![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| akaledureduzaphobia.it | 2005-02-06 14:21 | 100K | |
| all that glitters.it | 2005-02-06 14:15 | 268K | |
| another of the same.it | 2005-02-06 14:15 | 517K | |
| antidepressants.it | 2005-02-06 14:15 | 155K | |
| borrowed time.it | 1998-12-05 03:45 | 376K | |
| borrowed time otsafh..> | 2000-04-27 04:31 | 1.6M | |
| carol of the bells r..> | 2005-02-06 14:17 | 1.9M | |
| chemical imbalance.it | 1998-11-30 19:21 | 1.1M | |
| come with me.it | 2005-02-06 14:17 | 355K | |
| coop-Phil Brown/ | 2007-03-03 19:28 | - | |
| coop-Thorn/ | 2019-03-18 13:23 | - | |
| crapola guacamolisim..> | 2005-02-06 14:17 | 171K | |
| del rio.it | 2005-02-06 14:18 | 145K | |
| discoloration.it | 2005-02-06 14:18 | 84K | |
| for a moment.it | 2005-02-06 14:18 | 599K | |
| forgotten.it | 1998-11-30 19:27 | 1.1M | |
| fur elise remix.it | 1999-04-22 19:48 | 307K | |
| ginga.it | 1999-03-11 16:30 | 300K | |
| gravity.it | 2005-02-06 14:18 | 150K | |
| impromptu.it | 1999-02-12 13:41 | 712K | |
| influences.it | 1999-02-12 13:41 | 156K | |
| intricacies.it | 1999-03-11 16:35 | 646K | |
| jessika.it | 1999-02-12 13:37 | 504K | |
| living score.it | 2005-02-06 14:20 | 2.7M | |
| memphis nights.it | 1998-11-30 19:30 | 350K | |
| merkal.it | 2005-02-06 14:20 | 289K | |
| modarchive theme com..> | 2005-02-06 14:22 | 431K | |
| my little trip.it | 2005-02-06 14:20 | 520K | |
| panda.it | 1999-02-12 13:47 | 390K | |
| passion.it | 1998-11-29 22:22 | 659K | |
| perceptions of reali..> | 2005-02-06 14:21 | 266K | |
| piano concerto in a-..> | 1999-04-22 22:31 | 298K | |
| piano concerto in c-..> | 2005-09-17 00:28 | 288K | |
| piano concerto in c-..> | 1999-02-12 15:50 | 230K | |
| piano concerto in g-..> | 1998-12-08 14:31 | 242K | |
| popcorn-azo mix.it | 1999-03-04 02:13 | 232K | |
| remix of mind.it | 2005-02-06 14:21 | 116K | |
| return to lothloria.it | 1999-05-03 23:49 | 763K | |
| seduction.it | 1998-11-29 22:17 | 504K | |
| september.it | 1998-11-29 22:23 | 173K | |
| serenegoh suite.it | 2005-03-04 20:57 | 808K | |
| slight of mind.it | 1998-11-30 19:31 | 126K | |
| sonata #8 (patetica).it | 1999-03-26 17:25 | 204K | |
| sonora.it | 1999-08-06 18:07 | 1.1M | |
| sorrow.it | 1999-03-28 05:54 | 404K | |
| stormy sunday.it | 2005-02-06 14:21 | 158K | |
| super patterns #1.it | 2005-02-06 14:21 | 226K | |
| telemundo!.it | 2005-02-06 14:21 | 113K | |
| the sans angel.it | 2005-02-06 14:21 | 277K | |
| thirteen.it | 1999-02-12 13:58 | 4.2M | |
| two sketches-lead & ..> | 1998-12-01 08:10 | 415K | |
| until the last.it | 2005-02-06 14:22 | 150K | |
| upon a time.it | 2005-02-06 14:22 | 249K | |
| welcome to the menu.it | 2005-02-06 14:22 | 299K | |
| when truth be told (..> | 2005-10-27 19:43 | 1.5M | |