Index of /pub/modules/Nintendo SPC/Akio Ohmori/Earthbound
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | a bad dream.spc | 2008-09-02 16:47 | 65K | |
| a flash of memory.spc | 2008-09-02 16:47 | 65K | |
| a good buddy.spc | 2008-09-02 16:47 | 65K | |
| a good night's rest.spc | 2008-09-02 16:47 | 65K | |
| alien invasion 1.spc | 2008-09-02 16:47 | 65K | |
| alien invasion 2.spc | 2008-09-02 16:47 | 65K | |
| ambush!.spc | 2008-09-02 16:47 | 65K | |
| apple kid's theme.spc | 2008-09-02 16:47 | 65K | |
| bad morning to you.spc | 2008-09-02 16:47 | 65K | |
| battle against a mac..> | 2008-09-02 16:47 | 65K | |
| battle against a mob..> | 2008-09-02 16:47 | 65K | |
| battle against an un..> | 2008-09-02 16:47 | 65K | |
| battle against a wea..> | 2008-09-02 16:47 | 65K | |
| battle against a wei..> | 2008-09-02 16:47 | 65K | |
| battle against belch..> | 2008-09-02 16:47 | 65K | |
| bazaar.spc | 2008-09-02 16:47 | 65K | |
| because i love you.spc | 2008-09-02 16:47 | 65K | |
| bed and breakfast.spc | 2008-09-02 16:47 | 65K | |
| belch's factory.spc | 2008-09-02 16:47 | 65K | |
| boris' cocktail.spc | 2008-09-02 16:47 | 65K | |
| boy meets girl.spc | 2008-09-02 16:47 | 65K | |
| burp.spc | 2008-09-02 16:47 | 65K | |
| buy somethin' will y..> | 2008-09-02 16:47 | 65K | |
| buzz buzz's demise.spc | 2008-09-02 16:47 | 65K | |
| buzz buzz's prophecy..> | 2008-09-02 16:47 | 65K | |
| caverns of winters.spc | 2008-09-02 16:47 | 65K | |
| choose a file.spc | 2008-09-02 16:47 | 65K | |
| dangerous caves.spc | 2008-09-02 16:47 | 65K | |
| dead-end chaos theat..> | 2008-09-02 16:47 | 65K | |
| deeper into ness' su..> | 2008-09-02 16:47 | 65K | |
| dr. andonuts' lab.spc | 2008-09-02 16:47 | 65K | |
| drilling.spc | 2008-09-02 16:54 | 65K | |
| eight melodies.spc | 2008-09-02 16:47 | 65K | |
| enjoy your stay.spc | 2008-09-02 16:47 | 65K | |
| escargo express at y..> | 2008-09-02 16:47 | 65K | |
| evil mani mani statu..> | 2008-09-02 16:47 | 65K | |
| falling underground!..> | 2008-09-02 16:47 | 65K | |
| flowing water.spc | 2008-09-02 16:47 | 65K | |
| franky.spc | 2008-09-02 16:47 | 65K | |
| friendly neighbors.spc | 2008-09-02 16:47 | 65K | |
| get on the bus.spc | 2008-09-02 16:47 | 65K | |
| giygas' intimidation..> | 2008-09-02 16:47 | 65K | |
| giygas' intro.spc | 2008-09-02 16:47 | 65K | |
| giygas' lair.spc | 2008-09-02 16:47 | 65K | |
| giygas' static.spc | 2008-09-02 16:47 | 65K | |
| giygas disintegrates..> | 2008-09-02 16:47 | 65K | |
| giygas is fatally wo..> | 2008-09-02 16:47 | 65K | |
| giygas is wounded!.spc | 2008-09-02 16:47 | 65K | |
| giygas stirs.spc | 2008-09-02 16:47 | 65K | |
| going down!.spc | 2008-09-02 16:47 | 65K | |
