![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[DIR]](/icons/bomb.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1 On 1 Government/ | 2014-02-26 13:30 | - | |
| 2Xtreme/ | 2014-02-26 13:30 | - | |
| 19ji 03pun - Ueno Ha..> | 2023-05-27 17:17 | - | |
| Action Bass/ | 2023-05-27 17:17 | - | |
| Actua Tennis/ | 2014-02-26 13:30 | - | |
| Ad Lib Ouji - To Fuy..> | 2023-05-27 17:17 | - | |
| Air Combat/ | 2014-02-26 13:30 | - | |
| Alnam No Kiba/ | 2023-05-27 17:17 | - | |
| Angel Blade - Neo To..> | 2017-12-31 01:53 | - | |
| Angelique Special/ | 2017-12-31 01:53 | - | |
| Angelique Special 2/ | 2017-12-31 01:53 | - | |
| Angelique Tenkuu No ..> | 2017-12-31 01:53 | - | |
| Another Memories/ | 2017-12-31 01:53 | - | |
| Aoki Okami To Shirok..> | 2023-05-27 17:17 | - | |
| Apocalypse/ | 2014-02-26 13:32 | - | |
| Aqua Paradise/ | 2023-05-27 17:17 | - | |
| Aquanaut's Holiday/ | 2014-02-26 13:33 | - | |
| Aquanaut No Kyujitsu 2/ | 2023-05-27 17:17 | - | |
| Assault/ | 2023-05-27 17:17 | - | |
| Asuncia/ | 2023-05-27 17:17 | - | |
| Azito/ | 2017-12-31 01:53 | - | |
| Azito 2/ | 2017-12-31 01:53 | - | |
| Azito 3/ | 2023-05-27 17:17 | - | |
| Back Gainer/ | 2023-05-27 17:17 | - | |
| Baroque Syndrome/ | 2009-04-06 19:03 | - | |
| Battle Hunter/ | 2007-03-03 20:48 | - | |
| Black Matrix 00/ | 2007-03-03 20:48 | - | |
| Blue Breaker - Egao ..> | 2017-12-31 01:53 | - | |
| Blue Forest Story - ..> | 2009-04-06 19:04 | - | |
| Bomberman Fantasy Race/ | 2023-05-27 17:17 | - | |
| Bomberman Land/ | 2009-04-06 19:10 | - | |
| Bomberman Wars/ | 2017-12-31 01:53 | - | |
| Brave Saga 2/ | 2009-04-06 19:13 | - | |
| Brigandine - Grand E..> | 2009-04-06 19:13 | - | |
| Burger Burger 2/ | 2009-04-06 19:14 | - | |
| Captain Tsubasa J - ..> | 2007-03-03 20:49 | - | |
| Charamela/ | 2017-12-31 01:53 | - | |
| Chiisa Na Oukoku Elt..> | 2017-12-31 01:53 | - | |
| Circadia (Demo)/ | 2015-06-06 12:36 | - | |
| Circadia/ | 2009-04-06 19:17 | - | |
| Cotton 100%/ | 2009-04-06 19:20 | - | |
| Crash Bash Demo/ | 2009-04-06 19:20 | - | |
| Cross Tantei Monogat..> | 2017-12-31 01:53 | - | |
| Crossroad Crisis/ | 2023-05-27 17:17 | - | |
| Dai Koukai Jidai 4 -..> | 2007-03-03 20:49 | - | |
| Daiobake Yashiki/ | 2009-04-06 19:38 | - | |
| Dekiru! Game Center/ | 2009-04-06 19:39 | - | |
| Dengeki PS Disc 02/ | 2009-04-06 20:21 | - | |
| Dengeki PS Disc 04/ | 2009-04-06 20:23 | - | |
| Dengeki PS Disc 05/ | 2009-04-06 20:29 | - | |
| Dengeki PS Disc 06/ | 2009-04-06 20:46 | - | |
| Dengeki PS Disc 07/ | 2009-04-06 20:51 | - | |
| Dengeki PS Disc 08/ | 2009-04-06 20:52 | - | |
| Dengeki PS Disc 10/ | 2009-04-06 20:52 | - | |
| Dengeki PS Disc 19/ | 2009-04-06 20:57 | - | |
| Dengeki PS Disc 20/ | 2009-04-06 20:58 | - | |
| Dengeki PS Disc 25/ | 2009-04-06 20:59 | - | |
| Dengeki PS Disc 26/ | 2009-04-06 21:00 | - | |
