![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| boss theme 1.it | 2007-03-06 22:30 | 2.0M | |
| bring it on!.it | 2010-03-21 12:27 | 592K | |
| final boss theme.it | 2007-03-06 22:30 | 4.5M | |
| howl like a wolf.it | 2010-03-21 12:28 | 112K | |
| i am a star in the sky.it | 2010-03-21 12:28 | 218K | |
| kungfufurby in fm.it | 2010-03-21 12:27 | 639K | |
| mcfilet'ofish for $1 menu.it | 2010-03-21 12:28 | 134K | |
| moody dub - really.it | 2010-03-21 12:29 | 30K | |
| mw bowser battle +.it | 2007-02-24 15:58 | 294K | |
| shoot the arrow, robin!.it | 2010-03-21 12:28 | 232K | |
| trashed boogie.it | 2010-03-21 12:28 | 210K | |