![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| away.xm | 1999-05-30 00:56 | 1.1M | |
| chemical effect.xm | 2005-09-14 03:58 | 1.5M | |
| don't stop the rock.xm | 2005-09-14 03:53 | 1.0M | |
| epic.xm | 2000-01-05 14:20 | 2.0M | |
| forgotten past.xm | 2005-09-14 03:58 | 907K | |
| head rush.xm | 2005-09-14 03:53 | 828K | |
| high end.xm | 2005-09-14 03:53 | 688K | |
| kaffere remix.xm | 2005-09-14 03:53 | 785K | |
| mission impossible r..> | 2005-09-14 03:53 | 414K | |
| power source.xm | 2005-09-14 03:53 | 1.0M | |
| state of ambience.xm | 2005-09-14 03:58 | 1.7M | |
| the good life.xm | 2005-09-14 03:53 | 565K | |
| walk into the light.xm | 2005-09-14 03:53 | 348K | |
| where's will.xm | 2005-09-14 03:53 | 34K | |