![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | 1-2 mix.psid | 2014-02-13 11:16 | 3.0K | |
![[SND]](/icons/sound2.gif) | 1 min. piano rap.psid | 2007-05-01 02:18 | 3.8K | |
![[SND]](/icons/sound2.gif) | ace of bass-dad.psid | 2014-02-13 11:16 | 3.0K | |
![[SND]](/icons/sound2.gif) | airwolf.psid | 2004-09-13 21:15 | 3.5K | |
![[SND]](/icons/sound2.gif) | axel f.psid | 2014-02-13 11:16 | 2.9K | |
![[SND]](/icons/sound2.gif) | brenda's got a baby mix.psid | 2007-05-01 02:18 | 3.4K | |
![[SND]](/icons/sound2.gif) | can't get enough.psid | 2014-02-13 11:16 | 2.9K | |
![[SND]](/icons/sound2.gif) | das boot (techno version).psid | 2007-05-01 02:18 | 3.5K | |
![[SND]](/icons/sound2.gif) | dick turbin.psid | 2004-09-13 21:15 | 3.7K | |
![[SND]](/icons/sound2.gif) | double shit.psid | 2004-09-13 21:15 | 2.8K | |
![[SND]](/icons/sound2.gif) | dream on girl.psid | 2014-02-13 11:16 | 2.9K | |
![[SND]](/icons/sound2.gif) | dream on girl 2.psid | 2008-04-19 06:17 | 2.9K | |
![[SND]](/icons/sound2.gif) | final lafayette.psid | 2004-09-13 21:15 | 3.6K | |
![[SND]](/icons/sound2.gif) | flying bridge.psid | 2014-02-13 11:16 | 2.9K | |
![[SND]](/icons/sound2.gif) | flying bridge ii.psid | 2004-09-13 21:15 | 3.4K | |
![[SND]](/icons/sound2.gif) | get away (naked eye version).psid | 2007-05-01 02:18 | 3.6K | |
![[SND]](/icons/sound2.gif) | hunter patrol.psid | 2004-09-13 21:15 | 3.6K | |
![[SND]](/icons/sound2.gif) | i'll make u sweat'n'wild.psid | 2007-05-01 02:18 | 3.4K | |
![[SND]](/icons/sound2.gif) | i've scratch'd my mom' !!.psid | 2007-05-01 02:18 | 3.5K | |
![[SND]](/icons/sound2.gif) | i don't like reggae (top-remix).psid | 2007-05-01 02:18 | 3.6K | |
![[SND]](/icons/sound2.gif) | in the army.psid | 2014-02-13 11:16 | 2.8K | |
![[SND]](/icons/sound2.gif) | it had to end.psid | 2014-02-13 11:16 | 3.4K | |
![[SND]](/icons/sound2.gif) | lafayette.psid | 2014-02-13 11:16 | 2.9K | |
![[SND]](/icons/sound2.gif) | lafayette 3.psid | 2004-09-13 21:15 | 2.9K | |
![[SND]](/icons/sound2.gif) | lafayette 4.psid | 2014-02-13 11:16 | 2.9K | |
![[SND]](/icons/sound2.gif) | laila mix.psid | 2004-09-13 21:15 | 3.8K | |
![[SND]](/icons/sound2.gif) | land of confusion.psid | 2004-09-13 21:15 | 3.9K | |
![[SND]](/icons/sound2.gif) | manu.psid | 2004-09-13 21:15 | 3.3K | |
![[SND]](/icons/sound2.gif) | my number one.psid | 2014-02-13 11:16 | 3.9K | |
![[SND]](/icons/sound2.gif) | never gonna lose your love.psid | 2004-09-13 21:15 | 3.5K | |
![[SND]](/icons/sound2.gif) | never gonna lose your love 2.psid | 2007-05-01 02:18 | 3.7K | |
![[SND]](/icons/sound2.gif) | no friends left.psid | 2014-02-13 11:16 | 2.9K | |
![[SND]](/icons/sound2.gif) | no limits.psid | 2004-09-13 21:15 | 3.7K | |
![[SND]](/icons/sound2.gif) | no more fight.psid | 2004-09-13 21:15 | 3.5K | |
