![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| a.n.a.l.mod | 2004-09-13 21:20 | 155K | |
| amusique de sevilla.mod | 2004-09-13 21:20 | 11K | |
| a taste of chip.mod | 2004-09-13 21:20 | 8.6K | |
| castrated blogies.mod | 2004-09-13 21:20 | 165K | |
| chilly.mod | 2004-09-13 21:20 | 215K | |
| chip-monk.mod | 2004-09-13 21:20 | 12K | |
| cotton rectum bill.mod | 2004-09-13 21:20 | 3.1K | |
| craving for madness.mod | 2004-09-13 21:20 | 154K | |
| eat this!.mod | 2004-09-13 21:20 | 627K | |
| emotional outbreaks.mod | 2004-09-13 21:20 | 298K | |
| endjingle warner.mod | 2004-09-13 21:20 | 64K | |
| feta cheese.mod | 2004-09-13 21:20 | 28K | |
| fuck off.mod | 2004-09-13 21:20 | 367K | |
| funk of sorrow.mod | 2004-09-13 21:20 | 23K | |
| gabburger.mod | 2004-09-13 21:20 | 200K | |
| happy birthday 2 me.mod | 2004-09-13 21:20 | 5.1K | |
| lucid breeds.mod | 2004-09-13 21:20 | 196K | |
| maturalise.mod | 2004-09-13 21:20 | 111K | |
| mousmoulo.mod | 2004-09-13 21:20 | 19K | |
| mushed potatoes.mod | 2004-09-13 21:20 | 90K | |
| ode to vanessa.mod | 2004-09-13 21:20 | 259K | |
| round the mikly way.mod | 2004-09-13 21:20 | 21K | |
| russian drug.mod | 2004-09-13 21:20 | 87K | |
| sour taste.mod | 2004-09-13 21:20 | 217K | |
| spooky.mod | 2004-09-13 21:20 | 100K | |
| stuck in athens.mod | 2004-09-13 21:20 | 80K | |
| tears in the mud.mod | 2004-09-13 21:20 | 208K | |
| tirquise panther.mod | 2004-09-13 21:20 | 123K | |
| trancedental rmx.mod | 2004-09-13 21:20 | 274K | |
| triumph of love.mod | 2004-09-13 21:20 | 621K | |
| war of the lizardz.mod | 2004-09-13 21:20 | 91K | |
| x marks the spot.mod | 2004-09-13 21:20 | 190K | |
| loving the rainbow.mod | 2005-04-02 22:35 | 225K | |
| burning twilight.mod | 2005-05-30 11:20 | 134K | |
| crux.mod | 2005-05-30 11:20 | 400K | |
| solitude.mod | 2005-05-30 11:20 | 560K | |