![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| antaquatica.it | 2005-08-23 22:25 | 1.8M | |
| cold reaction.it | 2005-08-23 22:25 | 881K | |
| astral skies.it | 2005-08-23 22:25 | 647K | |
| radio congo.it | 2004-09-13 20:53 | 636K | |
| delayed anticipation.it | 2009-11-13 16:53 | 542K | |
| the one i knew.it | 2005-08-23 22:25 | 534K | |
| the cassandra effect.it | 2005-08-23 22:25 | 512K | |
| nonlinear dynamics.it | 2005-08-23 22:25 | 485K | |
| purple is a fruit.it | 2005-08-23 22:25 | 143K | |
| mud.it | 2007-03-14 23:59 | 98K | |
| leaky radiator.it | 2007-03-14 23:59 | 88K | |
| mayhem in finland 2.it | 2007-03-14 23:59 | 70K | |
| riding the hurricane.it | 2007-03-15 00:00 | 63K | |