![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| chemical part 2.xm | 2006-08-13 16:32 | 451K | |
| unnamed.xm | 2006-08-13 16:32 | 41K | |
| dead heart in love.xm | 2006-08-13 16:32 | 503K | |
| faithless lies qrt.xm | 2006-08-13 16:32 | 360K | |
| htimsoj3.xm | 2006-08-13 16:32 | 230K | |
| kathela jenos -j-s.xm | 2006-08-13 16:32 | 355K | |
| leap of the heart.xm | 2006-08-13 16:32 | 264K | |
| living a lie.xm | 2006-08-13 16:32 | 351K | |
| michelle's heart.xm | 2006-08-13 16:32 | 266K | |
| my live means nothin.xm | 2006-08-13 16:32 | 196K | |