![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1-[x]-0.nsf | 2006-10-07 04:29 | 32K | |
| absolution.nsf | 2006-10-21 00:11 | 32K | |
| action hero select.nsf | 2007-09-05 00:20 | 24K | |
| aerial assault.nsf | 2006-07-16 16:25 | 24K | |
| afraid of darkness.nsf | 2005-12-03 20:56 | 24K | |
| against overwhelming..> | 2005-12-03 20:56 | 32K | |
| alkali earth.nsf | 2007-09-05 00:20 | 29K | |
| almost there.nsf | 2006-07-16 16:56 | 24K | |
| apocalypse please.nsf | 2007-01-19 02:01 | 32K | |
| battle with the betr..> | 2005-12-03 20:56 | 24K | |
| beatbraked.nsf | 2007-09-05 00:20 | 32K | |
| biologic spearmint.nsf | 2007-09-04 04:17 | 32K | |
| bloody hell.nsf | 2007-03-16 23:41 | 24K | |
| boss.nsf | 2007-01-19 02:01 | 24K | |
| boss select.nsf | 2007-01-19 02:01 | 24K | |
| boss selected.nsf | 2007-01-19 02:01 | 24K | |
| chrono trigger - man..> | 2007-11-25 23:45 | 8.0K | |
| classical mushroom.nsf | 2005-12-03 20:45 | 32K | |
| classical mushroom u..> | 2005-12-03 20:45 | 88K | |
| computer.nsf | 2007-09-04 04:17 | 24K | |
| conflict of interest..> | 2007-09-04 04:17 | 24K | |
| coop-Kwix/ | 2007-11-25 23:50 | - | |
| cq boss.nsf | 2007-01-19 02:01 | 24K | |
| cq boss konami mix.nsf | 2005-12-03 20:45 | 24K | |
| cruzzazzay.nsf | 2007-01-19 02:01 | 24K | |
| dark waters.nsf | 2006-08-13 23:38 | 8.0K | |
| deep space dance.nsf | 2005-12-03 20:45 | 32K | |
| dementia.nsf | 2005-12-03 20:56 | 24K | |
| desert war.nsf | 2005-12-03 20:45 | 32K | |
| drift.nsf | 2007-01-19 02:01 | 24K | |
| ducktales - trancelv..> | 2006-08-13 23:38 | 32K | |
| ecco the dolphin 2 -..> | 2007-11-25 23:46 | 32K | |
| effect.nsf | 2007-09-04 04:17 | 20K | |
| ekans desert.nsf | 2005-12-03 20:45 | 24K | |
| exam cram.nsf | 2005-12-03 20:56 | 32K | |
| eye of the predator.nsf | 2007-01-19 02:01 | 32K | |
| f-zero - big blue.nsf | 2006-10-07 04:36 | 8.0K | |
| fast break.nsf | 2006-08-13 23:38 | 24K | |
| final boss theme (ex..> | 2007-01-19 02:01 | 24K | |
| final fantasy - prel..> | 2005-12-03 20:45 | 24K | |
| fx1.nsf | 2006-07-16 16:25 | 24K | |
| giant monster city l..> | 2007-09-05 00:20 | 32K | |
| grim determination.nsf | 2007-01-19 02:01 | 32K | |
| haunted dance.nsf | 2005-12-03 20:56 | 16K | |
| hawkeye - eye of the..> | 2007-11-25 23:47 | 32K | |
| home bay.nsf | 2007-01-19 02:01 | 32K | |
| infected mushroom - ..> | 2007-01-19 02:01 | 24K | |
| infected mushroom - ..> | 2005-12-03 20:45 | 24K | |
| inspirational doorkn..> | 2007-09-05 00:20 | 24K | |
| insurrection.nsf | 2005-12-03 20:56 | 24K | |
| into wilys fortress.nsf | 2007-09-04 04:17 | 32K | |
