![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | 100 hz.psid | 2005-09-03 06:00 | 3.4K | |
![[SND]](/icons/sound2.gif) | adventure.psid | 2005-09-03 06:00 | 3.5K | |
![[SND]](/icons/sound2.gif) | amelia.psid | 2005-09-03 06:00 | 4.4K | |
![[SND]](/icons/sound2.gif) | beatles mix.psid | 2005-09-03 06:00 | 4.1K | |
![[SND]](/icons/sound2.gif) | bog sie rodzi.psid | 2005-09-03 06:00 | 3.5K | |
![[SND]](/icons/sound2.gif) | cicha noc.psid | 2005-09-03 06:00 | 3.5K | |
![[SND]](/icons/sound2.gif) | gdy sliczna panna.psid | 2005-09-03 06:00 | 3.5K | |
![[SND]](/icons/sound2.gif) | goodbye shool.psid | 2005-09-03 06:00 | 3.7K | |
![[SND]](/icons/sound2.gif) | happy day.psid | 2005-09-03 06:00 | 3.3K | |
![[SND]](/icons/sound2.gif) | hey.psid | 2005-09-03 06:00 | 3.3K | |
![[SND]](/icons/sound2.gif) | i like techno.psid | 2005-09-03 06:00 | 3.7K | |
![[SND]](/icons/sound2.gif) | jezus malusienki.psid | 2005-09-03 06:00 | 3.8K | |
![[SND]](/icons/sound2.gif) | kochac to nie znaczy.psid | 2005-09-03 06:00 | 3.8K | |
![[SND]](/icons/sound2.gif) | kolorowe kredki.psid | 2005-09-03 06:00 | 4.0K | |
![[SND]](/icons/sound2.gif) | little boy.psid | 2005-09-03 06:00 | 3.1K | |
![[SND]](/icons/sound2.gif) | metamorfoza.psid | 2005-09-03 06:00 | 3.3K | |
![[SND]](/icons/sound2.gif) | min max.psid | 2005-09-03 06:00 | 3.9K | |
![[SND]](/icons/sound2.gif) | nuclear man.psid | 2005-09-03 06:00 | 4.0K | |
![[SND]](/icons/sound2.gif) | piersi.psid | 2005-09-03 06:00 | 3.5K | |
![[SND]](/icons/sound2.gif) | pirates sea.psid | 2005-09-03 06:00 | 4.1K | |
![[SND]](/icons/sound2.gif) | pojdzmy wszyscy.psid | 2005-09-03 06:00 | 3.5K | |
![[SND]](/icons/sound2.gif) | przybiezeli do betlejem.psid | 2005-09-03 06:00 | 3.5K | |
![[SND]](/icons/sound2.gif) | replay again 1.psid | 2005-09-03 06:00 | 3.3K | |
![[SND]](/icons/sound2.gif) | replay again 2.psid | 2005-09-03 06:00 | 3.5K | |
![[SND]](/icons/sound2.gif) | samael.psid | 2005-09-03 06:00 | 3.1K | |
![[SND]](/icons/sound2.gif) | slow techno.psid | 2005-09-03 06:00 | 3.7K | |
![[SND]](/icons/sound2.gif) | street fighter 1.psid | 2005-09-03 06:00 | 3.4K | |
![[SND]](/icons/sound2.gif) | street fighter 2.psid | 2005-09-03 06:00 | 3.3K | |
![[SND]](/icons/sound2.gif) | street fighter 112.psid | 2005-09-03 06:00 | 3.5K | |
![[SND]](/icons/sound2.gif) | surgeon 01.psid | 2005-09-03 06:00 | 2.2K | |
![[SND]](/icons/sound2.gif) | tree of one.psid | 2005-09-03 06:00 | 3.8K | |
![[SND]](/icons/sound2.gif) | war zone.psid | 2005-09-03 06:00 | 3.7K | |
![[SND]](/icons/sound2.gif) | wietnam.psid | 2005-09-03 06:00 | 4.1K | |
![[SND]](/icons/sound2.gif) | wszyscy pokutujemy.psid | 2005-09-03 06:00 | 3.1K | |
