![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| visionary lies.xm | 1995-06-13 01:00 | 266K | |
| compo.xm | 1996-04-22 01:25 | 351K | |
| airwolf anti-theme.xm | 1996-04-28 00:06 | 163K | |
| aslak.xm | 1996-05-09 20:21 | 439K | |
| light years.xm | 1996-05-09 21:45 | 490K | |
| q... i was free once.xm | 1996-05-12 04:37 | 147K | |
| zulu's revenge.xm | 1996-08-04 05:41 | 34K | |
| chemical warfare.xm | 1996-08-11 05:35 | 568K | |
| hostile hornet.xm | 1997-08-08 03:52 | 762K | |
| far away.xm | 1998-08-07 16:33 | 895K | |
| over the seas.xm | 1999-06-13 15:25 | 621K | |
| 4th dimension.xm | 2000-01-19 21:25 | 451K | |
| crackers.xm | 2000-01-19 21:25 | 27K | |
| errorzone zero.xm | 2000-01-19 21:25 | 20K | |
| flesh.xm | 2000-01-19 21:25 | 797K | |
| green.xm | 2000-01-19 21:25 | 395K | |
| neurosis.xm | 2000-01-19 21:25 | 414K | |
| signal.xm | 2000-01-19 21:25 | 214K | |
| toast.xm | 2000-01-19 21:25 | 37K | |
| a taste of goa ii.xm | 2000-04-15 12:25 | 1.0M | |
| tekknoo.xm | 2000-10-21 15:59 | 471K | |
| telepatia.xm | 2000-10-23 01:16 | 938K | |
| x-ray vision v2.xm | 2002-10-08 02:06 | 423K | |
| abandoned.xm | 2004-09-13 20:30 | 463K | |
| blinded.xm | 2004-09-13 20:30 | 354K | |
| block rockin' mix.xm | 2004-09-13 20:30 | 9.3M | |
| deliverance.xm | 2004-09-13 20:30 | 426K | |
| dice.xm | 2004-09-13 20:30 | 361K | |
| don't give up.xm | 2004-09-13 20:30 | 415K | |
| enigmatic hatred.xm | 2004-09-13 20:30 | 474K | |
| guild of sounds.xm | 2004-09-13 20:30 | 712K | |
| julli.xm | 2004-09-13 20:30 | 504K | |
| logic.xm | 2004-09-13 20:30 | 422K | |
| mystique.xm | 2004-09-13 20:30 | 18K | |
| no truth.xm | 2004-09-13 20:30 | 596K | |
| orbiting.xm | 2004-09-13 20:30 | 842K | |
| over the mountains.xm | 2004-09-13 20:30 | 838K | |
| planets of euphoria.xm | 2004-09-13 20:30 | 381K | |
| space & time.xm | 2004-09-13 20:30 | 682K | |
| tune.xm | 2004-09-13 20:30 | 16K | |
| superpop.xm | 2004-09-13 20:30 | 576K | |
| world of plastic.xm | 2004-09-13 20:30 | 338K | |
| under pressure.xm | 2005-01-27 22:38 | 519K | |
| hollow beats.xm | 2006-01-12 18:13 | 374K | |
| little melody.xm | 2006-01-12 18:13 | 78K | |
| m'qvana.xm | 2006-01-12 18:13 | 54K | |
| mozartkugeln.xm | 2006-01-12 18:13 | 37K | |
| x-ray vision.xm | 2006-01-12 18:13 | 293K | |
| yellow movement.xm | 2006-01-12 18:13 | 758K | |
| mindless jumping.xm | 2007-08-18 01:41 | 29K | |
| rage 8 bit.xm | 2008-07-22 10:23 | 2.6M | |
| changing times.xm | 2015-11-05 18:52 | 718K | |