![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 - opening.spc | 2007-01-07 00:01 | 65K | |
| 02 - the first villa..> | 2007-01-07 00:01 | 65K | |
| 03 - villagers.spc | 2007-01-07 00:01 | 65K | |
| 04 - cave.spc | 2007-01-07 00:01 | 65K | |
| 05 - dialogues.spc | 2007-01-07 00:01 | 65K | |
| 06 - status.spc | 2007-01-07 00:01 | 65K | |
| 07 - battle.spc | 2007-01-07 00:01 | 65K | |
| 08 - boss battle.spc | 2007-01-07 00:01 | 65K | |
| 09 - disquieting atm..> | 2007-01-07 00:01 | 65K | |
| 10 - map.spc | 2007-01-07 00:01 | 65K | |
| 11 - hydra mountain.spc | 2007-01-07 00:01 | 65K | |
| 12 - thieves' den.spc | 2007-01-07 00:01 | 65K | |
| 13 - johannes city.spc | 2007-01-07 00:01 | 65K | |
| 14 - drug store.spc | 2007-01-07 00:01 | 65K | |
| 15 - magical doctor.spc | 2007-01-07 00:01 | 65K | |
| 16 - church.spc | 2007-01-07 00:01 | 65K | |
| 17 - figaro city.spc | 2007-01-07 00:01 | 65K | |
| 18 - downward to the..> | 2007-01-07 00:01 | 65K | |
| 19 - atlus city.spc | 2007-01-07 00:01 | 65K | |
| 20 - sorcery church.spc | 2007-01-07 00:01 | 65K | |
| 21 - vaile castle.spc | 2007-01-07 00:01 | 65K | |
| 22 - crimson town.spc | 2007-01-07 00:01 | 65K | |
| 23 - devastated atlu..> | 2007-01-07 00:01 | 65K | |
| 24 - tales city.spc | 2007-01-07 00:01 | 65K | |
| 25 - mayela village.spc | 2007-01-07 00:01 | 65K | |
| 26 - malene village.spc | 2007-01-07 00:01 | 65K | |
| 27 - labinero villag..> | 2007-01-07 00:01 | 65K | |
| 28 - sigmun city.spc | 2007-01-07 00:01 | 65K | |
| 29 - seirun city.spc | 2007-01-07 00:01 | 65K | |
| 30 - seirun castle.spc | 2007-01-07 00:01 | 65K | |
| 31 - peace of mind.spc | 2007-01-07 00:01 | 65K | |
| 32 - okus village.spc | 2007-01-07 00:01 | 65K | |
| 33 - tairer city.spc | 2007-01-07 00:01 | 65K | |
| 34 - figaro castle.spc | 2007-01-07 00:01 | 65K | |
| 35 - sairag the doom..> | 2007-01-07 00:01 | 65K | |
| 36 - battle with zer..> | 2007-01-07 00:01 | 65K | |
| 37 - the first endin..> | 2007-01-07 00:01 | 65K | |
| 38 - peterus village..> | 2007-01-07 00:01 | 65K | |
| 39 - battle with ray..> | 2007-01-07 00:01 | 65K | |
| 40 - the second endi..> | 2007-01-07 00:01 | 65K | |
| ally joins.spc | 2007-01-07 00:01 | 65K | |
| farewell to an ally.spc | 2007-01-07 00:01 | 65K | |
| item.spc | 2007-01-07 00:01 | 65K | |
| new maps.spc | 2007-01-07 00:01 | 65K | |
| sleep.spc | 2007-01-07 00:01 | 65K | |
| victory.spc | 2007-01-07 00:01 | 65K | |