![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 - capcom.spc | 2006-11-04 21:25 | 65K | |
| 03 - map.spc | 2006-11-04 21:25 | 65K | |
| 17 - level finished.spc | 2006-11-04 21:25 | 65K | |
| 18 - arthur bites th..> | 2006-11-04 21:25 | 65K | |
| 19 - game over.spc | 2006-11-04 21:25 | 65K | |
| 22 - ending 2.spc | 2006-11-04 21:25 | 65K | |
| select fanfare.spc | 2006-11-04 21:25 | 65K | |
| 02 - princess got ki..> | 2006-11-04 21:25 | 65K | |
| 04 - haunted graveya..> | 2006-11-04 21:25 | 65K | |
| 05 - cockatrice.spc | 2006-11-04 21:25 | 65K | |
| 06 - sea of despair.spc | 2006-11-04 21:25 | 65K | |
| 07 - giant barnacle.spc | 2006-11-04 21:25 | 65K | |
| 08 - crucible of fla..> | 2006-11-04 21:25 | 65K | |
| 10 - ghouls' stomach..> | 2006-11-04 21:25 | 65K | |
| 11 - hydra.spc | 2006-11-04 21:25 | 65K | |
| 12 - ice forest.spc | 2006-11-04 21:25 | 65K | |
| 13 - freon.spc | 2006-11-04 21:25 | 65K | |
| 14 - castle of the e..> | 2006-11-04 21:25 | 65K | |
| 15 - asutaroto and n..> | 2006-11-04 21:25 | 65K | |
| 16 - sardius.spc | 2006-11-04 21:25 | 65K | |
| 20 - continue.spc | 2006-11-04 21:25 | 65K | |
| 21 - ending 1.spc | 2006-11-04 21:25 | 65K | |
| 09 - mongolian death..> | 2006-11-04 21:25 | 65K | |