| jag minns inte - rem..> | 2005-12-03 20:45 | 24K | |
| jag minns inte.nsf | 2007-01-19 02:01 | 24K | |
| konami's moon base.nsf | 2006-01-06 18:26 | 32K | |
| konamized.nsf | 2007-01-19 02:01 | 32K | |
| luminosity and visco..> | 2007-01-19 02:01 | 32K | |
| manoria cathedral.nsf | 2007-01-19 02:01 | 8.0K | |
| marble zone.nsf | 2007-01-19 02:01 | 24K | |
| medusa - shattered g..> | 2007-01-19 02:01 | 32K | |
| metroid prime - choz..> | 2007-01-19 02:01 | 24K | |
| mm6 select.nsf | 2006-07-16 16:56 | 24K | |
| nebula.nsf | 2006-08-13 23:38 | 24K | |
| need for speed 2 - s..> | 2007-01-19 02:01 | 24K | |
| nocturnal wishes.nsf | 2007-01-19 02:01 | 32K | |
| noxious.nsf | 2006-08-13 23:38 | 24K | |
| nut harvesters.nsf | 2007-09-19 02:26 | 24K | |
| one man and his droi..> | 2005-12-03 20:45 | 8.0K | |
| out of reach.nsf | 2008-02-09 17:56 | 32K | |
| overdrive!.nsf | 2007-01-19 02:01 | 32K | |
| overdrive.nsf | 2005-12-03 20:56 | 32K | |
| premenition.nsf | 2005-12-03 20:56 | 32K | |
| premonition.nsf | 2007-01-19 02:01 | 32K | |
| quickman rave.nsf | 2007-01-19 02:01 | 24K | |
| rockit.nsf | 2007-03-16 23:41 | 32K | |
| sea of memories.nsf | 2005-12-03 20:56 | 24K | |
| secrets and lies.nsf | 2007-01-19 02:01 | 24K | |
| sega logo.nsf | 2007-01-19 02:01 | 24K | |
| shiftyworld.nsf | 2007-09-04 04:17 | 32K | |
| solfeggio in c minor..> | 2007-01-19 02:01 | 8.0K | |
| still afraid of dark..> | 2007-01-19 02:01 | 8.0K | |
| still afraid of dark..> | 2005-12-03 20:56 | 8.0K | |
| storm eagle redux.nsf | 2006-10-07 04:29 | 24K | |
| storytime.nsf | 2007-09-04 04:17 | 24K | |
| stratosphere.nsf | 2005-12-03 20:56 | 8.0K | |
| stup0nd0rzed.nsf | 2007-09-05 00:20 | 32K | |
| tax evasion.nsf | 2005-12-03 20:56 | 24K | |
| terra's lament.nsf | 2006-10-07 04:29 | 32K | |
| tetris - tetritechno..> | 2007-01-19 02:01 | 32K | |
| the battle continues..> | 2007-01-19 02:01 | 32K | |
| the final conflict.nsf | 2007-01-19 02:01 | 32K | |
| the hidden answer.nsf | 2007-03-16 23:41 | 32K | |
| the last level.nsf | 2006-07-16 16:25 | 24K | |
| the rush dance adapt..> | 2007-01-19 02:01 | 32K | |
| the society of nonco..> | 2007-01-19 02:01 | 32K | |
| the spy who shat on ..> | 2007-09-04 04:17 | 24K | |
| throw that weight ar..> | 2007-09-05 00:20 | 24K | |
| tits of terrorists.nsf | 2007-09-04 04:17 | 32K | |
| trancelvania.nsf | 2007-01-19 02:01 | 32K | |
| trancelvania 2.nsf | 2005-12-03 20:45 | 24K | |
| troubled dreams.nsf | 2007-01-19 02:01 | 32K | |
| turbo.nsf | 2006-10-07 04:29 | 32K | |
| uimother.nsf | 2007-03-16 23:41 | 32K | |
| unwilling antagonist..> | 2005-12-03 20:45 | 32K | |