![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| summer asm'98 version.it | 2005-08-23 04:20 | 816K | |
| house of gremlins.it | 2019-08-31 19:48 | 704K | |
| hydroxide.it | 2019-08-31 19:48 | 601K | |
| megamix.it | 2019-08-31 19:48 | 600K | |
| truth.it | 2019-08-31 19:48 | 577K | |
| addict.it | 2019-08-31 19:48 | 531K | |
| alchemistry.it | 2019-08-31 19:48 | 512K | |
| without oxygen.it | 2019-08-31 19:48 | 488K | |
| trinity.it | 2019-08-31 19:48 | 483K | |
| absolute zer0.it | 2019-08-31 19:48 | 467K | |
| real world.it | 2019-08-31 19:48 | 465K | |
| compelitety.it | 2019-08-31 19:48 | 458K | |
| tranceman.it | 2019-08-31 19:48 | 456K | |
| interficall.it | 2019-08-31 19:48 | 448K | |
| electric wood.it | 2019-08-31 19:48 | 442K | |
| feelings of the pain.it | 2019-08-31 19:48 | 437K | |
| fix it soon !.it | 2019-08-31 19:48 | 434K | |
| chemical impulse.it | 2019-08-31 19:48 | 429K | |
| back to the realworld.it | 2019-08-31 19:48 | 410K | |
| electric feedback.it | 2019-08-31 19:48 | 381K | |
| acron.it | 2019-08-31 19:48 | 365K | |
| summer.it | 2019-08-31 19:48 | 361K | |
| cubic mind.it | 2019-08-31 19:48 | 356K | |
| stanton in da house unc.it | 2019-08-31 19:48 | 334K | |
| don't trust me.it | 2019-08-31 19:48 | 334K | |
| chaos in the dreamhouse.it | 2019-08-31 19:48 | 319K | |
| until the doom arrives.it | 2019-08-31 19:48 | 317K | |
| freedom.it | 2019-08-31 19:48 | 310K | |
| tracing.it | 2019-08-31 19:48 | 282K | |
| engates.it | 2019-08-31 19:48 | 270K | |
| anterphobic.it | 2019-08-31 19:48 | 253K | |
| party in the dreamhouse.it | 2019-08-31 19:48 | 208K | |
| noldinger.it | 2019-08-31 19:48 | 163K | |
| this is hell !.it | 2019-08-31 19:48 | 146K | |