![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 303 dream (final rmx..> | 2005-03-09 08:03 | 443K | |
| back into time.mmd3 | 2005-03-09 08:03 | 462K | |
| chemical go '98 mix...> | 2005-03-09 08:03 | 462K | |
| distortion attack.mmd3 | 2005-03-09 08:03 | 488K | |
| go insane [speed gar..> | 2005-03-09 08:03 | 276K | |
| greed (sythnie bass ..> | 2005-03-09 08:03 | 301K | |
| meldoic life [pure e..> | 2005-03-09 08:03 | 1.0M | |
| mindless-bom'in [b'n..> | 2005-03-09 08:03 | 700K | |
| noise of - incert ca..> | 2005-03-09 08:03 | 314K | |
| playing god.mmd3 | 2005-03-09 08:03 | 606K | |
| return of the bass-m..> | 2005-03-09 08:03 | 651K | |
| splow.mmd3 | 2005-03-09 08:03 | 138K | |
| spooky chill out.mmd3 | 2005-03-09 08:03 | 110K | |
| the air.mmd3 | 2005-03-09 08:03 | 614K | |
| work it.mmd3 | 2005-03-09 08:03 | 525K | |