![[SND]](/icons/sound2.gif) | w zlobie lezy.psid | 2005-09-03 06:00 | 3.7K | |
![[SND]](/icons/sound2.gif) | zig zac.psid | 2005-09-03 06:00 | 3.4K | |
![[SND]](/icons/sound2.gif) | acid drinkers.psid | 2005-11-20 07:09 | 3.8K | |
![[SND]](/icons/sound2.gif) | blood analisys.psid | 2005-11-20 07:09 | 3.7K | |
![[SND]](/icons/sound2.gif) | closterkeller.psid | 2005-11-20 07:09 | 3.7K | |
![[SND]](/icons/sound2.gif) | fast loader zak.psid | 2005-11-20 07:09 | 3.3K | |
![[SND]](/icons/sound2.gif) | fatal cucumber.psid | 2005-11-20 07:09 | 3.5K | |
![[SND]](/icons/sound2.gif) | horror show.psid | 2005-11-20 07:09 | 3.9K | |
![[SND]](/icons/sound2.gif) | nirvana.psid | 2005-11-20 07:09 | 3.7K | |
![[SND]](/icons/sound2.gif) | psychical dramat.psid | 2005-11-20 07:09 | 3.7K | |
![[SND]](/icons/sound2.gif) | slam dunk.psid | 2005-11-20 07:09 | 3.8K | |
![[SND]](/icons/sound2.gif) | at 2 o'clock.psid | 2007-01-25 01:46 | 4.1K | |
![[SND]](/icons/sound2.gif) | fastload.psid | 2007-01-25 01:46 | 3.8K | |
![[SND]](/icons/sound2.gif) | illumination.psid | 2007-01-25 01:46 | 4.1K | |
![[SND]](/icons/sound2.gif) | fear - live'gorefest.psid | 2007-04-28 06:13 | 3.7K | |
![[SND]](/icons/sound2.gif) | please don't cry.psid | 2007-04-28 06:13 | 3.3K | |
![[SND]](/icons/sound2.gif) | nokia tune.psid | 2007-07-30 04:58 | 4.1K | |
![[SND]](/icons/sound2.gif) | extreme - part 2.psid | 2008-04-19 05:54 | 5.2K | |
![[SND]](/icons/sound2.gif) | ready.psid | 2008-04-19 05:54 | 5.3K | |
![[SND]](/icons/sound2.gif) | syntax error.psid | 2008-04-19 05:55 | 5.0K | |
![[SND]](/icons/sound2.gif) | xxx land.psid | 2008-04-19 05:55 | 4.5K | |
![[SND]](/icons/sound2.gif) | compo music 2.psid | 2009-02-01 14:29 | 5.0K | |
![[SND]](/icons/sound2.gif) | could you be loved.psid | 2009-02-01 14:29 | 4.1K | |
![[SND]](/icons/sound2.gif) | error.psid | 2009-02-01 14:29 | 4.5K | |
![[SND]](/icons/sound2.gif) | extreme - part 1.psid | 2009-02-01 14:29 | 5.0K | |
![[SND]](/icons/sound2.gif) | high twist.psid | 2009-02-01 14:29 | 5.1K | |
![[SND]](/icons/sound2.gif) | welcome santa.psid | 2009-05-24 21:14 | 5.0K | |
![[SND]](/icons/sound2.gif) | diabolique.psid | 2013-06-30 22:41 | 3.9K | |
![[SND]](/icons/sound2.gif) | in the night garden.psid | 2013-06-30 22:41 | 4.3K | |
![[SND]](/icons/sound2.gif) | mix pol.psid | 2013-06-30 22:41 | 4.8K | |
![[SND]](/icons/sound2.gif) | ona tanczy dla mnie.psid | 2013-06-30 22:41 | 4.8K | |
![[SND]](/icons/sound2.gif) | 0005.psid | 2014-02-11 16:13 | 3.4K | |
![[SND]](/icons/sound2.gif) | 3 min alone.psid | 2014-02-11 16:13 | 4.5K | |
![[SND]](/icons/sound2.gif) | 0104.psid | 2014-02-11 16:13 | 4.0K | |
![[SND]](/icons/sound2.gif) | 2010 ad.psid | 2014-02-11 16:13 | 4.7K | |
