![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | 5-mix.psid | 2014-02-07 22:56 | 4.2K | |
![[SND]](/icons/sound2.gif) | a-man.psid | 2004-09-13 21:09 | 4.1K | |
![[SND]](/icons/sound2.gif) | acid disco.psid | 2018-12-07 23:14 | 3.8K | |
![[SND]](/icons/sound2.gif) | acid feelin'.psid | 2010-02-25 00:38 | 3.5K | |
![[SND]](/icons/sound2.gif) | acidstyle.psid | 2014-02-07 22:56 | 3.9K | |
![[SND]](/icons/sound2.gif) | acieed beat.psid | 2010-02-25 00:38 | 3.0K | |
![[SND]](/icons/sound2.gif) | action intro 2.psid | 2007-03-27 13:05 | 4.0K | |
![[SND]](/icons/sound2.gif) | addiction.psid | 2007-01-23 01:45 | 5.1K | |
![[SND]](/icons/sound2.gif) | all we are.psid | 2010-02-25 00:38 | 3.6K | |
![[SND]](/icons/sound2.gif) | alpha ship.psid | 2014-02-07 22:56 | 5.2K | |
![[SND]](/icons/sound2.gif) | angel.psid | 2014-02-07 22:56 | 6.0K | |
![[SND]](/icons/sound2.gif) | area of low pressure.psid | 2007-01-23 01:45 | 5.6K | |
![[SND]](/icons/sound2.gif) | armylogo.psid | 2007-04-05 18:30 | 3.9K | |
![[SND]](/icons/sound2.gif) | based.psid | 2014-02-07 22:56 | 4.1K | |
![[SND]](/icons/sound2.gif) | bass-o-matikk.psid | 2006-12-03 18:09 | 5.9K | |
![[SND]](/icons/sound2.gif) | beat ball.psid | 2018-12-07 23:14 | 8.9K | |
![[SND]](/icons/sound2.gif) | beat dis.psid | 2014-02-07 22:56 | 4.1K | |
![[SND]](/icons/sound2.gif) | behaviour.psid | 2010-02-25 00:38 | 4.3K | |
![[SND]](/icons/sound2.gif) | bitmania zak.psid | 2010-02-25 00:38 | 3.7K | |
![[SND]](/icons/sound2.gif) | blue flame.psid | 2014-02-07 22:56 | 8.1K | |
![[SND]](/icons/sound2.gif) | blue moon.psid | 2009-11-15 18:54 | 3.9K | |
![[SND]](/icons/sound2.gif) | blue shadow.psid | 2010-02-25 00:38 | 3.8K | |
![[SND]](/icons/sound2.gif) | bond action.psid | 2010-02-25 00:38 | 3.2K | |
![[SND]](/icons/sound2.gif) | bond action 1993.psid | 2010-02-25 00:38 | 4.2K | |
![[SND]](/icons/sound2.gif) | born to love.psid | 2019-08-23 23:00 | 3.5K | |
![[SND]](/icons/sound2.gif) | break it up!.psid | 2010-02-25 00:38 | 4.4K | |
![[SND]](/icons/sound2.gif) | bryllyant.psid | 2019-08-23 23:00 | 3.4K | |
![[SND]](/icons/sound2.gif) | castle darkstone.psid | 2014-02-07 22:56 | 5.5K | |
![[SND]](/icons/sound2.gif) | chemical river.psid | 2007-07-30 04:08 | 3.3K | |
![[SND]](/icons/sound2.gif) | clockwise.psid | 2007-09-22 18:36 | 3.1K | |
![[SND]](/icons/sound2.gif) | cold vision.psid | 2018-12-05 14:35 | 3.2K | |
![[SND]](/icons/sound2.gif) | colour section.psid | 2010-02-25 00:38 | 3.5K | |
![[SND]](/icons/sound2.gif) | corruption 12.psid | 2009-11-15 18:54 | 3.2K | |
![[SND]](/icons/sound2.gif) | crazy mamba.psid | 2009-02-01 12:42 | 3.8K | |
![[SND]](/icons/sound2.gif) | cyberware.psid | 2010-02-25 00:38 | 4.5K | |
![[SND]](/icons/sound2.gif) | darkness in your eyes.psid | 2010-02-25 00:38 | 3.2K | |
