![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | x-files.psid | 2014-02-15 12:23 | 2.5K | |
| wspaniala zabawa.psid | 2018-12-13 10:06 | 11K | |
| wheel of evolution.psid | 2007-01-25 01:39 | 3.6K | |
| volcanoes of passion.psid | 2008-04-19 05:48 | 4.2K | |
| the party.psid | 2018-12-13 10:06 | 3.3K | |
| tan-go-go.psid | 2007-01-25 01:39 | 3.5K | |
| super mario bros.psid | 2005-09-03 05:52 | 14K | |
| super frog spooky castle.psid | 2007-01-25 01:39 | 3.6K | |
| super frog space level.psid | 2014-02-15 12:23 | 4.0K | |
| super frog ice world.psid | 2014-02-15 12:23 | 4.5K | |
| super frog fun park.psid | 2007-07-30 04:53 | 3.5K | |
| super frog ancient level.psid | 2014-02-15 12:23 | 3.5K | |
| super frog.psid | 2004-09-13 21:14 | 4.1K | |
| starshine sounds.psid | 2004-09-13 21:14 | 3.8K | |
| srazzler.psid | 2018-12-13 10:06 | 3.7K | |
| spiral of arpeggioes.psid | 2006-12-03 18:21 | 3.1K | |
| sometthing.psid | 2007-07-30 04:53 | 2.6K | |
| slowly.psid | 2004-09-13 21:14 | 6.5K | |
| rock'n'role.psid | 2007-04-28 05:38 | 3.6K | |
| really old school.psid | 2004-09-13 21:14 | 8.3K | |
| radio maryja.psid | 2018-12-13 10:06 | 2.5K | |
| pole powierzchni walca.psid | 2018-12-13 10:06 | 3.1K | |
| pokey wcale nie falszuje.psid | 2007-01-25 01:39 | 3.2K | |
| plansza smierci.psid | 2018-12-13 10:06 | 11K | |
| one channel tune.psid | 2007-01-25 01:39 | 3.5K | |
| odlot.psid | 2018-12-13 10:06 | 11K | |
| my telephone.psid | 2005-09-03 05:52 | 5.3K | |
| muzik roulette.psid | 2007-01-25 01:39 | 3.4K | |
| mr pivo.psid | 2004-09-13 21:14 | 3.7K | |
| mr. pivo.psid | 2018-12-13 17:41 | 3.7K | |
| mountain morning.psid | 2007-01-25 01:39 | 3.3K | |
| mission aborted.psid | 2014-02-15 12:23 | 2.8K | |
| midday reactance.psid | 2018-12-13 10:06 | 3.0K | |
| last summer.psid | 2004-09-13 21:14 | 7.0K | |
| krakow.psid | 2007-01-25 01:39 | 3.0K | |
| isnt it simple.psid | 2004-09-13 21:14 | 4.2K | |
| isn't it simple.psid | 2007-04-28 05:38 | 3.9K | |
| heavy weight pop.psid | 2007-01-25 01:39 | 4.2K | |
| goodbye friend.psid | 2005-09-03 05:52 | 3.5K | |
| funny bee.psid | 2014-02-15 12:23 | 3.6K | |
| frog magic woods.psid | 2018-12-13 17:41 | 3.8K | |
| frog magic wood.psid | 2005-09-03 05:52 | 3.8K | |
| forgotten 80s.psid | 2004-09-13 21:14 | 3.6K | |
| forever.psid | 2005-09-03 05:52 | 7.3K | |
| falling star.psid | 2014-02-15 12:23 | 3.1K | |
| eurodance.psid | 2018-12-13 10:05 | 3.8K | |
| eternal 64.psid | 2004-09-13 21:14 | 3.6K | |
| end.psid | 2004-09-13 21:14 | 4.2K | |
| electric cafe.psid | 2018-12-13 10:05 | 3.8K | |
| donowegomaga.psid | 2018-12-13 17:41 | 3.2K | |
| disko.psid | 2004-09-13 21:14 | 3.7K | |
| digital dreams.psid | 2018-12-13 17:41 | 3.4K | |
| crystal structure.psid | 2008-04-19 05:48 | 3.4K | |
![[DIR]](/icons/folder.gif) | coop-Jammer/ | 2014-02-20 03:45 | - | |
| constellation of dragon.psid | 2004-09-13 21:14 | 3.6K | |
| clock monitor.psid | 2018-12-13 10:05 | 3.2K | |
| cauldron variations.psid | 2014-02-15 12:23 | 3.7K | |
| cauldron.psid | 2018-12-13 10:05 | 11K | |
| boys.psid | 2018-12-13 10:05 | 4.3K | |
| bossah novah.psid | 2018-12-13 17:41 | 3.1K | |
| bandyta.psid | 2018-12-13 10:05 | 11K | |
| all the go.psid | 2007-01-25 01:39 | 4.5K | |
| all songs mix.psid | 2018-12-13 10:05 | 11K | |
| 2002.psid | 2005-09-03 05:52 | 7.6K | |
| 60s.psid | 2009-02-01 14:21 | 3.2K | |
| 4k vipers.psid | 2007-01-25 01:39 | 1.6K | |
|
|---|