| Devil Summoner - Sou..> | 2007-03-03 20:49 | - | |
| Digimon Rumble Arena/ | 2017-12-31 01:53 | - | |
| Digimon World/ | 2015-06-06 12:36 | - | |
| Diver's Dream/ | 2009-04-06 21:04 | - | |
| Doki Doki Poyatchio!!/ | 2007-09-26 04:02 | - | |
| Dragon Knight IV/ | 2009-11-09 23:38 | - | |
| Dungeon Shoutenkai -..> | 2007-03-03 20:49 | - | |
| Echo Night/ | 2009-04-06 21:04 | - | |
| Echo Night 2/ | 2009-04-06 21:05 | - | |
| Ecsaform/ | 2017-12-31 01:53 | - | |
| Egg/ | 2017-12-31 01:53 | - | |
| Eithea/ | 2017-12-31 01:54 | - | |
| Emmyrea/ | 2023-05-27 17:17 | - | |
| Eternal Melody/ | 2007-03-03 20:49 | - | |
| FEDA 2 - White Surge..> | 2009-04-06 21:21 | - | |
| First Queen 4/ | 2023-05-27 17:17 | - | |
| Front Mission Altern..> | 2007-03-25 16:47 | - | |
| Gakkou Wo Tsukurou!! 2/ | 2015-06-06 12:36 | - | |
| Galerians/ | 2009-11-09 18:56 | - | |
| Ganbare Morikawa-kun..> | 2009-11-09 18:58 | - | |
| GateKeepers/ | 2007-03-03 20:49 | - | |
| Genghis Khan II - Cl..> | 2023-05-27 17:17 | - | |
| Gensou Maden Saiyuuk..> | 2017-12-31 01:54 | - | |
| Gundam Battle Assault/ | 2009-11-09 19:02 | - | |
| Gung Ho Brigade/ | 2009-11-09 19:04 | - | |
| Gunnm - Kasei No Kioku/ | 2007-11-12 00:35 | - | |
| Haou No Tariku -NA-1..> | 2007-11-12 00:36 | - | |
| Harukaze Sentai V Fo..> | 2007-03-03 20:49 | - | |
| Harvest Moon/ | 2007-03-03 20:49 | - | |
| Hercules Action Game/ | 2017-12-31 01:54 | - | |
| Hihou Ou/ | 2009-11-09 19:11 | - | |
| Himitsu Kessha Q/ | 2007-03-03 20:49 | - | |
| Hoshigami - Ruining ..> | 2009-11-09 19:12 | - | |
| Hot Shots Golf 2/ | 2007-03-03 20:49 | - | |
| Hyouryuu Ki - The Re..> | 2009-11-09 19:13 | - | |
| Hyper Olympic in Atl..> | 2007-03-03 20:49 | - | |
| Inagawa Atsuji - May..> | 2009-11-09 19:16 | - | |
| Initial D/ | 2007-03-03 20:49 | - | |
| Ishin No Arashi - Ba..> | 2007-03-03 20:49 | - | |
| Itsuka, Kasanariau A..> | 2015-06-06 12:36 | - | |
| Jade Cocoon - Story ..> | 2023-05-05 19:09 | - | |
| Kaettekita Cyborg Ku..> | 2007-03-03 20:49 | - | |
| Khamrai/ | 2023-05-27 17:17 | - | |
| King's Field/ | 2007-03-03 20:49 | - | |
| King's Field 2/ | 2017-12-31 01:54 | - | |
| King's Field 3/ | 2007-03-03 20:49 | - | |
| King of Fighters Kyo/ | 2007-03-03 20:49 | - | |
| Konohana - True Report/ | 2017-12-31 01:54 | - | |
| Kosodate Quiz Motto ..> | 2009-03-07 21:16 | - | |
| Kosodate Quiz My Angel/ | 2009-03-07 21:17 | - | |
| Kuro No Juusan/ | 2015-06-06 12:36 | - | |
| London Seirei Tantei..> | 2009-11-09 22:02 | - | |
| Lord Monarch - Shin ..> | 2008-10-12 20:11 | - | |
| Lord Of Monsters/ | 2017-12-31 01:54 | - | |
| Lunatic Dawn 3/ | 2017-12-31 01:54 | - | |
| Machi - Unmei no Kou..> | 2007-03-03 20:50 | - | |
| Makikoh - Mystery Ad..> | 2017-12-31 01:54 | - | |
| Masumon Kids - The A..> | 2017-12-31 01:54 | - | |
| MegaMan Battle & Chase/ | 2017-12-31 01:54 | - | |