![[SND]](/icons/sound2.gif) | daydream.psid | 2007-01-23 01:45 | 5.4K | |
![[SND]](/icons/sound2.gif) | dealing.psid | 2010-02-25 00:38 | 3.3K | |
![[SND]](/icons/sound2.gif) | death sentence.psid | 2010-02-25 00:38 | 6.0K | |
![[SND]](/icons/sound2.gif) | defender of the crown (remix).psid | 2014-02-07 22:56 | 5.3K | |
![[SND]](/icons/sound2.gif) | delta jam.psid | 2009-05-24 20:09 | 5.2K | |
![[SND]](/icons/sound2.gif) | disco factory.psid | 2014-02-07 22:56 | 4.3K | |
![[SND]](/icons/sound2.gif) | dream.psid | 2010-02-25 00:38 | 4.6K | |
![[SND]](/icons/sound2.gif) | dreamline b.o.psid | 2014-02-07 22:56 | 4.1K | |
![[SND]](/icons/sound2.gif) | drummer sound.psid | 2009-02-01 12:42 | 4.9K | |
![[SND]](/icons/sound2.gif) | dynamican.psid | 2018-12-07 23:14 | 3.7K | |
![[SND]](/icons/sound2.gif) | el sol.psid | 2018-12-05 14:35 | 3.3K | |
![[SND]](/icons/sound2.gif) | elysion.psid | 2009-02-01 12:42 | 8.6K | |
![[SND]](/icons/sound2.gif) | everest.psid | 2009-02-01 12:42 | 5.6K | |
![[SND]](/icons/sound2.gif) | final countdown.psid | 2010-02-25 00:38 | 11K | |
![[SND]](/icons/sound2.gif) | fire in the sky.psid | 2009-02-01 12:42 | 5.6K | |
![[SND]](/icons/sound2.gif) | flobber.psid | 2007-01-23 01:45 | 4.7K | |
![[SND]](/icons/sound2.gif) | flowerz.psid | 2007-01-23 01:45 | 4.5K | |
![[SND]](/icons/sound2.gif) | for away.psid | 2010-02-25 00:38 | 3.0K | |
![[SND]](/icons/sound2.gif) | foreign girl'09.psid | 2014-02-07 22:56 | 6.5K | |
![[SND]](/icons/sound2.gif) | foreign girl.psid | 2010-02-25 00:38 | 5.2K | |
![[SND]](/icons/sound2.gif) | forget sh it.psid | 2010-02-25 00:38 | 3.0K | |
![[SND]](/icons/sound2.gif) | forgotten ones.psid | 2014-02-07 22:56 | 3.0K | |
![[SND]](/icons/sound2.gif) | for sodom.psid | 2010-02-25 00:38 | 3.8K | |
![[SND]](/icons/sound2.gif) | frantic power.psid | 2010-02-25 00:38 | 3.2K | |
![[SND]](/icons/sound2.gif) | freedom.psid | 2010-02-25 00:38 | 4.4K | |
![[SND]](/icons/sound2.gif) | funny bunny.psid | 2010-02-25 00:38 | 3.0K | |
![[SND]](/icons/sound2.gif) | future composer 4-demo 07.psid | 2010-02-25 00:38 | 3.5K | |
![[SND]](/icons/sound2.gif) | game over + level.psid | 2019-08-23 23:00 | 4.2K | |
![[SND]](/icons/sound2.gif) | genesis.psid | 2009-02-01 12:42 | 6.5K | |
![[SND]](/icons/sound2.gif) | good times.psid | 2014-02-07 22:56 | 6.1K | |
![[SND]](/icons/sound2.gif) | got to soul.psid | 2010-02-25 00:38 | 3.9K | |
![[SND]](/icons/sound2.gif) | go up!.psid | 2014-02-07 22:56 | 5.2K | |
![[SND]](/icons/sound2.gif) | groove machine.psid | 2014-02-07 22:56 | 4.2K | |
![[SND]](/icons/sound2.gif) | gyronite.psid | 2014-02-07 22:56 | 3.4K | |
![[SND]](/icons/sound2.gif) | hack tonight.psid | 2010-02-25 00:38 | 3.5K | |