![[SND]](/icons/sound2.gif) | outside.psid | 2014-02-13 11:16 | 2.9K | |
![[SND]](/icons/sound2.gif) | outside 2.psid | 2014-02-13 11:16 | 2.8K | |
![[SND]](/icons/sound2.gif) | paradize.psid | 2014-02-13 11:16 | 3.4K | |
![[SND]](/icons/sound2.gif) | paradize 1.psid | 2014-02-13 11:16 | 2.9K | |
![[SND]](/icons/sound2.gif) | paradize 2.psid | 2014-02-13 11:16 | 2.8K | |
![[SND]](/icons/sound2.gif) | piano-rap ii (cut version).psid | 2007-05-01 02:18 | 3.7K | |
![[SND]](/icons/sound2.gif) | place on earth.psid | 2014-02-13 11:16 | 2.9K | |
![[SND]](/icons/sound2.gif) | popcorn.psid | 2007-05-01 02:18 | 3.6K | |
![[SND]](/icons/sound2.gif) | quiet death.psid | 2014-02-13 11:16 | 2.8K | |
![[SND]](/icons/sound2.gif) | radio pack #08 intro.psid | 2007-05-01 02:18 | 630 | |
![[SND]](/icons/sound2.gif) | rainman's power.psid | 2014-02-13 11:16 | 3.6K | |
![[SND]](/icons/sound2.gif) | reaction (tune 1).psid | 2014-02-13 11:16 | 3.0K | |
![[SND]](/icons/sound2.gif) | reaction (tune 2).psid | 2014-02-13 11:16 | 2.9K | |
![[SND]](/icons/sound2.gif) | reactions.psid | 2004-09-13 21:15 | 3.4K | |
![[SND]](/icons/sound2.gif) | run while you can.psid | 2004-09-13 21:15 | 3.6K | |
![[SND]](/icons/sound2.gif) | rythme is a dancer.psid | 2004-09-13 21:15 | 3.0K | |
![[SND]](/icons/sound2.gif) | rythm is a dancer 2.psid | 2014-02-13 11:16 | 2.9K | |
![[SND]](/icons/sound2.gif) | salt-lake-city (tune 1).psid | 2018-12-09 16:37 | 2.6K | |
![[SND]](/icons/sound2.gif) | salt-lake-city (tune 2).psid | 2018-12-09 16:37 | 2.8K | |
![[SND]](/icons/sound2.gif) | salt-lake-city (tune 3).psid | 2018-12-09 16:37 | 2.6K | |
![[SND]](/icons/sound2.gif) | sanxion loader mix.psid | 2004-09-13 21:15 | 3.8K | |
![[SND]](/icons/sound2.gif) | scotinaya.psid | 2004-09-13 21:15 | 2.8K | |
![[SND]](/icons/sound2.gif) | sexchicane.psid | 2004-09-13 21:15 | 3.6K | |
![[SND]](/icons/sound2.gif) | shorty.psid | 2014-02-13 11:16 | 2.7K | |
![[SND]](/icons/sound2.gif) | terminator ii (dance mix).psid | 2007-05-01 02:18 | 3.9K | |
![[SND]](/icons/sound2.gif) | topgun.psid | 2014-02-13 11:16 | 3.4K | |
![[SND]](/icons/sound2.gif) | toronto (part 4).psid | 2008-04-19 06:17 | 2.8K | |
![[SND]](/icons/sound2.gif) | toronto (part 5).psid | 2008-04-19 06:17 | 2.7K | |
![[SND]](/icons/sound2.gif) | toronto (part 7).psid | 2008-04-19 06:17 | 3.0K | |
![[SND]](/icons/sound2.gif) | turn up the zak.psid | 2014-02-13 11:16 | 2.9K | |
![[SND]](/icons/sound2.gif) | what is love.psid | 2008-04-19 06:17 | 3.5K | |
![[SND]](/icons/sound2.gif) | world of commodore.psid | 2004-09-13 21:15 | 3.6K | |
![[SND]](/icons/sound2.gif) | x-2000.psid | 2014-02-13 11:16 | 5.8K | |
![[SND]](/icons/sound2.gif) | yoko 02.psid | 2007-07-30 04:57 | 2.8K | |
|