![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| A Ressha De Ikou/ | 2007-11-12 01:06 | - | |
| Action 52/ | 2007-11-12 01:06 | - | |
| Aero The Acro-Bat/ | 2007-11-12 01:06 | - | |
| Aero The Acro-Bat 2/ | 2007-11-12 01:06 | - | |
| Air Management - Ooz..> | 2007-11-12 01:06 | - | |
| Alex Kidd In The Enc..> | 2007-11-12 01:06 | - | |
| Alien Storm/ | 2007-11-12 01:06 | - | |
| Altered Beast/ | 2007-11-12 01:06 | - | |
| American Gladiators/ | 2007-11-12 01:05 | - | |
| Atomic Robo-Kid/ | 2007-11-12 01:06 | - | |
| Ayrton Senna's Super..> | 2007-11-12 01:06 | - | |
| Bahamut Senki/ | 2007-11-12 01:06 | - | |
| Ballz/ | 2007-11-12 01:06 | - | |
| Battle Golfer Yui/ | 2007-11-12 01:06 | - | |
| Battle Mania/ | 2007-11-12 01:06 | - | |
| Battlemaster/ | 2007-11-12 01:05 | - | |
| Blockout/ | 2007-11-12 01:06 | - | |
| Boxing Legends Of Th..> | 2007-11-12 01:06 | - | |
| Cadash/ | 2007-11-12 01:06 | - | |
| California Games/ | 2007-11-12 01:06 | - | |
| Chase HQ 2/ | 2007-11-12 01:06 | - | |
| Chester Cheetah - To..> | 2007-11-12 01:06 | - | |
| Chester Cheetah - Wi..> | 2007-11-12 01:06 | - | |
| Chibi Maruko-chan - ..> | 2007-11-12 01:06 | - | |
| Conquering The World 3/ | 2007-11-12 01:06 | - | |
| Crack Down/ | 2007-11-12 01:06 | - | |
| CrossFire/ | 2007-11-12 01:06 | - | |
| Cyberball/ | 2007-11-12 01:06 | - | |
| Dahna Megami Tanjou/ | 2007-11-12 01:06 | - | |
| Dark Castle/ | 2008-02-02 16:24 | - | |
| Divine Sealing/ | 2007-11-12 01:06 | - | |
| Domino/ | 2007-11-12 01:06 | - | |
| Double Dragon 5 - Th..> | 2007-11-12 01:06 | - | |
| Dragon's Eye Plus - ..> | 2007-11-12 01:06 | - | |
| Dragon Slayer - The ..> | 2007-11-12 01:06 | - | |
| Dragon Slayer - The ..> | 2007-11-12 01:06 | - | |
| F1 Circus/ | 2007-11-12 01:06 | - | |
| F1 Super License/ | 2007-11-12 01:06 | - | |
| Fastest 1/ | 2007-11-12 01:06 | - | |
| Ferrari Grand Prix C..> | 2007-11-12 01:05 | - | |
| Fighting Masters/ | 2007-11-12 01:06 | - | |
| Flicky/ | 2007-11-12 01:05 | - | |
| Fushigi No Umi No Na..> | 2007-11-12 01:06 | - | |
| Game No Kandzume Oto..> | 2007-11-12 01:05 | - | |
| Ghostbusters/ | 2007-11-12 01:06 | - | |
| Gods/ | 2007-11-12 01:06 | - | |
| Gouketsuji Ichizoku/ | 2007-11-12 01:06 | - | |
| Hit The Ice/ | 2007-11-12 01:06 | - | |
| Honoo No Toukyuuji -..> | 2007-11-12 01:06 | - | |
| Insector X/ | 2007-11-12 01:06 | - | |
| J-League Pro Striker/ | 2007-11-12 01:06 | - | |
| J-League Pro Striker 2/ | 2007-11-12 01:06 | - | |
| James Buster Douglas..> | 2007-11-12 01:05 | - | |
| James Pond - Underwa..> | 2007-11-12 01:06 | - | |
| Janou Touryuumon/ | 2007-11-12 01:06 | - | |
| Junction/ | 2007-11-12 01:06 | - | |
| Ka-Ge-Ki/ | 2007-11-12 01:06 | - | |
| Kidou Keisatsu Patla..> | 2007-11-12 01:06 | - | |
| Kyuukai Douchuuki/ | 2007-11-12 01:06 | - | |
| Last Battle/ | 2007-11-12 01:06 | - | |
| Lemmings 2/ | 2007-11-12 01:06 | - | |
| Liberty Or Death/ | 2007-11-12 01:06 | - | |
| Lotus 2 RECS/ | 2007-11-12 01:05 | - | |
| Magic Girl/ | 2007-11-12 01:06 | - | |
| Mahjong Cop Ryuu - H..> | 2007-11-12 01:06 | - | |
| Marvel Land/ | 2007-11-12 01:06 | - | |
| Mega Anser/ | 2007-11-12 01:06 | - | |