![[SND]](/icons/sound2.gif) | hardcore tekkno.psid | 2010-02-25 00:38 | 4.5K | |
![[SND]](/icons/sound2.gif) | harmonic river.psid | 2018-12-07 23:14 | 3.2K | |
![[SND]](/icons/sound2.gif) | heartache.psid | 2007-01-23 01:45 | 5.9K | |
![[SND]](/icons/sound2.gif) | heart and soul.psid | 2014-02-07 22:56 | 4.6K | |
![[SND]](/icons/sound2.gif) | heartbeat intro.psid | 2014-02-07 22:56 | 3.3K | |
![[SND]](/icons/sound2.gif) | help in front.psid | 2014-02-07 22:56 | 3.0K | |
![[SND]](/icons/sound2.gif) | hi-tek.psid | 2010-02-25 00:38 | 4.0K | |
![[SND]](/icons/sound2.gif) | honey baby!.psid | 2014-02-07 22:56 | 4.0K | |
![[SND]](/icons/sound2.gif) | honeycomb.psid | 2007-01-23 01:45 | 6.8K | |
![[SND]](/icons/sound2.gif) | hot meal.psid | 2007-01-23 01:45 | 4.9K | |
![[SND]](/icons/sound2.gif) | into the swatch.psid | 2014-02-07 22:56 | 3.4K | |
![[SND]](/icons/sound2.gif) | introtune moozp 3.psid | 2010-02-25 00:38 | 3.6K | |
![[SND]](/icons/sound2.gif) | just like a pill.psid | 2014-02-07 22:56 | 3.9K | |
![[SND]](/icons/sound2.gif) | labyrinth.psid | 2010-02-25 00:38 | 8.0K | |
![[SND]](/icons/sound2.gif) | lambada acid.psid | 2014-02-07 22:56 | 3.6K | |
![[SND]](/icons/sound2.gif) | last unicorn.psid | 2010-02-25 00:38 | 3.8K | |
![[SND]](/icons/sound2.gif) | lethal bombs.psid | 2014-02-07 22:56 | 10K | |
![[SND]](/icons/sound2.gif) | lonely.psid | 2009-02-01 12:42 | 5.1K | |
![[SND]](/icons/sound2.gif) | lord.psid | 2010-02-25 00:38 | 3.1K | |
![[SND]](/icons/sound2.gif) | lost in space.psid | 2014-02-07 22:56 | 6.9K | |
![[SND]](/icons/sound2.gif) | loveland.psid | 2009-05-24 20:09 | 6.2K | |
![[SND]](/icons/sound2.gif) | lozaz pay (tune 14).psid | 2014-02-07 22:56 | 4.0K | |
![[SND]](/icons/sound2.gif) | magic stream.psid | 2010-02-25 00:38 | 5.6K | |
![[SND]](/icons/sound2.gif) | medium.psid | 2014-02-07 22:56 | 5.7K | |
![[SND]](/icons/sound2.gif) | melody-guru.psid | 2010-02-25 00:38 | 3.9K | |
![[SND]](/icons/sound2.gif) | mindbreaker.psid | 2010-02-25 00:38 | 7.6K | |
![[SND]](/icons/sound2.gif) | modern talking.psid | 2009-02-01 12:42 | 11K | |
![[SND]](/icons/sound2.gif) | moonlight.psid | 2009-02-01 12:42 | 4.3K | |
![[SND]](/icons/sound2.gif) | muzic p.o.p.psid | 2010-02-25 00:38 | 3.4K | |
![[SND]](/icons/sound2.gif) | muzic rain.psid | 2014-02-07 22:56 | 3.8K | |
![[SND]](/icons/sound2.gif) | mysterious worlds (high score).psid | 2018-12-07 23:14 | 4.4K | |
![[SND]](/icons/sound2.gif) | mysterious worlds (level 2).psid | 2018-12-05 14:35 | 4.5K | |
![[SND]](/icons/sound2.gif) | mysterious worlds (level 3).psid | 2018-12-07 23:14 | 4.2K | |
![[SND]](/icons/sound2.gif) | mysterious worlds (preview).psid | 2018-12-05 14:35 | 4.2K | |
![[SND]](/icons/sound2.gif) | neizak.psid | 2010-02-25 00:38 | 4.1K | |
![[SND]](/icons/sound2.gif) | nitro #17 (tune 10).psid | 2014-02-07 22:56 | 4.3K | |
