![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| chemical trip.xm | 1998-08-01 18:38 | 556K | |
| the quest.xm | 1998-09-16 16:42 | 1.1M | |
| island of dreams.xm | 1999-01-18 05:14 | 867K | |
| wishful thinking.xm | 2000-07-20 14:51 | 1.7M | |
| disconnection.xm | 2000-07-21 20:45 | 1.6M | |
| drum in space.xm | 2000-08-02 13:31 | 905K | |
| galactic girl.xm | 2000-08-02 13:34 | 813K | |
| heavenly waves.xm | 2000-08-02 13:35 | 1.2M | |
| lunar flyby.xm | 2000-08-02 13:38 | 927K | |
| vertigo.xm | 2000-08-02 13:39 | 803K | |
| island of hope.xm | 2000-08-08 13:25 | 2.1M | |
| scream.xm | 2000-11-09 20:06 | 1.1M | |
| species 7806.xm | 2004-09-13 20:21 | 1.2M | |
| feelingood.xm | 2005-03-06 03:46 | 1.0M | |
| trip to infinity.xm | 2005-09-15 19:07 | 668K | |
| shaking.xm | 2008-07-24 20:42 | 361K | |