| Mega Bomberman Demo/ | 2007-11-12 01:05 | - | |
| Mega Man - The Wily ..> | 2007-11-12 01:06 | - | |
| Megapanel/ | 2007-11-12 01:06 | - | |
| NBA Jam Tournament E..> | 2007-11-12 01:06 | - | |
| Nakajima Satoru Kans..> | 2007-11-12 01:06 | - | |
| Ninja Gaiden/ | 2007-11-12 01:06 | - | |
| Onslaught/ | 2007-11-12 01:05 | - | |
| Osomatsu-kun Hachame..> | 2007-11-12 01:06 | - | |
| Pac-Attack/ | 2007-11-12 01:06 | - | |
| Paperboy 2/ | 2007-11-12 01:05 | - | |
| Pocket Monster 2/ | 2007-11-12 01:06 | - | |
| Pro Striker Final St..> | 2007-11-12 01:06 | - | |
| Puzzle & Action - Ic..> | 2007-11-12 01:06 | - | |
| Puzzle & Action - Ta..> | 2007-11-12 01:06 | - | |
| Quack Shot/ | 2007-11-12 01:06 | - | |
| Quad Challenge/ | 2007-11-12 01:06 | - | |
| Race Drivin'/ | 2007-11-12 01:06 | - | |
| Radical Rex/ | 2007-11-12 01:05 | - | |
| Rambo III/ | 2007-11-12 01:06 | - | |
| Rampart/ | 2007-11-12 01:06 | - | |
| Rockman X3/ | 2007-11-12 01:06 | - | |
| Rolling Thunder 3/ | 2008-07-23 20:10 | - | |
| Romance Of The Three..> | 2007-11-12 01:06 | - | |
| SD Valis/ | 2007-11-12 01:06 | - | |
| Saint Sword/ | 2007-11-12 01:06 | - | |
| Sangokushi Retsuden ..> | 2007-11-12 01:06 | - | |
| Shi-Kin-Jou/ | 2007-11-12 01:06 | - | |
| Shougi No Hoshi/ | 2007-11-12 01:06 | - | |
| Shove It! - The Ware..> | 2007-11-12 01:05 | - | |
| Slam Dunk - Kyougou ..> | 2007-11-12 01:06 | - | |
| Splatterhouse 2/ | 2007-11-12 01:06 | - | |
| Splatterhouse 3/ | 2007-11-12 01:06 | - | |
| Squirrel King (Super..> | 2007-11-12 01:06 | - | |
| Star Trek DS9 - Cros..> | 2007-11-12 01:06 | - | |
| Strider Returns - Jo..> | 2007-11-12 01:06 | - | |
| Super Bubble Bobble/ | 2007-11-12 01:06 | - | |
| Super High Impact/ | 2007-11-12 01:06 | - | |
| Super Mario 2 1998/ | 2007-05-15 05:20 | - | |
| Super Mario World/ | 2008-07-18 00:20 | - | |
| Super Volleyball/ | 2007-11-12 01:06 | - | |
| Sylvester & Tweety I..> | 2007-11-12 01:06 | - | |
| Taiheiki/ | 2007-11-12 01:06 | - | |
| Tel Tel Mahjong/ | 2007-11-12 01:06 | - | |
| Tetris/ | 2007-11-12 01:05 | - | |
| The Flintstones/ | 2007-11-12 01:06 | - | |
| The Lion King 2/ | 2007-03-03 23:00 | - | |
| The Pirates of Dark ..> | 2007-11-12 01:06 | - | |
| The Punisher/ | 2007-11-12 01:06 | - | |
| The Simpsons - Bart'..> | 2007-11-12 01:05 | - | |
| The Simpsons - Virtu..> | 2007-11-12 01:06 | - | |
| Thunder Fox/ | 2007-11-12 01:06 | - | |
| Tom And Jerry - Fran..> | 2007-11-12 01:06 | - | |
| Trampoline Terror!/ | 2007-11-12 01:06 | - | |
| Turbo Outrun/ | 2007-11-12 01:06 | - | |
| Twinkle Tale/ | 2007-11-12 01:06 | - | |
| Uzu Keobukseon/ | 2007-11-12 01:06 | - | |
| Vixen 357/ | 2007-11-12 01:06 | - | |
| Wani Wani World/ | 2007-11-12 01:06 | - | |
| Warrior Of Rome/ | 2007-11-12 01:06 | - | |
| Warrior Of Rome 2/ | 2007-11-12 01:06 | - | |
| World Championship S..> | 2007-11-12 01:06 | - | |
| World Cup USA 94/ | 2007-11-12 01:05 | - | |
| World Of Illusion/ | 2007-11-12 01:06 | - | |
| Ys 3 - Wanderers Fro..> | 2007-11-12 01:06 | - | |
| Yuu Yuu Hakusho Gaiden/ | 2007-11-12 01:06 | - | |
| Zero the Kamikaze Sq..> | 2007-11-12 01:06 | - | |
| Zoom!/ | 2007-11-12 01:06 | - | |
| Zoop/ | 2007-11-12 01:05 | - | |