![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | ''winter'' from the four seasons.psid | 2007-04-24 03:25 | 2.6K | |
![[SND]](/icons/sound2.gif) | a groovy night.psid | 2010-02-27 01:17 | 3.5K | |
![[SND]](/icons/sound2.gif) | ancient property.psid | 2010-02-27 01:17 | 6.5K | |
![[SND]](/icons/sound2.gif) | autumn beach.psid | 2010-02-27 01:17 | 9.0K | |
![[SND]](/icons/sound2.gif) | bach's domain.psid | 2019-08-23 22:55 | 4.1K | |
![[SND]](/icons/sound2.gif) | back to the future iii-title.psid | 2014-02-13 10:49 | 5.7K | |
![[SND]](/icons/sound2.gif) | back to the future iii.psid | 2010-02-27 01:17 | 5.7K | |
![[SND]](/icons/sound2.gif) | baroque parting (zero page).psid | 2007-01-28 03:49 | 1.9K | |
![[SND]](/icons/sound2.gif) | baroque parting.psid | 2010-02-27 01:17 | 2.6K | |
![[SND]](/icons/sound2.gif) | bass fever.psid | 2018-12-08 15:16 | 12K | |
![[SND]](/icons/sound2.gif) | chips in music.psid | 2014-02-13 10:49 | 3.2K | |
![[SND]](/icons/sound2.gif) | chords of endlessness.psid | 2014-02-13 10:49 | 8.6K | |
![[SND]](/icons/sound2.gif) | cool is fool!.psid | 2007-01-28 03:49 | 2.8K | |
![[SND]](/icons/sound2.gif) | dancing a-head.psid | 2010-02-27 01:17 | 3.6K | |
![[SND]](/icons/sound2.gif) | dream in space.psid | 2018-12-08 15:16 | 16K | |
![[SND]](/icons/sound2.gif) | eternal sadness.psid | 2010-02-27 01:17 | 6.3K | |
![[SND]](/icons/sound2.gif) | fur claudia.psid | 2018-12-08 15:16 | 12K | |
![[SND]](/icons/sound2.gif) | genetic jazz.psid | 2010-02-27 01:17 | 3.0K | |
![[SND]](/icons/sound2.gif) | hallucinations (preview).psid | 2009-05-24 20:49 | 3.6K | |
![[SND]](/icons/sound2.gif) | happy birthday.psid | 2010-02-27 01:17 | 2.4K | |
![[SND]](/icons/sound2.gif) | happy cadaver.psid | 2018-12-08 15:16 | 12K | |
![[SND]](/icons/sound2.gif) | henry (level 1).psid | 2007-01-28 03:49 | 3.5K | |
![[SND]](/icons/sound2.gif) | jingle from the ''lenor'' advert.psid | 2007-04-24 03:25 | 3.0K | |
![[SND]](/icons/sound2.gif) | laser beat.psid | 2018-12-08 15:16 | 12K | |
![[SND]](/icons/sound2.gif) | lax' up.psid | 2007-01-28 03:49 | 3.9K | |
![[SND]](/icons/sound2.gif) | load the power.psid | 2014-02-13 10:49 | 5.7K | |
![[SND]](/icons/sound2.gif) | lords of synthesis.psid | 2013-06-30 15:17 | 6.5K | |
![[SND]](/icons/sound2.gif) | mega put.psid | 2010-02-27 01:17 | 3.7K | |
![[SND]](/icons/sound2.gif) | melt your brain.psid | 2010-02-27 01:17 | 3.9K | |
![[SND]](/icons/sound2.gif) | mother's little arpeggio.psid | 2007-01-28 03:49 | 3.6K | |
![[SND]](/icons/sound2.gif) | nameless horror.psid | 2010-02-27 01:17 | 7.7K | |
![[SND]](/icons/sound2.gif) | odipus.psid | 2018-12-08 15:16 | 12K | |
![[SND]](/icons/sound2.gif) | peaceful beauty.psid | 2010-02-27 01:17 | 3.7K | |
![[SND]](/icons/sound2.gif) | pocket funk.psid | 2010-02-27 01:17 | 2.6K | |
![[SND]](/icons/sound2.gif) | raped sid.psid | 2010-02-27 01:17 | 3.9K | |
![[SND]](/icons/sound2.gif) | rhythm of life.psid | 2018-12-08 15:16 | 12K | |
![[SND]](/icons/sound2.gif) | rock around the block.psid | 2018-12-08 15:16 | 12K | |
![[SND]](/icons/sound2.gif) | session tune.psid | 2010-02-27 01:17 | 7.2K | |
![[SND]](/icons/sound2.gif) | some genetic jazz.psid | 2018-12-09 20:20 | 3.0K | |
![[SND]](/icons/sound2.gif) | sonlasarka dunti.psid | 2010-02-27 01:17 | 6.9K | |
![[SND]](/icons/sound2.gif) | the cowboy song #2.psid | 2007-01-28 03:49 | 11K | |
![[SND]](/icons/sound2.gif) | the lunatic trashcan.psid | 2007-01-28 03:49 | 6.7K | |
![[SND]](/icons/sound2.gif) | the musical news.psid | 2007-01-28 03:49 | 8.1K | |
![[SND]](/icons/sound2.gif) | the rumour land.psid | 2007-01-28 03:49 | 3.9K | |
![[SND]](/icons/sound2.gif) | the underground-rock.psid | 2007-01-28 03:49 | 3.4K | |
![[SND]](/icons/sound2.gif) | the vagabonds groove.psid | 2007-01-28 03:49 | 3.5K | |
![[SND]](/icons/sound2.gif) | trance introzak.psid | 2010-02-27 01:17 | 3.2K | |
![[SND]](/icons/sound2.gif) | uranium dioxide.psid | 2010-02-27 01:17 | 4.1K | |
![[SND]](/icons/sound2.gif) | vag.psid | 2019-08-23 22:55 | 3.3K | |
![[SND]](/icons/sound2.gif) | wind of change.psid | 2010-02-27 01:17 | 3.1K | |
|