![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| coop-Charlie D/ | 2011-08-13 17:11 | - | |
| coop-Ronald van Agge..> | 2011-08-13 16:56 | - | |
| coop-Ronny/ | 2017-01-01 11:21 | - | |
| coop-Wybrova/ | 2007-03-03 18:57 | - | |
| outer chill.xm | 2005-03-06 03:33 | 100K | |
| out source (r).xm | 1999-01-07 16:59 | 185K | |
| pothole.xm | 1998-10-25 23:38 | 194K | |
| acoustic earterror.xm | 1998-05-06 12:50 | 252K | |
| tubular cells.xm | 1998-08-21 14:38 | 259K | |
| encapsulated (edit o..> | 1998-09-10 19:33 | 265K | |
| difference of realit..> | 1997-05-08 22:44 | 279K | |
| neohardophilic.xm | 1995-03-05 16:38 | 332K | |
| edge of the limits.xm | 2004-12-09 11:47 | 350K | |
| noise research.xm | 2004-09-13 20:15 | 359K | |
| grey locust.xm | 1998-09-05 04:43 | 364K | |
| indigo mood.xm | 2004-09-13 20:19 | 392K | |
| subframe 3.3 remix.xm | 1998-10-26 00:05 | 418K | |
| baby chocolaty.xm | 1998-10-23 02:14 | 454K | |
| slidfunkers.xm | 1998-10-25 23:05 | 475K | |
| computer love remake.xm | 2005-03-05 20:47 | 487K | |
| digital pitch pump.xm | 2005-08-09 23:18 | 531K | |
| the way i think.xm | 2004-12-09 11:47 | 554K | |
| t... rmx.xm | 2004-09-27 12:10 | 569K | |
| rainbow funk.xm | 1998-11-07 22:36 | 590K | |
| puppets own love son..> | 2004-09-27 12:11 | 592K | |
| acidimin kick.xm | 1998-09-09 12:19 | 599K | |
| subraum.xm | 2023-11-12 17:27 | 639K | |
| size box.xm | 1999-01-06 03:31 | 644K | |
| acid 738 - throw da ..> | 1999-02-18 02:00 | 663K | |
| we have some weird t..> | 1998-03-14 01:24 | 679K | |
| warm pulses.xm | 2004-12-09 11:47 | 718K | |
| crossing of the ener..> | 2004-09-27 12:11 | 721K | |
| imitations.xm | 2005-09-26 23:08 | 739K | |
| sound kindergarden.xm | 2004-12-09 11:47 | 756K | |
| bass toys.xm | 2004-12-09 11:47 | 787K | |
| the beat terminator.xm | 2004-09-27 12:11 | 796K | |
| acid 738 - dead in t..> | 1999-02-17 02:57 | 816K | |
| molecular distorsion.xm | 2004-12-09 11:47 | 823K | |
| astral motion remix.xm | 2004-12-09 11:46 | 834K | |
| clockworks.xm | 1999-01-06 03:30 | 852K | |
| porno na-tosh (boys ..> | 1999-02-09 23:57 | 853K | |
| things you like to h..> | 2005-08-09 23:18 | 854K | |
| energy groove.xm | 2004-09-27 12:11 | 857K | |
| facelift part one.xm | 2004-09-27 12:10 | 866K | |
| the mother fucka way.xm | 2005-09-26 23:08 | 872K | |
| porno na-tosh (girls..> | 1999-02-10 00:01 | 886K | |
| kolbenfresser remix.xm | 2004-09-27 12:10 | 895K | |
| liverpool (trashis m..> | 1996-12-21 11:47 | 903K | |
| dust and blue sky.xm | 1998-12-11 20:36 | 1.1M | |
| facelift part two.xm | 2004-09-27 12:10 | 1.1M | |
| pressure 1 remix.xm | 2004-09-27 12:10 | 1.1M | |
| atomic birds.xm | 2005-09-26 23:08 | 1.2M | |
| alien on my console.xm | 1998-04-13 02:34 | 1.2M | |
| entranced dimension.xm | 2004-09-13 20:28 | 1.2M | |
| mouvais et beau.xm | 2004-09-27 12:11 | 1.2M | |
| remember our cute el..> | 2004-09-27 12:11 | 1.2M | |
| flowers dont grow in..> | 2005-08-09 23:18 | 1.3M | |
| phony ride (2).xm | 2004-09-27 12:11 | 1.3M | |
| retro boogie.xm | 2004-09-27 12:11 | 1.3M | |
| remember our cute el..> | 2004-09-27 12:11 | 1.4M | |
| pressure 4 remix.xm | 2004-09-27 12:10 | 1.4M | |
| acid 738 - trainspot..> | 1999-02-17 00:11 | 1.4M | |
| facelift part three.xm | 2004-09-27 12:10 | 1.6M | |
| armed sequences rmx.xm | 2004-09-27 12:10 | 1.7M | |
| puppets own love son..> | 2004-09-27 12:11 | 2.0M | |
| sunshine on.xm | 2004-09-27 12:11 | 2.1M | |
| the final movement.xm | 2004-12-09 11:47 | 2.2M | |
| sun over chaos.xm | 2002-01-10 00:22 | 2.4M | |
| dream halucination.xm | 2004-12-09 11:47 | 2.5M | |
| m-tone mix vol 1.xm | 2011-08-13 17:11 | 2.5M | |
| obscure spectre.xm | 2004-09-13 20:28 | 6.6M | |