![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 30rpt10.it | 2004-09-13 20:55 | 194K | |
| a club in mars.it | 2004-09-13 20:55 | 1.4M | |
| a girl i used to kno..> | 2004-09-13 20:55 | 415K | |
| a man in the moon.it | 2003-05-03 20:52 | 747K | |
| artificial.it | 2004-09-13 20:55 | 859K | |
| black mind.it | 2004-09-13 20:55 | 611K | |
| blind tomorrow.it | 2004-09-13 20:55 | 672K | |
| brightest diamond.it | 2003-05-03 20:53 | 1.9M | |
| chemical feelings.it | 2004-09-13 20:55 | 1.6M | |
| chill me out.it | 2004-09-13 20:55 | 431K | |
| close to you.it | 2004-09-13 20:55 | 1.0M | |
| come into da jungle!..> | 2004-09-13 20:55 | 587K | |
| coop-Sonar/ | 2007-03-03 20:01 | - | |
| daft.it | 2004-09-13 20:55 | 301K | |
| dance of the fairies.it | 2003-05-03 20:54 | 844K | |
| dance with me.it | 2004-09-13 20:55 | 667K | |
| dark thoughts.it | 2003-05-03 20:55 | 1.3M | |
| distorted illusions.it | 2004-09-13 20:55 | 690K | |
| dp3-fast entry.it | 2002-04-05 23:06 | 198K | |
| easy funk.it | 2004-09-27 11:36 | 1.3M | |
| establishin' contact.it | 2004-09-13 20:55 | 574K | |
| experience.it | 2004-09-13 20:55 | 754K | |
| far.it | 2005-12-05 01:00 | 701K | |
| fill my cup.it | 2004-09-27 11:36 | 1.3M | |
| flight of an eagle.it | 2003-05-03 20:57 | 250K | |
| flowa.it | 2005-12-05 01:00 | 370K | |
| going on.it | 2005-12-05 01:00 | 254K | |
| i feel that freedom.it | 2003-05-03 20:58 | 2.3M | |
| imagine.it | 2004-09-13 20:55 | 522K | |
| improvise.it | 2004-09-13 20:55 | 914K | |
| jea.it | 2005-12-05 01:00 | 517K | |
| kadut kaupungin.it | 2005-12-05 01:00 | 311K | |
| keep funky.it | 2005-12-05 01:00 | 847K | |
| later man im groovin.it | 2005-12-05 01:00 | 1.3M | |
| let yourself go.it | 2004-09-13 20:55 | 308K | |
| live with an illusio..> | 2004-09-13 20:55 | 4.1M | |
| lost angel.it | 2003-05-03 20:59 | 1.1M | |
| lost paradise.it | 2004-09-13 20:55 | 1.3M | |
| message of love.it | 2004-09-13 20:56 | 1.1M | |
| midnight music.it | 2003-05-03 21:00 | 1.1M | |
| misterys of life.it | 2004-09-13 20:56 | 705K | |
| mr. a.n.log.it | 2005-12-05 01:00 | 411K | |
| my distant soul.it | 2004-07-22 16:13 | 1.3M | |
| nothing everlasting.it | 2004-09-13 20:56 | 780K | |
| nothing goes wrong.it | 2004-09-13 20:56 | 853K | |
| play it again.it | 2004-09-13 20:56 | 154K | |
| poisonous sound.it | 2004-09-13 20:56 | 207K | |
| pomp a gum.it | 2003-05-03 21:01 | 944K | |
| purplish nightfall.it | 2004-09-13 20:56 | 1.1M | |
| radio 2000.it | 2004-09-13 20:56 | 893K | |
| rip.it | 2004-09-13 20:56 | 532K | |
| scenic bits.it | 2005-09-21 22:29 | 472K | |
| seduction.it | 2004-09-13 20:56 | 1.4M | |
| smooth ride.it | 2004-09-27 11:36 | 687K | |
| so dark to see the m..> | 2003-05-03 21:02 | 644K | |
| space sat.it | 2003-05-03 21:03 | 1.3M | |
| spit the mike.it | 2004-09-13 20:56 | 1.4M | |
| spy.it | 2005-12-05 01:00 | 463K | |
| straight on.it | 2005-12-05 01:00 | 417K | |
| supaman jam.it | 2005-12-05 01:00 | 737K | |
| the essence of night..> | 2003-05-03 20:56 | 922K | |
| the misty lane.it | 2004-09-13 20:56 | 1.2M | |
| the seventh laborato..> | 2003-05-03 21:04 | 1.0M | |
| this could be art.it | 2004-09-13 20:56 | 464K | |
| three nights outside.it | 2004-09-13 20:56 | 1.6M | |
| tila 16.it | 2005-12-05 01:00 | 433K | |
| trapped in a cage.it | 2003-05-03 21:05 | 916K | |
| trip to the outer wo..> | 2004-09-13 20:56 | 1.2M | |
| trying to be better.it | 2004-09-13 20:56 | 2.2M | |
| turn me up.it | 2003-05-03 21:06 | 1.2M | |
| want you.it | 2004-09-13 20:56 | 2.3M | |
| wathing life passing..> | 2004-09-13 20:56 | 31K | |
| went too soon.it | 2004-09-13 20:56 | 1.1M | |
| when confused.it | 2004-09-13 20:56 | 1.7M | |
| white whispers.it | 2004-09-13 20:56 | 1.0M | |
| you wanna battle me.it | 2004-09-13 20:56 | 1.4M | |