![[SND]](/icons/sound2.gif) | amarath piano.psid | 2014-02-11 16:13 | 4.2K | |
![[SND]](/icons/sound2.gif) | andrex.psid | 2014-02-11 16:13 | 4.4K | |
![[SND]](/icons/sound2.gif) | apocalypsa.psid | 2014-02-11 16:13 | 4.3K | |
![[SND]](/icons/sound2.gif) | awake.psid | 2014-02-11 16:13 | 4.4K | |
![[SND]](/icons/sound2.gif) | bad day.psid | 2014-02-11 16:13 | 4.2K | |
![[SND]](/icons/sound2.gif) | baroqe.psid | 2014-02-11 16:13 | 3.5K | |
![[SND]](/icons/sound2.gif) | between parts of demo.psid | 2014-02-11 16:13 | 3.3K | |
![[SND]](/icons/sound2.gif) | billy jean.psid | 2014-02-11 16:13 | 4.2K | |
![[SND]](/icons/sound2.gif) | bird's eye.psid | 2014-02-11 16:13 | 4.8K | |
![[SND]](/icons/sound2.gif) | black & white 2.psid | 2014-02-11 16:13 | 4.6K | |
![[SND]](/icons/sound2.gif) | brainkaszana.psid | 2014-02-11 16:13 | 4.9K | |
![[SND]](/icons/sound2.gif) | braintest.psid | 2014-02-11 16:13 | 3.7K | |
![[SND]](/icons/sound2.gif) | busface.psid | 2014-02-11 16:13 | 4.4K | |
![[SND]](/icons/sound2.gif) | cegla.psid | 2014-02-11 16:13 | 4.6K | |
![[SND]](/icons/sound2.gif) | central party.psid | 2014-02-11 16:13 | 5.0K | |
![[SND]](/icons/sound2.gif) | chaos bc.psid | 2014-02-11 16:13 | 5.3K | |
![[SND]](/icons/sound2.gif) | chlorine free.psid | 2014-02-11 16:13 | 4.2K | |
![[SND]](/icons/sound2.gif) | cosik.psid | 2014-02-11 16:13 | 4.5K | |
![[SND]](/icons/sound2.gif) | cow anus fucked.psid | 2014-02-11 16:13 | 5.0K | |
![[SND]](/icons/sound2.gif) | cow anus fucked 2sid.psid | 2014-02-11 16:13 | 13K | |
![[SND]](/icons/sound2.gif) | cyklon.psid | 2014-02-11 16:13 | 4.9K | |
![[SND]](/icons/sound2.gif) | damaged brain.psid | 2014-02-11 16:13 | 3.8K | |
![[SND]](/icons/sound2.gif) | deadly train.psid | 2014-02-11 16:13 | 4.8K | |
![[SND]](/icons/sound2.gif) | deathclaw.psid | 2014-02-11 16:13 | 5.1K | |
![[SND]](/icons/sound2.gif) | delirium.psid | 2014-02-11 16:13 | 4.3K | |
![[SND]](/icons/sound2.gif) | destination.psid | 2014-02-11 16:13 | 3.7K | |
![[SND]](/icons/sound2.gif) | drug me.psid | 2014-02-11 16:13 | 4.8K | |
![[SND]](/icons/sound2.gif) | dual mind.psid | 2014-02-11 16:13 | 4.9K | |
![[SND]](/icons/sound2.gif) | end of death.psid | 2014-02-11 16:13 | 3.4K | |
![[SND]](/icons/sound2.gif) | engine.psid | 2014-02-11 16:13 | 4.1K | |
![[SND]](/icons/sound2.gif) | error (2 speed).psid | 2014-02-11 16:13 | 4.5K | |
![[SND]](/icons/sound2.gif) | exit crew.psid | 2014-02-11 16:13 | 3.9K | |
![[SND]](/icons/sound2.gif) | fastloader 2.psid | 2014-02-11 16:13 | 4.5K | |
![[SND]](/icons/sound2.gif) | fatal sinus.psid | 2014-02-11 16:13 | 4.2K | |
![[SND]](/icons/sound2.gif) | filter fx.psid | 2014-02-11 16:13 | 4.9K | |
