![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 8bit tales.sunvox | 2009-05-31 00:59 | 57K | |
| 4004.sunvox | 2015-01-06 22:11 | 54K | |
| afternoon.sunvox | 2012-02-07 11:22 | 8.7K | |
| alchemy masters.alt.sunvox | 2014-07-30 05:31 | 178K | |
| alchemy masters.sunvox | 2009-05-31 00:59 | 183K | |
| april song.sunvox | 2013-05-14 08:01 | 122K | |
| autumn-3.sunvox | 2011-09-18 13:39 | 383K | |
| autumn.sunvox | 2012-05-25 13:49 | 482K | |
| awakening city.sunvox | 2015-05-16 00:02 | 1.2M | |
| battle.sunvox | 2011-09-18 14:12 | 2.4M | |
| chain reaction.sunvox | 2011-07-25 18:40 | 93K | |
| circles.sunvox | 2009-05-31 00:59 | 2.8M | |
| city dreams.sunvox | 2009-07-24 21:39 | 98K | |
| color dreams.sunvox | 2012-05-25 08:57 | 1.7M | |
| ekaterinburg after the rain.sunvox | 2012-04-19 10:16 | 2.0M | |
| elochka.sunvox | 2009-07-24 21:39 | 301K | |
| endless fantasy.sunvox | 2012-05-25 09:11 | 1.2M | |
| follow the sun.sunvox | 2014-07-24 09:51 | 69K | |
| full moon night.sunvox | 2012-05-25 13:52 | 47K | |
| lullaby.sunvox | 2012-04-19 09:57 | 15M | |
| mechanical heart.sunvox | 2011-05-11 21:03 | 130K | |
| moon secrets.sunvox | 2013-06-29 02:55 | 77K | |
| music in our souls.sunvox | 2015-06-05 19:19 | 92K | |
| music of the rain.sunvox | 2012-05-25 13:35 | 2.8M | |
| northern forests.sunvox | 2009-07-24 21:39 | 102K | |
| palmsounds10.sunvox | 2016-10-01 20:55 | 79K | |
| pixel cave.sunvox | 2009-07-24 21:39 | 32K | |
| pixel disco.sunvox | 2009-05-31 00:59 | 668K | |
| pong.sunvox | 2009-05-31 01:00 | 76K | |
| quantum countdown.sunvox | 2016-05-27 11:29 | 209K | |
| sea breeze.sunvox | 2012-05-25 09:19 | 755K | |
| siberian beauty.sunvox | 2012-05-25 09:37 | 24K | |
| silence artifacts.sunvox | 2014-01-20 02:16 | 49K | |
| six steps.sunvox | 2012-05-25 13:51 | 1.8M | |
| snowfall.sunvox | 2015-11-06 20:15 | 115K | |
| solim.sunvox | 2009-07-24 21:39 | 77K | |
| space seq.sunvox | 2009-05-31 00:59 | 524K | |
| space trip.sunvox | 2009-05-31 01:00 | 120K | |
| sunvox soundcheck.sunvox | 2008-11-09 16:40 | 488K | |
| tales.sunvox | 2012-05-23 20:57 | 1.3M | |
| the window.sunvox | 2008-11-09 16:40 | 375K | |
| time flow.sunvox | 2012-05-23 21:03 | 1.4M | |
| timeless.sunvox | 2009-07-24 21:39 | 75K | |
| tiny tune.sunvox | 2008-11-09 16:40 | 4.2K | |
| unspoken words.sunvox | 2014-06-02 01:07 | 749K | |
| voices of spring.sunvox | 2012-05-25 09:06 | 1.2M | |
| waterfalls.sunvox | 2009-05-31 00:59 | 286K | |
| where.sunvox | 2009-05-31 00:59 | 292K | |
| window.sunvox | 2009-05-31 00:59 | 375K | |