![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 80s stars.xm | 2004-09-13 20:11 | 1.5M | |
| aphrodesiac.xm | 2004-09-13 20:11 | 1.8M | |
| pianopowers.xm | 2004-09-13 20:11 | 1.5M | |
| psychoactive drug.xm | 2004-09-13 20:11 | 2.4M | |
| ode to eiffel65.xm | 2005-11-05 00:47 | 4.1K | |
| chip4ever.xm | 2005-11-05 00:48 | 22K | |
| dam dam.xm | 2005-11-05 00:48 | 30K | |
| phatt.xm | 2005-11-05 00:48 | 534K | |
| popcorn rmx.xm | 2005-11-05 00:48 | 182K | |
| letz fetz the 2nd.xm | 2014-03-03 18:21 | 272K | |
| njiet gorbatshow.xm | 2014-03-03 18:21 | 27K | |