![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 - jaleco logo.spc | 2005-09-24 17:00 | 65K | |
| 02 - explosion.spc | 2005-09-24 17:00 | 65K | |
| 03 - ready to save l..> | 2005-09-24 17:00 | 65K | |
| 04 - burning buildin..> | 2005-09-24 17:00 | 65K | |
| 05 - toxic mine shaf..> | 2005-09-24 17:00 | 65K | |
| 06 - fire at the mus..> | 2005-09-24 17:00 | 65K | |
| 07 - chemical blaze.spc | 2005-09-24 17:00 | 65K | |
| 08 - get ready!.spc | 2005-09-24 17:00 | 65K | |
| 09 - urgent message!..> | 2005-09-24 17:00 | 65K | |
| 10 - get out now!.spc | 2005-09-24 17:00 | 65K | |
| 11 - one minute left..> | 2005-09-24 17:00 | 65K | |
| 12 - nikos - new rec..> | 2005-09-24 17:00 | 65K | |
| 13 - news of jay's d..> | 2005-09-24 17:00 | 65K | |
| 14 - heroic rambling..> | 2005-09-24 17:00 | 65K | |
| electricity.spc | 2005-09-24 17:00 | 65K | |
| grateful crowd.spc | 2005-09-24 17:00 | 65K | |
| level up!.spc | 2005-09-24 17:00 | 65K | |
| metal and sparks.spc | 2005-09-24 17:00 | 65K | |
| thank you!.spc | 2005-09-24 17:00 | 65K | |
| whoops.spc | 2005-09-24 17:00 | 65K | |