![[SND]](/icons/sound2.gif) | funny song.psid | 2014-02-11 16:13 | 4.7K | |
![[SND]](/icons/sound2.gif) | heavy phasor.psid | 2014-02-11 16:13 | 4.1K | |
![[SND]](/icons/sound2.gif) | history.psid | 2014-02-11 16:13 | 5.2K | |
![[SND]](/icons/sound2.gif) | i co ja robie tu.psid | 2014-02-11 16:13 | 3.9K | |
![[SND]](/icons/sound2.gif) | illness.psid | 2014-02-11 16:13 | 4.3K | |
![[SND]](/icons/sound2.gif) | inna amazing.psid | 2014-02-11 16:13 | 4.8K | |
![[SND]](/icons/sound2.gif) | innocence.psid | 2014-02-11 16:13 | 6.0K | |
![[SND]](/icons/sound2.gif) | intro.psid | 2014-02-11 16:13 | 4.4K | |
![[SND]](/icons/sound2.gif) | isotronic.psid | 2014-02-11 16:13 | 4.9K | |
![[SND]](/icons/sound2.gif) | lampa i sofa.psid | 2014-02-11 16:13 | 4.6K | |
![[SND]](/icons/sound2.gif) | loading 8.psid | 2014-02-11 16:13 | 3.6K | |
![[SND]](/icons/sound2.gif) | long time.psid | 2014-02-11 16:13 | 5.9K | |
![[SND]](/icons/sound2.gif) | loop 6.psid | 2014-02-11 16:13 | 4.3K | |
![[SND]](/icons/sound2.gif) | loop 7.psid | 2014-02-11 16:13 | 4.5K | |
![[SND]](/icons/sound2.gif) | loop 10.psid | 2014-02-11 16:13 | 3.6K | |
![[SND]](/icons/sound2.gif) | loops.psid | 2014-02-11 16:13 | 3.7K | |
![[SND]](/icons/sound2.gif) | mechanical warrior.psid | 2014-02-11 16:13 | 3.8K | |
![[SND]](/icons/sound2.gif) | mew face.psid | 2014-02-11 16:13 | 3.5K | |
![[SND]](/icons/sound2.gif) | monotone.psid | 2014-02-11 16:13 | 4.4K | |
![[SND]](/icons/sound2.gif) | moonspeel.psid | 2014-02-11 16:13 | 4.3K | |
![[SND]](/icons/sound2.gif) | mothafucka.psid | 2014-02-11 16:13 | 18K | |
![[SND]](/icons/sound2.gif) | mr. nothing.psid | 2014-02-11 16:13 | 4.5K | |
![[SND]](/icons/sound2.gif) | muthafucker.psid | 2014-02-11 16:13 | 4.4K | |
![[SND]](/icons/sound2.gif) | nasty track.psid | 2014-02-11 16:13 | 4.4K | |
![[SND]](/icons/sound2.gif) | newton market.psid | 2014-02-11 16:13 | 4.2K | |
![[SND]](/icons/sound2.gif) | no face.psid | 2014-02-11 16:13 | 4.4K | |
![[SND]](/icons/sound2.gif) | no idea.psid | 2014-02-11 16:13 | 5.0K | |
![[SND]](/icons/sound2.gif) | no name.psid | 2014-02-11 16:13 | 4.6K | |
![[SND]](/icons/sound2.gif) | nonsens.psid | 2014-02-11 16:13 | 4.6K | |
![[SND]](/icons/sound2.gif) | norfolk.psid | 2014-02-11 16:13 | 4.3K | |
![[SND]](/icons/sound2.gif) | odbyt tesciowej.psid | 2014-02-11 16:13 | 4.3K | |
![[SND]](/icons/sound2.gif) | one life.psid | 2014-02-11 16:13 | 4.3K | |
![[SND]](/icons/sound2.gif) | one pattern.psid | 2014-02-11 16:13 | 3.2K | |
![[SND]](/icons/sound2.gif) | optic gabinet.psid | 2014-02-11 16:13 | 4.5K | |
![[SND]](/icons/sound2.gif) | planetarium.psid | 2014-02-11 16:13 | 3.7K | |
![[SND]](/icons/sound2.gif) | please wait.psid | 2014-02-11 16:13 | 3.4K | |