| good friends, bad fr..> | 2008-09-02 16:47 | 65K | |
| happy-happy is blue.spc | 2008-09-02 16:47 | 65K | |
| heartless hotel.spc | 2008-09-02 16:47 | 65K | |
| hidden track.spc | 2008-09-02 16:47 | 65K | |
| hi hi hi.spc | 2008-09-02 16:47 | 65K | |
| home sweet home.spc | 2008-09-02 16:47 | 65K | |
| hospital.spc | 2008-09-02 16:47 | 65K | |
| in dalaam, there is ..> | 2008-09-02 16:47 | 65K | |
| inside the dungeon.spc | 2008-09-02 16:47 | 65K | |
| in winters, there is..> | 2008-09-02 16:47 | 65K | |
| key item fanfare.spc | 2008-09-02 16:47 | 65K | |
| kraken of the sea.spc | 2008-09-02 16:47 | 65K | |
| lava springs.spc | 2008-09-02 16:47 | 65K | |
| magic butterfly.spc | 2008-09-02 16:52 | 65K | |
| master of the stars.spc | 2008-09-02 16:52 | 65K | |
| mechanical tinkering..> | 2008-09-02 16:47 | 65K | |
| megaton walk.spc | 2008-09-02 16:47 | 65K | |
| moonside swing.spc | 2008-09-02 16:47 | 65K | |
| morning in the deser..> | 2008-09-02 16:47 | 65K | |
| mu training.spc | 2008-09-02 16:47 | 65K | |
| mysterious crash.spc | 2008-09-02 16:52 | 65K | |
| ness' bike.spc | 2008-09-02 16:47 | 65K | |
| ness awakens from th..> | 2008-09-02 16:47 | 65K | |
| now, let's go!.spc | 2008-09-02 16:47 | 65K | |
| ok 'ssuka.spc | 2008-09-02 16:47 | 65K | |
| oncoming boss.spc | 2008-09-02 16:47 | 65K | |
| oncoming foe.spc | 2008-09-02 16:47 | 65K | |
| one fateful night.spc | 2008-09-02 16:47 | 65K | |
| onett's arcade.spc | 2008-09-02 16:47 | 65K | |
| onett's trumpet play..> | 2008-09-02 16:47 | 65K | |
| onett buzz buzz 1.spc | 2008-09-02 16:47 | 65K | |
| onett buzz buzz 2.spc | 2008-09-02 16:47 | 65K | |
| onett buzz buzz 3.spc | 2008-09-02 16:47 | 65K | |
| onett night 1.spc | 2008-09-02 16:47 | 65K | |
| onett night 2.spc | 2008-09-02 16:47 | 65K | |
| onett night 3.spc | 2008-09-02 16:47 | 65K | |
| onett theme.spc | 2008-09-02 16:47 | 65K | |
| opening credits.spc | 2008-09-02 16:47 | 65K | |
| otherworldly foe.spc | 2008-09-02 16:47 | 65K | |
| paula's theme.spc | 2008-09-02 16:47 | 65K | |
| peaceful rest valley..> | 2008-09-02 16:47 | 65K | |
| phase distorter fail..> | 2008-09-02 16:47 | 65K | |
| phase distorter succ..> | 2008-09-02 16:51 | 65K | |
| phone.spc | 2008-09-02 16:47 | 65K | |
| pink cloud shrine.spc | 2008-09-02 16:47 | 65K | |
| pokey's house (buzz ..> | 2008-09-02 16:47 | 65K | |
| pokey's house.spc | 2008-09-02 16:47 | 65K | |
| pokey.spc | 2008-09-02 16:47 | 65K | |
| pokey means business..> | 2008-09-02 16:47 | 65K | |
| prayer for safety.spc | 2008-09-02 16:47 | 65K | |
| pyramid.spc | 2008-09-02 16:47 | 65K | |
| rough landing.spc | 2008-09-02 16:47 | 65K | |
| rude awakening.spc | 2008-09-02 16:47 | 65K | |
| runaway five's final..> | 2008-09-02 16:47 | 65K | |