| Megaman Legends/ | 2015-06-06 12:36 | - | |
| Micro Machines/ | 2007-03-03 20:50 | - | |
| Mirano No Arbeit Col..> | 2009-11-09 22:20 | - | |
| Misadventures Of Tro..> | 2007-03-25 20:31 | - | |
| Mitsumete Knight/ | 2023-06-06 20:23 | - | |
| Monster Farm Battle ..> | 2009-11-09 22:22 | - | |
| Monster Punish/ | 2009-11-09 22:24 | - | |
| Monster Race/ | 2009-11-09 22:25 | - | |
| Mouri Motonari - Chi..> | 2007-03-03 20:50 | - | |
| Namco Classics Arran..> | 2007-03-03 20:50 | - | |
| Namco Classics Arran..> | 2007-03-03 20:50 | - | |
| Namco Classics II Ar..> | 2007-11-12 00:34 | - | |
| Namco Museum 2/ | 2007-05-08 23:11 | - | |
| Namco Museum 3/ | 2007-05-08 23:12 | - | |
| Namco Museum 4/ | 2007-05-08 23:12 | - | |
| Namco Museum 5/ | 2007-05-08 23:12 | - | |
| Namco Museum Encore/ | 2007-05-08 23:12 | - | |
| Neues/ | 2009-11-09 22:26 | - | |
| Ningyo No Rakuin/ | 2007-03-03 20:50 | - | |
| Nobunaga No Yabou - ..> | 2007-03-03 20:50 | - | |
| Not Treasure Hunter/ | 2009-11-09 22:26 | - | |
| Oddworld - Abe's Odd..> | 2023-06-06 20:23 | - | |
| Otogirisou Soseihen/ | 2008-08-16 14:10 | - | |
| Overblood 2/ | 2015-06-06 12:36 | - | |
| PAL - Shinken Densetsu/ | 2009-11-09 22:40 | - | |
| Pandora Max Series V..> | 2009-11-09 22:38 | - | |
| Panzer Bandit/ | 2017-12-31 01:54 | - | |
| Paro Wars/ | 2009-11-09 22:41 | - | |
| PoPoRoGue/ | 2009-11-09 22:43 | - | |
| Pokeler/ | 2009-11-09 22:42 | - | |
| Power Dolls 2/ | 2009-11-09 22:45 | - | |
| Prisoner/ | 2007-03-03 20:50 | - | |
| Project Horned Owl/ | 2015-06-06 12:36 | - | |
| Proof Club/ | 2009-11-09 22:46 | - | |
| Puyo Puyo Box/ | 2007-03-03 20:50 | - | |
| Puyo Puyo Tsuu Kette..> | 2009-11-09 22:46 | - | |
| RPG Maker 4/ | 2007-03-08 21:17 | - | |
| Rage Racer/ | 2007-11-12 00:34 | - | |
| Real Robot - Battle ..> | 2023-05-27 17:17 | - | |
| Renai Kouhosei/ | 2007-03-03 20:50 | - | |
| Resident Evil (direc..> | 2007-03-03 20:50 | - | |
| Resident Evil 2 - Tr..> | 2008-07-23 18:42 | - | |
| Restaurant Dream/ | 2009-11-09 22:47 | - | |
| Rikujo Boueitai Mao-..> | 2007-03-03 20:51 | - | |
| Riot Stars/ | 2009-11-09 22:52 | - | |
| Road Rash/ | 2009-11-09 22:52 | - | |
| RockMan NEO Trial Ed..> | 2009-11-09 22:52 | - | |
| Rugrats - Search For..> | 2009-11-09 22:59 | - | |
| SD Gundam G Generati..> | 2009-03-07 21:07 | - | |
| Saishu Densha/ | 2007-03-03 20:51 | - | |
| Sangokushi 4/ | 2023-05-27 17:17 | - | |
| Sangokushi 6/ | 2007-03-03 20:51 | - | |
| Sangokushi 7/ | 2007-03-03 20:51 | - | |
| Sanvein/ | 2008-08-16 14:10 | - | |
| Seireiki Rayblade/ | 2007-03-03 20:51 | - | |
| Seirishoukan - Princ..> | 2009-11-09 23:01 | - | |
| Sengoku Mugen/ | 2009-11-09 23:01 | - | |
| Senryaku Shidan - To..> | 2009-11-09 23:02 | - | |
| Shadow Madness/ | 2010-02-19 20:31 | - | |
| Shin Masoukishin - P..> | 2009-11-09 23:12 | - | |
