![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| coop-Sky/ | 2024-07-25 06:55 | - | |
| coop-Newn/ | 2014-02-27 20:33 | - | |
| rea pa ikea.xm | 2014-02-21 21:41 | 572K | |
| porling water.xm | 2014-02-21 21:40 | 308K | |
| trams.xm | 2009-04-14 15:23 | 24K | |
| space garbage.xm | 2009-04-14 15:23 | 711K | |
| scrambled eggs.xm | 2009-04-14 15:22 | 232K | |
| f-zero - silent.xm | 2009-04-14 15:21 | 38K | |
| f-zero - port town 2.xm | 2009-04-14 15:21 | 23K | |
| f-zero - mute city.xm | 2009-04-14 15:21 | 25K | |
| a night at stan's.xm | 2008-07-25 18:17 | 852K | |
| zelda 3 - fairy them..> | 2004-09-13 20:25 | 4.4K | |
| zelda 3 - dark world.xm | 2004-09-13 20:25 | 36K | |
| virtual humanity.xm | 2004-09-13 20:25 | 876K | |
| trapped in a bottle.xm | 2004-09-13 20:25 | 327K | |
| the liberator.xm | 2004-09-13 20:25 | 772K | |
| the chase.xm | 2004-09-13 20:25 | 2.6M | |
| thanks for the fish.xm | 2004-09-13 20:25 | 964K | |
| soul hunt.xm | 2004-09-13 20:25 | 1.1M | |
| raping a monkey.xm | 2004-09-13 20:25 | 1.5M | |
| playing with death.xm | 2004-09-13 20:25 | 923K | |
| peaceful journey.xm | 2004-09-13 20:25 | 560K | |
| nuclear reaction.xm | 2004-09-13 20:25 | 658K | |
| lyrics from hell.xm | 2004-09-13 20:25 | 968K | |
| last sunset.xm | 2004-09-13 20:25 | 1.6M | |
| jet lag.xm | 2004-09-13 20:25 | 961K | |
| facing the evil.xm | 2004-09-13 20:25 | 765K | |
| electric heating.xm | 2004-09-13 20:25 | 607K | |
| do the monkey!.xm | 2004-09-13 20:25 | 1.0M | |
| cyber city.xm | 2004-09-13 20:25 | 681K | |
| crossroads.xm | 2004-09-13 20:25 | 2.1M | |
| awakening.xm | 2004-09-13 20:25 | 939K | |
| annie.xm | 2004-09-13 20:25 | 961K | |
| from the shadow.xm | 1999-06-17 01:06 | 1.3M | |