| runaway five - the d..> | 2008-09-02 16:47 | 65K | |
| runaway five left th..> | 2008-09-02 16:47 | 65K | |
| runaway five on the ..> | 2008-09-02 16:47 | 65K | |
| runaway five to the ..> | 2008-09-02 16:47 | 65K | |
| sailing to scaraba.spc | 2008-09-02 16:47 | 65K | |
| sanctuary guardian's..> | 2008-09-02 16:47 | 65K | |
| sanctuary guardian.spc | 2008-09-02 16:47 | 65K | |
| saturn valley cavern..> | 2008-09-02 16:47 | 65K | |
| save the miners!.spc | 2008-09-02 16:47 | 65K | |
| sea of eden.spc | 2008-09-02 16:47 | 65K | |
| secret passage.spc | 2008-09-02 16:47 | 65K | |
| smiles and tears.spc | 2008-09-02 16:47 | 65K | |
| snowman.spc | 2008-09-02 16:47 | 65K | |
| someone's knocking a..> | 2008-09-02 16:47 | 65K | |
| sound stone - fire s..> | 2012-03-10 03:05 | 65K | |
| sound stone - fire s..> | 2008-09-02 16:47 | 65K | |
| sound stone - giant ..> | 2012-03-10 03:03 | 65K | |
| sound stone - giant ..> | 2008-09-02 16:47 | 65K | |
| sound stone - lillip..> | 2012-03-10 03:03 | 65K | |
| sound stone - lillip..> | 2008-09-02 16:47 | 65K | |
| sound stone - lumine..> | 2012-03-10 03:05 | 65K | |
| sound stone - lumine..> | 2008-09-02 16:47 | 65K | |
| sound stone - magnet..> | 2012-03-10 03:04 | 65K | |
| sound stone - magnet..> | 2008-09-02 16:47 | 65K | |
| sound stone - milky ..> | 2012-03-10 03:04 | 65K | |
| sound stone - milky ..> | 2008-09-02 16:47 | 65K | |
| sound stone - no sou..> | 2012-04-19 21:14 | 65K | |
| sound stone - no sou..> | 2008-09-02 16:47 | 65K | |
| sound stone - pink c..> | 2012-03-10 03:05 | 65K | |
| sound stone - pink c..> | 2008-09-02 16:47 | 65K | |
| sound stone - rainy ..> | 2012-03-10 03:04 | 65K | |
| sound stone - rainy ..> | 2008-09-02 16:47 | 65K | |
| spacetoneer.spc | 2008-09-02 16:47 | 65K | |
| spell learned.spc | 2008-09-02 16:47 | 65K | |
| spooky.spc | 2008-09-02 16:47 | 65K | |
| stonehenge base shut..> | 2008-09-02 16:47 | 65K | |
| summers, eternal tou..> | 2008-09-02 16:47 | 65K | |
| sunrise & onett them..> | 2008-09-02 16:47 | 65K | |
| super dry dance.spc | 2008-09-02 16:47 | 65K | |
| teleportation.spc | 2008-09-02 16:47 | 65K | |
| teleportation end.spc | 2008-09-02 16:47 | 65K | |
| tessie!.spc | 2008-09-02 16:47 | 65K | |
| tessie has been sigh..> | 2008-09-02 16:47 | 65K | |
| that was easy!.spc | 2008-09-02 16:47 | 65K | |
| the cliff that time ..> | 2008-09-02 16:47 | 65K | |
| the deep darkness.spc | 2008-09-02 16:47 | 65K | |
| the evil giygas atta..> | 2008-09-02 16:47 | 65K | |
| the evil giygas atta..> | 2008-09-02 16:47 | 65K | |
| the floating kingdom..> | 2008-09-02 16:47 | 65K | |
| the heroes return (p..> | 2008-09-02 16:47 | 65K | |
| the heroes return (p..> | 2008-09-02 16:47 | 65K | |
