![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| velvet wind.it | 2008-07-31 18:56 | 1.5M | |
| echoes of eden.it | 2008-07-31 18:56 | 1.4M | |
| timeless.it | 2008-07-31 18:56 | 1.2M | |
| the mighty steel (tr..> | 2007-11-19 19:31 | 1.0M | |
| wrong illusion of li..> | 2007-11-19 19:31 | 873K | |
| rave mania.it | 2023-02-25 09:31 | 801K | |
| kneel before your ki..> | 2007-08-11 19:37 | 732K | |
| gonna make ya move.it | 2007-11-19 19:31 | 719K | |
| no good (start the d..> | 2007-11-19 19:31 | 685K | |
| the blackness (part1..> | 2011-08-10 19:00 | 504K | |
| the mighty steel (in..> | 2007-11-19 19:31 | 494K | |
| sick shit!.it | 2007-11-19 19:30 | 461K | |
| sick shit! (retouche..> | 2007-11-19 19:30 | 418K | |
| happy hour.it | 2007-11-19 19:31 | 397K | |
| megahertz megamix.it | 2007-11-19 19:31 | 361K | |
| satisfaction (origin..> | 2007-11-19 19:31 | 319K | |
| everlasting love (da..> | 2007-11-19 19:31 | 299K | |
| satisfaction (harmon..> | 2007-11-19 19:31 | 294K | |
| funk that.it | 2007-11-19 19:31 | 287K | |
| sunrise (live).it | 2007-11-19 19:31 | 273K | |
| megawoam-bada.it | 2005-03-04 23:07 | 247K | |
| virtual spirit.it | 2007-11-19 19:31 | 232K | |
| theme from fort boya..> | 2018-01-04 15:09 | 215K | |
| lambada (euro edit).it | 2007-11-19 19:31 | 188K | |
| house of energy.it | 2007-11-19 19:31 | 174K | |
| total reflection.it | 2007-11-19 19:31 | 167K | |
| hellroad.it | 2007-11-19 19:31 | 126K | |
| coop-Salice/ | 2011-08-10 19:00 | - | |
| coop-Focus/ | 2007-03-03 19:48 | - | |