![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| the temple of artemis.it | 1997-08-16 00:01 | 324K | |
| the prostitute principle.it | 1997-08-29 23:05 | 430K | |
| the istar gate.it | 1998-02-07 16:34 | 88K | |
| the electron groove.it | 1996-12-29 17:26 | 775K | |
| the divine comedy.it | 1998-02-07 15:56 | 160K | |
| the devil wears a dress.it | 2007-03-14 22:33 | 265K | |
| pyrrhic victory.it | 1997-07-20 11:58 | 422K | |
| necropolis.it | 2005-09-21 02:07 | 554K | |
| maussolos tomb.it | 1998-10-30 16:41 | 589K | |
| logic bank.it | 1998-04-11 18:30 | 149K | |
| husogenic drug.it | 1997-08-29 05:26 | 453K | |