| the jolly flying man..> | 2008-09-02 16:47 | 65K | |
| the lost underworld.spc | 2008-09-02 16:47 | 65K | |
| the metropolis of fo..> | 2008-09-02 16:47 | 65K | |
| the monkeys' maze.spc | 2008-09-02 16:47 | 65K | |
| the nightmare begins..> | 2008-09-02 16:47 | 65K | |
| the place.spc | 2008-09-02 16:47 | 65K | |
| the power.spc | 2008-09-02 16:47 | 65K | |
| the sky runner.spc | 2008-09-02 16:47 | 65K | |
| the sphinx's puzzle ..> | 2008-09-02 16:47 | 65K | |
| the sphinx's puzzle ..> | 2008-09-02 16:47 | 65K | |
| the sphinx's puzzle ..> | 2008-09-02 16:47 | 65K | |
| the sphinx's puzzle ..> | 2008-09-02 16:47 | 65K | |
| the sphinx's puzzle ..> | 2008-09-02 16:47 | 65K | |
| the sphinx's puzzle ..> | 2008-09-02 16:47 | 65K | |
| the submarine.spc | 2008-09-02 16:47 | 65K | |
| the tendas' cave.spc | 2008-09-02 16:47 | 65K | |
| the unforgiving dese..> | 2008-09-02 16:47 | 65K | |
| the voyage continues..> | 2008-09-02 16:47 | 65K | |
| threed, free at last..> | 2008-09-02 16:47 | 65K | |
| threed, zombie centr..> | 2008-09-02 16:47 | 65K | |
| title screen.spc | 2008-09-02 16:47 | 65K | |
| topolla theatre, hom..> | 2008-09-02 16:47 | 65K | |
| unidentified falling..> | 2008-09-02 16:47 | 65K | |
| unknown jingle 1.spc | 2008-09-02 16:51 | 65K | |
| unknown jingle 2.spc | 2008-09-02 16:52 | 65K | |
| unused pokey jingle.spc | 2008-09-02 16:51 | 65K | |
| venus live!.spc | 2008-09-02 16:47 | 65K | |
| welcome home.spc | 2008-09-02 16:47 | 65K | |
| welcome to your sanc..> | 2008-09-02 16:47 | 65K | |
| what a great picture..> | 2008-09-02 16:47 | 65K | |
| what an annoying kno..> | 2008-09-02 16:47 | 65K | |
| whoa!.spc | 2008-09-02 16:47 | 65K | |
| whoops!.spc | 2008-09-02 16:47 | 65K | |
| winters wake up call..> | 2008-09-02 16:47 | 65K | |
| winters white.spc | 2008-09-02 16:47 | 65K | |
| you've come far, nes..> | 2008-09-02 16:47 | 65K | |
| you've got a new fri..> | 2008-09-02 16:47 | 65K | |
| you defeated the bos..> | 2008-09-02 16:47 | 65K | |
| you gained a level!.spc | 2008-09-02 16:47 | 65K | |
| your name, please (n..> | 2008-09-02 16:47 | 65K | |
| your name, please.spc | 2008-09-02 16:47 | 65K | |
| your sanctuary - fir..> | 2008-09-02 16:47 | 65K | |
| your sanctuary - gia..> | 2008-09-02 16:47 | 65K | |
| your sanctuary - lil..> | 2008-09-02 16:47 | 65K | |
| your sanctuary - lum..> | 2008-09-02 16:47 | 65K | |
| your sanctuary - mag..> | 2008-09-02 16:47 | 65K | |
| your sanctuary - mil..> | 2008-09-02 16:47 | 65K | |
| your sanctuary - pin..> | 2008-09-02 16:47 | 65K | |
| your sanctuary - rai..> | 2008-09-02 16:47 | 65K | |
| you win!.spc | 2008-09-02 16:47 | 65K | |
| zombie paper.spc | 2008-09-02 16:47 | 65K | |
|
|---|