![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 19 kerdes.xm | 2014-06-15 19:49 | 1.2M | |
| almodj vilagot.xm | 2009-02-03 17:15 | 1.6M | |
| awakening.xm | 2009-01-23 22:18 | 269K | |
| dizsibe bee!.xm | 2018-06-12 23:42 | 7.2M | |
| eltunt evek.xm | 2014-06-15 19:49 | 1.1M | |
| furedi annaba'l.xm | 2014-06-15 19:49 | 915K | |
| hosszu menet.xm | 2018-06-12 23:42 | 11M | |
| igy szeretem-andaxin.xm | 2018-06-12 23:42 | 1.1M | |
| ja'rd ki, la'bam!.xm | 2018-06-12 23:42 | 1.8M | |
| let it all be music.xm | 2018-06-12 23:42 | 14M | |
| mr.alkohol.xm | 2014-06-15 19:49 | 2.1M | |
| rh's commando.xm | 2009-01-23 22:21 | 3.1M | |
| situation - love.xm | 2014-06-15 19:49 | 1.3M | |
| stay with me.xm | 2014-06-15 19:49 | 1.6M | |
| trap (of a mix).xm | 2009-01-20 21:23 | 13M | |