| Shin Sedai Robot Sen..> | 2009-11-09 23:14 | - | |
| Shin Super Robot Wars/ | 2009-11-09 23:14 | - | |
| Shinobi No Roku/ | 2007-03-25 20:57 | - | |
| Silent Bomber/ | 2008-03-11 10:59 | - | |
| Sim City 2000/ | 2007-11-12 00:35 | - | |
| Simple 1500 Series V..> | 2009-11-09 23:15 | - | |
| Simple 1500 Series V..> | 2009-11-09 23:15 | - | |
| Simple 1500 Series V..> | 2007-11-12 00:34 | - | |
| Simple 1500 Series V..> | 2009-11-09 23:15 | - | |
| Sister Princess/ | 2007-03-03 20:51 | - | |
| Sister Princess 2/ | 2007-03-08 21:18 | - | |
| Smash Court/ | 2007-03-03 20:51 | - | |
| Snatcher/ | 2017-12-31 01:54 | - | |
| Solid Link - Dungeon..> | 2009-11-09 23:18 | - | |
| Solid Link - Tower S..> | 2009-11-09 23:18 | - | |
| South Park/ | 2009-11-09 23:19 | - | |
| Spec Ops - Stealth P..> | 2009-11-09 23:20 | - | |
| Strikers 1945/ | 2023-05-27 17:17 | - | |
| Suikoden - Tenmei No..> | 2014-02-27 20:40 | - | |
| Summon Night/ | 2015-06-06 12:36 | - | |
| Summon Night 2/ | 2007-03-03 20:51 | - | |
| SuperLite 1500 Serie..> | 2007-03-03 20:52 | - | |
| Super Robot Wars Alpha/ | 2007-03-03 20:51 | - | |
| Super Robot Wars Alp..> | 2007-03-03 20:52 | - | |
| Super Robot Wars Com..> | 2007-03-03 20:52 | - | |
| Super Robot Wars Ele..> | 2007-03-03 20:52 | - | |
| Super Robot Wars F F..> | 2007-03-03 20:52 | - | |
| Super Tokusatsu Tais..> | 2015-06-06 12:36 | - | |
| T.R.A.G. - Tactical ..> | 2009-11-09 22:36 | - | |
| Take The A-Train - A..> | 2009-04-06 18:58 | - | |
| Take The A-Train - A..> | 2009-04-06 18:58 | - | |
| TechPS-9706/ | 2007-09-05 01:33 | - | |
| Tenshi Dohmei/ | 2009-11-09 23:23 | - | |
| Tenshi No Konamaiki/ | 2007-03-03 20:52 | - | |
| Tetris X/ | 2017-12-31 01:54 | - | |
| The Combini 2/ | 2007-03-03 20:52 | - | |
| Thoroughbred Breeder/ | 2007-03-03 20:52 | - | |
| Thousand Arms/ | 2009-11-09 23:24 | - | |
| Total NBA 98/ | 2009-11-09 23:26 | - | |
| Toys Dream/ | 2009-11-09 23:27 | - | |
| True Love Story/ | 2007-03-03 20:53 | - | |
| Urawaza Mahjong - Ko..> | 2015-06-06 12:36 | - | |
| Vampeel/ | 2009-11-09 23:32 | - | |
| Vampire Hunter D/ | 2009-11-09 23:33 | - | |
| Vanguard Bandits/ | 2007-03-03 20:53 | - | |
| Waku Puyo Dungeon Ke..> | 2007-03-03 20:53 | - | |
| Warera Mitsubayashi ..> | 2009-11-09 23:33 | - | |
| Wizardry Empire - Ik..> | 2023-05-27 17:17 | - | |
| Wonder Tracker/ | 2009-11-09 23:34 | - | |
| World Stadium EX/ | 2008-08-16 14:14 | - | |
| Wrestle Ball/ | 2007-05-08 23:16 | - | |
| Yasoukyoku/ | 2015-06-06 12:36 | - | |
| Yu-Gi-Oh - Forbidden..> | 2009-11-09 22:35 | - | |
| Yukyu Gensokyoku/ | 2007-03-03 20:53 | - | |
| Yukyu Gensokyoku 2nd..> | 2007-03-03 20:53 | - | |
| Yukyu Gensokyoku 3 -..> | 2007-03-03 20:53 | - | |
| Yuuyami Doori Tanken..> | 2007-09-03 01:59 | - | |
| Zeus - Carnage Heart..> | 2009-11-09 23:35 | - | |
| Zeus 2 - Carnage Heart/ | 2015-06-06 12:36 | - | |