![[SND]](/icons/sound2.gif) | poziomka.psid | 2014-02-11 16:13 | 4.2K | |
![[SND]](/icons/sound2.gif) | psycho.psid | 2014-02-11 16:13 | 4.5K | |
![[SND]](/icons/sound2.gif) | psycho trackmo.psid | 2014-02-11 16:13 | 4.7K | |
![[SND]](/icons/sound2.gif) | radiate.psid | 2014-02-11 16:13 | 4.3K | |
![[SND]](/icons/sound2.gif) | rain.psid | 2014-02-11 16:13 | 3.8K | |
![[SND]](/icons/sound2.gif) | ratty tunel.psid | 2014-02-11 16:13 | 3.8K | |
![[SND]](/icons/sound2.gif) | reggae me.psid | 2014-02-11 16:13 | 3.7K | |
![[SND]](/icons/sound2.gif) | revolution.psid | 2014-02-11 16:13 | 5.0K | |
![[SND]](/icons/sound2.gif) | rotation.psid | 2014-02-11 16:13 | 4.0K | |
![[SND]](/icons/sound2.gif) | ruchomot.psid | 2014-02-11 16:13 | 5.0K | |
![[SND]](/icons/sound2.gif) | ruchouomot.psid | 2014-02-11 16:13 | 4.8K | |
![[SND]](/icons/sound2.gif) | rycie beretu.psid | 2014-02-11 16:13 | 4.4K | |
![[SND]](/icons/sound2.gif) | shizzo.psid | 2014-02-11 16:13 | 3.5K | |
![[SND]](/icons/sound2.gif) | short track.psid | 2014-02-11 16:13 | 4.8K | |
![[SND]](/icons/sound2.gif) | sick imagination.psid | 2014-02-11 16:13 | 4.6K | |
![[SND]](/icons/sound2.gif) | silesia party.psid | 2014-02-11 16:13 | 3.8K | |
![[SND]](/icons/sound2.gif) | simple track.psid | 2014-02-11 16:13 | 4.8K | |
![[SND]](/icons/sound2.gif) | slide me.psid | 2014-02-11 16:13 | 4.7K | |
![[SND]](/icons/sound2.gif) | slow motion.psid | 2014-02-11 16:13 | 3.4K | |
![[SND]](/icons/sound2.gif) | small riff.psid | 2014-02-11 16:13 | 3.5K | |
![[SND]](/icons/sound2.gif) | small vulture.psid | 2014-02-11 16:13 | 4.4K | |
![[SND]](/icons/sound2.gif) | smoke on the water.psid | 2014-02-11 16:13 | 3.6K | |
![[SND]](/icons/sound2.gif) | so what.psid | 2014-02-11 16:13 | 4.8K | |
![[SND]](/icons/sound2.gif) | ssay suty.psid | 2014-02-11 16:13 | 4.9K | |
![[SND]](/icons/sound2.gif) | starmate.psid | 2014-02-11 16:13 | 4.9K | |
![[SND]](/icons/sound2.gif) | stay with me.psid | 2014-02-11 16:13 | 4.8K | |
![[SND]](/icons/sound2.gif) | strange beat.psid | 2014-02-11 16:13 | 3.8K | |
![[SND]](/icons/sound2.gif) | street fighter ii (1).psid | 2014-02-11 16:13 | 3.3K | |
![[SND]](/icons/sound2.gif) | street fighter ii (2).psid | 2014-02-11 16:13 | 3.5K | |
![[SND]](/icons/sound2.gif) | stupid music.psid | 2014-02-11 16:13 | 5.5K | |
![[SND]](/icons/sound2.gif) | sunday.psid | 2014-02-11 16:13 | 5.3K | |
![[SND]](/icons/sound2.gif) | that's the life.psid | 2014-02-11 16:13 | 4.3K | |
![[SND]](/icons/sound2.gif) | the end.psid | 2014-02-11 16:13 | 5.6K | |
![[SND]](/icons/sound2.gif) | the last.psid | 2014-02-11 16:13 | 4.4K | |
![[SND]](/icons/sound2.gif) | the stone.psid | 2014-02-11 16:13 | 4.4K | |
