![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| additive synthesis.it | 2007-03-15 00:09 | 83K | |
| chill compo-64.it | 2005-02-04 02:11 | 71K | |
| crystallo drome.it | 2005-02-04 02:11 | 132K | |
| depassionation.it | 2005-02-04 02:11 | 137K | |
| mercury crystals.it | 2007-03-15 00:09 | 102K | |
| robbies birthday.it | 2007-03-15 00:09 | 135K | |
| the unknown land.it | 2005-09-04 04:18 | 838K | |
| woodlands of hulsten.it | 2005-09-04 04:18 | 910K | |
| x.i.n.it | 2007-08-01 13:18 | 273K | |