 250K | |
| analgesic drug.dbm | 2004-09-13 19:51 | 1.1M | |