![[SND]](/icons/sound2.gif) | timetable.psid | 2014-02-11 16:13 | 4.9K | |
![[SND]](/icons/sound2.gif) | totalwar.psid | 2014-02-11 16:13 | 4.2K | |
![[SND]](/icons/sound2.gif) | toxic tonic.psid | 2014-02-11 16:13 | 5.6K | |
![[SND]](/icons/sound2.gif) | trance for you.psid | 2014-02-11 16:13 | 5.3K | |
![[SND]](/icons/sound2.gif) | transplantation.psid | 2014-02-11 16:13 | 4.6K | |
![[SND]](/icons/sound2.gif) | tribute to me.psid | 2014-02-11 16:13 | 5.2K | |
![[SND]](/icons/sound2.gif) | true story.psid | 2014-02-11 16:13 | 4.3K | |
![[SND]](/icons/sound2.gif) | try it on1x2x4-first 48 sec.psid | 2014-02-11 16:13 | 5.9K | |
![[SND]](/icons/sound2.gif) | two in one.psid | 2014-02-11 16:13 | 4.9K | |
![[SND]](/icons/sound2.gif) | twoja stara.psid | 2014-02-11 16:13 | 4.5K | |
![[SND]](/icons/sound2.gif) | ufo.psid | 2014-02-11 16:13 | 4.7K | |
![[SND]](/icons/sound2.gif) | unnormal track.psid | 2014-02-11 16:13 | 4.0K | |
![[SND]](/icons/sound2.gif) | unreal dream.psid | 2014-02-11 16:13 | 5.5K | |
![[SND]](/icons/sound2.gif) | vomiter.psid | 2014-02-11 16:13 | 4.6K | |
![[SND]](/icons/sound2.gif) | voyage voyage.psid | 2014-02-11 16:13 | 5.3K | |
![[SND]](/icons/sound2.gif) | yamashikoe.psid | 2014-02-11 16:13 | 4.4K | |
![[SND]](/icons/sound2.gif) | ye ba ny.psid | 2014-02-11 16:13 | 5.4K | |
![[SND]](/icons/sound2.gif) | you and your body.psid | 2014-02-11 16:13 | 3.7K | |
![[SND]](/icons/sound2.gif) | zacinanka.psid | 2014-02-11 16:13 | 3.2K | |
![[SND]](/icons/sound2.gif) | zium zium.psid | 2014-02-11 16:13 | 4.7K | |
![[SND]](/icons/sound2.gif) | adios winter.psid | 2018-12-08 15:23 | 3.4K | |
![[SND]](/icons/sound2.gif) | beverly hills cop.psid | 2018-12-08 15:23 | 3.2K | |
![[SND]](/icons/sound2.gif) | black & white.psid | 2018-12-08 15:23 | 3.5K | |
![[SND]](/icons/sound2.gif) | buzu squad.psid | 2018-12-08 15:23 | 3.8K | |
![[SND]](/icons/sound2.gif) | dead planets.psid | 2018-12-08 15:23 | 3.4K | |
![[SND]](/icons/sound2.gif) | edyta gorniak.psid | 2018-12-08 15:23 | 4.1K | |
![[SND]](/icons/sound2.gif) | go to future.psid | 2018-12-08 15:23 | 3.8K | |
![[SND]](/icons/sound2.gif) | hey list.psid | 2018-12-08 15:23 | 3.9K | |
![[SND]](/icons/sound2.gif) | improper world.psid | 2018-12-08 15:23 | 3.4K | |
![[SND]](/icons/sound2.gif) | killing gel.psid | 2018-12-08 15:23 | 3.4K | |
![[SND]](/icons/sound2.gif) | las vegas.psid | 2018-12-08 15:23 | 2.9K | |
![[SND]](/icons/sound2.gif) | night dreams.psid | 2018-12-08 15:23 | 3.8K | |
![[SND]](/icons/sound2.gif) | pentavras.psid | 2018-12-08 15:23 | 3.7K | |
![[SND]](/icons/sound2.gif) | second time.psid | 2018-12-08 15:23 | 4.9K | |
