![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1.mod | 2004-09-13 22:01 | 180K | |
| atmosphere.mod | 2004-09-13 22:01 | 258K | |
| atmosphere2.mod | 2005-04-09 00:10 | 220K | |
| beat it.mod | 2005-04-09 00:10 | 141K | |
| bonusround.mod | 2005-04-09 00:10 | 23K | |
| chemical light-htx.mod | 2005-04-09 00:10 | 182K | |
| conquer the sky.mod | 2005-04-09 00:10 | 126K | |
| cosmic duel.mod | 2004-09-13 22:01 | 17K | |
| crusade-remix.mod | 2004-09-13 22:01 | 206K | |
| crusade.alt.mod | 2021-12-10 07:17 | 205K | |
| crusade.mod | 2006-12-16 21:54 | 210K | |
| crusade short.mod | 2004-09-13 22:01 | 159K | |
| datatitle.mod | 2006-12-16 21:54 | 171K | |
| discomix.mod | 2004-09-13 22:01 | 161K | |
| discoommiiiix.mod | 2005-04-09 00:10 | 227K | |
| double dragon ii.mod | 2004-12-30 22:21 | 250K | |
| dragonhunt maxi.mod | 2005-04-09 00:10 | 150K | |
| furballs.mod | 2005-04-09 00:10 | 74K | |
| galerie.mod | 2005-04-09 00:10 | 87K | |
| game music 1.mod | 2004-09-13 22:01 | 9.6K | |
| game music 2.mod | 2004-09-13 22:01 | 8.6K | |
| hiscorejingle.mod | 2005-04-09 00:10 | 62K | |
| hot.mod | 2006-12-16 21:54 | 78K | |
| intro pic tune.mod | 2004-09-13 22:01 | 85K | |
| jazze north star.mod | 2004-09-13 22:01 | 62K | |
| labyrinth.mod | 2004-09-13 22:01 | 125K | |
| labyrinth.sfx.2.mod | 2007-11-12 18:05 | 173K | |
| leander1.1.mod | 2004-09-13 21:17 | 54K | |
| madness took me.mod | 2004-09-13 22:01 | 140K | |
| magic tubes.mod | 2005-10-28 18:12 | 114K | |
| mix1.mod | 2004-09-13 22:01 | 123K | |
| must be disco.mod | 2006-12-16 21:54 | 83K | |
| occ-san-geen+.mod | 2004-09-13 22:01 | 263K | |
| occ-san-geen-.mod | 2004-09-13 22:01 | 216K | |
| occ-san-geen.mod | 2004-09-13 22:01 | 227K | |
| open door.mod | 2005-04-09 00:10 | 8.4K | |
| orbit.mod | 2005-04-09 00:10 | 60K | |
| orchestra.mod | 2004-09-13 22:01 | 86K | |
| planetfallboom.long.mod | 2005-04-09 00:10 | 216K | |
| planet fall boom.mod | 2004-09-13 22:01 | 214K | |
| poseidon.mod | 2004-09-13 22:01 | 137K | |
| poseidon 2.mod | 2008-08-09 20:46 | 357K | |
| pyramidclimber.mod | 2005-04-09 00:10 | 22K | |
| rsm remix.mod | 2006-12-16 21:54 | 261K | |
| runaway-r.s.mod | 2005-04-09 00:10 | 114K | |
| run the gauntlet.mod | 2004-09-13 22:01 | 114K | |
| savannah.mod | 2005-02-05 06:16 | 67K | |
| scoopex-slideshow.mod | 2004-09-13 22:01 | 87K | |
| scoopex1.mod | 2004-09-13 22:01 | 177K | |
| spell-amelioration.long.mod | 2005-04-09 00:10 | 188K | |
| spell-amelioration.mod | 2004-09-13 22:01 | 170K | |
| spell.mod | 2004-09-13 22:01 | 172K | |
| spell v3.0 unf.mod | 2005-04-09 00:10 | 152K | |
| sq-go for it.mod | 2005-04-09 00:10 | 30K | |
| sq-harpwarp.mod | 2005-04-09 00:10 | 13K | |
| stereobeat.mod | 2004-09-13 22:01 | 83K | |
| stunnflight.mod | 2005-04-09 00:10 | 184K | |
| tag.mod | 2005-04-09 00:10 | 121K | |
| tethrahedrons.mod | 2004-09-13 22:01 | 175K | |
| tethrahedrons.sht2.mod | 2005-04-09 00:10 | 169K | |
| tetrahedrons.2.mod | 2005-04-09 00:10 | 120K | |
| tetrahedrons.3.mod | 2005-04-09 00:10 | 128K | |
| tetrahedrons.short.mod | 2005-04-09 00:10 | 172K | |
| the zyriax.mod | 2005-04-09 00:10 | 150K | |
| toi-tei.mod | 2004-09-13 22:01 | 151K | |
| tubular.long.mod | 2005-04-09 00:10 | 151K | |
| tubular.mod | 2004-09-13 22:01 | 150K | |
| tun2.mod | 2004-09-13 22:01 | 70K | |
| vector.mod | 2005-04-09 00:10 | 51K | |
| walkaround1.mod | 2005-04-09 00:10 | 36K | |
| wings.mod | 2004-09-13 22:01 | 189K | |
| xeqtion-scoopex swe.mod | 2005-04-09 00:10 | 93K | |
| xeqtion.mod | 2004-09-13 22:01 | 89K | |
| yes.mod | 2005-04-09 00:10 | 130K | |
| zyriax+.mod | 2005-04-09 00:10 | 97K | |