![[SND]](/icons/sound2.gif) | no cruel.psid | 2018-12-07 23:14 | 3.1K | |
![[SND]](/icons/sound2.gif) | ocean fever.psid | 2010-02-25 00:38 | 3.6K | |
![[SND]](/icons/sound2.gif) | old knight.psid | 2010-02-25 00:38 | 3.7K | |
![[SND]](/icons/sound2.gif) | oregon power.psid | 2014-02-07 22:56 | 3.8K | |
![[SND]](/icons/sound2.gif) | oxygen.psid | 2010-02-25 00:38 | 4.5K | |
![[SND]](/icons/sound2.gif) | paradize.psid | 2010-02-25 00:38 | 5.0K | |
![[SND]](/icons/sound2.gif) | pay my ice.psid | 2010-02-25 00:38 | 3.8K | |
![[SND]](/icons/sound2.gif) | phat frog.psid | 2014-02-07 22:56 | 10K | |
![[SND]](/icons/sound2.gif) | pinball dreams intro.psid | 2009-02-01 12:42 | 7.0K | |
![[SND]](/icons/sound2.gif) | pinball dreams menu.psid | 2009-02-01 12:42 | 5.7K | |
![[SND]](/icons/sound2.gif) | plexex du.psid | 2007-03-27 13:05 | 3.5K | |
![[SND]](/icons/sound2.gif) | proto special.psid | 2010-02-25 00:38 | 5.1K | |
![[SND]](/icons/sound2.gif) | reav de hero.psid | 2010-02-25 00:38 | 4.2K | |
![[SND]](/icons/sound2.gif) | red sunset.psid | 2010-02-25 00:38 | 4.8K | |
![[SND]](/icons/sound2.gif) | richard's birthday demo.psid | 2009-02-01 12:42 | 5.2K | |
![[SND]](/icons/sound2.gif) | road house.psid | 2010-02-25 00:38 | 3.8K | |
![[SND]](/icons/sound2.gif) | sad wave 2.psid | 2010-02-25 00:38 | 3.6K | |
![[SND]](/icons/sound2.gif) | saga-tune.psid | 2018-12-07 23:14 | 3.9K | |
![[SND]](/icons/sound2.gif) | samurai beat.psid | 2014-02-07 22:56 | 4.0K | |
![[SND]](/icons/sound2.gif) | sea of love.psid | 2014-02-07 22:56 | 3.5K | |
![[SND]](/icons/sound2.gif) | secret masterplan.psid | 2014-02-07 22:56 | 15K | |
![[SND]](/icons/sound2.gif) | seven flowers.psid | 2010-02-25 00:38 | 4.2K | |
![[SND]](/icons/sound2.gif) | shock.psid | 2010-02-25 00:38 | 3.1K | |
![[SND]](/icons/sound2.gif) | shuffle break.psid | 2014-02-07 22:56 | 4.3K | |
![[SND]](/icons/sound2.gif) | silent water.psid | 2009-02-01 12:42 | 15K | |
![[SND]](/icons/sound2.gif) | smooth evening (long version).psid | 2007-07-30 04:08 | 4.4K | |
![[SND]](/icons/sound2.gif) | smooth evening (short version).psid | 2007-07-30 04:08 | 3.8K | |
![[SND]](/icons/sound2.gif) | smoove groove.psid | 2014-02-07 22:56 | 6.1K | |
![[SND]](/icons/sound2.gif) | soccer zak.psid | 2018-12-05 14:35 | 4.0K | |
![[SND]](/icons/sound2.gif) | sommer unseres lebens.psid | 2007-07-30 04:08 | 5.5K | |
![[SND]](/icons/sound2.gif) | song of death.psid | 2010-02-25 00:38 | 5.0K | |
![[SND]](/icons/sound2.gif) | souvenir.psid | 2010-02-25 00:38 | 3.7K | |
![[SND]](/icons/sound2.gif) | space tiger (v2).psid | 2014-02-07 22:56 | 3.7K | |
![[SND]](/icons/sound2.gif) | space tiger.psid | 2014-02-07 22:56 | 4.6K | |
![[SND]](/icons/sound2.gif) | spherical.psid | 2010-02-25 00:38 | 3.7K | |