![[SND]](/icons/sound2.gif) | the secret book.psid | 2018-12-08 15:23 | 3.4K | |
![[SND]](/icons/sound2.gif) | tracktime.psid | 2018-12-08 15:23 | 4.1K | |
![[SND]](/icons/sound2.gif) | universal cop.psid | 2018-12-08 15:23 | 3.5K | |
![[SND]](/icons/sound2.gif) | wsrod nocnej ciszy.psid | 2018-12-08 15:23 | 3.9K | |
![[SND]](/icons/sound2.gif) | zic zac.psid | 2018-12-08 15:23 | 3.4K | |
![[SND]](/icons/sound2.gif) | bez ograniczen.psid | 2018-12-09 15:58 | 5.3K | |
![[SND]](/icons/sound2.gif) | crystalize.psid | 2018-12-09 15:58 | 4.0K | |
![[SND]](/icons/sound2.gif) | extreme tree.psid | 2018-12-09 15:58 | 6.0K | |
![[SND]](/icons/sound2.gif) | fisher tank.psid | 2018-12-09 15:58 | 5.1K | |
![[SND]](/icons/sound2.gif) | fix-mix.psid | 2018-12-09 15:58 | 3.8K | |
![[SND]](/icons/sound2.gif) | goat dick cheese.psid | 2018-12-09 15:58 | 4.8K | |
![[SND]](/icons/sound2.gif) | jebaka na stojaka.psid | 2018-12-09 15:58 | 5.3K | |
![[SND]](/icons/sound2.gif) | kochac cie za pozno.psid | 2018-12-09 15:58 | 4.6K | |
![[SND]](/icons/sound2.gif) | luka.psid | 2018-12-09 15:58 | 4.3K | |
![[SND]](/icons/sound2.gif) | meluzyna.psid | 2018-12-09 15:58 | 4.7K | |
![[SND]](/icons/sound2.gif) | memento more.psid | 2018-12-09 15:58 | 3.3K | |
![[SND]](/icons/sound2.gif) | nasze rendez vous.psid | 2018-12-09 15:58 | 5.2K | |
![[SND]](/icons/sound2.gif) | nothing to say.psid | 2018-12-09 15:58 | 5.1K | |
![[SND]](/icons/sound2.gif) | pokolenie.psid | 2018-12-09 15:58 | 5.4K | |
![[SND]](/icons/sound2.gif) | przybiezeli do betlejem....psid | 2018-12-09 15:58 | 3.5K | |
![[SND]](/icons/sound2.gif) | repeat baby.psid | 2018-12-09 15:58 | 5.4K | |
![[SND]](/icons/sound2.gif) | slodkiego milego zycia.psid | 2018-12-09 15:58 | 5.2K | |
![[SND]](/icons/sound2.gif) | slow motion 2016.psid | 2018-12-09 15:58 | 4.2K | |
![[SND]](/icons/sound2.gif) | smak mamrota.psid | 2018-12-09 15:58 | 4.4K | |
![[SND]](/icons/sound2.gif) | sodom clinic.psid | 2018-12-09 15:58 | 4.4K | |
![[SND]](/icons/sound2.gif) | something just like this.psid | 2018-12-09 15:58 | 4.3K | |
![[SND]](/icons/sound2.gif) | ss (niedokonczony).psid | 2018-12-09 15:58 | 3.9K | |
![[SND]](/icons/sound2.gif) | stupid birds.psid | 2018-12-09 15:58 | 3.4K | |
![[SND]](/icons/sound2.gif) | techno koleda.psid | 2018-12-09 15:58 | 3.7K | |
![[SND]](/icons/sound2.gif) | what is it.psid | 2018-12-09 15:58 | 3.7K | |
![[SND]](/icons/sound2.gif) | xsin-xsan.psid | 2018-12-09 15:58 | 5.5K | |
![[SND]](/icons/sound2.gif) | nice dream.psid | 2018-12-13 10:18 | 13K | |
![[SND]](/icons/sound2.gif) | nice dream v2.psid | 2018-12-16 14:29 | 4.6K | |
![[SND]](/icons/sound2.gif) | marble machine.psid | 2019-08-24 15:51 | 3.8K | |
|