![[SND]](/icons/sound2.gif) | starshine.psid | 2009-02-01 12:42 | 3.7K | |
![[SND]](/icons/sound2.gif) | sunbeam.psid | 2014-02-07 22:56 | 5.4K | |
![[SND]](/icons/sound2.gif) | sunshine dreams.psid | 2009-11-15 18:54 | 7.6K | |
![[SND]](/icons/sound2.gif) | sweeper.psid | 2010-02-25 00:38 | 4.0K | |
![[SND]](/icons/sound2.gif) | sweetbox.psid | 2008-04-19 03:29 | 5.3K | |
![[SND]](/icons/sound2.gif) | take my breath away.psid | 2010-02-25 00:38 | 3.9K | |
![[SND]](/icons/sound2.gif) | tcd intro 1.psid | 2014-02-07 22:56 | 3.3K | |
![[SND]](/icons/sound2.gif) | tcd intro 2.psid | 2014-02-07 22:56 | 3.6K | |
![[SND]](/icons/sound2.gif) | tcd intro 3.psid | 2014-02-07 22:56 | 2.8K | |
![[SND]](/icons/sound2.gif) | the final countdown.psid | 2018-12-07 23:14 | 11K | |
![[SND]](/icons/sound2.gif) | the last unicorn.psid | 2004-09-13 21:09 | 3.8K | |
![[SND]](/icons/sound2.gif) | the lord.psid | 2004-09-13 21:09 | 3.1K | |
![[SND]](/icons/sound2.gif) | the power of magic.psid | 2009-02-01 12:42 | 11K | |
![[SND]](/icons/sound2.gif) | thriller.psid | 2014-02-07 22:56 | 3.8K | |
![[SND]](/icons/sound2.gif) | thrillin' killer.psid | 2018-12-07 23:14 | 4.4K | |
![[SND]](/icons/sound2.gif) | tiger.psid | 2010-02-25 00:38 | 3.7K | |
![[SND]](/icons/sound2.gif) | title bild airc.psid | 2010-02-25 00:38 | 3.8K | |
![[SND]](/icons/sound2.gif) | to be alone.psid | 2010-02-25 00:38 | 3.3K | |
![[SND]](/icons/sound2.gif) | track 'n sector 2.psid | 2010-02-25 00:38 | 4.9K | |
![[SND]](/icons/sound2.gif) | tragedy burp.psid | 2014-02-07 22:56 | 3.7K | |
![[SND]](/icons/sound2.gif) | tranquility.psid | 2007-01-23 01:45 | 5.1K | |
![[SND]](/icons/sound2.gif) | transfer ticket.psid | 2007-01-23 01:45 | 6.3K | |
![[SND]](/icons/sound2.gif) | tridot.psid | 2014-02-07 22:56 | 4.8K | |
![[SND]](/icons/sound2.gif) | vandalism news #46.psid | 2007-01-23 01:45 | 4.5K | |
![[SND]](/icons/sound2.gif) | waterman.psid | 2009-02-01 12:42 | 4.7K | |
![[SND]](/icons/sound2.gif) | we didn't start the fire.psid | 2014-02-07 22:56 | 3.4K | |
![[SND]](/icons/sound2.gif) | weet jij het.psid | 2010-02-25 00:38 | 3.9K | |
![[SND]](/icons/sound2.gif) | white christmas.psid | 2009-02-01 12:42 | 6.1K | |
![[SND]](/icons/sound2.gif) | white light.psid | 2007-01-23 01:45 | 5.4K | |
![[SND]](/icons/sound2.gif) | wonderland.psid | 2009-02-01 12:42 | 13K | |
![[SND]](/icons/sound2.gif) | world of confusion.psid | 2014-02-07 22:56 | 3.3K | |
![[SND]](/icons/sound2.gif) | wurlizer.psid | 2009-02-01 12:42 | 3.3K | |
![[SND]](/icons/sound2.gif) | x t c.psid | 2010-02-25 00:38 | 4.7K | |
![[SND]](/icons/sound2.gif) | zack (hi score).psid | 2018-12-05 14:35 | 3.1K | |
![[SND]](/icons/sound2.gif) | zack theme.psid | 2010-02-25 00:38 | 4.3K | |
|